mirror of
https://github.com/boostorg/thread.git
synced 2026-02-18 02:22:10 +00:00
Compare commits
739 Commits
svn-branch
...
svn-branch
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
ffc1bbcbb2 | ||
|
|
398b6a83a7 | ||
|
|
c0bea158d4 | ||
|
|
70686b4913 | ||
|
|
14502dd715 | ||
|
|
8ee986536b | ||
|
|
8ed82798d2 | ||
|
|
ebfe10b7df | ||
|
|
4aa26180ca | ||
|
|
89496448d9 | ||
|
|
dfa0a3979a | ||
|
|
396cd7db4f | ||
|
|
0351d59060 | ||
|
|
6f0b0e976d | ||
|
|
dd5d687014 | ||
|
|
5d8b0891bd | ||
|
|
7dc95f63d3 | ||
|
|
a7adc5865b | ||
|
|
cdbe5766fa | ||
|
|
b1cac0731c | ||
|
|
fc8de511c6 | ||
|
|
defdb8ff1c | ||
|
|
b576a57581 | ||
|
|
9a08a8478f | ||
|
|
a6f7a0180b | ||
|
|
5a59df4476 | ||
|
|
1df9d7c575 | ||
|
|
65008b11f7 | ||
|
|
b18314878a | ||
|
|
11a951c679 | ||
|
|
c67e3ff7b9 | ||
|
|
e5a633cc41 | ||
|
|
3724d847cf | ||
|
|
b6063b5c60 | ||
|
|
0d08362291 | ||
|
|
9f120a80a7 | ||
|
|
2eb6fd754e | ||
|
|
9f4a8973d0 | ||
|
|
a4d9355060 | ||
|
|
5a7545afbd | ||
|
|
4d25ea1760 | ||
|
|
6ec8e2ccec | ||
|
|
97d0ae6527 | ||
|
|
50a74d0eda | ||
|
|
5ad66c7e35 | ||
|
|
f9e03b5eaa | ||
|
|
ad571bd898 | ||
|
|
de8ef9aee4 | ||
|
|
21f75da2f6 | ||
|
|
233dbf8075 | ||
|
|
d8f1ba9b3d | ||
|
|
1241f18215 | ||
|
|
b6604882eb | ||
|
|
a9c9d5c499 | ||
|
|
9a827d937e | ||
|
|
38594f889a | ||
|
|
04c17e45b3 | ||
|
|
730a8de024 | ||
|
|
7eac2fe3e4 | ||
|
|
267243d959 | ||
|
|
f587262c8e | ||
|
|
ebf458dbd0 | ||
|
|
f64b5559dd | ||
|
|
2ddcd5f678 | ||
|
|
cac715937a | ||
|
|
d0817640b6 | ||
|
|
39f43feb11 | ||
|
|
58d65b17ea | ||
|
|
4314f0cac3 | ||
|
|
d4da369930 | ||
|
|
6f1876b618 | ||
|
|
c6e872ceb0 | ||
|
|
72d809819f | ||
|
|
dd09ef3362 | ||
|
|
aa7941fae2 | ||
|
|
35af4a8f35 | ||
|
|
a01fd3dd76 | ||
|
|
d220da89d1 | ||
|
|
55c75e9299 | ||
|
|
616ea87a0a | ||
|
|
319ba2fe75 | ||
|
|
d79eeff779 | ||
|
|
11e6fd20bf | ||
|
|
e722202ee6 | ||
|
|
26d38748db | ||
|
|
5c124234bb | ||
|
|
681af396b8 | ||
|
|
cac0eaa6c3 | ||
|
|
a64fa2c18f | ||
|
|
f07640850b | ||
|
|
e43586ffac | ||
|
|
2b9e87cc2f | ||
|
|
9cc243837d | ||
|
|
de7e3baabc | ||
|
|
5e29afcb57 | ||
|
|
0a1085d9be | ||
|
|
0439d53704 | ||
|
|
5ac2ff4521 | ||
|
|
8565a3e472 | ||
|
|
3648bc8cb0 | ||
|
|
73121eda9d | ||
|
|
768e92b0e9 | ||
|
|
98333b7dcf | ||
|
|
4e0007780c | ||
|
|
10f0c3e08e | ||
|
|
fa2950a04b | ||
|
|
ebfb62ca49 | ||
|
|
96023e81af | ||
|
|
9c07d0ff5d | ||
|
|
72a85b396c | ||
|
|
87786091bb | ||
|
|
784494274b | ||
|
|
68012dd92c | ||
|
|
e40be775fe | ||
|
|
64e6924132 | ||
|
|
4bbf47086d | ||
|
|
7c674bc255 | ||
|
|
6b9a2d791b | ||
|
|
4551e8759b | ||
|
|
9442976bdb | ||
|
|
8d07df176f | ||
|
|
4b22aff33e | ||
|
|
93dee254d0 | ||
|
|
a29b598205 | ||
|
|
e3b20eaae9 | ||
|
|
d369fb0f94 | ||
|
|
d816bca42f | ||
|
|
d6bb11c4e9 | ||
|
|
2fdcefac05 | ||
|
|
044c3cc11e | ||
|
|
bd9223b525 | ||
|
|
347703dab2 | ||
|
|
f9a0e450e1 | ||
|
|
f6b8cdd1f5 | ||
|
|
6727013302 | ||
|
|
cda12a2660 | ||
|
|
c3c2072472 | ||
|
|
bfc226fdc0 | ||
|
|
fd28e1a7fb | ||
|
|
b11911f5e5 | ||
|
|
a1587d070f | ||
|
|
df2f43bc61 | ||
|
|
895e8eea52 | ||
|
|
97d6249f3b | ||
|
|
7a8ed98eb5 | ||
|
|
d611eece19 | ||
|
|
a99320f5a4 | ||
|
|
c97484943a | ||
|
|
547d9bd844 | ||
|
|
1a65aab05a | ||
|
|
2e869aeb86 | ||
|
|
d729776575 | ||
|
|
895c436405 | ||
|
|
4ae2932792 | ||
|
|
a52be2bdbb | ||
|
|
31c4792216 | ||
|
|
39fd9c0b47 | ||
|
|
9c25df3402 | ||
|
|
fb150b5038 | ||
|
|
8cff3a167e | ||
|
|
2be1431f60 | ||
|
|
255b7ed7f6 | ||
|
|
58fd27399e | ||
|
|
5f88ba1e47 | ||
|
|
ab569461d8 | ||
|
|
7093fc670b | ||
|
|
6f2b030253 | ||
|
|
0e61e679af | ||
|
|
b40998e1b5 | ||
|
|
174d701bc3 | ||
|
|
f2143d08b9 | ||
|
|
1273e2620d | ||
|
|
c719f6e37e | ||
|
|
37922d8ce0 | ||
|
|
7b79a31f40 | ||
|
|
9a09406f77 | ||
|
|
9bdb778478 | ||
|
|
9621dafe46 | ||
|
|
d7c9837844 | ||
|
|
27bb7803ae | ||
|
|
c0e1086f2c | ||
|
|
ffa751c617 | ||
|
|
b8ad60a2d6 | ||
|
|
5db0aac816 | ||
|
|
3fae7c5184 | ||
|
|
47889a8f22 | ||
|
|
8d22c3869b | ||
|
|
235ed4afe0 | ||
|
|
627cb7f774 | ||
|
|
09021af350 | ||
|
|
31c280d1fa | ||
|
|
629f344f34 | ||
|
|
db5f924e24 | ||
|
|
9be3eb282a | ||
|
|
effd891a16 | ||
|
|
13db35cbf5 | ||
|
|
0f2d480e3c | ||
|
|
9edc61e37b | ||
|
|
f4dab6aac5 | ||
|
|
9e0550d140 | ||
|
|
0d1701c509 | ||
|
|
f2f62f93ea | ||
|
|
8a329f66fb | ||
|
|
05d4c52918 | ||
|
|
8fd0dd0cc0 | ||
|
|
8eea5811ba | ||
|
|
a154c2adab | ||
|
|
10bf4ed576 | ||
|
|
60d12dd395 | ||
|
|
b4e9be3c52 | ||
|
|
dcebae6d4a | ||
|
|
0d776bcd26 | ||
|
|
2d6ed47cf2 | ||
|
|
ea06434425 | ||
|
|
6508eff95e | ||
|
|
69930684a9 | ||
|
|
b1931a3eda | ||
|
|
63b44d4e32 | ||
|
|
f7cb8d8141 | ||
|
|
48c857e02c | ||
|
|
442dc58e0f | ||
|
|
25460c652c | ||
|
|
31a98f0a1e | ||
|
|
36c44b6f45 | ||
|
|
27426b18d1 | ||
|
|
3ea9ce1c8c | ||
|
|
4dfc636c84 | ||
|
|
5fe4312c6c | ||
|
|
63e675a6bb | ||
|
|
e92aeac7d7 | ||
|
|
f1f7eac1f2 | ||
|
|
eff0c84553 | ||
|
|
58c8ce61c7 | ||
|
|
6ac5e6953a | ||
|
|
5d9ad59af2 | ||
|
|
3c48a05437 | ||
|
|
4462124ff2 | ||
|
|
373f557ef7 | ||
|
|
495e561398 | ||
|
|
d24a579033 | ||
|
|
77130424b4 | ||
|
|
eb30688937 | ||
|
|
880bac0633 | ||
|
|
851d6a987f | ||
|
|
9bebd7b35f | ||
|
|
309acb9597 | ||
|
|
a56887167e | ||
|
|
e984dff4e4 | ||
|
|
685e4d446b | ||
|
|
8af680f307 | ||
|
|
6c60cce60d | ||
|
|
5882a675bb | ||
|
|
a5e95845b3 | ||
|
|
5b83d81e40 | ||
|
|
c8e5ad564d | ||
|
|
5edfa273ff | ||
|
|
4db57bcb10 | ||
|
|
3f13340903 | ||
|
|
6abb53c9d3 | ||
|
|
fdd20a519e | ||
|
|
67cc49f333 | ||
|
|
31a34cd0b5 | ||
|
|
ef8c08ba99 | ||
|
|
2991ca6c6f | ||
|
|
52bace18b2 | ||
|
|
767d14ae4f | ||
|
|
1a5c911e36 | ||
|
|
6e42a04e43 | ||
|
|
28be2cfeef | ||
|
|
8be168fd87 | ||
|
|
eee95fef57 | ||
|
|
9ea179b052 | ||
|
|
6868280409 | ||
|
|
e00b764454 | ||
|
|
999613c686 | ||
|
|
c2661d7eb5 | ||
|
|
4d21dd1f47 | ||
|
|
a0a0e57527 | ||
|
|
d8af0d0b4e | ||
|
|
113288e3b0 | ||
|
|
afecfd7c2d | ||
|
|
94d89aac5f | ||
|
|
8831b13efc | ||
|
|
01f99da03a | ||
|
|
080654e3ef | ||
|
|
2ac2eb2a61 | ||
|
|
61b940b705 | ||
|
|
4a4f87e017 | ||
|
|
6d5e7f63a7 | ||
|
|
f77285f375 | ||
|
|
dc5d03a6dc | ||
|
|
ea0961b7f6 | ||
|
|
33d9f9774c | ||
|
|
86097fa038 | ||
|
|
70d9dbc45a | ||
|
|
3926fd3a20 | ||
|
|
7861cf1146 | ||
|
|
0516b86a6e | ||
|
|
ec735d3e9b | ||
|
|
1c5c070983 | ||
|
|
a5c02b73dc | ||
|
|
918b920670 | ||
|
|
de67d2e27e | ||
|
|
bc89df04cb | ||
|
|
c26a4cf082 | ||
|
|
6e1a866b13 | ||
|
|
f91986ad0d | ||
|
|
795cc23f3e | ||
|
|
a3695bd4a0 | ||
|
|
08dc521daf | ||
|
|
8b916d21b1 | ||
|
|
c40f47a78a | ||
|
|
e9fb470b06 | ||
|
|
343d049772 | ||
|
|
86f9480da4 | ||
|
|
8696b610ca | ||
|
|
6f13227eda | ||
|
|
58d5110e61 | ||
|
|
76e53c7bc5 | ||
|
|
cfb08be1a8 | ||
|
|
b5bbb7fb1c | ||
|
|
a76c33f8cc | ||
|
|
810306b8f3 | ||
|
|
6c22bdb3bd | ||
|
|
6a0d3e98bc | ||
|
|
3809321037 | ||
|
|
eef695bdf0 | ||
|
|
ab01ab1e4d | ||
|
|
c8d8a108a7 | ||
|
|
7afd9efcc5 | ||
|
|
56ded87ad2 | ||
|
|
82e503339b | ||
|
|
713d0c7ace | ||
|
|
25ad6e3f8f | ||
|
|
df0197b617 | ||
|
|
a89c4f01ad | ||
|
|
ae67099633 | ||
|
|
57542d3a5c | ||
|
|
9a1da14116 | ||
|
|
ed050d753d | ||
|
|
8bec363710 | ||
|
|
7c68e190a9 | ||
|
|
7ebf5ea3d1 | ||
|
|
11e0435a4b | ||
|
|
d15ee57cd1 | ||
|
|
56d660b7fd | ||
|
|
792958e693 | ||
|
|
914e67dc04 | ||
|
|
b50a7ccb61 | ||
|
|
f827709d42 | ||
|
|
36abb42175 | ||
|
|
40f3b1b4c8 | ||
|
|
4f35e25688 | ||
|
|
270e88edd7 | ||
|
|
5ded171247 | ||
|
|
332dd988e4 | ||
|
|
bce8db41d7 | ||
|
|
f6fd70245d | ||
|
|
4ff0a055d6 | ||
|
|
c9140267a5 | ||
|
|
72fcee4e5e | ||
|
|
9c8e512edd | ||
|
|
3c191af34a | ||
|
|
5e0b2d7370 | ||
|
|
5994abd453 | ||
|
|
67a2d119c0 | ||
|
|
114215088a | ||
|
|
a78e2b793e | ||
|
|
519ed3834e | ||
|
|
22647135fa | ||
|
|
58c741e9ca | ||
|
|
ef9083089e | ||
|
|
5de1582a0a | ||
|
|
39c864e31f | ||
|
|
320cb63df4 | ||
|
|
c246222ded | ||
|
|
b7edb2873c | ||
|
|
89f2032c0d | ||
|
|
d2f8230093 | ||
|
|
9f6b5d169a | ||
|
|
e56708d4aa | ||
|
|
304156c20e | ||
|
|
31e1566e1d | ||
|
|
3908637056 | ||
|
|
abee301f3d | ||
|
|
9b1d3f8f3c | ||
|
|
3513eaf701 | ||
|
|
08a840afe4 | ||
|
|
370f5d461c | ||
|
|
8efc8458e1 | ||
|
|
6485717c52 | ||
|
|
1d5bbd11a8 | ||
|
|
bc403742b5 | ||
|
|
c7f963f57e | ||
|
|
afb6684bde | ||
|
|
ee3d772235 | ||
|
|
1af08f7085 | ||
|
|
ccf23fa273 | ||
|
|
f701defc5f | ||
|
|
c606f05bf8 | ||
|
|
a646153615 | ||
|
|
60380afe15 | ||
|
|
d4b0a977c9 | ||
|
|
f86156ad10 | ||
|
|
1836ee854f | ||
|
|
c37cdeec9f | ||
|
|
b0b2b17908 | ||
|
|
2918732481 | ||
|
|
5a4d5ddb9d | ||
|
|
55afcf678d | ||
|
|
16c7cf9b5e | ||
|
|
432bd29c1c | ||
|
|
a87914ef23 | ||
|
|
041530a953 | ||
|
|
9d4c55161a | ||
|
|
a706d1df00 | ||
|
|
b15b2e666f | ||
|
|
5d4678364e | ||
|
|
9590526430 | ||
|
|
1c6dfda83c | ||
|
|
a8be12940e | ||
|
|
4b5046366b | ||
|
|
a0fff90c26 | ||
|
|
a8daedac5e | ||
|
|
5fa26fb3ac | ||
|
|
ea3e297175 | ||
|
|
a11bd6ebd9 | ||
|
|
9889bf50a2 | ||
|
|
d75fb2deda | ||
|
|
6355a5b28d | ||
|
|
595bbee41e | ||
|
|
cb3f3a1f64 | ||
|
|
0e44838905 | ||
|
|
64cd268fc7 | ||
|
|
f048dd81f2 | ||
|
|
5746f2214c | ||
|
|
099af669d4 | ||
|
|
79cac706a7 | ||
|
|
df229074ac | ||
|
|
191c27e856 | ||
|
|
e5ee01b43c | ||
|
|
c46b040f6f | ||
|
|
72e4794f5b | ||
|
|
c30b65a0ea | ||
|
|
1cb08ff60c | ||
|
|
d3d7fd9317 | ||
|
|
acf0f97663 | ||
|
|
34bd87cea7 | ||
|
|
228f11262e | ||
|
|
9683e0f1cc | ||
|
|
674ae6d571 | ||
|
|
690d44e2e6 | ||
|
|
720ccdb474 | ||
|
|
a556ff6560 | ||
|
|
33c0af8253 | ||
|
|
86072f95ac | ||
|
|
c7b96bcd7d | ||
|
|
572c18302f | ||
|
|
efd1bdec23 | ||
|
|
ba86f9ff13 | ||
|
|
56b07cb5c0 | ||
|
|
358e32e98f | ||
|
|
01297016bd | ||
|
|
64b5b67661 | ||
|
|
b6f0ec7fd9 | ||
|
|
e9c0b5e0c5 | ||
|
|
4a005ea288 | ||
|
|
9658b69af4 | ||
|
|
e3c9446e29 | ||
|
|
aa240e61d9 | ||
|
|
2954e932ce | ||
|
|
5be79cc858 | ||
|
|
4a9d97d22d | ||
|
|
f4f3433854 | ||
|
|
26bffa3740 | ||
|
|
69e52a9882 | ||
|
|
cc8de48849 | ||
|
|
9d7c119f94 | ||
|
|
6ba9fd1b60 | ||
|
|
fb6250eb94 | ||
|
|
bc73368c96 | ||
|
|
3068f0c62c | ||
|
|
8e00803c83 | ||
|
|
087b69b629 | ||
|
|
3b237267fb | ||
|
|
b9dbb1ed45 | ||
|
|
41d3b29ec0 | ||
|
|
05ceb8b1e2 | ||
|
|
80d3925b8d | ||
|
|
2cd6cbeacc | ||
|
|
6382846f6c | ||
|
|
349d0fd74b | ||
|
|
9c88855bf4 | ||
|
|
f0e6cdfcb5 | ||
|
|
af9864a1b5 | ||
|
|
8ac145e667 | ||
|
|
39f7afc7d0 | ||
|
|
113b974bb7 | ||
|
|
c747a6ff4e | ||
|
|
107d11cfd5 | ||
|
|
a4d2cd94b9 | ||
|
|
3d9fb84fc9 | ||
|
|
e500bc075e | ||
|
|
25e8fa0e11 | ||
|
|
5f27fb2607 | ||
|
|
d977cedb78 | ||
|
|
454b58cdf0 | ||
|
|
82a632b0f9 | ||
|
|
43cbe3f1f8 | ||
|
|
d027cec8a6 | ||
|
|
e53c2c52ee | ||
|
|
5ff0ecc12d | ||
|
|
9c1f421ccb | ||
|
|
66850bc057 | ||
|
|
33da34b4bf | ||
|
|
792cd49310 | ||
|
|
37fdb5e2b0 | ||
|
|
88cd251db7 | ||
|
|
4038d18fc8 | ||
|
|
59bf92a183 | ||
|
|
57879155d2 | ||
|
|
96d43cebc0 | ||
|
|
8e13857b29 | ||
|
|
8c6e454697 | ||
|
|
4c7c7df89b | ||
|
|
515e6d8635 | ||
|
|
bbd941e2df | ||
|
|
3edba1bf19 | ||
|
|
4ad99d8242 | ||
|
|
c0aeaecc14 | ||
|
|
792be9e687 | ||
|
|
fd65337f43 | ||
|
|
9de9726e6f | ||
|
|
522037ca4a | ||
|
|
8fc3d1f718 | ||
|
|
cebaf27ee8 | ||
|
|
b62503f274 | ||
|
|
af50c640ab | ||
|
|
b5c5fbe0f5 | ||
|
|
b88ae8105e | ||
|
|
9ad04bb65e | ||
|
|
13bbaab1c4 | ||
|
|
09ca8d1728 | ||
|
|
9797a93d86 | ||
|
|
d29dae72de | ||
|
|
59fba2bff6 | ||
|
|
0350d4c501 | ||
|
|
d3e4a90e70 | ||
|
|
8ebb19fd18 | ||
|
|
02ddc33e6c | ||
|
|
410e8efeba | ||
|
|
e9f8e0bad9 | ||
|
|
f69e0313dc | ||
|
|
baa9b396d9 | ||
|
|
a82b0c516d | ||
|
|
43e2192aa2 | ||
|
|
4cd6453cac | ||
|
|
921d4c24c2 | ||
|
|
4fc7653b12 | ||
|
|
9d0e39a7c2 | ||
|
|
7aa979cf5b | ||
|
|
0aa50614d7 | ||
|
|
6f402c7362 | ||
|
|
2bf43a124d | ||
|
|
3573c53eda | ||
|
|
4546ec4ef7 | ||
|
|
2f7337aaf6 | ||
|
|
046698bcc2 | ||
|
|
06d7bf21d5 | ||
|
|
e7b9ccdf10 | ||
|
|
1e15b043a0 | ||
|
|
6c5f3d76e2 | ||
|
|
8679d6f6af | ||
|
|
f1c7d0f354 | ||
|
|
261e413500 | ||
|
|
094e41d7a7 | ||
|
|
e20299c8ee | ||
|
|
f8962b7ad2 | ||
|
|
c34f829c3e | ||
|
|
46264e4a4a | ||
|
|
096df68ea6 | ||
|
|
35f2055a1e | ||
|
|
e1353eefb3 | ||
|
|
4911a532bf | ||
|
|
96362e03aa | ||
|
|
049b4e09fe | ||
|
|
828c0e28af | ||
|
|
15a638edc0 | ||
|
|
fc8f1b1075 | ||
|
|
318a8e38c9 | ||
|
|
f0dbb02a9f | ||
|
|
649b777b76 | ||
|
|
6fad43670a | ||
|
|
e24b16229e | ||
|
|
21b4b81810 | ||
|
|
1096b1e28e | ||
|
|
03458fedef | ||
|
|
c1a2004344 | ||
|
|
2adb13a209 | ||
|
|
dba194ddb9 | ||
|
|
8179f041e6 | ||
|
|
a13c7a4d84 | ||
|
|
bbf92bb971 | ||
|
|
b33f413635 | ||
|
|
58ffb2bc16 | ||
|
|
0ed112631c | ||
|
|
9cfe8e9422 | ||
|
|
7d3fe72970 | ||
|
|
ac422138fa | ||
|
|
bf8746454a | ||
|
|
b61aa5b4ba | ||
|
|
c2bcd08168 | ||
|
|
48593b8868 | ||
|
|
83d4dc1831 | ||
|
|
0696f3cc41 | ||
|
|
515590495a | ||
|
|
7221bca909 | ||
|
|
ed64a8cd12 | ||
|
|
cbd30d22ff | ||
|
|
0c74dbd436 | ||
|
|
49356cc931 | ||
|
|
ceee6e8b17 | ||
|
|
61ab2754d2 | ||
|
|
2de3df61e8 | ||
|
|
b84d7aa06d | ||
|
|
ed48f900a3 | ||
|
|
d197a49707 | ||
|
|
b8ccaa3bf6 | ||
|
|
507a684b21 | ||
|
|
c969c9387a | ||
|
|
1709db4953 | ||
|
|
4d1c9ba316 | ||
|
|
45b0396355 | ||
|
|
1df2169e48 | ||
|
|
2c056b3621 | ||
|
|
680119006c | ||
|
|
c4ac4b7538 | ||
|
|
ff5d3b49ca | ||
|
|
e101c878f0 | ||
|
|
125193dcfa | ||
|
|
77efa9810d | ||
|
|
7f03d1917b | ||
|
|
55b4ca9350 | ||
|
|
7196a0f9d2 | ||
|
|
2caabde5ca | ||
|
|
137d7663c1 | ||
|
|
508b71a921 | ||
|
|
5d90820005 | ||
|
|
84727e90b1 | ||
|
|
9a1e3d3320 | ||
|
|
d33e0c8ee1 | ||
|
|
3332649480 | ||
|
|
c918b66199 | ||
|
|
dbbf56e17a | ||
|
|
c77500c15a | ||
|
|
75084aaa96 | ||
|
|
35714c8f1c | ||
|
|
3699cc97a6 | ||
|
|
5a7377acda | ||
|
|
6aaee629b5 | ||
|
|
b465fe569c | ||
|
|
5e6f72a688 | ||
|
|
51f80f6c15 | ||
|
|
45c314e594 | ||
|
|
cfce0892e0 | ||
|
|
05d1abf030 | ||
|
|
6c24a2626b | ||
|
|
870c75bd12 | ||
|
|
5fdd771708 | ||
|
|
06f39ac409 | ||
|
|
c92b0a2fb7 | ||
|
|
8a8d0e05ca | ||
|
|
74bae2baac | ||
|
|
4ba48676bd | ||
|
|
78480e7951 | ||
|
|
4cb9c412e8 | ||
|
|
75c83fed96 | ||
|
|
391de20ae0 | ||
|
|
1e2a9e8971 | ||
|
|
43cbd3a283 | ||
|
|
31cf6b5e64 | ||
|
|
99109ab78b | ||
|
|
a80d5f159d | ||
|
|
7ba4fc4aed | ||
|
|
9fb31e9868 | ||
|
|
3a2246de5b | ||
|
|
e7c4e2fa57 | ||
|
|
724ab285f0 | ||
|
|
d60e66fb00 | ||
|
|
97cdaca028 | ||
|
|
3044c8f905 | ||
|
|
2775a2a945 | ||
|
|
c43c1febba | ||
|
|
ceb6471d57 | ||
|
|
b99cc044f3 | ||
|
|
d91429dcec | ||
|
|
b1d1f7d8f1 | ||
|
|
86b608cf41 | ||
|
|
f263f75751 | ||
|
|
24bec05b86 | ||
|
|
ce1a5e9359 | ||
|
|
311525bc06 | ||
|
|
ecdfd96529 | ||
|
|
5aab32bc1a | ||
|
|
e152a1c6f2 | ||
|
|
e84fde78ec | ||
|
|
6ec4652bcf | ||
|
|
a5239c820b | ||
|
|
41b001b22c | ||
|
|
34e903b8b0 | ||
|
|
2b67e953fd | ||
|
|
aa0d3adf1d | ||
|
|
a1f57a8a80 | ||
|
|
6bc82a8580 | ||
|
|
c4c2e5d3a2 | ||
|
|
dd7d4b2173 | ||
|
|
2719c4d545 | ||
|
|
33c1e36b54 | ||
|
|
e7e46e185e | ||
|
|
9200d48873 | ||
|
|
831d054d24 | ||
|
|
f3af804ddb | ||
|
|
1f35149ef0 | ||
|
|
554a18842f | ||
|
|
869243b6d1 | ||
|
|
c0da02326a | ||
|
|
9b5f666fc5 | ||
|
|
1ce93426a4 | ||
|
|
6dacf3478b | ||
|
|
dff91699c3 | ||
|
|
9f83e8c1fc | ||
|
|
7b07cb0759 | ||
|
|
c2e7091632 | ||
|
|
1ab320042e | ||
|
|
b0cd307eaf | ||
|
|
ca2cf20cf3 | ||
|
|
b3acba1d2d | ||
|
|
6d2731c463 | ||
|
|
b7f8f8867c |
@@ -1,40 +0,0 @@
|
|||||||
# (C) Copyright William E. Kempf 2001. Permission to copy, use, modify, sell and
|
|
||||||
# distribute this software is granted provided this copyright notice appears
|
|
||||||
# in all copies. This software is provided "as is" without express or implied
|
|
||||||
# warranty, and with no claim as to its suitability for any purpose.
|
|
||||||
#
|
|
||||||
# Boost.Threads build and test Jamfile
|
|
||||||
#
|
|
||||||
# Declares the following targets:
|
|
||||||
# 1. libboost_thread, a static link library.
|
|
||||||
# 1a. On Win32, a dynamic link library libboost_threadmon,
|
|
||||||
# which must be used in conjunction with libboost_thread.
|
|
||||||
|
|
||||||
# declare the location of this subproject relative to the root
|
|
||||||
subproject libs/thread/build ;
|
|
||||||
|
|
||||||
#######################
|
|
||||||
|
|
||||||
#
|
|
||||||
# Declare the Boost.Threads static link library.
|
|
||||||
#
|
|
||||||
|
|
||||||
# For Win32 we need to build a special DLL, libboost_threadmon, to handle
|
|
||||||
# TSS destruction.
|
|
||||||
if $(NT)
|
|
||||||
{
|
|
||||||
dll libboost_threadmon : ../src/threadmon.cpp
|
|
||||||
# requirements
|
|
||||||
: <threading>multi
|
|
||||||
: debug release ;
|
|
||||||
}
|
|
||||||
|
|
||||||
# Base names of the source files for libboost_thread
|
|
||||||
CPP_SOURCES =
|
|
||||||
condition mutex recursive_mutex semaphore thread tss xtime once ;
|
|
||||||
|
|
||||||
lib libboost_thread : ../src/$(CPP_SOURCES).cpp
|
|
||||||
# requirements
|
|
||||||
: <include>$(BOOST_ROOT)
|
|
||||||
<threading>multi
|
|
||||||
: debug release ;
|
|
||||||
234
build/Jamfile.v2
Normal file
234
build/Jamfile.v2
Normal file
@@ -0,0 +1,234 @@
|
|||||||
|
# $Id$
|
||||||
|
# Copyright 2006-2007 Roland Schwarz.
|
||||||
|
# Copyright 2007 Anthony Williams
|
||||||
|
# Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
# accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
# http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#########################################################################
|
||||||
|
# The boost threading library can be built on top of different API's
|
||||||
|
# Currently this is the win32 API and the pthreads API.
|
||||||
|
# Pthread is native on unix variants.
|
||||||
|
# To get pthread on windows you need the pthread win32 library
|
||||||
|
# http://sourceware.org/pthreads-win32 which is available under LGPL.
|
||||||
|
#
|
||||||
|
# You need to provide the include path and lib path in the variables
|
||||||
|
# PTW32_INCLUDE and PTW32_LIB respectively. You can specify these
|
||||||
|
# paths in site-config.jam, user-config.jam or in the environment.
|
||||||
|
# A new feature is provided to request a specific API:
|
||||||
|
# <threadapi>win32 and <threadapi)pthread.
|
||||||
|
#
|
||||||
|
# The naming of the resulting libraries is mostly the same for the
|
||||||
|
# variant native to the build platform, i.e.
|
||||||
|
# boost_thread and the boost specific tagging.
|
||||||
|
# For the library variant that is not native on the build platform
|
||||||
|
# an additional tag is applied:
|
||||||
|
# boost_thread_pthread for the pthread variant on windows, and
|
||||||
|
# boost_thread_win32 for the win32 variant (likely when built on cygwin).
|
||||||
|
#
|
||||||
|
# To request the pthread variant on windows, from boost root you would
|
||||||
|
# say e.g:
|
||||||
|
# bjam msvc-8.0 --with-thread install threadapi=pthread
|
||||||
|
#########################################################################
|
||||||
|
|
||||||
|
import os ;
|
||||||
|
import feature ;
|
||||||
|
import indirect ;
|
||||||
|
import path ;
|
||||||
|
|
||||||
|
project boost/thread
|
||||||
|
: source-location ../src
|
||||||
|
: requirements <threading>multi
|
||||||
|
<link>static:<define>BOOST_THREAD_BUILD_LIB=1
|
||||||
|
<link>shared:<define>BOOST_THREAD_BUILD_DLL=1
|
||||||
|
-<tag>@$(BOOST_JAMROOT_MODULE)%$(BOOST_JAMROOT_MODULE).tag
|
||||||
|
<tag>@$(__name__).tag
|
||||||
|
<toolset>gcc:<cxxflags>-Wno-long-long
|
||||||
|
<define>BOOST_SYSTEM_NO_DEPRECATED
|
||||||
|
<library>/boost/system//boost_system
|
||||||
|
|
||||||
|
# : default-build <threading>multi
|
||||||
|
: usage-requirements # pass these requirement to dependents (i.e. users)
|
||||||
|
<link>static:<define>BOOST_THREAD_BUILD_LIB=1
|
||||||
|
<link>shared:<define>BOOST_THREAD_BUILD_DLL=1
|
||||||
|
<define>BOOST_SYSTEM_NO_DEPRECATED
|
||||||
|
<library>/boost/system//boost_system
|
||||||
|
;
|
||||||
|
|
||||||
|
local rule default_threadapi ( )
|
||||||
|
{
|
||||||
|
local api = pthread ;
|
||||||
|
if [ os.name ] = "NT" { api = win32 ; }
|
||||||
|
return $(api) ;
|
||||||
|
}
|
||||||
|
|
||||||
|
feature.feature threadapi : pthread win32 : propagated ;
|
||||||
|
feature.set-default threadapi : [ default_threadapi ] ;
|
||||||
|
|
||||||
|
rule tag ( name : type ? : property-set )
|
||||||
|
{
|
||||||
|
local result = $(name) ;
|
||||||
|
|
||||||
|
if $(type) in STATIC_LIB SHARED_LIB IMPORT_LIB
|
||||||
|
{
|
||||||
|
local api = [ $(property-set).get <threadapi> ] ;
|
||||||
|
|
||||||
|
# non native api gets additional tag
|
||||||
|
if $(api) != [ default_threadapi ] {
|
||||||
|
result = $(result)_$(api) ;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
# forward to the boost tagging rule
|
||||||
|
return [ indirect.call $(BOOST_JAMROOT_MODULE)%$(BOOST_JAMROOT_MODULE).tag
|
||||||
|
$(result) : $(type) : $(property-set) ] ;
|
||||||
|
}
|
||||||
|
|
||||||
|
rule win32_pthread_paths ( properties * )
|
||||||
|
{
|
||||||
|
local result ;
|
||||||
|
local PTW32_INCLUDE ;
|
||||||
|
local PTW32_LIB ;
|
||||||
|
PTW32_INCLUDE = [ modules.peek : PTW32_INCLUDE ] ;
|
||||||
|
PTW32_LIB = [ modules.peek : PTW32_LIB ] ;
|
||||||
|
PTW32_INCLUDE ?= [ modules.peek user-config : PTW32_INCLUDE ] ;
|
||||||
|
PTW32_LIB ?= [ modules.peek user-config : PTW32_LIB ] ;
|
||||||
|
PTW32_INCLUDE ?= [ modules.peek site-config : PTW32_INCLUDE ] ;
|
||||||
|
PTW32_LIB ?= [ modules.peek site-config : PTW32_LIB ] ;
|
||||||
|
|
||||||
|
if ! ( $(PTW32_INCLUDE) && $(PTW32_LIB) )
|
||||||
|
{
|
||||||
|
if ! $(.notified)
|
||||||
|
{
|
||||||
|
echo "************************************************************" ;
|
||||||
|
echo "Trying to build Boost.Thread with pthread support." ;
|
||||||
|
echo "If you need pthread you should specify the paths." ;
|
||||||
|
echo "You can specify them in site-config.jam, user-config.jam" ;
|
||||||
|
echo "or in the environment." ;
|
||||||
|
echo "For example:" ;
|
||||||
|
echo "PTW32_INCLUDE=C:\\Program Files\\ptw32\\Pre-built2\\include" ;
|
||||||
|
echo "PTW32_LIB=C:\\Program Files\\ptw32\\Pre-built2\\lib" ;
|
||||||
|
echo "************************************************************" ;
|
||||||
|
.notified = true ;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
local include_path = [ path.make $(PTW32_INCLUDE) ] ;
|
||||||
|
local lib_path = [ path.make $(PTW32_LIB) ] ;
|
||||||
|
local libname = pthread ;
|
||||||
|
if <toolset>msvc in $(properties)
|
||||||
|
{
|
||||||
|
libname = $(libname)VC2.lib ;
|
||||||
|
}
|
||||||
|
if <toolset>gcc in $(properties)
|
||||||
|
{
|
||||||
|
libname = lib$(libname)GC2.a ;
|
||||||
|
}
|
||||||
|
lib_path = [ path.glob $(lib_path) : $(libname) ] ;
|
||||||
|
if ! $(lib_path)
|
||||||
|
{
|
||||||
|
if ! $(.notified)
|
||||||
|
{
|
||||||
|
echo "************************************************************" ;
|
||||||
|
echo "Trying to build Boost.Thread with pthread support." ;
|
||||||
|
echo "But the library" $(libname) "could not be found in path" ;
|
||||||
|
echo $(PTW32_LIB) ;
|
||||||
|
echo "************************************************************" ;
|
||||||
|
.notified = true ;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
result += <include>$(include_path) ;
|
||||||
|
result += <library>$(lib_path) ;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return $(result) ;
|
||||||
|
}
|
||||||
|
|
||||||
|
rule usage-requirements ( properties * )
|
||||||
|
{
|
||||||
|
local result ;
|
||||||
|
if <threadapi>pthread in $(properties)
|
||||||
|
{
|
||||||
|
result += <define>BOOST_THREAD_POSIX ;
|
||||||
|
if <target-os>windows in $(properties)
|
||||||
|
{
|
||||||
|
result += [ win32_pthread_paths $(properties) ] ;
|
||||||
|
# TODO: What is for static linking? Is the <library> also needed
|
||||||
|
# in that case?
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if <toolset>vacpp in $(properties)
|
||||||
|
{
|
||||||
|
result += <define>BOOST_THREAD_DONT_USE_CHRONO ;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
result += <library>/boost/chrono//boost_chrono ;
|
||||||
|
}
|
||||||
|
|
||||||
|
return $(result) ;
|
||||||
|
}
|
||||||
|
|
||||||
|
rule requirements ( properties * )
|
||||||
|
{
|
||||||
|
local result ;
|
||||||
|
|
||||||
|
if <threadapi>pthread in $(properties)
|
||||||
|
{
|
||||||
|
result += <define>BOOST_THREAD_POSIX ;
|
||||||
|
if <target-os>windows in $(properties)
|
||||||
|
{
|
||||||
|
local paths = [ win32_pthread_paths $(properties) ] ;
|
||||||
|
if $(paths)
|
||||||
|
{
|
||||||
|
result += $(paths) ;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
result = <build>no ;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if <toolset>vacpp in $(properties)
|
||||||
|
{
|
||||||
|
result += <define>BOOST_THREAD_DONT_USE_CHRONO ;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
result += <library>/boost/chrono//boost_chrono ;
|
||||||
|
}
|
||||||
|
|
||||||
|
return $(result) ;
|
||||||
|
}
|
||||||
|
|
||||||
|
alias thread_sources
|
||||||
|
: ## win32 sources ##
|
||||||
|
win32/thread.cpp
|
||||||
|
win32/tss_dll.cpp
|
||||||
|
win32/tss_pe.cpp
|
||||||
|
: ## requirements ##
|
||||||
|
<threadapi>win32
|
||||||
|
;
|
||||||
|
|
||||||
|
alias thread_sources
|
||||||
|
: ## pthread sources ##
|
||||||
|
pthread/thread.cpp
|
||||||
|
pthread/once.cpp
|
||||||
|
: ## requirements ##
|
||||||
|
<threadapi>pthread
|
||||||
|
;
|
||||||
|
|
||||||
|
explicit thread_sources ;
|
||||||
|
|
||||||
|
lib boost_thread
|
||||||
|
: thread_sources future.cpp
|
||||||
|
: <conditional>@requirements
|
||||||
|
:
|
||||||
|
: <link>shared:<define>BOOST_THREAD_USE_DLL=1
|
||||||
|
<link>static:<define>BOOST_THREAD_USE_LIB=1
|
||||||
|
<conditional>@usage-requirements
|
||||||
|
;
|
||||||
32
doc/Jamfile.v2
Normal file
32
doc/Jamfile.v2
Normal file
@@ -0,0 +1,32 @@
|
|||||||
|
# (C) Copyright 2008-11 Anthony Williams
|
||||||
|
# (C) Copyright 2011-12 Vicente J. Botet Escriba
|
||||||
|
#
|
||||||
|
# Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
# file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
path-constant boost-images : ../../../doc/src/images ;
|
||||||
|
|
||||||
|
xml thread : thread.qbk ;
|
||||||
|
|
||||||
|
boostbook standalone
|
||||||
|
:
|
||||||
|
thread
|
||||||
|
:
|
||||||
|
# HTML options first:
|
||||||
|
# Use graphics not text for navigation:
|
||||||
|
<xsl:param>navig.graphics=1
|
||||||
|
# How far down we chunk nested sections, basically all of them:
|
||||||
|
<xsl:param>chunk.section.depth=2
|
||||||
|
# Don't put the first section on the same page as the TOC:
|
||||||
|
<xsl:param>chunk.first.sections=1
|
||||||
|
# How far down sections get TOC's
|
||||||
|
<xsl:param>toc.section.depth=4
|
||||||
|
# Max depth in each TOC:
|
||||||
|
<xsl:param>toc.max.depth=2
|
||||||
|
# How far down we go with TOC's
|
||||||
|
<xsl:param>generate.section.toc.level=10
|
||||||
|
# Path for links to Boost:
|
||||||
|
<xsl:param>boost.root=../../../..
|
||||||
|
;
|
||||||
|
|
||||||
|
|
||||||
@@ -1,72 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=windows-1252">
|
|
||||||
<meta name="GENERATOR" content="Microsoft FrontPage 4.0">
|
|
||||||
<meta name="ProgId" content="FrontPage.Editor.Document">
|
|
||||||
<title>Boost.Threads Acknowledgements</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" text="#000000">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">Acknowledgements</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<h2>Acknowledgments</h2>
|
|
||||||
|
|
||||||
<p><a href="../../../people/william_kempf.htm">William E. Kempf</a> was the
|
|
||||||
architect, designer, and implementor of <b>Boost.Threads</b>.</p>
|
|
||||||
|
|
||||||
<p>Important contributions were also made by Jeremy Siek (lots of input on
|
|
||||||
the design and on the implementation), Alexander Terekhov (lots of input on
|
|
||||||
the Win32 implementation, especially in regards to boost::condition, as well
|
|
||||||
as a lot of explanation of POSIX behavior), Greg Colvin (lots of input on the
|
|
||||||
design), and Paul Mclachlan, Thomas Matelich and Iain Hanson (for help in
|
|
||||||
trying to get the build to work on other platforms).</p>
|
|
||||||
|
|
||||||
<p>The documentation was written by William E. Kempf. Beman Dawes provided
|
|
||||||
additional documentation material and editing.</p>
|
|
||||||
|
|
||||||
<p>Discussions on the boost.org mailing list were essential in the development
|
|
||||||
of <b>Boost.Threads</b>. As of August 1, 2001, participants included Alan Griffiths,
|
|
||||||
Albrecht Fritzsche, Aleksey Gurtovoy, Alexander Terekhov, Andrew Green, Andy Sawyer,
|
|
||||||
Asger Alstrup Nielsen, Beman Dawes, Bill Klein, Bill Rutiser, Bill Wade, Branko
|
|
||||||
Èibej, Brent Verner, Craig Henderson, Csaba Szepesvari, Dale Peakall, Damian
|
|
||||||
Dixon, Dan Nuffer, Darryl Green, Daryle Walker, David Abrahams, David Allan
|
|
||||||
Finch, Dejan Jelovic, Dietmar Kuehl, Doug Gregor, Douglas Gregor, Duncan Harris,
|
|
||||||
Ed Brey, Eric Swanson, Eugene Karpachov, Fabrice Truillot, Frank
|
|
||||||
Gerlach, Gary Powell, Gernot Neppert, Geurt Vos, Ghazi Ramadan, Greg Colvin,
|
|
||||||
Gregory Seidman, HYS, Iain Hanson, Ian Bruntlett, J Panzer, Jeff Garland, Jeff
|
|
||||||
Paquette, Jens Maurer, Jeremy Siek, Jesse Jones, Joe Gottman, John (EBo) David,
|
|
||||||
John Bandela, John Maddock, John Max Skaller, John Panzer, Jon Jagger , Karl
|
|
||||||
Nelson, Kevlin Henney, KG Chandrasekhar, Levente Farkas, Lie-Quan Lee, Lois
|
|
||||||
Goldthwaite, Luis Pedro Coelho, Marc Girod, Mark A. Borgerding, Mark Rodgers,
|
|
||||||
Marshall Clow, Matthew Austern, Matthew Hurd, Michael D. Crawford, Michael H.
|
|
||||||
Cox , Mike Haller, Miki Jovanovic, Nathan Myers, Paul Moore, Pavel Cisler, Peter
|
|
||||||
Dimov, Petr Kocmid, Philip Nash, Rainer Deyke, Reid Sweatman, Ross Smith, Scott
|
|
||||||
McCaskill, Shalom Reich , Steve Cleary, Steven Kirk, Thomas Holenstein, Thomas
|
|
||||||
Matelich, Trevor Perrin, Valentin Bonnard, Vesa Karvonen, Wayne Miller, and
|
|
||||||
William Kempf.</p>
|
|
||||||
|
|
||||||
<p>Apologies for anyone inadvertently missed.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->29 August, 2001<!--webbot bot="Timestamp" endspan i-checksum="34360" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p>©<i> Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
|
|
||||||
</html>
|
|
||||||
23
doc/acknowledgements.qbk
Normal file
23
doc/acknowledgements.qbk
Normal file
@@ -0,0 +1,23 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2007-8 Anthony Williams.
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[section:acknowledgements Acknowledgments]
|
||||||
|
|
||||||
|
The original implementation of __boost_thread__ was written by William Kempf, with contributions from numerous others. This new
|
||||||
|
version initially grew out of an attempt to rewrite __boost_thread__ to William Kempf's design with fresh code that could be
|
||||||
|
released under the Boost Software License. However, as the C++ Standards committee have been actively discussing standardizing a
|
||||||
|
thread library for C++, this library has evolved to reflect the proposals, whilst retaining as much backwards-compatibility as
|
||||||
|
possible.
|
||||||
|
|
||||||
|
Particular thanks must be given to Roland Schwarz, who contributed a lot of time and code to the original __boost_thread__ library,
|
||||||
|
and who has been actively involved with the rewrite. The scheme for dividing the platform-specific implementations into separate
|
||||||
|
directories was devised by Roland, and his input has contributed greatly to improving the quality of the current implementation.
|
||||||
|
|
||||||
|
Thanks also must go to Peter Dimov, Howard Hinnant, Alexander Terekhov, Chris Thomasson and others for their comments on the
|
||||||
|
implementation details of the code.
|
||||||
|
|
||||||
|
[endsect]
|
||||||
72
doc/barrier.qbk
Normal file
72
doc/barrier.qbk
Normal file
@@ -0,0 +1,72 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2007-8 Anthony Williams.
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[section:barriers Barriers]
|
||||||
|
|
||||||
|
A barrier is a simple concept. Also known as a ['rendezvous], it is a synchronization point between multiple threads. The barrier is
|
||||||
|
configured for a particular number of threads (`n`), and as threads reach the barrier they must wait until all `n` threads have
|
||||||
|
arrived. Once the `n`-th thread has reached the barrier, all the waiting threads can proceed, and the barrier is reset.
|
||||||
|
|
||||||
|
[section:barrier Class `barrier`]
|
||||||
|
|
||||||
|
#include <boost/thread/barrier.hpp>
|
||||||
|
|
||||||
|
class barrier
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
barrier(unsigned int count);
|
||||||
|
~barrier();
|
||||||
|
|
||||||
|
bool wait();
|
||||||
|
};
|
||||||
|
|
||||||
|
Instances of __barrier__ are not copyable or movable.
|
||||||
|
|
||||||
|
[heading Constructor]
|
||||||
|
|
||||||
|
barrier(unsigned int count);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Construct a barrier for `count` threads.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error occurs.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[heading Destructor]
|
||||||
|
|
||||||
|
~barrier();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Precondition:] [No threads are waiting on `*this`.]]
|
||||||
|
|
||||||
|
[[Effects:] [Destroys `*this`.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[heading Member function `wait`]
|
||||||
|
|
||||||
|
bool wait();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Block until `count` threads have called `wait` on `*this`. When the `count`-th thread calls `wait`, all waiting threads
|
||||||
|
are unblocked, and the barrier is reset. ]]
|
||||||
|
|
||||||
|
[[Returns:] [`true` for exactly one thread from each batch of waiting threads, `false` otherwise.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error occurs.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
@@ -1,145 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=windows-1252">
|
|
||||||
<meta name="GENERATOR" content="Microsoft FrontPage 4.0">
|
|
||||||
<meta name="ProgId" content="FrontPage.Editor.Document">
|
|
||||||
<title>Boost.Threads Bibliography</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" text="#000000">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">Bibliography</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
<h2>Bibliography</h2>
|
|
||||||
<table border="0" cellpadding="5" width="777">
|
|
||||||
<tr>
|
|
||||||
<td width="102" valign="top" align="left"><b>[<a name="Andrews-83">Andrews
|
|
||||||
83</a>]</b></td>
|
|
||||||
<td width="645">
|
|
||||||
Gregory R. Andrews, Fred B. Schneider, <cite>Concepts and Notations for Concurrent
|
|
||||||
Programming</cite>, ACM Computing Surveys, Vol. 15, No. 1, March, 1983. <a href="http://www.acm.org/pubs/citations/journals/surveys/1983-15-1/p3-andrews/">http://www.acm.org/pubs/citations/journals/surveys/1983-15-1/p3-andrews/</a>
|
|
||||||
<p>Good general background reading. Includes descriptions of Path
|
|
||||||
Expressions, Message Passing, and Remote Procedure Call in addition to the
|
|
||||||
basics.
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td width="102" valign="top" align="left"><b>[<a name="Boost">Boost</a>]</b></td>
|
|
||||||
<td width="645">
|
|
||||||
The <cite> Boost</cite> world-wide web site. <a href="http://www.boost.org">http://www.boost.org</a>
|
|
||||||
<p>Boost.Threads is one of many Boost libraries. The Boost web site
|
|
||||||
includes a great deal of documentation and general information which applies to
|
|
||||||
all Boost libraries. Current copies of the libraries including documentation and
|
|
||||||
test programs may be downloaded from the web site.
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td width="102" valign="top" align="left"><b>[<a name="Brinch-Hansen-73">Brinch
|
|
||||||
Hansen 73</a>]</b></td>
|
|
||||||
<td width="645">
|
|
||||||
Per Brinch Hansen, <cite>Concurrent Programming Concepts</cite>, ACM Computing
|
|
||||||
Surveys, Vol. 5, No. 4, December, 1973. <a href="http://www.acm.org/pubs/articles/journals/surveys/1973-5-4/p223-hansen/p223-hansen.pdf">http://www.acm.org/pubs/articles/journals/surveys/1973-5-4/p223-hansen/</a>
|
|
||||||
<p>"This paper describes the evolution of language features for
|
|
||||||
multiprogramming from event queues and semaphores to critical regions and
|
|
||||||
monitors." Includes analysis of why <i>events</i> are considered
|
|
||||||
error-prone. Also noteworthy because of an introductory quotation from
|
|
||||||
Christopher Alexander; Brinch Hansen was years ahead of others in recognizing
|
|
||||||
pattern concepts applied to software too.
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td width="102" valign="top" align="left"><b>]<a name="Butenhof-97">Butenhof
|
|
||||||
97</a>]</b></td>
|
|
||||||
<td width="645">
|
|
||||||
<p> David R. Butenhof, <cite>Programming with
|
|
||||||
POSIX Threads</cite>, Addison-Wesley 1997, ISBN 0-201-63392-2 <a href="http://cseng.aw.com/book/0,3828,0201633922,00.html">http://cseng.aw.com/book/0,3828,0201633922,00.html</a></p>
|
|
||||||
<p>This is a very readable explanation of threads and how to use them. Many
|
|
||||||
of the insights given apply to all multi-threaded programming, not just POSIX
|
|
||||||
Threads.</p>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td width="102" valign="top" align="left"><b>[<a name="Hoare-74">Hoare 74</a>]</b></td>
|
|
||||||
<td width="645">
|
|
||||||
<p>C.A.R Hoare, <cite> Monitors: An Operating System Structuring Concept</cite>,
|
|
||||||
Communications of the ACM, Vol. 17, No. 10. October
|
|
||||||
1974, pp. 549-557 <a href="http://www.acm.org/classics/feb96/">http://www.acm.org/classics/feb96/ </a></p>
|
|
||||||
<p>Hoare and Brinch Hansen's work on Monitors is the basis for reliable
|
|
||||||
multi-threading patterns. This is one of the most often referenced papers in
|
|
||||||
all of computer science, and with good reason.</p>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td width="102" valign="top" align="left"><b>[<a name="ISO-98">ISO 98</a>]</b></td>
|
|
||||||
<td width="645">
|
|
||||||
<p>ISO/IEC 14882:1998(E) <cite> Programming Language C++</cite> <a href="http://www.ansi.org">http://www.ansi.org</a></p>
|
|
||||||
<p>This is the official C++ Standards
|
|
||||||
document. Available from the ANSI (American
|
|
||||||
National Standards Institute) Electronic Standards Store.</p>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td width="102" valign="top" align="left"><b>[<a name="McDowell-89">McDowell
|
|
||||||
89</a>]</b></td>
|
|
||||||
<td width="645">
|
|
||||||
Charles E McDowell, David P. Helmbold, <cite>Debugging Concurrent Programs</cite>,
|
|
||||||
ACM Computing Surveys, Vol. 21, No. 2, December, 1989. <a href="http://www.acm.org/pubs/citations/journals/surveys/1989-21-4/p593-mcdowell/">http://www.acm.org/pubs/citations/journals/surveys/1989-21-4/p593-mcdowell/</a>
|
|
||||||
<p>Identifies many of the unique failure modes and debugging difficulties
|
|
||||||
associated with concurrent programs.
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td width="102" valign="top" align="left"> <b>[<a name="Schmidt">Schmidt</a>] </b></td>
|
|
||||||
<td width="645">
|
|
||||||
<p> Douglas C. Schmidt and Irfan Pyarali, <cite>Strategies for
|
|
||||||
Implementing POSIX Condition Variables on Win32</cite>, Department of Computer Science, Washington University, St. Louis, Missouri.
|
|
||||||
<a href="http://www.cs.wustl.edu/~schmidt/win32-cv-1.html">http://www.cs.wustl.edu/~schmidt/win32-cv-1.html</a></p>
|
|
||||||
<p>Rationale for understanding Boost.Threads condition variables. Note that Alexander Terekhov found some bugs in
|
|
||||||
the implementation given in this article, so pthreads-win32 and Boost.Threads
|
|
||||||
are even more complicated yet.</p>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td width="102" valign="top" align="left"> <b>[<a name="Schmidt-00">Schmidt
|
|
||||||
00</a>] </b></td>
|
|
||||||
<td width="645">
|
|
||||||
<p> Douglas C. Schmidt, Michael Stal, Hans Rohnert and Frank Buschmann, <cite>Pattern-Oriented Software Architecture Volume 2 - Patterns for
|
|
||||||
Concurrent and Networked Objects</cite>, Wiley 2000, ISBN 0-471-60695-2 <a href="http://www.wiley.com/Corporate/Website/Objects/Products/0,9049,104671,00.html">http://www.wiley.com/Corporate/Website/Objects/Products/0,9049,104671,00.html</a></p>
|
|
||||||
<p>This is a very good explanation of how to apply several patterns useful for concurrent programming.
|
|
||||||
Among the patterns documented is the Monitor Pattern mentioned frequently in the <b>Boost.Threads</b>
|
|
||||||
documentation.</p>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td width="102" valign="top" align="left"> <b>[<a name="Stroustrup-00">Stroustrup
|
|
||||||
00</a>]</b></td>
|
|
||||||
<td width="645">
|
|
||||||
Bjarne Stroustrup, <cite> The C++ Programming Language</cite>, Special Edition, Addison-Wesley
|
|
||||||
2000, ISBN 0-201-70073-5 <a href="http://cseng.aw.com/book/0,3828,0201700735,00.html">http://cseng.aw.com/book/0,3828,0201700735,00.html</a>
|
|
||||||
<p>The first book a C++ programmer should own. Note that the 3rd edition
|
|
||||||
(and subsequent editions like the Special Edition) has been rewritten to cover
|
|
||||||
the ISO standard language and library.
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
<p>Note: The URL's above are provided in plain text form so that they will be visible
|
|
||||||
on printed copies of this document.</p>
|
|
||||||
<hr>
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %b %Y" startspan -->17 Aug 2001<!--webbot bot="Timestamp" endspan i-checksum="14763" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p>© Copyright Beman Dawes, 2001</p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
|
|
||||||
</html>
|
|
||||||
@@ -1,128 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, Boost.Threads, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, call_once</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">call_once</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><A href="#Introduction">Introduction</A><br>
|
|
||||||
<A href="#Header">Header</A><br>
|
|
||||||
<A href="#Synopsis">Synopsis</A><br>
|
|
||||||
<A href="#Members">Members</A><br>
|
|
||||||
<A href="#Example">Example</A></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>The <code>call_once</code> routine and <code>once_flag</code> type can be used to
|
|
||||||
run a routine exactly once. This can be used to initialize data in a
|
|
||||||
<a href="definitions.html#Thread-safe">thread-safe</a> manner.</p>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/once.hpp"><boost/thread/once.hpp></a>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Synopsis">Synopsis</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost {
|
|
||||||
|
|
||||||
typedef <i>[implementation defined]</i> once_flag;
|
|
||||||
const once_flag once_init = <i>[implementation defined]</i>;
|
|
||||||
void call_once(void (*func)(), once_flag& flag);
|
|
||||||
|
|
||||||
} // namespace boost
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Reference">Reference</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>once_flag</h3>
|
|
||||||
|
|
||||||
<p>This implementation defined type is used as a flag to insure a routine is called only once.
|
|
||||||
Instances of this type should be statically initialized to <code>once_init</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>once_init</h3>
|
|
||||||
|
|
||||||
<p>This is a constant value used to initialize <code>once_flag</code> instances
|
|
||||||
to indicate that the logically associated routine has not been run yet.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>call_once</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void call_once(void (*func)(), once_flag& flag);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> The function <code>func</code> shall not throw exceptions.</p>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> As if (in an atomic fashion)</p>
|
|
||||||
|
|
||||||
<code>
|
|
||||||
if (flag == once_init)<br>
|
|
||||||
func();
|
|
||||||
</code>
|
|
||||||
|
|
||||||
<p><b>Postcondition:</b> <code>flag</code> != <code>once_init</code></p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h2><a name="Example">Example Usage</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/thread.hpp"><boost/thread/thread.hpp></a>
|
|
||||||
#include <a href="../../../boost/thread/tss.hpp"><boost/thread/once.hpp></a>
|
|
||||||
#include <cassert>
|
|
||||||
|
|
||||||
int value=0;
|
|
||||||
boost::once_flag once = boost::once_init;
|
|
||||||
|
|
||||||
void init()
|
|
||||||
{
|
|
||||||
++value;
|
|
||||||
}
|
|
||||||
|
|
||||||
void thread_proc()
|
|
||||||
{
|
|
||||||
boost::call_once(&init, once);
|
|
||||||
}
|
|
||||||
|
|
||||||
int main(int argc, char* argv[])
|
|
||||||
{
|
|
||||||
boost::thread_group threads;
|
|
||||||
for (int i=0; i<5; ++i)
|
|
||||||
threads.create_thread(&thread_proc);
|
|
||||||
threads.join_all();
|
|
||||||
assert(value == 1);
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->13 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39334" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
176
doc/changes.qbk
Normal file
176
doc/changes.qbk
Normal file
@@ -0,0 +1,176 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2007-11 Anthony Williams.
|
||||||
|
(C) Copyright 2011-12 Vicente J. Botet Escriba.
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[section:changes History]
|
||||||
|
|
||||||
|
[heading Version 2.0.0 - boost 1.50]
|
||||||
|
|
||||||
|
New Features:
|
||||||
|
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/2741 #2741] Proposal to manage portable and non portable thread attributes.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6195 #6195] c++11 compliance: Provide the standard time related interface using Boost.Chrono.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6224 #6224] c++11 compliance: Add the use of standard noexcept on compilers supporting them.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6226 #6226] c++11 compliance: Add explicit bool conversion from locks.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6230 #6230] c++11 compliance: Follows the exception reporting mechanism as defined in the c++11.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6272 #6272] c++11 compliance: Add thread::id hash specialization.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6273 #6273] c++11 compliance: Add cv_status enum class and use it on the conditions wait functions.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6194 #6194] Adapt to Boost.Move.
|
||||||
|
|
||||||
|
Fixed Bugs:
|
||||||
|
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/2575 #2575] Bug- Boost 1.36.0 on Itanium platform.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/4921 #4921] BOOST_THREAD_USE_DLL and BOOST_THREAD_USE_LIB are crucial and need to be documented.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/5013 #5013] documentation: boost::thread: pthreas_exit causes terminate().
|
||||||
|
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/5351 #5351] interrupt a future get boost::unknown_exception.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/5516 #5516] Upgrade lock is not acquired when previous upgrade lock releases if another read lock is present.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/5990 #5990] shared_future<T>::get() has wrong return type.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6174 #6174] packaged_task doesn't correctly handle moving results.
|
||||||
|
|
||||||
|
[/
|
||||||
|
|
||||||
|
Deprecated features since boost 1.50 available only until boost 1.55:
|
||||||
|
|
||||||
|
These deprecated features will be provided by default up to boost 1.52. If you don't want to include the deprecated features you could define BOOST_THREAD_DONT_PROVIDE_DEPRECATED_FEATURES_SINCE_V2_0_0. Since 1.53 these features will not be included any more by default. Since this version, if you want to include the deprecated features yet you could define BOOST_THREAD_PROVIDE_DEPRECATED_FEATURES_SINCE_V2_0_0. These deprecated features will be only available until boost 1.55, that is you have 1 year and a half to move to the new features.
|
||||||
|
|
||||||
|
* Time related functions don't using the Boost.Chrono library, use the chrono overloads instead.
|
||||||
|
|
||||||
|
Breaking changes:
|
||||||
|
|
||||||
|
There are some new features which share the same interface but with different behavior. These breaking features are not provided by default when BOOST_THREAD_VERSION is 2, but the user can however choose the version 1 behavior by defining the corresponding macro. As for the deprecated features, these broken features will be only available until boost 1.55.
|
||||||
|
|
||||||
|
* #6266 c++11 compliance: thread destructor should call terminate if joinable
|
||||||
|
* #6269 c++11 compliance: thread move assignment should call terminate if joinable
|
||||||
|
]
|
||||||
|
|
||||||
|
[heading boost 1.49]
|
||||||
|
|
||||||
|
Fixed Bugs:
|
||||||
|
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/2309 #2309] Lack of g++ symbol visibility support in Boost.Thread.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/2639 #2639] documentation should be extended(defer_lock, try_to_lock, ...).
|
||||||
|
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/3639 #3639] Boost.Thread doesn't build with Sun-5.9 on Linux.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/3762 #3762] Thread can't be compiled with winscw (Codewarrior by Nokia).
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/3885 #3885] document about mix usage of boost.thread and native thread api.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/3975 #3975] Incorrect precondition for promise::set_wait_callback().
|
||||||
|
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/4048 #4048] thread::id formatting involves locale
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/4315 #4315] gcc 4.4 Warning: inline ... declared as dllimport: attribute ignored.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/4480 #4480] OpenVMS patches for compiler issues workarounds.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/4819 #4819] boost.thread's documentation misprints.
|
||||||
|
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/5423 #5423] thread issues with C++0x.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/5617 #5617] boost::thread::id copy ctor.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/5739 #5739] set-but-not-used warnings with gcc-4.6.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/5826 #5826] threads.cpp: resource leak on threads creation failure.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/5839 #5839] thread.cpp: ThreadProxy leaks on exceptions.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/5859 #5859] win32 shared_mutex constructor leaks on exceptions.
|
||||||
|
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6100 #6100] Compute hardware_concurrency() using get_nprocs() on GLIBC systems.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6168 #6168] recursive_mutex is using wrong config symbol (possible typo).
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6175 #6175] Compile error with SunStudio.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6200 #6200] patch to have condition_variable and mutex error better handle EINTR.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6207 #6207] shared_lock swap compiler error on clang 3.0 c++11.
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/6208 #6208] try_lock_wrapper swap compiler error on clang 3.0 c++11.
|
||||||
|
|
||||||
|
[heading Changes since boost 1.40]
|
||||||
|
|
||||||
|
The 1.41.0 release of Boost adds futures to the thread library. There are also a few minor changes.
|
||||||
|
|
||||||
|
[heading Changes since boost 1.35]
|
||||||
|
|
||||||
|
The 1.36.0 release of Boost includes a few new features in the thread library:
|
||||||
|
|
||||||
|
* New generic __lock_multiple_ref__ and __try_lock_multiple_ref__ functions for locking multiple mutexes at once.
|
||||||
|
|
||||||
|
* Rvalue reference support for move semantics where the compilers supports it.
|
||||||
|
|
||||||
|
* A few bugs fixed and missing functions added (including the serious win32 condition variable bug).
|
||||||
|
|
||||||
|
* `scoped_try_lock` types are now backwards-compatible with Boost 1.34.0 and previous releases.
|
||||||
|
|
||||||
|
* Support for passing function arguments to the thread function by supplying additional arguments to the __thread__ constructor.
|
||||||
|
|
||||||
|
* Backwards-compatibility overloads added for `timed_lock` and `timed_wait` functions to allow use of `xtime` for timeouts.
|
||||||
|
|
||||||
|
[heading Changes since boost 1.34]
|
||||||
|
|
||||||
|
Almost every line of code in __boost_thread__ has been changed since the 1.34 release of boost. However, most of the interface
|
||||||
|
changes have been extensions, so the new code is largely backwards-compatible with the old code. The new features and breaking
|
||||||
|
changes are described below.
|
||||||
|
|
||||||
|
[heading New Features]
|
||||||
|
|
||||||
|
* Instances of __thread__ and of the various lock types are now movable.
|
||||||
|
|
||||||
|
* Threads can be interrupted at __interruption_points__.
|
||||||
|
|
||||||
|
* Condition variables can now be used with any type that implements the __lockable_concept__, through the use of
|
||||||
|
`boost::condition_variable_any` (`boost::condition` is a `typedef` to `boost::condition_variable_any`, provided for backwards
|
||||||
|
compatibility). `boost::condition_variable` is provided as an optimization, and will only work with
|
||||||
|
`boost::unique_lock<boost::mutex>` (`boost::mutex::scoped_lock`).
|
||||||
|
|
||||||
|
* Thread IDs are separated from __thread__, so a thread can obtain it's own ID (using `boost::this_thread::get_id()`), and IDs can
|
||||||
|
be used as keys in associative containers, as they have the full set of comparison operators.
|
||||||
|
|
||||||
|
* Timeouts are now implemented using the Boost DateTime library, through a typedef `boost::system_time` for absolute timeouts, and
|
||||||
|
with support for relative timeouts in many cases. `boost::xtime` is supported for backwards compatibility only.
|
||||||
|
|
||||||
|
* Locks are implemented as publicly accessible templates `boost::lock_guard`, `boost::unique_lock`, `boost::shared_lock`, and
|
||||||
|
`boost::upgrade_lock`, which are templated on the type of the mutex. The __lockable_concept__ has been extended to include publicly
|
||||||
|
available __lock_ref__ and __unlock_ref__ member functions, which are used by the lock types.
|
||||||
|
|
||||||
|
[heading Breaking Changes]
|
||||||
|
|
||||||
|
The list below should cover all changes to the public interface which break backwards compatibility.
|
||||||
|
|
||||||
|
* __try_mutex__ has been removed, and the functionality subsumed into __mutex__. __try_mutex__ is left as a `typedef`,
|
||||||
|
but is no longer a separate class.
|
||||||
|
|
||||||
|
* __recursive_try_mutex__ has been removed, and the functionality subsumed into
|
||||||
|
__recursive_mutex__. __recursive_try_mutex__ is left as a `typedef`, but is no longer a separate class.
|
||||||
|
|
||||||
|
* `boost::detail::thread::lock_ops` has been removed. Code that relies on the `lock_ops` implementation detail will no longer work,
|
||||||
|
as this has been removed, as it is no longer necessary now that mutex types now have public __lock_ref__ and __unlock_ref__ member
|
||||||
|
functions.
|
||||||
|
|
||||||
|
* `scoped_lock` constructors with a second parameter of type `bool` are no longer provided. With previous boost releases,
|
||||||
|
``boost::mutex::scoped_lock some_lock(some_mutex,false);`` could be used to create a lock object that was associated with a mutex,
|
||||||
|
but did not lock it on construction. This facility has now been replaced with the constructor that takes a
|
||||||
|
`boost::defer_lock_type` as the second parameter: ``boost::mutex::scoped_lock some_lock(some_mutex,boost::defer_lock);``
|
||||||
|
|
||||||
|
* The `locked()` member function of the `scoped_lock` types has been renamed to __owns_lock_ref__.
|
||||||
|
|
||||||
|
* You can no longer obtain a __thread__ instance representing the current thread: a default-constructed __thread__ object is not
|
||||||
|
associated with any thread. The only use for such a thread object was to support the comparison operators: this functionality has
|
||||||
|
been moved to __thread_id__.
|
||||||
|
|
||||||
|
* The broken `boost::read_write_mutex` has been replaced with __shared_mutex__.
|
||||||
|
|
||||||
|
* __mutex__ is now never recursive. For Boost releases prior to 1.35 __mutex__ was recursive on Windows and not on POSIX platforms.
|
||||||
|
|
||||||
|
* When using a __recursive_mutex__ with a call to [cond_any_wait_link `boost::condition_variable_any::wait()`], the mutex is only
|
||||||
|
unlocked one level, and not completely. This prior behaviour was not guaranteed and did not feature in the tests.
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:future Future]
|
||||||
|
|
||||||
|
The following features will be included in next releases. By order of priority:
|
||||||
|
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/4710 #4710] Missing async().
|
||||||
|
* Lock guards
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/1850 #1850] request for unlock_guard (and/or unique_unlock) to compliment lock_guard/unique_lock
|
||||||
|
* [@http://svn.boost.org/trac/boost/ticket/3567 #3567] Request for shared_lock_guard
|
||||||
|
* #2880 Request for Thread scheduler support for boost ..
|
||||||
|
* #3696 Boost Thread library lacks any way to set priority of threads
|
||||||
|
* #5956 Add optional stack_size argument to thread::start_thread()
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
101
doc/compliance.qbk
Normal file
101
doc/compliance.qbk
Normal file
@@ -0,0 +1,101 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2011-12 Vicente J. Botet Escriba.
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[section:compliance Compliance with standard]
|
||||||
|
|
||||||
|
[section:cpp11 C++11 standard Thread library]
|
||||||
|
|
||||||
|
|
||||||
|
[table Compliance C++11 standard
|
||||||
|
[[Section] [Description] [Status] [Comments] [Ticket]]
|
||||||
|
[[30] [Thread support library] [Partial] [-] [-]]
|
||||||
|
[[30.1] [General] [-] [-] [-]]
|
||||||
|
[[30.2] [Requirements] [-] [-] [-]]
|
||||||
|
[[30.2.1] [Template parameter names] [-] [-] [-]]
|
||||||
|
[[30.2.2] [Exceptions] [Yes] [-] [#6230]]
|
||||||
|
[[30.2.3] [Native handles] [Yes] [-] [-]]
|
||||||
|
[[30.2.4] [Timing specifications] [Yes] [-] [#6195]]
|
||||||
|
[[30.2.5] [Requirements for Lockable types] [Partial] [-] [-]]
|
||||||
|
[[30.2.5.1] [In general] [-] [-] [-]]
|
||||||
|
[[30.2.5.2] [BasicLockable requirements] [No] [-] [#6231]]
|
||||||
|
[[30.2.5.3] [Lockable requirements] [yes] [-] [-]]
|
||||||
|
[[30.2.5.4] [TimedLockable requirements] [Yes] [-] [#6195]]
|
||||||
|
[[30.2.6] [decay_copy] [-] [-] [-]]
|
||||||
|
[[30.3] [Threads] [Partial] [-] [-]]
|
||||||
|
[[30.3.1] [Class thread] [Partial] [move,terminate] [-]]
|
||||||
|
[[30.3.1.1] [Class thread::id] [Yes] [-] [#6224,#6272]]
|
||||||
|
[[30.3.1.2] [thread constructors] [Partial] [move] [#6224,#6194, #6270]]
|
||||||
|
[[30.3.1.3] [thread destructor] [Partial] [terminate] [#6266]]
|
||||||
|
[[30.3.1.4] [thread assignment] [Partial] [move, terminate] [#6269]]
|
||||||
|
[[30.3.1.5] [thread members] [Yes] [-] [#6224,#6195]]
|
||||||
|
[[30.3.1.6] [thread static members] [Yes] [-] [#6224]]
|
||||||
|
[[30.3.1.7] [thread specialized algorithms] [Yes] [-] [-]]
|
||||||
|
|
||||||
|
[[30.3.2] [Namespace this_thread] [Yes] [-] [#6195]]
|
||||||
|
[[30.4] [Mutual exclusion] [Partial] [move] [-]]
|
||||||
|
[[30.4.1] [Mutex requirements] [Yes] [-] [-]]
|
||||||
|
[[30.4.1.1] [In general] [Yes] [-] [-]]
|
||||||
|
[[30.4.1.2] [Mutex types] [Yes] [-] [#6224,#6225]]
|
||||||
|
[[30.4.1.2.1] [Class mutex] [Yes] [-] [#6224,#6225]]
|
||||||
|
[[30.4.1.2.2] [Class recursive_mutex] [Yes] [-] [#6224,#6225]]
|
||||||
|
[[30.4.1.3] [Timed mutex types] [Yes] [-] [#6224,#6195,#6225]]
|
||||||
|
[[30.4.1.3.1] [Class timed_mutex] [Yes] [-] [#6224,#6195,#6225]]
|
||||||
|
[[30.4.1.3.1] [Class recursive_timed_mutex] [Yes] [-] [#6224,#6195,#6225]]
|
||||||
|
[[30.4.2] [Locks] [Partial] [move] [#6224,#6195,#6225,#6227]]
|
||||||
|
[[30.4.2.1] [Class template lock_guard] [Yes] [-] [#6225]]
|
||||||
|
[[30.4.2.2] [Class template unique_lock] [Yes] [move] [#6224,#6195,#6225,#6227]]
|
||||||
|
[[30.4.2.2.1] [unique_lock constructors, destructor, and assignment] [Partial] [move] [#6224,#6195,#6225,#6227]]
|
||||||
|
[[30.4.2.2.2] [unique_lock locking] [Yes] [-] [#6195]]
|
||||||
|
[[30.4.2.2.3] [unique_lock modifiers] [Yes] [-] [-]]
|
||||||
|
[[30.4.2.2.4] [unique_lock observers] [Yes] [] [#6227]]
|
||||||
|
[[30.4.3] [Generic locking algorithms] [Partial] [variadic] [#6227]]
|
||||||
|
[[30.4.4] [Call once] [Partial] [move,variadic,] [#6194,#7]]
|
||||||
|
[[30.4.4.1] [Struct once_flag] [Partial] [interface] [#xx]]
|
||||||
|
[[30.4.4.2] [Function call_once] [Partial] [move,variadic,interface] [#xx]]
|
||||||
|
[[30.5] [Condition variables] [Partial] [notify_all_at_thread_exit] [#6195,#6273,#9]]
|
||||||
|
[[30.5 6-10] [Function notify_all_at_thread_exit] [No] [-] [#9]]
|
||||||
|
[[30.5.1] [Class condition_variable] [Yes] [-] [#6195,#6273]]
|
||||||
|
[[30.5.2] [Class condition_variable_any] [Yes] [-] [#6195,#6273]]
|
||||||
|
[[30.6] [Futures] [Partial] [-] [-]]
|
||||||
|
[[30.6.1] [Overview] [Partial] [-] [-]]
|
||||||
|
[[30.6.2] [Error handling] [No] [-] [-]]
|
||||||
|
[[30.6.3] [Class future_error] [No] [-] [-]]
|
||||||
|
[[30.6.4] [Shared state] [No] [-] [-]]
|
||||||
|
[[30.6.5] [Class template promise] [Partial] [allocator,move] [#6228,#6194,#6225]]
|
||||||
|
[[30.6.6] [Class template future] [No] [unique_future is the closest to future] [##6229,#6228]]
|
||||||
|
[[30.6.7] [Class template shared_future] [Partial] [allocator,move] [#6228,#6194,#6225]]
|
||||||
|
[[30.6.8] [Function template async] [No] [async] [#4710]]
|
||||||
|
[[30.6.8] [Class template packaged_task] [Partial] [move] [#6194]]
|
||||||
|
]
|
||||||
|
|
||||||
|
[/
|
||||||
|
[table Extension
|
||||||
|
[[Section] [Description] [Comments]]
|
||||||
|
[[30.3.1.5.x] [interrupt] [-]]
|
||||||
|
[[30.3.2.x] [Interruption] [-]]
|
||||||
|
[[30.3.2.y] [at_thread_exit] [-]]
|
||||||
|
[[30.4.3.x] [Generic locking algorithms begin/end] [-]]
|
||||||
|
[[30.x] [Barriers] [-]]
|
||||||
|
[[30.y] [Thread Local Storage] [-]]
|
||||||
|
[[30.z] [Class thread_group] [-]]
|
||||||
|
]
|
||||||
|
]
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[/
|
||||||
|
[section:shared Shared Mutex library extension]
|
||||||
|
|
||||||
|
[table Clock Requirements
|
||||||
|
[[Section] [Description] [Status] [Comments]]
|
||||||
|
[[XXXX] [DDDD] [SSSS] [CCCC]]
|
||||||
|
[[XXXX] [DDDD] [SSSS] [CCCC]]
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
@@ -1,333 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, condition</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#ffffff" link="#0000ff" vlink="#800080" text="#000000">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><IMG height=86 alt="C++ Boost" src="../../../c++boost.gif" width=277></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">condition</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><A href="#Introduction">Introduction</a><br>
|
|
||||||
<A href="#Header">Header</a><br>
|
|
||||||
<A href="#Synopsis">Synopsis</a><br>
|
|
||||||
<A href="#Members">Members</a><br>
|
|
||||||
<A href="#Example">Example</a></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>An object of class <code>condition</code> is a synchronization primitive used to
|
|
||||||
cause a thread to wait until a particular shared-data condition (or time) is met.
|
|
||||||
A <code>condition</code> object is always used in conjunction with a mutex
|
|
||||||
object modeling a <a href="mutex_concept.html">Mutex Concept</a>. The mutex must be locked prior to waiting on the
|
|
||||||
<code>condition</code>, which is ensured by passing a lock object modeling a <a href="lock_concept.html">Lock
|
|
||||||
Concept</a> to the <code>condition</code> object's <code>wait</code> functions. While the thread is waiting on the <code>condition</code>
|
|
||||||
object,
|
|
||||||
the mutex associated with the lock is unlocked. When the thread returns
|
|
||||||
from a call to one of the <code>condition</code> object's <code>wait</code> functions,
|
|
||||||
the mutex is again locked. The tricky lock/unlock/lock sequence is performed
|
|
||||||
automatically by the <code>condition</code> object's <code>wait</code>
|
|
||||||
functions.</p>
|
|
||||||
|
|
||||||
<p>The <code>condition</code> type is often used to implement the <i>Monitor Object</i>
|
|
||||||
and other important patterns. See <A href="bibliography.html#Schmidt-00">[Schmidt-00]</a>
|
|
||||||
and <A href="bibliography.html#Hoare-74">[Hoare 74]</a>. Monitors are one of the most
|
|
||||||
important patterns for creating reliable multithreaded programs.</p>
|
|
||||||
|
|
||||||
<p>See <A href="definitions.html">Formal Definitions</a> for definitions of thread
|
|
||||||
states <A href="definitions.html#state">blocked</a> and
|
|
||||||
<A href="definitions.html#state">ready</a>. Note that "waiting" is a synonym
|
|
||||||
for blocked.</p>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <A href="../../../boost/thread/condition.hpp"><boost/thread/condition.hpp></a>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Synopsis">Synopsis</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost {
|
|
||||||
|
|
||||||
class condition : private <A href="../../utility/utility.htm#Class noncopyable">boost::noncopyable</a> // Exposition only.
|
|
||||||
// Class condition meets the <a href="overview.html#NonCopyable">NonCopyable</a> requirement.
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
condition();
|
|
||||||
~condition();
|
|
||||||
|
|
||||||
void notify_one();
|
|
||||||
void notify_all();
|
|
||||||
template <typename <a href="scoped_lock.html">ScopedLock</a>>
|
|
||||||
void wait(<a href="scoped_lock.html">ScopedLock</a>& lock);
|
|
||||||
template <typename <a href="scoped_lock.html">ScopedLock</a>, typename <A href="http://www.sgi.com/tech/stl/Predicate.html">Predicate</A>>
|
|
||||||
void wait(<a href="scoped_lock.html">ScopedLock</a>& lock, <A href="http://www.sgi.com/tech/stl/Predicate.html">Predicate</A> pred);
|
|
||||||
template <typename <a href="scoped_lock.html">ScopedLock</a>>
|
|
||||||
bool timed_wait(<a href="scoped_lock.html">ScopedLock</a>& lock, const xtime& xt);
|
|
||||||
template <typename <a href="scoped_lock.html">ScopedLock</a>, typename <A href="http://www.sgi.com/tech/stl/Predicate.html">Predicate</A>>
|
|
||||||
bool timed_wait(<a href="scoped_lock.html">ScopedLock</a>& lock, const xtime& xt, <A href="http://www.sgi.com/tech/stl/Predicate.html">Predicate</A> pred);
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace boost
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Members">Members</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
condition();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Constructs a <code>condition</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~condition();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Destroys <code>*this</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>notify_one</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void notify_one();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> If there is a thread waiting on <code>*this</code>, change
|
|
||||||
that thread's state to ready. Otherwise there is no effect.</p>
|
|
||||||
|
|
||||||
<p><b>Notes:</b> If more that one thread is waiting on the condition, it is
|
|
||||||
unspecified which is made ready.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>notify_all</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void notify_all();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Change the state of all threads waiting on <code>*this</code>
|
|
||||||
to ready. If there are no waiting threads, <code>notify_all()</code> has no effect.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>wait</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
template <typename ScopedLock>
|
|
||||||
void wait(ScopedLock& lock);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> ScopedLock meets the
|
|
||||||
<A href="lock_concept.html#ScopedLock">ScopedLock</a> requirements.</p>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Releases the lock on the <A href="mutex_concept.html">mutex model</a>
|
|
||||||
associated with <code>lock</code>, blocks the current thread of execution until readied
|
|
||||||
by a call to <code>this->notify_one()</code> or <code>this->notify_all()</code>,
|
|
||||||
and then reacquires the lock. All effects occur in an atomic fashion.</p>
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <code><A href="lock_error.html">lock_error</a></code>
|
|
||||||
if <code>!lock.locked()</code></p>
|
|
||||||
|
|
||||||
<p><b>Danger:</b> This version should always be used within a loop checking that the
|
|
||||||
state logically associated with the <code>condition</code> has become true. Without
|
|
||||||
the loop, race conditions can ensue due to possible "spurious wake ups". The second
|
|
||||||
version encapsulates this loop idiom internally and is generally the preferred method.</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
template <typename ScopedLock, typename Pr>
|
|
||||||
void wait(ScopedLock& lock, Pr pred);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> ScopedLock meets the
|
|
||||||
<A href="lock_concept.html#ScopedLock">ScopedLock</a> requirements, return from
|
|
||||||
<code>pred()</code> convertible to bool.</p>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> As if:</p>
|
|
||||||
|
|
||||||
<code>
|
|
||||||
while (!pred()) wait(lock)
|
|
||||||
</code>
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <code><A href="lock_error.html">lock_error</a></code> if
|
|
||||||
<code>!lock.locked()</code></p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>timed_wait</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
template <typename ScopedTimedLock>
|
|
||||||
bool timed_wait(ScopedTimedLock& lock, const <a href="xtime.html">xtime</a>& xt);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> ScopedTimeLock meets the
|
|
||||||
<A href="lock_concept.html#ScopedTimedLock">ScopedTimedLock</a> requirements.</p>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Releases the lock on the <A href="mutex_concept.html">mutex model</a>
|
|
||||||
associated with the <code>lock</code>, blocks the current thread of execution until
|
|
||||||
readied by a call to <code>this->notify_one()</code> or
|
|
||||||
<code>this->notify_all()</code>, or until <code>xt</code>, and then reacquires the
|
|
||||||
lock. All effects occur in an atomic fashion.</p>
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <code><A href="lock_error.html">lock_error</a></code> if
|
|
||||||
<code>!lock.locked()</code></p>
|
|
||||||
|
|
||||||
<p><b>Danger:</b> This version should always be used within a loop checking that the
|
|
||||||
state logically associated with the <code>condition</code> has become true. Without
|
|
||||||
the loop, race conditions can ensue due to "spurious wake ups". The second version
|
|
||||||
encapsulates this loop idiom internally and is generally the preferred method.</p>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> <code>false</code> if <code>xt</code> is reached, otherwise
|
|
||||||
<code>true</code>.</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
template <typename ScopedTimedLock, typename Pr>
|
|
||||||
bool timed_wait(ScopedTimedLock& lock, const <a href="xtime.html">xtime</a>& xt, Pr pred);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Requires: </b>ScopedTimeLock meets the
|
|
||||||
<A href="lock_concept.html#ScopedTimedLock">ScopedTimedLock</a> requirements,
|
|
||||||
return from <code>pred()</code> convertible to bool.</p>
|
|
||||||
|
|
||||||
<p><b>Effects: </b>As if:</p>
|
|
||||||
|
|
||||||
<code>
|
|
||||||
while (!pred())<br>
|
|
||||||
{<br>
|
|
||||||
if (!timed_wait(lock, xt))<br>
|
|
||||||
return false;<br>
|
|
||||||
}
|
|
||||||
</code>
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <code><A href="lock_error.html">lock_error</a></code> if
|
|
||||||
<code>!lock.locked()</code></p>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> <code>false</code> if <code>xt</code> is reached, otherwise
|
|
||||||
<code>true</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2><a name="Example">Example Usage</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <iostream>
|
|
||||||
#include <vector>
|
|
||||||
#include <A href="../../../boost/utility.hpp"><boost/utility.hpp></a>
|
|
||||||
#include <A href="../../../boost/thread/condition.hpp"><boost/thread/condition.hpp></a>
|
|
||||||
#include <A href="../../../boost/thread/thread.hpp"><boost/thread/thread.hpp></a>
|
|
||||||
|
|
||||||
class bounded_buffer : private boost::noncopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef boost::mutex::scoped_lock lock;
|
|
||||||
|
|
||||||
bounded_buffer(int n) : begin(0), end(0), buffered(0), circular_buf(n) { }
|
|
||||||
|
|
||||||
void send (int m) {
|
|
||||||
lock lk(monitor);
|
|
||||||
while (buffered == circular_buf.size())
|
|
||||||
buffer_not_full.wait(lk);
|
|
||||||
circular_buf[end] = m;
|
|
||||||
end = (end+1) % circular_buf.size();
|
|
||||||
++buffered;
|
|
||||||
buffer_not_empty.notify_one();
|
|
||||||
}
|
|
||||||
int receive() {
|
|
||||||
lock lk(monitor);
|
|
||||||
while (buffered == 0)
|
|
||||||
buffer_not_empty.wait(lk);
|
|
||||||
int i = circular_buf[begin];
|
|
||||||
begin = (begin+1) % circular_buf.size();
|
|
||||||
--buffered;
|
|
||||||
buffer_not_full.notify_one();
|
|
||||||
return i;
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
int begin, end, buffered;
|
|
||||||
std::vector<int> circular_buf;
|
|
||||||
boost::condition buffer_not_full, buffer_not_empty;
|
|
||||||
boost::mutex monitor;
|
|
||||||
};
|
|
||||||
|
|
||||||
bounded_buffer buf(2);
|
|
||||||
|
|
||||||
void sender() {
|
|
||||||
int n = 0;
|
|
||||||
while (n < 100) {
|
|
||||||
buf.send(n);
|
|
||||||
std::cout << "sent: " << n << std::endl;
|
|
||||||
++n;
|
|
||||||
}
|
|
||||||
buf.send(-1);
|
|
||||||
}
|
|
||||||
|
|
||||||
void receiver() {
|
|
||||||
int n;
|
|
||||||
do {
|
|
||||||
n = buf.receive();
|
|
||||||
std::cout << "received: " << n << std::endl;
|
|
||||||
} while (n != -1); // -1 indicates end of buffer
|
|
||||||
}
|
|
||||||
|
|
||||||
int main(int, char*[])
|
|
||||||
{
|
|
||||||
boost::thread thrd1(&sender);
|
|
||||||
boost::thread thrd2(&receiver);
|
|
||||||
thrd1.join();
|
|
||||||
thrd2.join();
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>Typical output (dependent on scheduling policies) is:</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
sent: 0
|
|
||||||
sent: 1
|
|
||||||
received: 0
|
|
||||||
received: 1
|
|
||||||
sent: 2
|
|
||||||
sent: 3
|
|
||||||
received: 2
|
|
||||||
received: 3
|
|
||||||
sent: 4
|
|
||||||
received: 4
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->13 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39334" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <A href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
772
doc/condition_variables.qbk
Normal file
772
doc/condition_variables.qbk
Normal file
@@ -0,0 +1,772 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2007-11 Anthony Williams.
|
||||||
|
(C) Copyright 2011-12 Vicente J. Botet Escriba.
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[section:condvar_ref Condition Variables]
|
||||||
|
|
||||||
|
[heading Synopsis]
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
enum class cv_status;
|
||||||
|
{
|
||||||
|
no_timeout,
|
||||||
|
timeout
|
||||||
|
};
|
||||||
|
class condition_variable;
|
||||||
|
class condition_variable_any;
|
||||||
|
}
|
||||||
|
|
||||||
|
The classes `condition_variable` and `condition_variable_any` provide a
|
||||||
|
mechanism for one thread to wait for notification from another thread that a
|
||||||
|
particular condition has become true. The general usage pattern is that one
|
||||||
|
thread locks a mutex and then calls `wait` on an instance of
|
||||||
|
`condition_variable` or `condition_variable_any`. When the thread is woken from
|
||||||
|
the wait, then it checks to see if the appropriate condition is now true, and
|
||||||
|
continues if so. If the condition is not true, then the thread then calls `wait`
|
||||||
|
again to resume waiting. In the simplest case, this condition is just a boolean
|
||||||
|
variable:
|
||||||
|
|
||||||
|
boost::condition_variable cond;
|
||||||
|
boost::mutex mut;
|
||||||
|
bool data_ready;
|
||||||
|
|
||||||
|
void process_data();
|
||||||
|
|
||||||
|
void wait_for_data_to_process()
|
||||||
|
{
|
||||||
|
boost::unique_lock<boost::mutex> lock(mut);
|
||||||
|
while(!data_ready)
|
||||||
|
{
|
||||||
|
cond.wait(lock);
|
||||||
|
}
|
||||||
|
process_data();
|
||||||
|
}
|
||||||
|
|
||||||
|
Notice that the `lock` is passed to `wait`: `wait` will atomically add the
|
||||||
|
thread to the set of threads waiting on the condition variable, and unlock the
|
||||||
|
mutex. When the thread is woken, the mutex will be locked again before the call
|
||||||
|
to `wait` returns. This allows other threads to acquire the mutex in order to
|
||||||
|
update the shared data, and ensures that the data associated with the condition
|
||||||
|
is correctly synchronized.
|
||||||
|
|
||||||
|
In the mean time, another thread sets the condition to `true`, and then calls
|
||||||
|
either `notify_one` or `notify_all` on the condition variable to wake one
|
||||||
|
waiting thread or all the waiting threads respectively.
|
||||||
|
|
||||||
|
void retrieve_data();
|
||||||
|
void prepare_data();
|
||||||
|
|
||||||
|
void prepare_data_for_processing()
|
||||||
|
{
|
||||||
|
retrieve_data();
|
||||||
|
prepare_data();
|
||||||
|
{
|
||||||
|
boost::lock_guard<boost::mutex> lock(mut);
|
||||||
|
data_ready=true;
|
||||||
|
}
|
||||||
|
cond.notify_one();
|
||||||
|
}
|
||||||
|
|
||||||
|
Note that the same mutex is locked before the shared data is updated, but that
|
||||||
|
the mutex does not have to be locked across the call to `notify_one`.
|
||||||
|
|
||||||
|
This example uses an object of type `condition_variable`, but would work just as
|
||||||
|
well with an object of type `condition_variable_any`: `condition_variable_any`
|
||||||
|
is more general, and will work with any kind of lock or mutex, whereas
|
||||||
|
`condition_variable` requires that the lock passed to `wait` is an instance of
|
||||||
|
`boost::unique_lock<boost::mutex>`. This enables `condition_variable` to make
|
||||||
|
optimizations in some cases, based on the knowledge of the mutex type;
|
||||||
|
`condition_variable_any` typically has a more complex implementation than
|
||||||
|
`condition_variable`.
|
||||||
|
|
||||||
|
[section:condition_variable Class `condition_variable`]
|
||||||
|
|
||||||
|
#include <boost/thread/condition_variable.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
class condition_variable
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
condition_variable();
|
||||||
|
~condition_variable();
|
||||||
|
|
||||||
|
void notify_one() noexcept;
|
||||||
|
void notify_all() noexcept;
|
||||||
|
|
||||||
|
void wait(boost::unique_lock<boost::mutex>& lock);
|
||||||
|
|
||||||
|
template<typename predicate_type>
|
||||||
|
void wait(boost::unique_lock<boost::mutex>& lock,predicate_type predicate);
|
||||||
|
|
||||||
|
bool timed_wait(boost::unique_lock<boost::mutex>& lock,boost::system_time const& abs_time); // DEPRECATED V2
|
||||||
|
|
||||||
|
template<typename duration_type>
|
||||||
|
bool timed_wait(boost::unique_lock<boost::mutex>& lock,duration_type const& rel_time); // DEPRECATED V2
|
||||||
|
|
||||||
|
template<typename predicate_type>
|
||||||
|
bool timed_wait(boost::unique_lock<boost::mutex>& lock,boost::system_time const& abs_time,predicate_type predicate); // DEPRECATED V2
|
||||||
|
|
||||||
|
template<typename duration_type,typename predicate_type>
|
||||||
|
bool timed_wait(boost::unique_lock<boost::mutex>& lock,duration_type const& rel_time,predicate_type predicate); // DEPRECATED V2
|
||||||
|
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
typename cv_status::type
|
||||||
|
wait_until(
|
||||||
|
unique_lock<mutex>& lock,
|
||||||
|
const chrono::time_point<Clock, Duration>& t);
|
||||||
|
|
||||||
|
template <class Clock, class Duration, class Predicate>
|
||||||
|
bool
|
||||||
|
wait_until(
|
||||||
|
unique_lock<mutex>& lock,
|
||||||
|
const chrono::time_point<Clock, Duration>& t,
|
||||||
|
Predicate pred);
|
||||||
|
|
||||||
|
template <class Rep, class Period>
|
||||||
|
typename cv_status::type
|
||||||
|
wait_for(
|
||||||
|
unique_lock<mutex>& lock,
|
||||||
|
const chrono::duration<Rep, Period>& d);
|
||||||
|
|
||||||
|
template <class Rep, class Period, class Predicate>
|
||||||
|
bool
|
||||||
|
wait_for(
|
||||||
|
unique_lock<mutex>& lock,
|
||||||
|
const chrono::duration<Rep, Period>& d,
|
||||||
|
Predicate pred);
|
||||||
|
|
||||||
|
// backwards compatibility
|
||||||
|
|
||||||
|
bool timed_wait(boost::unique_lock<boost::mutex>& lock,boost::xtime const& abs_time); // DEPRECATED V2
|
||||||
|
|
||||||
|
template<typename predicate_type>
|
||||||
|
bool timed_wait(boost::unique_lock<boost::mutex>& lock,boost::xtime const& abs_time,predicate_type predicate); // DEPRECATED V2
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
[section:constructor `condition_variable()`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Constructs an object of class `condition_variable`.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error occurs.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:destructor `~condition_variable()`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Precondition:] [All threads waiting on `*this` have been notified by a call to
|
||||||
|
`notify_one` or `notify_all` (though the respective calls to `wait` or
|
||||||
|
`timed_wait` need not have returned).]]
|
||||||
|
|
||||||
|
[[Effects:] [Destroys the object.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:notify_one `void notify_one()`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If any threads are currently __blocked__ waiting on `*this` in a call
|
||||||
|
to `wait` or `timed_wait`, unblocks one of those threads.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:notify_all `void notify_all()`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If any threads are currently __blocked__ waiting on `*this` in a call
|
||||||
|
to `wait` or `timed_wait`, unblocks all of those threads.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait `void wait(boost::unique_lock<boost::mutex>& lock)`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Precondition:] [`lock` is locked by the current thread, and either no other
|
||||||
|
thread is currently waiting on `*this`, or the execution of the `mutex()` member
|
||||||
|
function on the `lock` objects supplied in the calls to `wait` or `timed_wait`
|
||||||
|
in all the threads currently waiting on `*this` would return the same value as
|
||||||
|
`lock->mutex()` for this call to `wait`.]]
|
||||||
|
|
||||||
|
[[Effects:] [Atomically call `lock.unlock()` and blocks the current thread. The
|
||||||
|
thread will unblock when notified by a call to `this->notify_one()` or
|
||||||
|
`this->notify_all()`, or spuriously. When the thread is unblocked (for whatever
|
||||||
|
reason), the lock is reacquired by invoking `lock.lock()` before the call to
|
||||||
|
`wait` returns. The lock is also reacquired by invoking `lock.lock()` if the
|
||||||
|
function exits with an exception.]]
|
||||||
|
|
||||||
|
[[Postcondition:] [`lock` is locked by the current thread.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error
|
||||||
|
occurs. __thread_interrupted__ if the wait was interrupted by a call to
|
||||||
|
__interrupt__ on the __thread__ object associated with the current thread of execution.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait_predicate `template<typename predicate_type> void wait(boost::unique_lock<boost::mutex>& lock, predicate_type pred)`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [As-if ``
|
||||||
|
while(!pred())
|
||||||
|
{
|
||||||
|
wait(lock);
|
||||||
|
}
|
||||||
|
``]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:timed_wait `bool timed_wait(boost::unique_lock<boost::mutex>& lock,boost::system_time const& abs_time)` DEPRECATED V2]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Precondition:] [`lock` is locked by the current thread, and either no other
|
||||||
|
thread is currently waiting on `*this`, or the execution of the `mutex()` member
|
||||||
|
function on the `lock` objects supplied in the calls to `wait` or `timed_wait`
|
||||||
|
in all the threads currently waiting on `*this` would return the same value as
|
||||||
|
`lock->mutex()` for this call to `wait`.]]
|
||||||
|
|
||||||
|
[[Effects:] [Atomically call `lock.unlock()` and blocks the current thread. The
|
||||||
|
thread will unblock when notified by a call to `this->notify_one()` or
|
||||||
|
`this->notify_all()`, when the time as reported by `boost::get_system_time()`
|
||||||
|
would be equal to or later than the specified `abs_time`, or spuriously. When
|
||||||
|
the thread is unblocked (for whatever reason), the lock is reacquired by
|
||||||
|
invoking `lock.lock()` before the call to `wait` returns. The lock is also
|
||||||
|
reacquired by invoking `lock.lock()` if the function exits with an exception.]]
|
||||||
|
|
||||||
|
[[Returns:] [`false` if the call is returning because the time specified by
|
||||||
|
`abs_time` was reached, `true` otherwise.]]
|
||||||
|
|
||||||
|
[[Postcondition:] [`lock` is locked by the current thread.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error
|
||||||
|
occurs. __thread_interrupted__ if the wait was interrupted by a call to
|
||||||
|
__interrupt__ on the __thread__ object associated with the current thread of execution.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:timed_wait_rel `template<typename duration_type> bool timed_wait(boost::unique_lock<boost::mutex>& lock,duration_type const& rel_time)` DEPRECATED V2]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Precondition:] [`lock` is locked by the current thread, and either no other
|
||||||
|
thread is currently waiting on `*this`, or the execution of the `mutex()` member
|
||||||
|
function on the `lock` objects supplied in the calls to `wait` or `timed_wait`
|
||||||
|
in all the threads currently waiting on `*this` would return the same value as
|
||||||
|
`lock->mutex()` for this call to `wait`.]]
|
||||||
|
|
||||||
|
[[Effects:] [Atomically call `lock.unlock()` and blocks the current thread. The
|
||||||
|
thread will unblock when notified by a call to `this->notify_one()` or
|
||||||
|
`this->notify_all()`, after the period of time indicated by the `rel_time`
|
||||||
|
argument has elapsed, or spuriously. When the thread is unblocked (for whatever
|
||||||
|
reason), the lock is reacquired by invoking `lock.lock()` before the call to
|
||||||
|
`wait` returns. The lock is also reacquired by invoking `lock.lock()` if the
|
||||||
|
function exits with an exception.]]
|
||||||
|
|
||||||
|
[[Returns:] [`false` if the call is returning because the time period specified
|
||||||
|
by `rel_time` has elapsed, `true` otherwise.]]
|
||||||
|
|
||||||
|
[[Postcondition:] [`lock` is locked by the current thread.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error
|
||||||
|
occurs. __thread_interrupted__ if the wait was interrupted by a call to
|
||||||
|
__interrupt__ on the __thread__ object associated with the current thread of execution.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[note The duration overload of timed_wait is difficult to use correctly. The overload taking a predicate should be preferred in most cases.]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:timed_wait_predicate `template<typename predicate_type> bool timed_wait(boost::unique_lock<boost::mutex>& lock, boost::system_time const& abs_time, predicate_type pred)` DEPRECATED V2]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [As-if ``
|
||||||
|
while(!pred())
|
||||||
|
{
|
||||||
|
if(!timed_wait(lock,abs_time))
|
||||||
|
{
|
||||||
|
return pred();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
``]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
|
||||||
|
[section:wait_until `template <class Clock, class Duration> cv_status wait_until(boost::unique_lock<boost::mutex>& lock, const chrono::time_point<Clock, Duration>& abs_time)`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Precondition:] [`lock` is locked by the current thread, and either no other
|
||||||
|
thread is currently waiting on `*this`, or the execution of the `mutex()` member
|
||||||
|
function on the `lock` objects supplied in the calls to `wait` or `wait_for` or `wait_until`
|
||||||
|
in all the threads currently waiting on `*this` would return the same value as
|
||||||
|
`lock->mutex()` for this call to `wait`.]]
|
||||||
|
|
||||||
|
[[Effects:] [Atomically call `lock.unlock()` and blocks the current thread. The
|
||||||
|
thread will unblock when notified by a call to `this->notify_one()` or
|
||||||
|
`this->notify_all()`, when the time as reported by `Clock::now()`
|
||||||
|
would be equal to or later than the specified `abs_time`, or spuriously. When
|
||||||
|
the thread is unblocked (for whatever reason), the lock is reacquired by
|
||||||
|
invoking `lock.lock()` before the call to `wait` returns. The lock is also
|
||||||
|
reacquired by invoking `lock.lock()` if the function exits with an exception.]]
|
||||||
|
|
||||||
|
[[Returns:] [`cv_status::no_timeout` if the call is returning because the time specified by
|
||||||
|
`abs_time` was reached, `cv_status::timeout` otherwise.]]
|
||||||
|
|
||||||
|
[[Postcondition:] [`lock` is locked by the current thread.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error
|
||||||
|
occurs. __thread_interrupted__ if the wait was interrupted by a call to
|
||||||
|
__interrupt__ on the __thread__ object associated with the current thread of execution.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait_for `template <class Rep, class Period> cv_status wait_for(boost::unique_lock<boost::mutex>& lock, const chrono::duration<Rep, Period>& rel_time)`]
|
||||||
|
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Precondition:] [`lock` is locked by the current thread, and either no other
|
||||||
|
thread is currently waiting on `*this`, or the execution of the `mutex()` member
|
||||||
|
function on the `lock` objects supplied in the calls to `wait` or `wait_until` or `wait_for`
|
||||||
|
in all the threads currently waiting on `*this` would return the same value as
|
||||||
|
`lock->mutex()` for this call to `wait`.]]
|
||||||
|
|
||||||
|
[[Effects:] [Atomically call `lock.unlock()` and blocks the current thread. The
|
||||||
|
thread will unblock when notified by a call to `this->notify_one()` or
|
||||||
|
`this->notify_all()`, after the period of time indicated by the `rel_time`
|
||||||
|
argument has elapsed, or spuriously. When the thread is unblocked (for whatever
|
||||||
|
reason), the lock is reacquired by invoking `lock.lock()` before the call to
|
||||||
|
`wait` returns. The lock is also reacquired by invoking `lock.lock()` if the
|
||||||
|
function exits with an exception.]]
|
||||||
|
|
||||||
|
[[Returns:] [`cv_status::no_timeout ` if the call is returning because the time period specified
|
||||||
|
by `rel_time` has elapsed, `cv_status::timeout ` otherwise.]]
|
||||||
|
|
||||||
|
[[Postcondition:] [`lock` is locked by the current thread.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error
|
||||||
|
occurs. __thread_interrupted__ if the wait was interrupted by a call to
|
||||||
|
__interrupt__ on the __thread__ object associated with the current thread of execution.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[note The duration overload of timed_wait is difficult to use correctly. The overload taking a predicate should be preferred in most cases.]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait_until_predicate `template <class Clock, class Duration, class Predicate> bool wait_until(boost::unique_lock<boost::mutex>& lock, const chrono::time_point<Clock, Duration>& abs_time, Predicate pred)`]
|
||||||
|
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [As-if ``
|
||||||
|
while(!pred())
|
||||||
|
{
|
||||||
|
if(!wait_until(lock,abs_time))
|
||||||
|
{
|
||||||
|
return pred();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
``]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait_for_predicate `template <class Rep, class Period, class Predicate> bool wait_for(boost::unique_lock<boost::mutex>& lock, const chrono::duration<Rep, Period>& rel_time, Predicate pred)`]
|
||||||
|
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [As-if ``
|
||||||
|
while(!pred())
|
||||||
|
{
|
||||||
|
if(!wait_for(lock,rel_time))
|
||||||
|
{
|
||||||
|
return pred();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
``]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:condition_variable_any Class `condition_variable_any`]
|
||||||
|
|
||||||
|
#include <boost/thread/condition_variable.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
class condition_variable_any
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
condition_variable_any();
|
||||||
|
~condition_variable_any();
|
||||||
|
|
||||||
|
void notify_one();
|
||||||
|
void notify_all();
|
||||||
|
|
||||||
|
template<typename lock_type>
|
||||||
|
void wait(lock_type& lock);
|
||||||
|
|
||||||
|
template<typename lock_type,typename predicate_type>
|
||||||
|
void wait(lock_type& lock,predicate_type predicate);
|
||||||
|
|
||||||
|
template<typename lock_type>
|
||||||
|
bool timed_wait(lock_type& lock,boost::system_time const& abs_time) // DEPRECATED V2;
|
||||||
|
|
||||||
|
template<typename lock_type,typename duration_type>
|
||||||
|
bool timed_wait(lock_type& lock,duration_type const& rel_time) // DEPRECATED V2;
|
||||||
|
|
||||||
|
template<typename lock_type,typename predicate_type>
|
||||||
|
bool timed_wait(lock_type& lock,boost::system_time const& abs_time,predicate_type predicate) // DEPRECATED V2;
|
||||||
|
|
||||||
|
template<typename lock_type,typename duration_type,typename predicate_type>
|
||||||
|
bool timed_wait(lock_type& lock,duration_type const& rel_time,predicate_type predicate) // DEPRECATED V2;
|
||||||
|
|
||||||
|
template <class lock_type, class Clock, class Duration>
|
||||||
|
cv_status wait_until(
|
||||||
|
lock_type& lock,
|
||||||
|
const chrono::time_point<Clock, Duration>& t);
|
||||||
|
|
||||||
|
template <class lock_type, class Clock, class Duration, class Predicate>
|
||||||
|
bool wait_until(
|
||||||
|
lock_type& lock,
|
||||||
|
const chrono::time_point<Clock, Duration>& t,
|
||||||
|
Predicate pred);
|
||||||
|
|
||||||
|
|
||||||
|
template <class lock_type, class Rep, class Period>
|
||||||
|
cv_status wait_for(
|
||||||
|
lock_type& lock,
|
||||||
|
const chrono::duration<Rep, Period>& d);
|
||||||
|
|
||||||
|
template <class lock_type, class Rep, class Period, class Predicate>
|
||||||
|
bool wait_for(
|
||||||
|
lock_type& lock,
|
||||||
|
const chrono::duration<Rep, Period>& d,
|
||||||
|
Predicate pred);
|
||||||
|
|
||||||
|
// backwards compatibility
|
||||||
|
|
||||||
|
template<typename lock_type>
|
||||||
|
bool timed_wait(lock_type>& lock,boost::xtime const& abs_time) // DEPRECATED V2;
|
||||||
|
|
||||||
|
template<typename lock_type,typename predicate_type>
|
||||||
|
bool timed_wait(lock_type& lock,boost::xtime const& abs_time,predicate_type predicate) // DEPRECATED V2;
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
[section:constructor `condition_variable_any()`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Constructs an object of class `condition_variable_any`.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error occurs.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:destructor `~condition_variable_any()`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Precondition:] [All threads waiting on `*this` have been notified by a call to
|
||||||
|
`notify_one` or `notify_all` (though the respective calls to `wait` or
|
||||||
|
`timed_wait` need not have returned).]]
|
||||||
|
|
||||||
|
[[Effects:] [Destroys the object.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:notify_one `void notify_one()`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If any threads are currently __blocked__ waiting on `*this` in a call
|
||||||
|
to `wait` or `timed_wait`, unblocks one of those threads.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:notify_all `void notify_all()`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If any threads are currently __blocked__ waiting on `*this` in a call
|
||||||
|
to `wait` or `timed_wait`, unblocks all of those threads.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait `template<typename lock_type> void wait(lock_type& lock)`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Atomically call `lock.unlock()` and blocks the current thread. The
|
||||||
|
thread will unblock when notified by a call to `this->notify_one()` or
|
||||||
|
`this->notify_all()`, or spuriously. When the thread is unblocked (for whatever
|
||||||
|
reason), the lock is reacquired by invoking `lock.lock()` before the call to
|
||||||
|
`wait` returns. The lock is also reacquired by invoking `lock.lock()` if the
|
||||||
|
function exits with an exception.]]
|
||||||
|
|
||||||
|
[[Postcondition:] [`lock` is locked by the current thread.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error
|
||||||
|
occurs. __thread_interrupted__ if the wait was interrupted by a call to
|
||||||
|
__interrupt__ on the __thread__ object associated with the current thread of execution.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait_predicate `template<typename lock_type,typename predicate_type> void wait(lock_type& lock, predicate_type pred)`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [As-if ``
|
||||||
|
while(!pred())
|
||||||
|
{
|
||||||
|
wait(lock);
|
||||||
|
}
|
||||||
|
``]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:timed_wait `template<typename lock_type> bool timed_wait(lock_type& lock,boost::system_time const& abs_time)` DEPRECATED V2]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Atomically call `lock.unlock()` and blocks the current thread. The
|
||||||
|
thread will unblock when notified by a call to `this->notify_one()` or
|
||||||
|
`this->notify_all()`, when the time as reported by `boost::get_system_time()`
|
||||||
|
would be equal to or later than the specified `abs_time`, or spuriously. When
|
||||||
|
the thread is unblocked (for whatever reason), the lock is reacquired by
|
||||||
|
invoking `lock.lock()` before the call to `wait` returns. The lock is also
|
||||||
|
reacquired by invoking `lock.lock()` if the function exits with an exception.]]
|
||||||
|
|
||||||
|
[[Returns:] [`false` if the call is returning because the time specified by
|
||||||
|
`abs_time` was reached, `true` otherwise.]]
|
||||||
|
|
||||||
|
[[Postcondition:] [`lock` is locked by the current thread.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error
|
||||||
|
occurs. __thread_interrupted__ if the wait was interrupted by a call to
|
||||||
|
__interrupt__ on the __thread__ object associated with the current thread of execution.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:timed_wait_rel `template<typename lock_type,typename duration_type> bool timed_wait(lock_type& lock,duration_type const& rel_time)` DEPRECATED V2]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Atomically call `lock.unlock()` and blocks the current thread. The
|
||||||
|
thread will unblock when notified by a call to `this->notify_one()` or
|
||||||
|
`this->notify_all()`, after the period of time indicated by the `rel_time`
|
||||||
|
argument has elapsed, or spuriously. When the thread is unblocked (for whatever
|
||||||
|
reason), the lock is reacquired by invoking `lock.lock()` before the call to
|
||||||
|
`wait` returns. The lock is also reacquired by invoking `lock.lock()` if the
|
||||||
|
function exits with an exception.]]
|
||||||
|
|
||||||
|
[[Returns:] [`false` if the call is returning because the time period specified
|
||||||
|
by `rel_time` has elapsed, `true` otherwise.]]
|
||||||
|
|
||||||
|
[[Postcondition:] [`lock` is locked by the current thread.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error
|
||||||
|
occurs. __thread_interrupted__ if the wait was interrupted by a call to
|
||||||
|
__interrupt__ on the __thread__ object associated with the current thread of execution.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[note The duration overload of timed_wait is difficult to use correctly. The overload taking a predicate should be preferred in most cases.]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:timed_wait_predicate `template<typename lock_type,typename predicate_type> bool timed_wait(lock_type& lock, boost::system_time const& abs_time, predicate_type pred)` DEPRECATED V2]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [As-if ``
|
||||||
|
while(!pred())
|
||||||
|
{
|
||||||
|
if(!timed_wait(lock,abs_time))
|
||||||
|
{
|
||||||
|
return pred();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
``]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait_until `template <class lock_type, class Clock, class Duration> cv_status wait_until(lock_type& lock, const chrono::time_point<Clock, Duration>& abs_time)`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Atomically call `lock.unlock()` and blocks the current thread. The
|
||||||
|
thread will unblock when notified by a call to `this->notify_one()` or
|
||||||
|
`this->notify_all()`, when the time as reported by `Clock::now()`
|
||||||
|
would be equal to or later than the specified `abs_time`, or spuriously. When
|
||||||
|
the thread is unblocked (for whatever reason), the lock is reacquired by
|
||||||
|
invoking `lock.lock()` before the call to `wait` returns. The lock is also
|
||||||
|
reacquired by invoking `lock.lock()` if the function exits with an exception.]]
|
||||||
|
|
||||||
|
[[Returns:] [`cv_status::timeout` if the call is returning because the time specified by
|
||||||
|
`abs_time` was reached, `cv_status::no_timeout` otherwise.]]
|
||||||
|
|
||||||
|
[[Postcondition:] [`lock` is locked by the current thread.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error
|
||||||
|
occurs. __thread_interrupted__ if the wait was interrupted by a call to
|
||||||
|
__interrupt__ on the __thread__ object associated with the current thread of execution.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait_for `template <class lock_type, class Rep, class Period> cv_status wait_for(lock_type& lock, const chrono::duration<Rep, Period>& rel_time)`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Atomically call `lock.unlock()` and blocks the current thread. The
|
||||||
|
thread will unblock when notified by a call to `this->notify_one()` or
|
||||||
|
`this->notify_all()`, after the period of time indicated by the `rel_time`
|
||||||
|
argument has elapsed, or spuriously. When the thread is unblocked (for whatever
|
||||||
|
reason), the lock is reacquired by invoking `lock.lock()` before the call to
|
||||||
|
`wait` returns. The lock is also reacquired by invoking `lock.lock()` if the
|
||||||
|
function exits with an exception.]]
|
||||||
|
|
||||||
|
[[Returns:] [`cv_status::timeout` if the call is returning because the time specified by
|
||||||
|
`abs_time` was reached, `cv_status::no_timeout` otherwise.]]
|
||||||
|
|
||||||
|
[[Postcondition:] [`lock` is locked by the current thread.]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_resource_error__ if an error
|
||||||
|
occurs. __thread_interrupted__ if the wait was interrupted by a call to
|
||||||
|
__interrupt__ on the __thread__ object associated with the current thread of execution.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[note The duration overload of timed_wait is difficult to use correctly. The overload taking a predicate should be preferred in most cases.]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait_until_predicate `template <class lock_type, class Clock, class Duration, class Predicate> bool wait_until(lock_type& lock, const chrono::time_point<Clock, Duration>& abs_time, Predicate pred)`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [As-if ``
|
||||||
|
while(!pred())
|
||||||
|
{
|
||||||
|
if(!__cvany_wait_until(lock,abs_time))
|
||||||
|
{
|
||||||
|
return pred();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
``]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait_for_predicate `template <class lock_type, class Rep, class Period, class Predicate> bool wait_until(lock_type& lock, const chrono::duration<Rep, Period>& rel_time, Predicate pred)`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [As-if ``
|
||||||
|
while(!pred())
|
||||||
|
{
|
||||||
|
if(!__cvany_wait_for(lock,rel_time))
|
||||||
|
{
|
||||||
|
return pred();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
``]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:condition Typedef `condition`]
|
||||||
|
|
||||||
|
#include <boost/thread/condition.hpp>
|
||||||
|
|
||||||
|
typedef condition_variable_any condition;
|
||||||
|
|
||||||
|
The typedef `condition` is provided for backwards compatibility with previous boost releases.
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
103
doc/config.html
103
doc/config.html
@@ -1,103 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<title>Boost.Threads, Configuration Information</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">Configuration Information</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><b>Boost.Threads</b> uses several configuration macros in <a href="../../config/config.htm"> <boost/config.hpp></a>.
|
|
||||||
These macros are documented here. Most of the macros are
|
|
||||||
of interest only to developers attempting to provide new implementations of <b>Boost.Threads</b>.
|
|
||||||
The one exception to this is BOOST_HAS_THREADS.</p>
|
|
||||||
|
|
||||||
<table cellspacing="10" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top">
|
|
||||||
<b>Macro</b>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<b>Meaning</b>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top">
|
|
||||||
BOOST_HAS_THREADS
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
Indicates that threading support is available. This means both that there is a
|
|
||||||
platform specific implementation for <b>Boost.Threads</b> and that threading
|
|
||||||
support has been enabled in a platform specific manner. For instance, on the
|
|
||||||
Win32 platform there's an implementation for <b>Boost.Threads</b> but unless
|
|
||||||
the program is compiled against one of the multi-threading runtimes
|
|
||||||
(often determined by the
|
|
||||||
compiler predefining the macro _MT) the
|
|
||||||
BOOST_HAS_THREADS macro remains undefined.
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top">
|
|
||||||
BOOST_HAS_WINTHREADS
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
Indicates that the platform has the Microsoft Win32 threading libraries,
|
|
||||||
and that they should be used
|
|
||||||
to implement <b>Boost.Threads</b>.
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top">
|
|
||||||
BOOST_HAS_PTHREADS
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
Indicates that the platform has the POSIX pthreads libraries, and that
|
|
||||||
they should be used
|
|
||||||
to implement <b>Boost.Threads</b>.
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top">
|
|
||||||
BOOST_HAS_FTIME
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
Indicates that the implementation should use GetSystemTimeAsFileTime() and
|
|
||||||
the FILETIME type to calculate the current time. This is an implementation
|
|
||||||
detail used by boost::detail::getcurtime().
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top">
|
|
||||||
BOOST_HAS_GETTTIMEOFDAY
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
Indicates that the implementation should use gettimeofday() to calculate the
|
|
||||||
current time. This is an implementation detail used by boost::detail::getcurtime().
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->18 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39344" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
@@ -1,244 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Language" content="en-us">
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=windows-1252">
|
|
||||||
<meta name="GENERATOR" content="Microsoft FrontPage 4.0">
|
|
||||||
<meta name="ProgId" content="FrontPage.Editor.Document">
|
|
||||||
<title>Boost.Threads Definitions</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center"> Definitions</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
<h2>Introduction</h2>
|
|
||||||
<p>The definitions are given in terms of the <a href="bibliography.html#ISO-98"> C++ Standard</a>. References to the standard
|
|
||||||
are in the form [1.2.3/4], which
|
|
||||||
represents the section number, with the paragraph number following the "/".</p>
|
|
||||||
<p>Because the definitions are written in something akin to
|
|
||||||
"standardese", they can be difficult to understand. The intent
|
|
||||||
isn't to confuse, but rather to clarify the additional requirements
|
|
||||||
Boost.Threads places on a C++ implementation as defined by the C++ Standard.</p>
|
|
||||||
<h2>Definitions</h2>
|
|
||||||
<h3>Thread</h3>
|
|
||||||
<p>Thread is short for "thread of execution". A thread of execution is an execution environment [1.9/7] within the execution environment
|
|
||||||
of a C++ program [1.9]. The main() function [3.6.1] of the program is the
|
|
||||||
initial function of the initial thread. A program in a multi-threading
|
|
||||||
environment always has an initial thread even if the program explicitly creates
|
|
||||||
no additional threads.</p>
|
|
||||||
<p>Unless otherwise specified, each thread shares all aspects of its execution environment with
|
|
||||||
other threads in the program. Shared aspects of the execution environment
|
|
||||||
include, but are not limited to, the following:</p>
|
|
||||||
<ul>
|
|
||||||
<li>Static storage duration (static, extern) objects [3.7.1].</li>
|
|
||||||
</ul>
|
|
||||||
<ul>
|
|
||||||
<li>Dynamic storage duration (heap) objects [3.7.3]. Thus each memory
|
|
||||||
allocation will return a unique addresses, regardless of the thread making
|
|
||||||
the allocation request.</li>
|
|
||||||
</ul>
|
|
||||||
<ul>
|
|
||||||
<li>Automatic storage duration (stack) objects [3.7.2] accessed via pointer or
|
|
||||||
reference from another thread.</li>
|
|
||||||
</ul>
|
|
||||||
<ul>
|
|
||||||
<li>Resources provided by the operating
|
|
||||||
system. For example, files.</li>
|
|
||||||
</ul>
|
|
||||||
<ul>
|
|
||||||
<li>The program itself. In other words, each thread is executing some
|
|
||||||
function of the same program, not a totally different program.</li>
|
|
||||||
</ul>
|
|
||||||
<p>Each thread has its own:</p>
|
|
||||||
<ul>
|
|
||||||
<li>Registers and current execution sequence (program counter) [1.9/5].</li>
|
|
||||||
</ul>
|
|
||||||
<ul>
|
|
||||||
<li>Automatic storage duration (stack) objects [3.7.2].</li>
|
|
||||||
</ul>
|
|
||||||
<h3><a name="Thread-safe">Thread-safe</a></h3>
|
|
||||||
<p>A program is thread-safe if it has no <a href="#Race condition">race
|
|
||||||
conditions</a>, does not <a href="#Deadlock">deadlock</a>, and has no <a href="#Priority failure">priority
|
|
||||||
failures</a>.</p>
|
|
||||||
<p>Note that thread-safety does not necessarily imply efficiency, and than while
|
|
||||||
some thread-safety violations can be determined statically at compile time, many
|
|
||||||
thread-safety errors can only only be detected at runtime.</p>
|
|
||||||
<h3>Thread <a name="State">State</a></h3>
|
|
||||||
<p>During the lifetime of a thread, it shall be in one of the following
|
|
||||||
states:</p>
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><b>State</b></td>
|
|
||||||
<td><b>Description</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Ready</td>
|
|
||||||
<td>Ready to run, but waiting for a processor.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Running</td>
|
|
||||||
<td>Currently executing on a processor. Zero or more threads may be running
|
|
||||||
at any time, with a maximum equal to the number of processors. </td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Blocked</td>
|
|
||||||
<td>Waiting for some resource other than a processor which is not currently
|
|
||||||
available, or for the completion of calls to library functions [1.9/6].
|
|
||||||
The term "waiting" is synonymous for "blocked"</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Terminated</td>
|
|
||||||
<td>Finished execution but not yet detached or joined.</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
<p>Thread state transitions shall occur only as specified:</p>
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><b>From</b></td>
|
|
||||||
<td><b>To</b></td>
|
|
||||||
<td><b>Cause</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>
|
|
||||||
<p align="left">[none]</td>
|
|
||||||
<td>Ready</td>
|
|
||||||
<td>Thread is created by a call to a library function. In the case of
|
|
||||||
the initial thread, creation is implicit and occurs during the startup of
|
|
||||||
the main() function [3.6.1].</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Ready</td>
|
|
||||||
<td>Running</td>
|
|
||||||
<td>Processor becomes available.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Running</td>
|
|
||||||
<td>Ready</td>
|
|
||||||
<td>Thread preempted.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Running</td>
|
|
||||||
<td>Blocked</td>
|
|
||||||
<td>Thread calls a library function which waits for a resource or for the
|
|
||||||
completion of I/O.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Running</td>
|
|
||||||
<td>Terminated</td>
|
|
||||||
<td>Thread returns from its initial function, calls a thread termination
|
|
||||||
library function, or is cancelled by some other thread calling a thread
|
|
||||||
termination library function.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Blocked</td>
|
|
||||||
<td>Ready</td>
|
|
||||||
<td>The resource being waited for becomes available, or the blocking library
|
|
||||||
function completes.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Terminated</td>
|
|
||||||
<td>[none]</td>
|
|
||||||
<td>Thread is detached or joined by some other thread calling the
|
|
||||||
appropriate library function, or by program termination [3.6.3].</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
<p>[Note: if a suspend() function is added to the threading library, additional
|
|
||||||
transitions to the blocked state will have to be added to the above table.]</p>
|
|
||||||
<h3><a name="Race condition">Race condition</a></h3>
|
|
||||||
<p>A race condition is what occurs when multiple threads read and
|
|
||||||
write to the same memory without proper synchronization, resulting in an
|
|
||||||
incorrect value being read or written. The result of a race condition may
|
|
||||||
be a bit pattern which isn't even a valid value for the data type. A race
|
|
||||||
condition results in undefined behavior [1.3.12].</p>
|
|
||||||
<p>Race conditions can be prevented by serializing memory access
|
|
||||||
using the tools provided by Boost.Threads. </p>
|
|
||||||
<h3><a name="Deadlock">Deadlock</a></h3>
|
|
||||||
<p>Deadlock is an execution state where for some set of threads, each thread in
|
|
||||||
the set is blocked waiting for some action by one of the other threads in the
|
|
||||||
set. Since each is waiting on the others, none will ever become ready again.</p>
|
|
||||||
<h3><a name="Priority failure">Priority failure</a></h3>
|
|
||||||
<p>A priority failure (such as priority inversion or infinite overtaking) occurs
|
|
||||||
when threads executed in such a sequence that required work is not performed in
|
|
||||||
time to be useful.</p>
|
|
||||||
<h2>Memory visibility between threads</h2>
|
|
||||||
<p>An address [1.7] shall always point to the same memory byte, regardless of the
|
|
||||||
thread or processor dereferencing the address.</p>
|
|
||||||
<p>An object [1.8, 1.9] is accessible from multiple threads if it is of
|
|
||||||
static storage duration (static, extern) [3.7.1], or if a pointer or reference to
|
|
||||||
it is explicitly or
|
|
||||||
implicitly dereferenced in multiple threads.</p>
|
|
||||||
<p>For an object accessible from multiple threads, the value of the object
|
|
||||||
accessed from one thread may be indeterminate or different than the value
|
|
||||||
accessed from another thread, except under the conditions specified in the following
|
|
||||||
table. For the same row of the table, the value of an object
|
|
||||||
accessible at the indicated sequence point in thread A will be determinate and the
|
|
||||||
same if accessed at or after the indicated sequence point in thread B, provided
|
|
||||||
the object is not otherwise modified. In the table, the
|
|
||||||
"sequence point at a call" is the sequence point after the evaluation
|
|
||||||
of all function arguments [1.9/17], while the "sequence point after a
|
|
||||||
call" is the sequence point after the copying of the returned
|
|
||||||
value..." [1.9/17].</p>
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td align="center"><b>Thread A</b></td>
|
|
||||||
<td align="center"><b>Thread B</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>The sequence point at a call to a library thread-creation
|
|
||||||
function. </td>
|
|
||||||
<td>The first sequence point of the initial function in the new thread
|
|
||||||
created by the Thread A call.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>The sequence point at a call to a library function which locks a mutex,
|
|
||||||
directly or by waiting for a condition variable.</td>
|
|
||||||
<td>The sequence point after a call to a library function which unlocks the
|
|
||||||
same mutex.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>The last sequence point before thread termination.</td>
|
|
||||||
<td>The sequence point after a call to a library function which joins the
|
|
||||||
terminated thread.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>The sequence point at a call to a library function which signals or
|
|
||||||
broadcasts a condition variable.</td>
|
|
||||||
<td>The sequence point after the call to the library function which was
|
|
||||||
waiting on that same condition variable or signal.</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
<p>The architecture of the execution environment and the observable behavior of
|
|
||||||
the abstract machine [1.9] shall be the same on all processors.</p>
|
|
||||||
<p>The latitude granted by the C++ standard for an implementation to alter the
|
|
||||||
definition of observable behavior of the abstract machine to include additional library I/O
|
|
||||||
functions [1.9/6] is extended to include threading library functions.</p>
|
|
||||||
<p>When an exception is thrown and there is no matching exception handler in the
|
|
||||||
same thread, behavior is undefined. The preferred behavior is the same as when there is no matching exception handler
|
|
||||||
in a program [15.3/9]. That is, terminate() is called, and it is implementation defined
|
|
||||||
whether or not the stack is unwound.</p>
|
|
||||||
<h2><a name="Acknowledgements">Acknowledgements</a></h2>
|
|
||||||
<p>This document has been much improved by the incorporation of comments from
|
|
||||||
William Kempf.</p>
|
|
||||||
<p>The visibility rules are based on <a href="bibliography.html#Butenhof-97">[Butenhof
|
|
||||||
97]</a>. </p>
|
|
||||||
<hr>
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %b %Y" startspan -->07 Aug 2001<!--webbot bot="Timestamp" endspan i-checksum="14762" -->
|
|
||||||
</p>
|
|
||||||
<p>© Copyright Beman Dawes, 2001</p>
|
|
||||||
<p> </p>
|
|
||||||
<p> </p>
|
|
||||||
<p> </p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
|
|
||||||
</html>
|
|
||||||
174
doc/faq.html
174
doc/faq.html
@@ -1,174 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, FAQ</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">Frequently Asked Questions</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2>1. Are lock objects <a href="definitions.html#Thread-safe">thread-safe</a>?</h2>
|
|
||||||
|
|
||||||
<p><b>No!</b> Lock objects are not meant to be shared between threads. They are meant to
|
|
||||||
be short lived objects created on automatic storage within a code block. Any other usage
|
|
||||||
is just likely to lead to errors and won't really be of actual benefit any way. Share
|
|
||||||
<a href="mutex_concept.html">mutexes</a>, not locks. For more information see the
|
|
||||||
<a href="rationale.html#lock_objects">rationale</a> behind the design for lock objects.</p>
|
|
||||||
|
|
||||||
<h2>2a. Why was Boost.Threads modeled after (specific library name)?</h2>
|
|
||||||
|
|
||||||
<p>It wasn't. Boost.Threads was designed from scratch. Extensive design
|
|
||||||
discussions involved numerous people representing a wide range of experience across
|
|
||||||
many platforms. To ensure portability, the initial implements were done in
|
|
||||||
parallel using POSIX Threads and theWin32 threading API. But the Boost.Threads
|
|
||||||
design is very much in the spirit of C++, and thus doesn't model such C based
|
|
||||||
APIs.</p>
|
|
||||||
|
|
||||||
<h2>2b. Why wasn't Boost.Threads modeled after (specific library name)?</h2>
|
|
||||||
|
|
||||||
<p>Existing C++ libraries either seemed dangerous (often failing to take
|
|
||||||
advantage of prior art to reduce errors) or had excessive dependencies on
|
|
||||||
library components unrelated to threading. Existing C libraries couldn't meet
|
|
||||||
our C++ requirements, and were also missing certain features. For
|
|
||||||
instance, POSIX threads doesn't support a maximum value for semaphores.
|
|
||||||
The WIN32 thread API lacks condition variables, even though these are critical
|
|
||||||
for the important Monitor pattern <a href="bibliography.html#Schmidt-00">[Schmidt
|
|
||||||
00]</a>.</p>
|
|
||||||
|
|
||||||
<h2>3. Why do <a href="mutex_concept.html"> Mutexes</a> have noncopyable semantics?</h2>
|
|
||||||
|
|
||||||
<p>To ensure that <a href="definitions.html#Deadlock"> deadlocks</a> don't occur. The only logical form of copy would be to
|
|
||||||
use some sort of shallow copy semantics in which multiple mutex objects could refer
|
|
||||||
to the same mutex state. This means that if ObjA has a mutex object as part of its state
|
|
||||||
and ObjB is copy constructed from it, then when ObjB::foo() locks the mutex it has effectively
|
|
||||||
locked ObjA as well. This behavior can result in deadlock. Other
|
|
||||||
copy semantics result in similar problems (if you think you can prove this to
|
|
||||||
be wrong then supply us with an alternative and we'll reconsider).</p>
|
|
||||||
|
|
||||||
<h2>4. How can you prevent <a href="definitions.html#Deadlock"> deadlock</a> from occurring when a thread must lock multiple
|
|
||||||
mutexes?</h2>
|
|
||||||
|
|
||||||
<p>Always lock them in the same order. One easy way of doing this is to use
|
|
||||||
each mutex's address to determine the order in which they are locked. A future
|
|
||||||
Boost.Threads concept may wrap this pattern up in a reusable class.</p>
|
|
||||||
|
|
||||||
<h2>5. Don't noncopyable <a href="mutex_concept.html"> mutex</a> semantics mean that a
|
|
||||||
class with a mutex member will be noncopyable as well?</h2>
|
|
||||||
|
|
||||||
<p>No, but what it does mean is that the compiler can't generate a copy constructor
|
|
||||||
and assignment operator, so they will have to be coded explicitly. This is a
|
|
||||||
<b>good thing</b>, however, since the compiler generated operations would not
|
|
||||||
be <a href="definitions.html#Thread-safe">thread-safe</a>. The following is a
|
|
||||||
simple example of a class with copyable semantics and internal synchronization through
|
|
||||||
a mutex member.</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
class counter
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
// Doesn't need synchronization since there can be no references to *this
|
|
||||||
// until after it's constructed!
|
|
||||||
explicit counter(int initial_value)
|
|
||||||
: m_value(initial_value)
|
|
||||||
{
|
|
||||||
}
|
|
||||||
|
|
||||||
// We only need to syncronize other for the same reason we don't have to
|
|
||||||
// synchronize on construction!
|
|
||||||
counter(const counter& other)
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock scoped_lock(other.m_mutex);
|
|
||||||
m_value = other.m_value;
|
|
||||||
}
|
|
||||||
|
|
||||||
// For assignment we need to synchronize both objects!
|
|
||||||
const counter& operator=(const counter& other)
|
|
||||||
{
|
|
||||||
if (this == &other)
|
|
||||||
return *this;
|
|
||||||
|
|
||||||
boost::mutex::scoped_lock lock1(&m_mutex < &other.m_mutex ? m_mutex : other.m_mutex);
|
|
||||||
boost::mutex::scoped_lock lock2(&m_mutex > &other.m_mutex ? m_mutex : other.m_mutex);
|
|
||||||
m_value = other.m_value;
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
int value() const
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock scoped_lock(m_mutex);
|
|
||||||
return m_value;
|
|
||||||
}
|
|
||||||
int increment()
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock scoped_lock(m_mutex);
|
|
||||||
return ++m_value;
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
mutable boost::mutex m_mutex;
|
|
||||||
int m_value;
|
|
||||||
};
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2>6. How can you lock a <a href="mutex_concept.html"> mutex</a> member in a const member function, in order to
|
|
||||||
implement the Monitor Pattern?</h2>
|
|
||||||
|
|
||||||
<p>The Monitor Pattern mutex <a href="bibliography.html#Schmidt-00">[Schmidt
|
|
||||||
00]</a> should simply be declared as mutable. See the example code above. The internal state of mutex
|
|
||||||
types could have been made mutable, with all lock calls made via const
|
|
||||||
functions, but
|
|
||||||
this does a poor job of documenting the actual semantics. Declaring a mutex member
|
|
||||||
as mutable clearly documentations the intended semantics.</p>
|
|
||||||
|
|
||||||
<h2>7. Why supply <a href="condition.html">condition variables</a> rather than <a href="rationale.html#Events">
|
|
||||||
event variables</a>?</h2>
|
|
||||||
|
|
||||||
<p>Condition variables result in user code much less prone to <a href="definitions.html#Race condition">race
|
|
||||||
conditions</a> than event variables. See <a href="rationale.html#Events">Rationale</a>
|
|
||||||
for analysis. Also see <a href="bibliography.html#Hoare-74">[Hoare74]</a>
|
|
||||||
and <a href="bibliography.html#Schmidt-00">[Schmidt
|
|
||||||
00]</a>.</p>
|
|
||||||
|
|
||||||
<h2>8. Why isn't thread cancellation or termination provided?</h2>
|
|
||||||
|
|
||||||
<p>There's a valid need for thread termination, so at some point Boost.Threads
|
|
||||||
probably will include it, but only after we can find a truly safe (and portable)
|
|
||||||
mechanism for this concept.</p>
|
|
||||||
|
|
||||||
<h2>9. Is it safe for threads to share automatic storage duration (stack)
|
|
||||||
objects via pointers or references?</h2>
|
|
||||||
|
|
||||||
<p>Only if you can guarantee that the lifetime of the stack object will not end
|
|
||||||
while other threads might still access the object. Thus the safest practice is
|
|
||||||
to avoid sharing stack objects, particularly in designs where threads are
|
|
||||||
created and destroyed dynamically. Restrict sharing of stack objects to simple
|
|
||||||
designs with very clear and unchanging function and thread lifetimes. (Suggested
|
|
||||||
by Darryl Green).</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->04 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39335" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
968
doc/future_ref.qbk
Normal file
968
doc/future_ref.qbk
Normal file
@@ -0,0 +1,968 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2008-11 Anthony Williams.
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[section:reference Futures Reference]
|
||||||
|
|
||||||
|
[section:future_state `state` enum]
|
||||||
|
|
||||||
|
namespace future_state
|
||||||
|
{
|
||||||
|
enum state {uninitialized, waiting, ready};
|
||||||
|
}
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:unique_future `unique_future` class template]
|
||||||
|
|
||||||
|
template <typename R>
|
||||||
|
class unique_future
|
||||||
|
{
|
||||||
|
unique_future(unique_future & rhs);// = delete;
|
||||||
|
unique_future& operator=(unique_future& rhs);// = delete;
|
||||||
|
|
||||||
|
public:
|
||||||
|
typedef future_state::state state;
|
||||||
|
|
||||||
|
unique_future();
|
||||||
|
~unique_future();
|
||||||
|
|
||||||
|
// move support
|
||||||
|
unique_future(unique_future && other);
|
||||||
|
unique_future& operator=(unique_future && other);
|
||||||
|
|
||||||
|
void swap(unique_future& other);
|
||||||
|
|
||||||
|
// retrieving the value
|
||||||
|
R&& get();
|
||||||
|
|
||||||
|
// functions to check state
|
||||||
|
state get_state() const;
|
||||||
|
bool is_ready() const;
|
||||||
|
bool has_exception() const;
|
||||||
|
bool has_value() const;
|
||||||
|
|
||||||
|
// waiting for the result to be ready
|
||||||
|
void wait() const;
|
||||||
|
template<typename Duration>
|
||||||
|
bool timed_wait(Duration const& rel_time) const;
|
||||||
|
bool timed_wait_until(boost::system_time const& abs_time) const;
|
||||||
|
};
|
||||||
|
|
||||||
|
[section:default_constructor Default Constructor]
|
||||||
|
|
||||||
|
unique_future();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Constructs an uninitialized future.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [[unique_future_is_ready_link `this->is_ready`] returns `false`. [unique_future_get_state_link
|
||||||
|
`this->get_state()`] returns __uninitialized__.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:destructor Destructor]
|
||||||
|
|
||||||
|
~unique_future();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Destroys `*this`.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:move_constructor Move Constructor]
|
||||||
|
|
||||||
|
unique_future(unique_future && other);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Constructs a new future, and transfers ownership of the asynchronous result associated with `other` to `*this`.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [[unique_future_get_state_link `this->get_state()`] returns the value of `other->get_state()` prior to the
|
||||||
|
call. `other->get_state()` returns __uninitialized__. If `other` was associated with an asynchronous result, that result is now
|
||||||
|
associated with `*this`. `other` is not associated with any asynchronous result.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
[[Notes:] [If the compiler does not support rvalue-references, this is implemented using the boost.thread move emulation.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:move_assignment Move Assignment Operator]
|
||||||
|
|
||||||
|
unique_future& operator=(unique_future && other);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Transfers ownership of the asynchronous result associated with `other` to `*this`.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [[unique_future_get_state_link `this->get_state()`] returns the value of `other->get_state()` prior to the
|
||||||
|
call. `other->get_state()` returns __uninitialized__. If `other` was associated with an asynchronous result, that result is now
|
||||||
|
associated with `*this`. `other` is not associated with any asynchronous result. If `*this` was associated with an asynchronous
|
||||||
|
result prior to the call, that result no longer has an associated __unique_future__ instance.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
[[Notes:] [If the compiler does not support rvalue-references, this is implemented using the boost.thread move emulation.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:swap Member function `swap()`]
|
||||||
|
|
||||||
|
void swap(unique_future & other);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Swaps ownership of the asynchronous results associated with `other` and `*this`.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [[unique_future_get_state_link `this->get_state()`] returns the value of `other->get_state()` prior to the
|
||||||
|
call. `other->get_state()` returns the value of `this->get_state()` prior to the call. If `other` was associated with an
|
||||||
|
asynchronous result, that result is now associated with `*this`, otherwise `*this` has no associated result. If `*this` was
|
||||||
|
associated with an asynchronous result, that result is now associated with `other`, otherwise `other` has no associated result.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
|
||||||
|
[section:get Member function `get()`]
|
||||||
|
|
||||||
|
R&& get();
|
||||||
|
R& unique_future<R&>::get();
|
||||||
|
void unique_future<void>::get();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If `*this` is associated with an asynchronous result, waits until the result is ready as-if by a call to
|
||||||
|
__unique_future_wait__, and retrieves the result (whether that is a value or an exception).]]
|
||||||
|
|
||||||
|
[[Returns:] [If the result type `R` is a reference, returns the stored reference. If `R` is `void`, there is no return
|
||||||
|
value. Otherwise, returns an rvalue-reference to the value stored in the asynchronous result.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [[unique_future_is_ready_link `this->is_ready()`] returns `true`. [unique_future_get_state_link
|
||||||
|
`this->get_state()`] returns __ready__.]]
|
||||||
|
|
||||||
|
[[Throws:] [__future_uninitialized__ if `*this` is not associated with an asynchronous result. __thread_interrupted__ if the result
|
||||||
|
associated with `*this` is not ready at the point of the call, and the current thread is interrupted. Any exception stored in the
|
||||||
|
asynchronous result in place of a value.]]
|
||||||
|
|
||||||
|
[[Notes:] [`get()` is an ['interruption point].]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait Member function `wait()`]
|
||||||
|
|
||||||
|
void wait();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If `*this` is associated with an asynchronous result, waits until the result is ready. If the result is not ready on
|
||||||
|
entry, and the result has a ['wait callback] set, that callback is invoked prior to waiting.]]
|
||||||
|
|
||||||
|
[[Throws:] [__future_uninitialized__ if `*this` is not associated with an asynchronous result. __thread_interrupted__ if the result
|
||||||
|
associated with `*this` is not ready at the point of the call, and the current thread is interrupted. Any exception thrown by the
|
||||||
|
['wait callback] if such a callback is called.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [[unique_future_is_ready_link `this->is_ready()`] returns `true`. [unique_future_get_state_link
|
||||||
|
`this->get_state()`] returns __ready__.]]
|
||||||
|
|
||||||
|
[[Notes:] [`wait()` is an ['interruption point].]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:timed_wait_duration Member function `timed_wait()`]
|
||||||
|
|
||||||
|
template<typename Duration>
|
||||||
|
bool timed_wait(Duration const& wait_duration);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If `*this` is associated with an asynchronous result, waits until the result is ready, or the time specified by
|
||||||
|
`wait_duration` has elapsed. If the result is not ready on entry, and the result has a ['wait callback] set, that callback is
|
||||||
|
invoked prior to waiting.]]
|
||||||
|
|
||||||
|
[[Returns:] [`true` if `*this` is associated with an asynchronous result, and that result is ready before the specified time has
|
||||||
|
elapsed, `false` otherwise.]]
|
||||||
|
|
||||||
|
[[Throws:] [__future_uninitialized__ if `*this` is not associated with an asynchronous result. __thread_interrupted__ if the result
|
||||||
|
associated with `*this` is not ready at the point of the call, and the current thread is interrupted. Any exception thrown by the
|
||||||
|
['wait callback] if such a callback is called.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [If this call returned `true`, then [unique_future_is_ready_link `this->is_ready()`] returns `true` and
|
||||||
|
[unique_future_get_state_link `this->get_state()`] returns __ready__.]]
|
||||||
|
|
||||||
|
[[Notes:] [`timed_wait()` is an ['interruption point]. `Duration` must be a type that meets the Boost.DateTime time duration requirements.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:timed_wait_absolute Member function `timed_wait()`]
|
||||||
|
|
||||||
|
bool timed_wait(boost::system_time const& wait_timeout);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If `*this` is associated with an asynchronous result, waits until the result is ready, or the time point specified by
|
||||||
|
`wait_timeout` has passed. If the result is not ready on entry, and the result has a ['wait callback] set, that callback is invoked
|
||||||
|
prior to waiting.]]
|
||||||
|
|
||||||
|
[[Returns:] [`true` if `*this` is associated with an asynchronous result, and that result is ready before the specified time has
|
||||||
|
passed, `false` otherwise.]]
|
||||||
|
|
||||||
|
[[Throws:] [__future_uninitialized__ if `*this` is not associated with an asynchronous result. __thread_interrupted__ if the result
|
||||||
|
associated with `*this` is not ready at the point of the call, and the current thread is interrupted. Any exception thrown by the
|
||||||
|
['wait callback] if such a callback is called.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [If this call returned `true`, then [unique_future_is_ready_link `this->is_ready()`] returns `true` and
|
||||||
|
[unique_future_get_state_link `this->get_state()`] returns __ready__.]]
|
||||||
|
|
||||||
|
[[Notes:] [`timed_wait()` is an ['interruption point].]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
|
||||||
|
[section:is_ready Member function `is_ready()`]
|
||||||
|
|
||||||
|
bool is_ready();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Checks to see if the asynchronous result associated with `*this` is set.]]
|
||||||
|
|
||||||
|
[[Returns:] [`true` if `*this` is associated with an asynchronous result, and that result is ready for retrieval, `false`
|
||||||
|
otherwise.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:has_value Member function `has_value()`]
|
||||||
|
|
||||||
|
bool has_value();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Checks to see if the asynchronous result associated with `*this` is set with a value rather than an exception.]]
|
||||||
|
|
||||||
|
[[Returns:] [`true` if `*this` is associated with an asynchronous result, that result is ready for retrieval, and the result is a
|
||||||
|
stored value, `false` otherwise.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:has_exception Member function `has_exception()`]
|
||||||
|
|
||||||
|
bool has_exception();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Checks to see if the asynchronous result associated with `*this` is set with an exception rather than a value.]]
|
||||||
|
|
||||||
|
[[Returns:] [`true` if `*this` is associated with an asynchronous result, that result is ready for retrieval, and the result is a
|
||||||
|
stored exception, `false` otherwise.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:get_state Member function `get_state()`]
|
||||||
|
|
||||||
|
future_state::state get_state();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Determine the state of the asynchronous result associated with `*this`, if any.]]
|
||||||
|
|
||||||
|
[[Returns:] [__uninitialized__ if `*this` is not associated with an asynchronous result. __ready__ if the asynchronous result
|
||||||
|
associated with `*this` is ready for retrieval, __waiting__ otherwise.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:shared_future `shared_future` class template]
|
||||||
|
|
||||||
|
template <typename R>
|
||||||
|
class shared_future
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
typedef future_state::state state;
|
||||||
|
|
||||||
|
shared_future();
|
||||||
|
~shared_future();
|
||||||
|
|
||||||
|
// copy support
|
||||||
|
shared_future(shared_future const& other);
|
||||||
|
shared_future& operator=(shared_future const& other);
|
||||||
|
|
||||||
|
// move support
|
||||||
|
shared_future(shared_future && other);
|
||||||
|
shared_future(unique_future<R> && other);
|
||||||
|
shared_future& operator=(shared_future && other);
|
||||||
|
shared_future& operator=(unique_future<R> && other);
|
||||||
|
|
||||||
|
void swap(shared_future& other);
|
||||||
|
|
||||||
|
// retrieving the value
|
||||||
|
R get();
|
||||||
|
|
||||||
|
// functions to check state, and wait for ready
|
||||||
|
state get_state() const;
|
||||||
|
bool is_ready() const;
|
||||||
|
bool has_exception() const;
|
||||||
|
bool has_value() const;
|
||||||
|
|
||||||
|
// waiting for the result to be ready
|
||||||
|
void wait() const;
|
||||||
|
template<typename Duration>
|
||||||
|
bool timed_wait(Duration const& rel_time) const;
|
||||||
|
bool timed_wait_until(boost::system_time const& abs_time) const;
|
||||||
|
};
|
||||||
|
|
||||||
|
[section:default_constructor Default Constructor]
|
||||||
|
|
||||||
|
shared_future();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Constructs an uninitialized future.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [[shared_future_is_ready_link `this->is_ready`] returns `false`. [shared_future_get_state_link
|
||||||
|
`this->get_state()`] returns __uninitialized__.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:get Member function `get()`]
|
||||||
|
|
||||||
|
const R& get();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If `*this` is associated with an asynchronous result, waits until the result is ready as-if by a call to
|
||||||
|
__shared_future_wait__, and returns a `const` reference to the result.]]
|
||||||
|
|
||||||
|
[[Returns:] [If the result type `R` is a reference, returns the stored reference. If `R` is `void`, there is no return
|
||||||
|
value. Otherwise, returns a `const` reference to the value stored in the asynchronous result.]]
|
||||||
|
|
||||||
|
[[Throws:] [__future_uninitialized__ if `*this` is not associated with an asynchronous result. __thread_interrupted__ if the
|
||||||
|
result associated with `*this` is not ready at the point of the call, and the current thread is interrupted.]]
|
||||||
|
|
||||||
|
[[Notes:] [`get()` is an ['interruption point].]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait Member function `wait()`]
|
||||||
|
|
||||||
|
void wait();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If `*this` is associated with an asynchronous result, waits until the result is ready. If the result is not ready on
|
||||||
|
entry, and the result has a ['wait callback] set, that callback is invoked prior to waiting.]]
|
||||||
|
|
||||||
|
[[Throws:] [__future_uninitialized__ if `*this` is not associated with an asynchronous result. __thread_interrupted__ if the result
|
||||||
|
associated with `*this` is not ready at the point of the call, and the current thread is interrupted. Any exception thrown by the
|
||||||
|
['wait callback] if such a callback is called.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [[shared_future_is_ready_link `this->is_ready()`] returns `true`. [shared_future_get_state_link
|
||||||
|
`this->get_state()`] returns __ready__.]]
|
||||||
|
|
||||||
|
[[Notes:] [`wait()` is an ['interruption point].]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:timed_wait_duration Member function `timed_wait()`]
|
||||||
|
|
||||||
|
template<typename Duration>
|
||||||
|
bool timed_wait(Duration const& wait_duration);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If `*this` is associated with an asynchronous result, waits until the result is ready, or the time specified by
|
||||||
|
`wait_duration` has elapsed. If the result is not ready on entry, and the result has a ['wait callback] set, that callback is
|
||||||
|
invoked prior to waiting.]]
|
||||||
|
|
||||||
|
[[Returns:] [`true` if `*this` is associated with an asynchronous result, and that result is ready before the specified time has
|
||||||
|
elapsed, `false` otherwise.]]
|
||||||
|
|
||||||
|
[[Throws:] [__future_uninitialized__ if `*this` is not associated with an asynchronous result. __thread_interrupted__ if the result
|
||||||
|
associated with `*this` is not ready at the point of the call, and the current thread is interrupted. Any exception thrown by the
|
||||||
|
['wait callback] if such a callback is called.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [If this call returned `true`, then [shared_future_is_ready_link `this->is_ready()`] returns `true` and
|
||||||
|
[shared_future_get_state_link `this->get_state()`] returns __ready__.]]
|
||||||
|
|
||||||
|
[[Notes:] [`timed_wait()` is an ['interruption point]. `Duration` must be a type that meets the Boost.DateTime time duration requirements.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:timed_wait_absolute Member function `timed_wait()`]
|
||||||
|
|
||||||
|
bool timed_wait(boost::system_time const& wait_timeout);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If `*this` is associated with an asynchronous result, waits until the result is ready, or the time point specified by
|
||||||
|
`wait_timeout` has passed. If the result is not ready on entry, and the result has a ['wait callback] set, that callback is invoked
|
||||||
|
prior to waiting.]]
|
||||||
|
|
||||||
|
[[Returns:] [`true` if `*this` is associated with an asynchronous result, and that result is ready before the specified time has
|
||||||
|
passed, `false` otherwise.]]
|
||||||
|
|
||||||
|
[[Throws:] [__future_uninitialized__ if `*this` is not associated with an asynchronous result. __thread_interrupted__ if the result
|
||||||
|
associated with `*this` is not ready at the point of the call, and the current thread is interrupted. Any exception thrown by the
|
||||||
|
['wait callback] if such a callback is called.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [If this call returned `true`, then [shared_future_is_ready_link `this->is_ready()`] returns `true` and
|
||||||
|
[shared_future_get_state_link `this->get_state()`] returns __ready__.]]
|
||||||
|
|
||||||
|
[[Notes:] [`timed_wait()` is an ['interruption point].]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:is_ready Member function `is_ready()`]
|
||||||
|
|
||||||
|
bool is_ready();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Checks to see if the asynchronous result associated with `*this` is set.]]
|
||||||
|
|
||||||
|
[[Returns:] [`true` if `*this` is associated with an asynchronous result, and that result is ready for retrieval, `false`
|
||||||
|
otherwise.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:has_value Member function `has_value()`]
|
||||||
|
|
||||||
|
bool has_value();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Checks to see if the asynchronous result associated with `*this` is set with a value rather than an exception.]]
|
||||||
|
|
||||||
|
[[Returns:] [`true` if `*this` is associated with an asynchronous result, that result is ready for retrieval, and the result is a
|
||||||
|
stored value, `false` otherwise.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:has_exception Member function `has_exception()`]
|
||||||
|
|
||||||
|
bool has_exception();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Checks to see if the asynchronous result associated with `*this` is set with an exception rather than a value.]]
|
||||||
|
|
||||||
|
[[Returns:] [`true` if `*this` is associated with an asynchronous result, that result is ready for retrieval, and the result is a
|
||||||
|
stored exception, `false` otherwise.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:get_state Member function `get_state()`]
|
||||||
|
|
||||||
|
future_state::state get_state();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Determine the state of the asynchronous result associated with `*this`, if any.]]
|
||||||
|
|
||||||
|
[[Returns:] [__uninitialized__ if `*this` is not associated with an asynchronous result. __ready__ if the asynchronous result
|
||||||
|
associated with `*this` is ready for retrieval, __waiting__ otherwise.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:promise `promise` class template]
|
||||||
|
|
||||||
|
template <typename R>
|
||||||
|
class promise
|
||||||
|
{
|
||||||
|
promise(promise & rhs);// = delete;
|
||||||
|
promise & operator=(promise & rhs);// = delete;
|
||||||
|
public:
|
||||||
|
// template <class Allocator> explicit promise(Allocator a);
|
||||||
|
|
||||||
|
promise();
|
||||||
|
~promise();
|
||||||
|
|
||||||
|
// Move support
|
||||||
|
promise(promise && rhs);
|
||||||
|
promise & operator=(promise&& rhs);
|
||||||
|
|
||||||
|
void swap(promise& other);
|
||||||
|
// Result retrieval
|
||||||
|
unique_future<R> get_future();
|
||||||
|
|
||||||
|
// Set the value
|
||||||
|
void set_value(R& r);
|
||||||
|
void set_value(R&& r);
|
||||||
|
void set_exception(boost::exception_ptr e);
|
||||||
|
|
||||||
|
template<typename F>
|
||||||
|
void set_wait_callback(F f);
|
||||||
|
};
|
||||||
|
|
||||||
|
[section:default_constructor Default Constructor]
|
||||||
|
|
||||||
|
promise();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Constructs a new __promise__ with no associated result.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:move_constructor Move Constructor]
|
||||||
|
|
||||||
|
promise(promise && other);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Constructs a new __promise__, and transfers ownership of the result associated with `other` to `*this`, leaving `other`
|
||||||
|
with no associated result.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
[[Notes:] [If the compiler does not support rvalue-references, this is implemented using the boost.thread move emulation.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:move_assignment Move Assignment Operator]
|
||||||
|
|
||||||
|
promise& operator=(promise && other);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Transfers ownership of the result associated with `other` to `*this`, leaving `other` with no associated result. If there
|
||||||
|
was already a result associated with `*this`, and that result was not ['ready], sets any futures associated with that result to
|
||||||
|
['ready] with a __broken_promise__ exception as the result. ]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
[[Notes:] [If the compiler does not support rvalue-references, this is implemented using the boost.thread move emulation.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:destructor Destructor]
|
||||||
|
|
||||||
|
~promise();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Destroys `*this`. If there was a result associated with `*this`, and that result is not ['ready], sets any futures
|
||||||
|
associated with that task to ['ready] with a __broken_promise__ exception as the result.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:get_future Member Function `get_future()`]
|
||||||
|
|
||||||
|
unique_future<R> get_future();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If `*this` was not associated with a result, allocate storage for a new asynchronous result and associate it with
|
||||||
|
`*this`. Returns a __unique_future__ associated with the result associated with `*this`. ]]
|
||||||
|
|
||||||
|
[[Throws:] [__future_already_retrieved__ if the future associated with the task has already been retrieved. `std::bad_alloc` if any
|
||||||
|
memory necessary could not be allocated.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:set_value Member Function `set_value()`]
|
||||||
|
|
||||||
|
void set_value(R&& r);
|
||||||
|
void set_value(const R& r);
|
||||||
|
void promise<R&>::set_value(R& r);
|
||||||
|
void promise<void>::set_value();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If `*this` was not associated with a result, allocate storage for a new asynchronous result and associate it with
|
||||||
|
`*this`. Store the value `r` in the asynchronous result associated with `*this`. Any threads blocked waiting for the asynchronous
|
||||||
|
result are woken.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [All futures waiting on the asynchronous result are ['ready] and __unique_future_has_value__ or
|
||||||
|
__shared_future_has_value__ for those futures shall return `true`.]]
|
||||||
|
|
||||||
|
[[Throws:] [__promise_already_satisfied__ if the result associated with `*this` is already ['ready]. `std::bad_alloc` if the memory
|
||||||
|
required for storage of the result cannot be allocated. Any exception thrown by the copy or move-constructor of `R`.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:set_exception Member Function `set_exception()`]
|
||||||
|
|
||||||
|
void set_exception(boost::exception_ptr e);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If `*this` was not associated with a result, allocate storage for a new asynchronous result and associate it with
|
||||||
|
`*this`. Store the exception `e` in the asynchronous result associated with `*this`. Any threads blocked waiting for the asynchronous
|
||||||
|
result are woken.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [All futures waiting on the asynchronous result are ['ready] and __unique_future_has_exception__ or
|
||||||
|
__shared_future_has_exception__ for those futures shall return `true`.]]
|
||||||
|
|
||||||
|
[[Throws:] [__promise_already_satisfied__ if the result associated with `*this` is already ['ready]. `std::bad_alloc` if the memory
|
||||||
|
required for storage of the result cannot be allocated.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:set_wait_callback Member Function `set_wait_callback()`]
|
||||||
|
|
||||||
|
template<typename F>
|
||||||
|
void set_wait_callback(F f);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Preconditions:] [The expression `f(t)` where `t` is a lvalue of type __promise__ shall be well-formed. Invoking a copy of
|
||||||
|
`f` shall have the same effect as invoking `f`]]
|
||||||
|
|
||||||
|
[[Effects:] [Store a copy of `f` with the asynchronous result associated with `*this` as a ['wait callback]. This will replace any
|
||||||
|
existing wait callback store alongside that result. If a thread subsequently calls one of the wait functions on a __unique_future__
|
||||||
|
or __shared_future__ associated with this result, and the result is not ['ready], `f(*this)` shall be invoked.]]
|
||||||
|
|
||||||
|
[[Throws:] [`std::bad_alloc` if memory cannot be allocated for the required storage.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:packaged_task `packaged_task` class template]
|
||||||
|
|
||||||
|
template<typename R>
|
||||||
|
class packaged_task
|
||||||
|
{
|
||||||
|
packaged_task(packaged_task&);// = delete;
|
||||||
|
packaged_task& operator=(packaged_task&);// = delete;
|
||||||
|
|
||||||
|
public:
|
||||||
|
// construction and destruction
|
||||||
|
template <class F>
|
||||||
|
explicit packaged_task(F const& f);
|
||||||
|
|
||||||
|
explicit packaged_task(R(*f)());
|
||||||
|
|
||||||
|
template <class F>
|
||||||
|
explicit packaged_task(F&& f);
|
||||||
|
|
||||||
|
// template <class F, class Allocator>
|
||||||
|
// explicit packaged_task(F const& f, Allocator a);
|
||||||
|
// template <class F, class Allocator>
|
||||||
|
// explicit packaged_task(F&& f, Allocator a);
|
||||||
|
|
||||||
|
~packaged_task()
|
||||||
|
{}
|
||||||
|
|
||||||
|
// move support
|
||||||
|
packaged_task(packaged_task&& other);
|
||||||
|
packaged_task& operator=(packaged_task&& other);
|
||||||
|
|
||||||
|
void swap(packaged_task& other);
|
||||||
|
// result retrieval
|
||||||
|
unique_future<R> get_future();
|
||||||
|
|
||||||
|
// execution
|
||||||
|
void operator()();
|
||||||
|
|
||||||
|
template<typename F>
|
||||||
|
void set_wait_callback(F f);
|
||||||
|
};
|
||||||
|
|
||||||
|
[section:task_constructor Task Constructor]
|
||||||
|
|
||||||
|
template<typename F>
|
||||||
|
packaged_task(F const &f);
|
||||||
|
|
||||||
|
packaged_task(R(*f)());
|
||||||
|
|
||||||
|
template<typename F>
|
||||||
|
packaged_task(F&&f);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Preconditions:] [`f()` is a valid expression with a return type convertible to `R`. Invoking a copy of `f` shall behave the same
|
||||||
|
as invoking `f`.]]
|
||||||
|
|
||||||
|
[[Effects:] [Constructs a new __packaged_task__ with a copy of `f` stored as the associated task.]]
|
||||||
|
|
||||||
|
[[Throws:] [Any exceptions thrown by the copy (or move) constructor of `f`. `std::bad_alloc` if memory for the internal data
|
||||||
|
structures could not be allocated.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:move_constructor Move Constructor]
|
||||||
|
|
||||||
|
packaged_task(packaged_task && other);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Constructs a new __packaged_task__, and transfers ownership of the task associated with `other` to `*this`, leaving `other`
|
||||||
|
with no associated task.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
[[Notes:] [If the compiler does not support rvalue-references, this is implemented using the boost.thread move emulation.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:move_assignment Move Assignment Operator]
|
||||||
|
|
||||||
|
packaged_task& operator=(packaged_task && other);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Transfers ownership of the task associated with `other` to `*this`, leaving `other` with no associated task. If there
|
||||||
|
was already a task associated with `*this`, and that task has not been invoked, sets any futures associated with that task to
|
||||||
|
['ready] with a __broken_promise__ exception as the result. ]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
[[Notes:] [If the compiler does not support rvalue-references, this is implemented using the boost.thread move emulation.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:destructor Destructor]
|
||||||
|
|
||||||
|
~packaged_task();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Destroys `*this`. If there was a task associated with `*this`, and that task has not been invoked, sets any futures
|
||||||
|
associated with that task to ['ready] with a __broken_promise__ exception as the result.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:get_future Member Function `get_future()`]
|
||||||
|
|
||||||
|
unique_future<R> get_future();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Returns a __unique_future__ associated with the result of the task associated with `*this`. ]]
|
||||||
|
|
||||||
|
[[Throws:] [__task_moved__ if ownership of the task associated with `*this` has been moved to another instance of
|
||||||
|
__packaged_task__. __future_already_retrieved__ if the future associated with the task has already been retrieved.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:call_operator Member Function `operator()()`]
|
||||||
|
|
||||||
|
void operator()();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Invoke the task associated with `*this` and store the result in the corresponding future. If the task returns normally,
|
||||||
|
the return value is stored as the asynchronous result, otherwise the exception thrown is stored. Any threads blocked waiting for the
|
||||||
|
asynchronous result associated with this task are woken.]]
|
||||||
|
|
||||||
|
[[Postconditions:] [All futures waiting on the asynchronous result are ['ready]]]
|
||||||
|
|
||||||
|
[[Throws:] [__task_moved__ if ownership of the task associated with `*this` has been moved to another instance of
|
||||||
|
__packaged_task__. __task_already_started__ if the task has already been invoked.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:set_wait_callback Member Function `set_wait_callback()`]
|
||||||
|
|
||||||
|
template<typename F>
|
||||||
|
void set_wait_callback(F f);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Preconditions:] [The expression `f(t)` where `t` is a lvalue of type __packaged_task__ shall be well-formed. Invoking a copy of
|
||||||
|
`f` shall have the same effect as invoking `f`]]
|
||||||
|
|
||||||
|
[[Effects:] [Store a copy of `f` with the task associated with `*this` as a ['wait callback]. This will replace any existing wait
|
||||||
|
callback store alongside that task. If a thread subsequently calls one of the wait functions on a __unique_future__ or
|
||||||
|
__shared_future__ associated with this task, and the result of the task is not ['ready], `f(*this)` shall be invoked.]]
|
||||||
|
|
||||||
|
[[Throws:] [__task_moved__ if ownership of the task associated with `*this` has been moved to another instance of
|
||||||
|
__packaged_task__.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait_for_any Non-member function `wait_for_any()`]
|
||||||
|
|
||||||
|
template<typename Iterator>
|
||||||
|
Iterator wait_for_any(Iterator begin,Iterator end);
|
||||||
|
|
||||||
|
template<typename F1,typename F2>
|
||||||
|
unsigned wait_for_any(F1& f1,F2& f2);
|
||||||
|
|
||||||
|
template<typename F1,typename F2,typename F3>
|
||||||
|
unsigned wait_for_any(F1& f1,F2& f2,F3& f3);
|
||||||
|
|
||||||
|
template<typename F1,typename F2,typename F3,typename F4>
|
||||||
|
unsigned wait_for_any(F1& f1,F2& f2,F3& f3,F4& f4);
|
||||||
|
|
||||||
|
template<typename F1,typename F2,typename F3,typename F4,typename F5>
|
||||||
|
unsigned wait_for_any(F1& f1,F2& f2,F3& f3,F4& f4,F5& f5);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Preconditions:] [The types `Fn` shall be specializations of
|
||||||
|
__unique_future__ or __shared_future__, and `Iterator` shall be a
|
||||||
|
forward iterator with a `value_type` which is a specialization of
|
||||||
|
__unique_future__ or __shared_future__.]]
|
||||||
|
|
||||||
|
[[Effects:] [Waits until at least one of the specified futures is ['ready].]]
|
||||||
|
|
||||||
|
[[Returns:] [The range-based overload returns an `Iterator` identifying the first future in the range that was detected as
|
||||||
|
['ready]. The remaining overloads return the zero-based index of the first future that was detected as ['ready] (first parameter =>
|
||||||
|
0, second parameter => 1, etc.).]]
|
||||||
|
|
||||||
|
[[Throws:] [__thread_interrupted__ if the current thread is interrupted. Any exception thrown by the ['wait callback] associated
|
||||||
|
with any of the futures being waited for. `std::bad_alloc` if memory could not be allocated for the internal wait structures.]]
|
||||||
|
|
||||||
|
[[Notes:] [`wait_for_any()` is an ['interruption point].]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:wait_for_all Non-member function `wait_for_all()`]
|
||||||
|
|
||||||
|
template<typename Iterator>
|
||||||
|
void wait_for_all(Iterator begin,Iterator end);
|
||||||
|
|
||||||
|
template<typename F1,typename F2>
|
||||||
|
void wait_for_all(F1& f1,F2& f2);
|
||||||
|
|
||||||
|
template<typename F1,typename F2,typename F3>
|
||||||
|
void wait_for_all(F1& f1,F2& f2,F3& f3);
|
||||||
|
|
||||||
|
template<typename F1,typename F2,typename F3,typename F4>
|
||||||
|
void wait_for_all(F1& f1,F2& f2,F3& f3,F4& f4);
|
||||||
|
|
||||||
|
template<typename F1,typename F2,typename F3,typename F4,typename F5>
|
||||||
|
void wait_for_all(F1& f1,F2& f2,F3& f3,F4& f4,F5& f5);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Preconditions:] [The types `Fn` shall be specializations of
|
||||||
|
__unique_future__ or __shared_future__, and `Iterator` shall be a
|
||||||
|
forward iterator with a `value_type` which is a specialization of
|
||||||
|
__unique_future__ or __shared_future__.]]
|
||||||
|
|
||||||
|
[[Effects:] [Waits until all of the specified futures are ['ready].]]
|
||||||
|
|
||||||
|
[[Throws:] [Any exceptions thrown by a call to `wait()` on the specified futures.]]
|
||||||
|
|
||||||
|
[[Notes:] [`wait_for_all()` is an ['interruption point].]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
|
||||||
|
[endsect]
|
||||||
187
doc/futures.qbk
Executable file
187
doc/futures.qbk
Executable file
@@ -0,0 +1,187 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2008-11 Anthony Williams.
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[section:futures Futures]
|
||||||
|
|
||||||
|
[template future_state_link[link_text] [link thread.synchronization.futures.reference.future_state [link_text]]]
|
||||||
|
[def __uninitialized__ [future_state_link `boost::future_state::uninitialized`]]
|
||||||
|
[def __ready__ [future_state_link `boost::future_state::ready`]]
|
||||||
|
[def __waiting__ [future_state_link `boost::future_state::waiting`]]
|
||||||
|
|
||||||
|
[def __future_uninitialized__ `boost::future_uninitialized`]
|
||||||
|
[def __broken_promise__ `boost::broken_promise`]
|
||||||
|
[def __future_already_retrieved__ `boost::future_already_retrieved`]
|
||||||
|
[def __task_moved__ `boost::task_moved`]
|
||||||
|
[def __task_already_started__ `boost::task_already_started`]
|
||||||
|
[def __promise_already_satisfied__ `boost::promise_already_satisfied`]
|
||||||
|
|
||||||
|
[def __thread_interrupted__ `boost::thread_interrupted`]
|
||||||
|
|
||||||
|
|
||||||
|
[template unique_future_link[link_text] [link thread.synchronization.futures.reference.unique_future [link_text]]]
|
||||||
|
[def __unique_future__ [unique_future_link `boost::unique_future`]]
|
||||||
|
|
||||||
|
[template unique_future_get_link[link_text] [link thread.synchronization.futures.reference.unique_future.get [link_text]]]
|
||||||
|
[def __unique_future_get__ [unique_future_get_link `boost::unique_future<R>::get()`]]
|
||||||
|
|
||||||
|
[template unique_future_wait_link[link_text] [link thread.synchronization.futures.reference.unique_future.wait [link_text]]]
|
||||||
|
[def __unique_future_wait__ [unique_future_wait_link `boost::unique_future<R>::wait()`]]
|
||||||
|
|
||||||
|
[template unique_future_is_ready_link[link_text] [link thread.synchronization.futures.reference.unique_future.is_ready [link_text]]]
|
||||||
|
[def __unique_future_is_ready__ [unique_future_is_ready_link `boost::unique_future<R>::is_ready()`]]
|
||||||
|
|
||||||
|
[template unique_future_has_value_link[link_text] [link thread.synchronization.futures.reference.unique_future.has_value [link_text]]]
|
||||||
|
[def __unique_future_has_value__ [unique_future_has_value_link `boost::unique_future<R>::has_value()`]]
|
||||||
|
|
||||||
|
[template unique_future_has_exception_link[link_text] [link thread.synchronization.futures.reference.unique_future.has_exception [link_text]]]
|
||||||
|
[def __unique_future_has_exception__ [unique_future_has_exception_link `boost::unique_future<R>::has_exception()`]]
|
||||||
|
|
||||||
|
[template unique_future_get_state_link[link_text] [link thread.synchronization.futures.reference.unique_future.get_state [link_text]]]
|
||||||
|
[def __unique_future_get_state__ [unique_future_get_state_link `boost::unique_future<R>::get_state()`]]
|
||||||
|
|
||||||
|
[template shared_future_link[link_text] [link thread.synchronization.futures.reference.shared_future [link_text]]]
|
||||||
|
[def __shared_future__ [shared_future_link `boost::shared_future`]]
|
||||||
|
|
||||||
|
[template shared_future_get_link[link_text] [link thread.synchronization.futures.reference.shared_future.get [link_text]]]
|
||||||
|
[def __shared_future_get__ [shared_future_get_link `boost::shared_future<R>::get()`]]
|
||||||
|
|
||||||
|
[template shared_future_wait_link[link_text] [link thread.synchronization.futures.reference.shared_future.wait [link_text]]]
|
||||||
|
[def __shared_future_wait__ [shared_future_wait_link `boost::shared_future<R>::wait()`]]
|
||||||
|
|
||||||
|
[template shared_future_is_ready_link[link_text] [link thread.synchronization.futures.reference.shared_future.is_ready [link_text]]]
|
||||||
|
[def __shared_future_is_ready__ [shared_future_is_ready_link `boost::shared_future<R>::is_ready()`]]
|
||||||
|
|
||||||
|
[template shared_future_has_value_link[link_text] [link thread.synchronization.futures.reference.shared_future.has_value [link_text]]]
|
||||||
|
[def __shared_future_has_value__ [shared_future_has_value_link `boost::shared_future<R>::has_value()`]]
|
||||||
|
|
||||||
|
[template shared_future_has_exception_link[link_text] [link thread.synchronization.futures.reference.shared_future.has_exception [link_text]]]
|
||||||
|
[def __shared_future_has_exception__ [shared_future_has_exception_link `boost::shared_future<R>::has_exception()`]]
|
||||||
|
|
||||||
|
[template shared_future_get_state_link[link_text] [link thread.synchronization.futures.reference.shared_future.get_state [link_text]]]
|
||||||
|
[def __shared_future_get_state__ [shared_future_get_state_link `boost::shared_future<R>::get_state()`]]
|
||||||
|
|
||||||
|
[template promise_link[link_text] [link thread.synchronization.futures.reference.promise [link_text]]]
|
||||||
|
[def __promise__ [promise_link `boost::promise`]]
|
||||||
|
|
||||||
|
[template packaged_task_link[link_text] [link thread.synchronization.futures.reference.packaged_task [link_text]]]
|
||||||
|
[def __packaged_task__ [packaged_task_link `boost::packaged_task`]]
|
||||||
|
|
||||||
|
[template wait_for_any_link[link_text] [link thread.synchronization.futures.reference.wait_for_any [link_text]]]
|
||||||
|
[def __wait_for_any__ [wait_for_any_link `boost::wait_for_any()`]]
|
||||||
|
|
||||||
|
[template wait_for_all_link[link_text] [link thread.synchronization.futures.reference.wait_for_all [link_text]]]
|
||||||
|
[def __wait_for_all__ [wait_for_all_link `boost::wait_for_all()`]]
|
||||||
|
|
||||||
|
|
||||||
|
[section:overview Overview]
|
||||||
|
|
||||||
|
The futures library provides a means of handling synchronous future values, whether those values are generated by another thread, or
|
||||||
|
on a single thread in response to external stimuli, or on-demand.
|
||||||
|
|
||||||
|
This is done through the provision of four class templates: __unique_future__ and __shared_future__ which are used to retrieve the
|
||||||
|
asynchronous results, and __promise__ and __packaged_task__ which are used to generate the asynchronous results.
|
||||||
|
|
||||||
|
An instance of __unique_future__ holds the one and only reference to a result. Ownership can be transferred between instances using
|
||||||
|
the move constructor or move-assignment operator, but at most one instance holds a reference to a given asynchronous result. When
|
||||||
|
the result is ready, it is returned from __unique_future_get__ by rvalue-reference to allow the result to be moved or copied as
|
||||||
|
appropriate for the type.
|
||||||
|
|
||||||
|
On the other hand, many instances of __shared_future__ may reference the same result. Instances can be freely copied and assigned,
|
||||||
|
and __shared_future_get__ returns a `const` reference so that multiple calls to __shared_future_get__ are safe. You can move an
|
||||||
|
instance of __unique_future__ into an instance of __shared_future__, thus transferring ownership of the associated asynchronous
|
||||||
|
result, but not vice-versa.
|
||||||
|
|
||||||
|
You can wait for futures either individually or with one of the __wait_for_any__ and __wait_for_all__ functions.
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:creating Creating asynchronous values]
|
||||||
|
|
||||||
|
You can set the value in a future with either a __promise__ or a __packaged_task__. A __packaged_task__ is a callable object that
|
||||||
|
wraps a function or callable object. When the packaged task is invoked, it invokes the contained function in turn, and populates a
|
||||||
|
future with the return value. This is an answer to the perennial question: "how do I return a value from a thread?": package the
|
||||||
|
function you wish to run as a __packaged_task__ and pass the packaged task to the thread constructor. The future retrieved from the
|
||||||
|
packaged task can then be used to obtain the return value. If the function throws an exception, that is stored in the future in
|
||||||
|
place of the return value.
|
||||||
|
|
||||||
|
int calculate_the_answer_to_life_the_universe_and_everything()
|
||||||
|
{
|
||||||
|
return 42;
|
||||||
|
}
|
||||||
|
|
||||||
|
boost::packaged_task<int> pt(calculate_the_answer_to_life_the_universe_and_everything);
|
||||||
|
boost::unique_future<int> fi=pt.get_future();
|
||||||
|
|
||||||
|
boost::thread task(boost::move(pt)); // launch task on a thread
|
||||||
|
|
||||||
|
fi.wait(); // wait for it to finish
|
||||||
|
|
||||||
|
assert(fi.is_ready());
|
||||||
|
assert(fi.has_value());
|
||||||
|
assert(!fi.has_exception());
|
||||||
|
assert(fi.get_state()==boost::future_state::ready);
|
||||||
|
assert(fi.get()==42);
|
||||||
|
|
||||||
|
|
||||||
|
A __promise__ is a bit more low level: it just provides explicit functions to store a value or an exception in the associated
|
||||||
|
future. A promise can therefore be used where the value may come from more than one possible source, or where a single operation may
|
||||||
|
produce multiple values.
|
||||||
|
|
||||||
|
boost::promise<int> pi;
|
||||||
|
boost::unique_future<int> fi;
|
||||||
|
fi=pi.get_future();
|
||||||
|
|
||||||
|
pi.set_value(42);
|
||||||
|
|
||||||
|
assert(fi.is_ready());
|
||||||
|
assert(fi.has_value());
|
||||||
|
assert(!fi.has_exception());
|
||||||
|
assert(fi.get_state()==boost::future_state::ready);
|
||||||
|
assert(fi.get()==42);
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:lazy_futures Wait Callbacks and Lazy Futures]
|
||||||
|
|
||||||
|
Both __promise__ and __packaged_task__ support ['wait callbacks] that are invoked when a thread blocks in a call to `wait()` or
|
||||||
|
`timed_wait()` on a future that is waiting for the result from the __promise__ or __packaged_task__, in the thread that is doing the
|
||||||
|
waiting. These can be set using the `set_wait_callback()` member function on the __promise__ or __packaged_task__ in question.
|
||||||
|
|
||||||
|
This allows ['lazy futures] where the result is not actually computed until it is needed by some thread. In the example below, the
|
||||||
|
call to `f.get()` invokes the callback `invoke_lazy_task`, which runs the task to set the value. If you remove the call to
|
||||||
|
`f.get()`, the task is not ever run.
|
||||||
|
|
||||||
|
int calculate_the_answer_to_life_the_universe_and_everything()
|
||||||
|
{
|
||||||
|
return 42;
|
||||||
|
}
|
||||||
|
|
||||||
|
void invoke_lazy_task(boost::packaged_task<int>& task)
|
||||||
|
{
|
||||||
|
try
|
||||||
|
{
|
||||||
|
task();
|
||||||
|
}
|
||||||
|
catch(boost::task_already_started&)
|
||||||
|
{}
|
||||||
|
}
|
||||||
|
|
||||||
|
int main()
|
||||||
|
{
|
||||||
|
boost::packaged_task<int> task(calculate_the_answer_to_life_the_universe_and_everything);
|
||||||
|
task.set_wait_callback(invoke_lazy_task);
|
||||||
|
boost::unique_future<int> f(task.get_future());
|
||||||
|
|
||||||
|
assert(f.get()==42);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[include future_ref.qbk]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
@@ -1,87 +1,12 @@
|
|||||||
|
<!-- Copyright (c) 2002-2003 Beman Dawes, William E. Kempf.
|
||||||
|
Subject to the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
-->
|
||||||
<html>
|
<html>
|
||||||
|
|
||||||
<head>
|
<head>
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
<meta http-equiv="refresh" content="0; URL=../../../doc/html/thread.html">
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<title>Boost.Threads, Index</title>
|
|
||||||
</head>
|
</head>
|
||||||
|
<body>
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
Automatic redirection failed, please go to <a href="../../../doc/html/thread.html">../../../doc/html/thread.html</a>
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">Documentation Map</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2>Contents</h2>
|
|
||||||
|
|
||||||
<ul>
|
|
||||||
<li><a href="overview.html">Overview</a></li>
|
|
||||||
<li>Class <a href="semaphore.html">semaphore</a></li>
|
|
||||||
<li><a href="mutex_concept.html">Mutex Concepts</a></li>
|
|
||||||
<ul>
|
|
||||||
<li><a href="mutex_concept.html#Mutex">Mutex</a></li>
|
|
||||||
<li><a href="mutex_concept.html#TryMutex">TryMutex</a></li>
|
|
||||||
<li><a href="mutex_concept.html#TimedMutex">TimedMutex</a></li>
|
|
||||||
</ul>
|
|
||||||
<li>Mutex Classes</li>
|
|
||||||
<ul>
|
|
||||||
<li><a href="mutex.html">mutex / try_mutex / timed_mutex</a></li>
|
|
||||||
<li><a href="recursive_mutex.html">recursive_mutex / recursive_try_mutex / recursive_timed_mutex</a></li>
|
|
||||||
</ul>
|
|
||||||
<li><a href="lock_concept.html">Lock Concepts</a></li>
|
|
||||||
<ul>
|
|
||||||
<li><a href="lock_concept.html#Lock">Lock</a></li>
|
|
||||||
<li><a href="lock_concept.html#ScopedLock">ScopedLock</a></li>
|
|
||||||
<li><a href="lock_concept.html#ScopedTryLock">ScopedTryLock</a></li>
|
|
||||||
<li><a href="lock_concept.html#ScopedTimedLock">ScopedTimedLock</a></li>
|
|
||||||
</ul>
|
|
||||||
<li>Lock Classes</li>
|
|
||||||
<ul>
|
|
||||||
<li><a href="scoped_lock.html">scoped_lock</a></li>
|
|
||||||
<li><a href="scoped_try_lock.html">scoped_try_lock</a></li>
|
|
||||||
<li><a href="scoped_timed_lock.html">scoped_timed_lock</a></li>
|
|
||||||
</ul>
|
|
||||||
<li>Class <a href="condition.html">condition</a></li>
|
|
||||||
<li>Class <a href="thread_specific_ptr.html">thread_specific_ptr</a></li>
|
|
||||||
<li>Class <a href="thread.html">thread</a></li>
|
|
||||||
<li>Class <a href="thread_group.html">thread_group</a></li>
|
|
||||||
<li>Class <a href="xtime.html">xtime</a></li>
|
|
||||||
<li>Class <a href="lock_error.html">lock_error</a></li>
|
|
||||||
<li>Class <a href="thread_resource_error.html">thread_resource_error</a></li>
|
|
||||||
<li>Routine <a href="call_once.html">call_once</a></li>
|
|
||||||
<li><a href="config.html">Configuration Information</a></li>
|
|
||||||
<li><a href="introduction.html">Introduction to design</a></li>
|
|
||||||
<li><a href="rationale.html">Rationale for design decisions</a></li>
|
|
||||||
<li><a href="definitions.html">Definitions</a></li>
|
|
||||||
<li><a href="faq.html">Frequently Asked Questions</a></li>
|
|
||||||
<li><a href="bibliography.html">Bibliography</a></li>
|
|
||||||
<li><a href="acknowledgements.html">Acknowledgements</a></li>
|
|
||||||
</ul>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->12 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39332" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p>©<i> Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001</i></p>
|
|
||||||
<p>Permission to use, copy, modify, distribute and sell this software
|
|
||||||
and its documentation for any purpose is hereby granted without fee,
|
|
||||||
provided that the above copyright notice appear in all copies and
|
|
||||||
that both that copyright notice and this permission notice appear
|
|
||||||
in supporting documentation. William E. Kempf makes no representations
|
|
||||||
about the suitability of this software for any purpose.
|
|
||||||
It is provided "as is" without express or implied warranty.</p>
|
|
||||||
|
|
||||||
</body>
|
</body>
|
||||||
</html>
|
</html>
|
||||||
|
|||||||
@@ -1,151 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<title>Boost.Threads, Introduction</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#ffffff" link="#0000ff" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><IMG height=86 alt="C++ Boost" src="../../../c++boost.gif" width=277></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">Introduction</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Motivation</h3>
|
|
||||||
|
|
||||||
<p>With client/server and three-tier architectures becoming common place in today's
|
|
||||||
world, it's becoming increasingly important for programs to be able to handle parallel
|
|
||||||
processing. Modern day operating systems usually provide some support for this
|
|
||||||
through native thread APIs. Unfortunately, writing portable code that makes use
|
|
||||||
of parallel processing in C++ is made very difficult by a lack of a standard interface
|
|
||||||
for these native APIs. Further, these APIs are almost universally C APIs and fail to
|
|
||||||
take advantage of C++'s strengths, or to address C++'s issues.</p>
|
|
||||||
|
|
||||||
<p>The <b>Boost.Threads</b> library is an attempt to define a portable interface for writing
|
|
||||||
parallel processes in C++.</p>
|
|
||||||
|
|
||||||
<h3>Goals</h3>
|
|
||||||
|
|
||||||
<p>The <b>Boost.Threads</b> library has several goals that should help to set it apart from
|
|
||||||
other solutions. These goals are listed in order of precedence with full descriptions
|
|
||||||
below.<p>
|
|
||||||
|
|
||||||
<ul>
|
|
||||||
<li><b>Portability</b>
|
|
||||||
<p><b>Boost.Threads</b> was designed to be highly portable. The goal is for the
|
|
||||||
interface to be easily implemented on any platform that supports threads,
|
|
||||||
and possibly even on platforms without native thread support.</p>
|
|
||||||
<li><b>Safety</b>
|
|
||||||
<p><b>Boost.Threads</b> was designed to be as safe as possible. Writing
|
|
||||||
<a href="definitions.html#Thread-safe">thread-safe</a>
|
|
||||||
code is very difficult and successful libraries must strive to insulate
|
|
||||||
the programmer from dangerous constructs as much as possible. This is accomplished
|
|
||||||
in several ways:</p>
|
|
||||||
<ul>
|
|
||||||
<li><p align="left">C++ language features are used make correct usage easy (if possible,
|
|
||||||
the default) and error-prone impossible or at least more difficult.
|
|
||||||
For example, see the <a href="mutex_concept.html">Mutex</a> and <a href="lock_concept.html">Lock</a>
|
|
||||||
designs, and how note how they interact.</p></li>
|
|
||||||
<li>
|
|
||||||
<p align="left">Certain traditional concurrent programming features
|
|
||||||
are considered so error-prone that they are not provided at all. For
|
|
||||||
example, see the <a href="rationale.html#Events">Events Not Provided</a>
|
|
||||||
rationale.</p>
|
|
||||||
</li>
|
|
||||||
<li>
|
|
||||||
<p align="left">Dangerous features, or features which may be misused,
|
|
||||||
are identified as such in the documentation to make users aware of
|
|
||||||
potential pitfalls. For example, see <a href="semaphore.html#Danger">Semaphore</a>.</p>
|
|
||||||
</li>
|
|
||||||
</ul>
|
|
||||||
<li><b>Flexibility</b>
|
|
||||||
<p><b>Boost.Threads</b> was designed to be flexible. This goal is often at odds
|
|
||||||
with <i>safety</i>. When functionality might be compromised by the desire
|
|
||||||
to keep the interface safe, <b>Boost.Threads</b> has been designed to provide
|
|
||||||
the functionality, but to make it's use prohibitive for general use.</p>
|
|
||||||
<li><b>Efficiency</b>
|
|
||||||
<p><b>Boost.Threads</b> was designed to be as efficient as possible. When building
|
|
||||||
a library on top of another library there is always a danger that the result
|
|
||||||
will be so much slower than the "native" API that programmers are inclined
|
|
||||||
to ignore the higher level API. <b>Boost.Threads</b> was designed to minimize the
|
|
||||||
chances of this occurring. The interfaces have been crafted to allow an
|
|
||||||
implementation the greatest chance of being as efficient as possible. This
|
|
||||||
goal is often at odds with the goal for <i>safety</i>. Every effort was made to
|
|
||||||
ensure efficient implementations, but when in conflict <i>safety</i> has always taken
|
|
||||||
precedence.</p>
|
|
||||||
</li>
|
|
||||||
</ul>
|
|
||||||
|
|
||||||
<h3>Iterative Phases</h3>
|
|
||||||
|
|
||||||
<p>Another goal of <b>Boost.Threads</b> was to take a dynamic, iterative
|
|
||||||
approach in its development. The computing industry is still exploring the concepts of parallel programming.
|
|
||||||
Most thread libraries supply only simple primitive concepts for thread synchronization.
|
|
||||||
These concepts are very simple, but they are very difficult to use safely or to provide
|
|
||||||
formal proofs for constructs built on top of them. Until recently, these primitives
|
|
||||||
were "state of the art" and the only concepts available to programmers. Recently
|
|
||||||
there has been a lot of research in other concepts, such as in "Communicating Sequential
|
|
||||||
Processes." <b>Boost.Threads</b> was designed in iterative steps, providing the building
|
|
||||||
blocks necessary for the next step, and giving the researcher the tools necessary to
|
|
||||||
explore new concepts in a portable manner.</p>
|
|
||||||
|
|
||||||
<p>Given the goal of following a dynamic, iterative approach <b>Boost.Threads</b> shall go through
|
|
||||||
several growth cycles. Each phase in its development shall be roughly documented here.</p>
|
|
||||||
|
|
||||||
<h4>Phase 1, Synchronization Primitives</h4>
|
|
||||||
|
|
||||||
<p>Boost is all about providing high quality libraries with implementations for many platforms.
|
|
||||||
Unfortunately, there's a big problem faced by developers wishing to supply such high quality
|
|
||||||
libraries, namely thread-safety. The C++ standard doesn't address threads at all, but real
|
|
||||||
world programs often make use of native threading support. A portable library that doesn't
|
|
||||||
address the issue of thread-safety is there for not much help to a programmer who wants to
|
|
||||||
use the library in his multi-threaded application. So there's a very great need for portable
|
|
||||||
primitives that will allow the library developer to create <a href="file:///c:/boost/site/libs/thread/doc/definitions.html#Thread-safe">thread-safe</a>
|
|
||||||
implementations. This
|
|
||||||
need far out weighs the need for portable methods to create and manage threads.</p>
|
|
||||||
|
|
||||||
<p>Because of this need, the first phase of <b>Boost.Threads</b> focuses solely on providing
|
|
||||||
portable primitive concepts for thread synchronization. Types provided in this phase include
|
|
||||||
the <A href="semaphore.html">semaphore</a>, <A href="mutex.html">mutex/try_mutex/timed_mutex</a>,
|
|
||||||
<A href="recursive_mutex.html">recursive_mutex/recursive_try_mutex/recursive_timed_mutex</a>,
|
|
||||||
<A href="scoped_lock.html">scoped_lock</a>, <A href="scoped_try_lock.html">scoped_try_lock</a>,
|
|
||||||
<A href="scoped_timed_lock.html">scoped_timed_lock</a> and <A href="lock_error.html">lock_error</a>.
|
|
||||||
These are considered the "core" synchronization primitives, though there are others that will
|
|
||||||
be added in later phases.</p>
|
|
||||||
|
|
||||||
<h4>Phase 2, Thread Management and Thread Specific Storage</h4>
|
|
||||||
|
|
||||||
<p>This phase addresses the creation and management of threads and provides a mechanism for
|
|
||||||
thread specific storage (data associated with a thread instance). Thread management is a tricky
|
|
||||||
issue in C++, so this phase addresses only the basic needs of multi-threaded program. Later
|
|
||||||
phases are likely to add additional functionality in this area. This phase of <b>Boost.Threads</b>
|
|
||||||
adds the <A href="thread.html">thread</a> and
|
|
||||||
<A href="thread_specific_ptr.html">thread_specific_ptr</a> types. With these additions
|
|
||||||
the <b>Boost.Threads</b> library can be considered minimal but complete.</p>
|
|
||||||
|
|
||||||
<h4>The Next Phase</h4>
|
|
||||||
|
|
||||||
<p>The next phase will address more advanced synchronization concepts, such as read/write mutexes
|
|
||||||
and barriers.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->03 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39333" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <A href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
@@ -1,242 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<title>Boost.Threads, Lock Concept</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">Lock Concepts</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><a href="#Introduction">Introduction</a><br>
|
|
||||||
<a href="#Requirements">Concept Requirements</a><br>
|
|
||||||
<a href="#Lock">Lock Concept</a><br>
|
|
||||||
<a href="#ScopedLock">ScopedLock Concept</a><br>
|
|
||||||
<a href="#ScopedTryLock">ScopedTryLock Concept</a><br>
|
|
||||||
<a href="#ScopedTimedLock">ScopedTimedLock Concept</a><br>
|
|
||||||
<a href="#Models">Models</a></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>The lock concepts provide exception safe means for locking and unlocking a
|
|
||||||
<a href="mutex_concept.html">mutex model</a>. In other words they are an
|
|
||||||
implementation of the <i>Scoped Locking</i>
|
|
||||||
<a href="bibliography.html#Schmidt 00">[Schmidt 00]</a> pattern. The
|
|
||||||
<a href="#ScopedLock">ScopedLock</a> concept, with
|
|
||||||
<a href="#ScopedTryLock">ScopedTryLock</a> and
|
|
||||||
<a href="#ScopedTimedLock">ScopedTimedLock</a> refinements, formalize the
|
|
||||||
requirements.</p>
|
|
||||||
|
|
||||||
<p>Lock models are constructed with a reference to a
|
|
||||||
<a href="mutex_concept.html">mutex model</a> and typically acquire ownership of the
|
|
||||||
<a href="mutex_concept.html">mutex model</a> by setting its state to locked. They also
|
|
||||||
ensure ownership is relinquished in the destructor. Lock models also expose functions
|
|
||||||
to query the lock status and to manually lock and unlock the
|
|
||||||
<a href="mutex_concept.html">mutex model</a>.</p>
|
|
||||||
|
|
||||||
<p>Instances of lock models are meant to be short lived, expected to be used at block
|
|
||||||
scope only. The lock models are not
|
|
||||||
<a href="definitions.html#Thread-safe">thread-safe</a>. Lock models must maintain state
|
|
||||||
to indicate whether or not they've been locked and this state is not protected by any
|
|
||||||
synchronization concepts. For this reason an instance of a lock model should never be
|
|
||||||
shared between multiple threads.</p>
|
|
||||||
|
|
||||||
<h2>Concept <a name="Requirements">Requirements</a></h2>
|
|
||||||
|
|
||||||
<p>[For documentation purposes, portions of the concept requirements are
|
|
||||||
repeated in the documentation for specific lock classes. Those copies need
|
|
||||||
to be kept in sync with the requirements here.]</p>
|
|
||||||
|
|
||||||
<h3><a name="Lock">Lock</a> Concept</h3>
|
|
||||||
|
|
||||||
<p>For a <a href="#ScopedLock"> ScopedLock</a>,
|
|
||||||
<a href="#ScopedTryLock">ScopedTryLock</a>, or
|
|
||||||
<a href="#ScopedTimedLock">ScopedTimedLock</a> type <code>L</code> and an object
|
|
||||||
<code>lk</code> and const object <code>clk</code> of that type, the following expressions
|
|
||||||
must be well-formed and have the indicated effects.</p>
|
|
||||||
|
|
||||||
<p>The Lock concept is used as a base for the <a href="#ScopedLock">ScopedLock</a>,
|
|
||||||
<a href="#ScopedTryLock">ScopedTryLock</a>, and
|
|
||||||
<a href="#ScopedTimedLock">ScopedTimedLock</a> refinements. The associated mutex type
|
|
||||||
is as specified for each of those refinements respectively.</p>
|
|
||||||
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><b>Expression</b></td>
|
|
||||||
<td><b>Effects</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code>(&lk)->~L();</code></td>
|
|
||||||
<td><code>if (locked()) unlock();</code></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code>(&clk)->operator const void*()</code></td>
|
|
||||||
<td>Returns type void*, non-zero if if the associated mutex has been locked
|
|
||||||
by <code>clk</code>, otherwise 0.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code>clk.locked()</code></td>
|
|
||||||
<td>Returns a <code>bool</code>, <code>(&clk)->operator const void*() != 0</code></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code>lk.lock()</code></td>
|
|
||||||
<td>Throws lock_error if locked(). If the associated mutex is already locked by some other
|
|
||||||
thread, places the current thread in the
|
|
||||||
<a href="definitions.html#State">Blocked</a> state until the associated mutex is
|
|
||||||
unlocked, after which the current thread is placed in the
|
|
||||||
<a href="definitions.html#State">Ready</a> state, eventually to be returned to the
|
|
||||||
<a href="definitions.html#State">Running</a> state.<br>
|
|
||||||
Postcondition: locked()</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code>lk.unlock()</code></td>
|
|
||||||
<td>If !locked(), throws lock_error, otherwise unlocks the associated mutex.<br>
|
|
||||||
Postcondition: !locked()</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<h3><a name="ScopedLock">ScopedLock</a> Concept</h3>
|
|
||||||
|
|
||||||
<p>A ScopedLock must meet the <a href="#Lock">Lock</a> requirements. For a ScopedLock
|
|
||||||
type <code>L</code> and an object <code>lk</code> of that type,
|
|
||||||
and an object <code>m</code> of a type meeting the
|
|
||||||
<a href="mutex_concept.html#Mutex">Mutex</a> requirements, and an object <code>b</code>
|
|
||||||
of type <code>bool</code>, the following expressions must be well-formed and have the
|
|
||||||
indicated effects.</p>
|
|
||||||
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><b>Expression</b></td>
|
|
||||||
<td><b>Effects</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code>L lk(m);</code></td>
|
|
||||||
<td>Constructs an object <code>lk</code>, and associates mutex <code>m</code> with
|
|
||||||
it, then calls <code>lock()</code></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code>L lk(m,b);</code></td>
|
|
||||||
<td>Constructs an object <code>lk</code>, and associates mutex <code>m</code> with
|
|
||||||
it, then if <code>b</code>, calls <code>lock()</code></td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<h3><a name="ScopedTryLock">ScopedTryLock</a> Concept</h3>
|
|
||||||
|
|
||||||
<p>A ScopedTryLock must meet the <a href="#Lock">Lock</a> requirements. For a
|
|
||||||
ScopedTryLock type <code>L</code> and an object <code>lk</code> of that type,
|
|
||||||
and an object <code>m</code> of a type meeting the
|
|
||||||
<a href="mutex_concept.html#TryMutex">TryMutex</a> requirements, and an object
|
|
||||||
<code>b</code> of type <code>bool</code>, the following expressions must be well-formed
|
|
||||||
and have the indicated effects.</p>
|
|
||||||
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><b>Expression</b></td>
|
|
||||||
<td><b>Effects</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code>L lk(m);</code></td>
|
|
||||||
<td>Constructs an object <code>lk</code>, and associates mutex <code>m</code> with
|
|
||||||
it, then calls <code>try_lock()</code></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code>L lk(m,b);</code></td>
|
|
||||||
<td>Constructs an object <code>lk</code>, and associates mutex <code>m</code> with
|
|
||||||
it, then if <code>b</code>, calls <code>lock()</code></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code>lk.try_lock()</code></td>
|
|
||||||
<td>If locked(), throws <code>lock_error</code>. Makes a non-blocking attempt to
|
|
||||||
lock the associated mutex, returning <code>true</code> if the lock attempt is
|
|
||||||
successful, otherwise <code>false</code>.</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<h3><a name="ScopedTimedLock">ScopedTimedLock</a> Concept</h3>
|
|
||||||
|
|
||||||
<p>A ScopedTimedLock must meet the <a href="#Lock">Lock</a> requirements. For a
|
|
||||||
ScopedTimedLock type <code>L</code> and an object <code>lk</code> of that type,
|
|
||||||
and an object <code>m</code> of a type meeting the
|
|
||||||
<a href="mutex_concept.html#TimedMutex">TimedMutex</a> requirements, and an object
|
|
||||||
<code>b</code> of type <code>bool</code>, and an object <code>t</code> of type
|
|
||||||
<code><a href="xtime.html">xtime</a></code>, the following expressions must be well-formed and have the indicated
|
|
||||||
effects.</p>
|
|
||||||
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><b>Expression</b></td>
|
|
||||||
<td><b>Effects</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code>L lk(m,t);</code></td>
|
|
||||||
<td>Constructs an object <code>lk</code>, and associates mutex <code>m</code> with
|
|
||||||
it, then calls <code>timed_lock(t)</code></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code>L lk(m,b);</code></td>
|
|
||||||
<td>Constructs an object <code>lk</code>, and associates mutex <code>m</code> with
|
|
||||||
it, then if <code>b</code>, calls <code>lock()</code></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code>lk.timed_lock(t)</code></td>
|
|
||||||
<td>If locked(), throws lock_error. Makes a blocking attempt to lock the
|
|
||||||
associated mutex, and returns <code>true</code> if successful within the specified
|
|
||||||
time <code>t</code>, otherwise <code>false</code>.</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<h2><a name="Models">Models</a></h2>
|
|
||||||
|
|
||||||
<p><b>Boost.Threads</b> currently supplies three classes which model lock concepts.</p>
|
|
||||||
|
|
||||||
<p>These classes are normally accessed via typedefs of the same name supplied by
|
|
||||||
a <a href="mutex_concept.html">mutex model</a>.</p>
|
|
||||||
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><b>Concept</b></td>
|
|
||||||
<td><b>Refines</b></td>
|
|
||||||
<td><b>Classes Modeling the Concept</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td><a href="#ScopedLock">ScopedLock</a></td>
|
|
||||||
<td> </td>
|
|
||||||
<td><a href="scoped_lock.html">scoped_lock</a></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td><a href="#ScopedTryLock">ScopedTryLock</a></td>
|
|
||||||
<td><a href="#ScopedLock">ScopedLock</a></td>
|
|
||||||
<td><a href="scoped_try_lock.html">scoped_try_lock</a> </td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td><a href="#ScopedTimedLock">ScopedTimedLock</a></td>
|
|
||||||
<td><a href="#ScopedLock">ScopedLock</a></td>
|
|
||||||
<td><a href="scoped_timed_lock.html">scoped_timed_lock</a></td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->04 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39335" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
@@ -1,111 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, lock_error</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">lock_error</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><a href="#Introduction">Introduction</a><br>
|
|
||||||
<a href="#Header">Header</a><br>
|
|
||||||
<a href="#Synopsis">Synopsis</a><br>
|
|
||||||
<a href="#Members">Members</a><br>
|
|
||||||
<a href="#Example">Example</a></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>The <tt>lock_error</tt> class defines an exception type thrown to indicate a
|
|
||||||
locking related error has been detected. Examples of such errors include a lock
|
|
||||||
operation which can be determined to result in a deadlock, or unlock operations
|
|
||||||
attempted by a thread that does not own the lock.</p>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/thread.hpp"><boost/thread/thread.hpp></a>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Synopsis">Synopsis</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost
|
|
||||||
|
|
||||||
class lock_error : public std::runtime_error
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
lock_error();
|
|
||||||
};
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Members">Members</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
lock_error();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>Constructs a <tt>lock_error</tt> object.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2><a name="Example">Example</a> Usage</h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/mutex.hpp"><boost/thread/mutex.hpp></a>
|
|
||||||
#include <a href="../../../boost/thread/thread.hpp"><boost/thread/thread.hpp></a>
|
|
||||||
#include <iostream>
|
|
||||||
|
|
||||||
int main(int, char*[])
|
|
||||||
{
|
|
||||||
boost::mutex mutex;
|
|
||||||
boost::mutex::scoped_lock scoped_lock(mutex);
|
|
||||||
try
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock deadlock(mutex);
|
|
||||||
std::cout << "lock succeeded" << std::endl;
|
|
||||||
}
|
|
||||||
catch (boost::lock_error& err)
|
|
||||||
{
|
|
||||||
std::cout << err.what() << " - deadlock occurred." << std::endl;
|
|
||||||
}
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>The output is:</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
thread lock error - deadlock occurred.
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->10 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39328" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
319
doc/mutex.html
319
doc/mutex.html
@@ -1,319 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, mutex</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#ffffff" link="#0000ff" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><IMG alt="C++ Boost" src="../../../c++boost.gif" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">mutex<br>
|
|
||||||
try_mutex<br>
|
|
||||||
timed_mutex</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><a href="#Introduction">Introduction</a><br>
|
|
||||||
<a href="#Header">Header</a><br>
|
|
||||||
<a href="#mutex Synopsis">Class mutex Synopsis</a><br>
|
|
||||||
<a href="#mutex Members">Class mutex Members</a><br>
|
|
||||||
<a href="#try_mutex Synopsis">Class try_mutex Synopsis</a><br>
|
|
||||||
<a href="#try_mutex Members">Class try_mutex Members</a><br>
|
|
||||||
<a href="#timed_mutex Synopsis">Class timed_mutex Synopsis</a><br>
|
|
||||||
<a href="#timed_mutex Members">Class timed_mutex Members</a><br>
|
|
||||||
<a href="#Example">Example</a></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>The <tt><a href="#mutex Synopsis">mutex</a></tt>, <tt><a href="#try_mutex Synopsis">try_mutex</a></tt> and <tt><a href="#timed_mutex Synopsis">timed_mutex</a></tt> classes define full featured
|
|
||||||
models of the <a href="mutex_concept.html#Mutex">Mutex</a>, <a href="mutex_concept.html#TryMutex">TryMutex</a>,
|
|
||||||
and <a href="mutex_concept.html#TimedMutex">TimedMutex</a> concepts. These types should be used to
|
|
||||||
non-recursively synchronize access to
|
|
||||||
shared resources. For recursive locking mechanics, see <a href="recursive_mutex.html">recursive
|
|
||||||
mutexes</a>.</p>
|
|
||||||
|
|
||||||
<p>Each class supplies one or more typedefs for lock types which model matching
|
|
||||||
lock concepts. For the best possible performance you should use the mutex class that supports
|
|
||||||
the minimum set of lock
|
|
||||||
types that you need.</p>
|
|
||||||
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><b>Mutex Class</b></td>
|
|
||||||
<td><b>Lock name</b></td>
|
|
||||||
<td><b>Implementation defined Lock Type</b></td>
|
|
||||||
<td><b> Lock Concept</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><a href="#mutex Synopsis"><code>mutex</code></a></td>
|
|
||||||
<td valign="middle"><code>scoped_lock</code></td>
|
|
||||||
<td valign="middle"><code><a href="scoped_lock.html">boost::</a></code><a href="scoped_lock.html"><code>detail::thread::scoped_lock<mutex></code></a></td>
|
|
||||||
<td valign="middle"><a href="lock_concept.html#ScopedLock">ScopedLock</a></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><tt><a href="#try_mutex Synopsis">try_mutex</a></tt> </td>
|
|
||||||
<td valign="middle"><code>scoped_lock<br>
|
|
||||||
scoped_try_lock</code></td>
|
|
||||||
<td valign="middle"><code><a href="scoped_lock.html">boost::</a></code><a href="scoped_lock.html"><code>detail::thread::scoped_lock<try_mutex><br>
|
|
||||||
</code></a><code><a href="scoped_try_lock.html">boost::detail::thread::scoped_try_lock<try_mutex></a></code></td>
|
|
||||||
<td valign="middle"><a href="lock_concept.html#ScopedLock">ScopedLock</a><br>
|
|
||||||
<a href="lock_concept.html#ScopedTryLock">ScopedTryLock</a></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code><a href="#timed_mutex Synopsis">timed_mutex</a></code> </td>
|
|
||||||
<td valign="middle"><code>scoped_lock<br>
|
|
||||||
scoped_try_lock<br>
|
|
||||||
scoped_timed_lock</code></td>
|
|
||||||
<td valign="middle"><code><a href="scoped_lock.html">boost::</a></code><a href="scoped_lock.html"><code>detail::thread::scoped_lock<timed_mutex></code></a><br>
|
|
||||||
<code><a href="scoped_try_lock.html">boost::</a></code><a href="scoped_try_lock.html"><code>detail::thread::scoped_try_lock<timed_mutex></code></a><br>
|
|
||||||
<code><a href="scoped_timed_lock.html">boost::</a></code><a href="scoped_timed_lock.html"><code>detail::thread::scoped_timed_lock<timed_mutex></code></a></td>
|
|
||||||
<td valign="middle"><a href="lock_concept.html#ScopedLock">ScopedLock</a><br>
|
|
||||||
<a href="lock_concept.html#ScopedTryLock">ScopedTryLock</a><br>
|
|
||||||
<a href="lock_concept.html#ScopedTimedLock">ScopedTimedLock</a></td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<p>The <tt>mutex</tt>, <tt>try_mutex</tt> and <tt>timed_mutex</tt> classes use an <tt>Unspecified</tt>
|
|
||||||
<A href="mutex_concept.html#LockingStrategies">locking strategy</a>, so attempts to recursively lock
|
|
||||||
them or attempts to unlock them by threads that don't own a lock on them result in <b>undefined behavior</b>.
|
|
||||||
This strategy allows implementations to be as efficient as possible on any given platform. It is, however,
|
|
||||||
recommended that implementations include debugging support to detect misuse when <tt>NDEBUG</tt> is
|
|
||||||
not defined.</p>
|
|
||||||
|
|
||||||
<p>Like all the <b>Boost.Threads</b> <A href="mutex_concept.html">mutex models</a>, the <tt>mutex</tt>,
|
|
||||||
<tt>try_mutex</tt> and <tt>timed_mutex</tt> leave the
|
|
||||||
<A href="mutex_concept.html#SchedulingPolicies">scheduling policy</a> as <tt>Unspecified</tt>.
|
|
||||||
Programmers should assume that threads waiting for a lock on objects of these types
|
|
||||||
acquire
|
|
||||||
the lock in a random order, even though the specific behavior for a given platform may be different.</p>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/mutex.hpp"><boost/thread/mutex.hpp></a>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2>Class <a name="mutex Synopsis"> mutex Synopsis</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost
|
|
||||||
{
|
|
||||||
class mutex : private <a href="../../utility/utility.htm">boost::noncopyable</a> // Exposition only.
|
|
||||||
// Class mutex meets the <a href="overview.html#NonCopyable">NonCopyable</a> requirement.
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef <i>[implementation defined; see <a href="#Introduction">Introduction</a>]</i> scoped_lock;
|
|
||||||
|
|
||||||
mutex();
|
|
||||||
~mutex();
|
|
||||||
};
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2>
|
|
||||||
Class <a name="mutex Members">mutex Members</a>
|
|
||||||
</h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
mutex();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Postconditions: </b><code>*this</code> is in the unlocked state.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~mutex();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> <code>*this</code> is in the unlocked state.</p>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Destroys <code>*this</code>.</p>
|
|
||||||
|
|
||||||
<p><b>Dangers:</b> Destruction of a locked mutex is a serious programming error
|
|
||||||
resulting in undefined behavior such as a program crash.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2>
|
|
||||||
Class <a name="try_mutex Synopsis">try_mutex Synopsis</a>
|
|
||||||
</h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost
|
|
||||||
{
|
|
||||||
class try_mutex : private boost::noncopyable // Exposition only.
|
|
||||||
// Class try_mutex meets the <a href="overview.html#NonCopyable">NonCopyable</a> requirement.
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef <i>[implementation defined; see <a href="#Introduction">Introduction</a>]</i> scoped_lock;
|
|
||||||
typedef <i>[implementation defined; see <a href="#Introduction">Introduction</a>]</i> scoped_try_lock;
|
|
||||||
|
|
||||||
try_mutex();
|
|
||||||
~try_mutex();
|
|
||||||
};
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2>Class <a name="try_mutex Members">try_mutex Members</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
try_mutex();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Postconditions: </b><code>*this</code> is in the unlocked state.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~try_mutex();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> <code>*this</code> is in the unlocked state.</p>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Destroys <code>*this</code>.</p>
|
|
||||||
|
|
||||||
<p><b>Dangers:</b> Destruction of a locked mutex is a serious programming error
|
|
||||||
resulting in undefined behavior such as a program crash.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2>
|
|
||||||
Class <a name="timed_mutex Synopsis">timed_mutex Synopsis</a>
|
|
||||||
</h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost
|
|
||||||
{
|
|
||||||
class timed_mutex : private boost::noncopyable // Exposition only.
|
|
||||||
// Class timed_mutex meets the <a href="overview.html#NonCopyable">NonCopyable</a> requirement.
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef <i>[implementation defined; see <a href="#Introduction">Introduction</a>]</i> scoped_lock;
|
|
||||||
typedef <i>[implementation defined; see <a href="#Introduction">Introduction</a>]</i> scoped_try_lock;
|
|
||||||
typedef <i>[implementation defined; see <a href="#Introduction">Introduction</a>]</i> scoped_timed_lock;
|
|
||||||
|
|
||||||
timed_mutex();
|
|
||||||
~timed_mutex();
|
|
||||||
};
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2>Class <a name="timed_mutex Members">timed_mutex Members</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
timed_mutex();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Postconditions: </b><code>*this</code> is in the unlocked state.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~timed_mutex();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> <code>*this</code> is in the unlocked state.</p>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Destroys <code>*this</code>.</p>
|
|
||||||
|
|
||||||
<p><b>Dangers:</b> Destruction of a locked mutex is a serious programming error
|
|
||||||
resulting in undefined behavior such as a program crash.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2><a name="Example">Example</a> Usage</h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/mutex.hpp"><boost/thread/mutex.hpp></a>
|
|
||||||
#include <a href="../../../boost/thread/thread.hpp"><boost/thread/thread.hpp></a>
|
|
||||||
#include <iostream>
|
|
||||||
|
|
||||||
boost::mutex io_mutex; // The iostreams are not guaranteed to be <a href="file:///c:/boost/site/libs/thread/doc/definitions.html#Thread-safe">thread-safe</a>!
|
|
||||||
|
|
||||||
class counter
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
counter() : count(0) { }
|
|
||||||
|
|
||||||
int increment() {
|
|
||||||
boost::mutex::scoped_lock scoped_lock(mutex);
|
|
||||||
return ++count;
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
boost::mutex mutex;
|
|
||||||
int count;
|
|
||||||
};
|
|
||||||
|
|
||||||
counter c;
|
|
||||||
|
|
||||||
void change_count(void*)
|
|
||||||
{
|
|
||||||
int i = c.increment();
|
|
||||||
boost::mutex::scoped_lock scoped_lock(io_mutex);
|
|
||||||
std::cout << "count == " << i << std::endl;
|
|
||||||
}
|
|
||||||
|
|
||||||
int main(int, char*[])
|
|
||||||
{
|
|
||||||
const int num_threads = 4;
|
|
||||||
boost::thread_group thrds;
|
|
||||||
for (int i=0; i < num_threads; ++i)
|
|
||||||
thrds.create_thread(&change_count, 0);
|
|
||||||
|
|
||||||
thrds.join_all();
|
|
||||||
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>The output is:</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
count == 1
|
|
||||||
count == 2
|
|
||||||
count == 3
|
|
||||||
count == 4
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->13 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39334" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <A href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
@@ -1,275 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<title>Boost.Threads, Mutex Concept</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#ffffff" link="#0000ff" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><IMG height=86 alt="C++ Boost" src="../../../c++boost.gif" width=277></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">Mutex Concepts</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><a href="#Introduction">Introduction</a><br>
|
|
||||||
<a href="#LockingStrategies">Locking Strategies</a><br>
|
|
||||||
<a href="#Recursive">Recursive</a><br>
|
|
||||||
<a href="#CheckedStrategy">Checked</a><br>
|
|
||||||
<a href="#UncheckedStrategy">Unchecked</a><br>
|
|
||||||
<a href="#UnspecifiedStrategy">Unspecified</a><br>
|
|
||||||
<a href="#SchedulingPolicies">Scheduling Policies</a><br>
|
|
||||||
<a href="#FIFO">FIFO</a><br>
|
|
||||||
<a href="#Priority Driven">Priority Driven</a><br>
|
|
||||||
<a href="#UndefinedScheduling">Undefined</a><br>
|
|
||||||
<a href="#UnspecifiedScheduling">Unspecified</a><br>
|
|
||||||
<a href="#Requirements">Concept Requirements</a><br>
|
|
||||||
<a href="#Mutex">Mutex Concept</a><br>
|
|
||||||
<a href="#TryMutex">TryMutex Concept</a><br>
|
|
||||||
<a href="#TimedMutex">TimedMutex Concept</a><br>
|
|
||||||
<a href="#Models">Models</a></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>A mutex (short for mutual-exclusion) concept serializes access to
|
|
||||||
a resource shared between multiple threads. The <a href="#Mutex">Mutex</a>
|
|
||||||
concept, with <a href="#TryMutex">TryMutex</a> and <a href="#TimedMutex">TimedMutex</a>
|
|
||||||
refinements, formalize the requirements. A model that implements Mutex and its
|
|
||||||
refinements has two states: <b> locked</b> and <b>unlocked</b>. Before using a
|
|
||||||
shared resource, a thread locks a Boost.Threads mutex model object,
|
|
||||||
insuring <a href="definitions.html#Thread-safe">thread-safe</a> access to the shared
|
|
||||||
resource. When use of the shared resource is complete, the thread unlocks the mutex
|
|
||||||
model object, allowing another thread to acquire the lock and use the shared resource.</p>
|
|
||||||
|
|
||||||
<p>Traditional C thread APIs, like Pthreads or the Windows thread APIs, expose
|
|
||||||
functions to lock and unlock a mutex model. This is dangerous since it's easy to forget
|
|
||||||
to unlock a locked mutex. When the flow of control is complex, with multiple return
|
|
||||||
points, the likelihood of forgetting to unlock a mutex model would become even greater.
|
|
||||||
When exceptions are thrown, it becomes nearly impossible to ensure that the mutex is
|
|
||||||
unlocked properly when using these traditional API's. The result is
|
|
||||||
<a href="definitions.html#Deadlock">deadlock</a>.</p>
|
|
||||||
|
|
||||||
<p>Many C++ threading libraries use a pattern known as <i>Scoped Locking</i>
|
|
||||||
<a href="bibliography.html#Schmidt 00">[Schmidt 00]</a> to free the programmer from the
|
|
||||||
need to explicitly lock and unlock mutexes. With this pattern, a
|
|
||||||
<A href="lock_concept.html">lock concept</A> is employed where the lock model's
|
|
||||||
constructor locks the associated mutex model and the destructor automatically does the
|
|
||||||
unlocking. The <b>Boost.Threads</b> library takes this pattern to the extreme in that
|
|
||||||
lock concepts are the only way to lock and unlock a mutex model: lock and unlock
|
|
||||||
functions are not exposed by any <b>Boost.Threads </b>mutex models. This helps to
|
|
||||||
ensure safe usage patterns, especially when code throws exceptions.</p>
|
|
||||||
|
|
||||||
<h2><a name="LockingStrategies">Locking Strategies</a></h2>
|
|
||||||
|
|
||||||
<p>Every mutex model follows one of several locking strategies. These strategies
|
|
||||||
define the semantics for the locking operation when the calling thread already
|
|
||||||
owns a lock on the mutex model.</p>
|
|
||||||
|
|
||||||
<h3><a name="Recursive">Recursive</a></h3>
|
|
||||||
|
|
||||||
<p>With a recursive locking strategy when a thread attempts to acquire a lock on
|
|
||||||
the mutex model for which it already owns a lock, the operation is successful.
|
|
||||||
Note the distinction between a thread, which may have multiple locks outstanding
|
|
||||||
on a recursive mutex, and a lock object, which even for a recursive mutex cannot
|
|
||||||
have its lock() function called multiple times without first calling unlock().</p>
|
|
||||||
|
|
||||||
<p>Internally a lock count is maintained and the owning thread must unlock the
|
|
||||||
mutex model the same number of times that it's locked it before the mutex model's
|
|
||||||
state returns to unlocked. Since mutex models in <b>Boost.Threads</b> expose
|
|
||||||
locking functionality only through lock concepts, a thread will always unlock a mutex
|
|
||||||
model the same number of times that it locked it. This helps to eliminate a whole set
|
|
||||||
of errors typically found in traditional C style thread APIs.</p>
|
|
||||||
|
|
||||||
<p>Classes <A href="recursive_mutex.html">recursive_mutex</A>,
|
|
||||||
<A href="recursive_mutex.html">recursive_try_mutex</A> and
|
|
||||||
<A href="recursive_mutex.html">recursive_timed_mutex</A> use this locking strategy.</p>
|
|
||||||
|
|
||||||
<h3><a name="CheckedStrategy">Checked</a></h3>
|
|
||||||
|
|
||||||
<p>With a checked locking strategy when a thread attempts to acquire a lock on
|
|
||||||
the mutex model for which the thread already owns a lock, the operation will fail with
|
|
||||||
some sort of error indication. Further, attempts by a thread to unlock a mutex
|
|
||||||
that was not locked by the thread will also return some sort of error indication.
|
|
||||||
In <b>Boost.Threads</b>, an exception of type <A href="lock_error.html">lock_error</A>
|
|
||||||
would be thrown in these cases.</p>
|
|
||||||
|
|
||||||
<p><b>Boost.Threads</b> does not currently provide any mutex models that use this
|
|
||||||
strategy.</p>
|
|
||||||
|
|
||||||
<h3><a name="UncheckedStrategy">Unchecked</a></h3>
|
|
||||||
|
|
||||||
<p>With an unchecked locking strategy when a thread attempts to acquire a lock
|
|
||||||
on the mutex model for which the thread already owns a lock the operation will
|
|
||||||
<a href="definitions.html#Deadlock">deadlock</a>. In general this locking strategy is
|
|
||||||
less safe than a checked or recursive strategy, but it's also a faster strategy and so
|
|
||||||
is employed by many libraries.</p>
|
|
||||||
|
|
||||||
<p><b>Boost.Threads</b> does not currently provide any mutex models that use this
|
|
||||||
strategy.</p>
|
|
||||||
|
|
||||||
<h3><a name="UnspecifiedStrategy">Unspecified</a></h3>
|
|
||||||
|
|
||||||
<p>With an unspecified locking strategy, when a thread attempts to acquire a lock
|
|
||||||
on a mutex model for which the thread already owns a lock the operation results in
|
|
||||||
<b>undefined behavior</b>. When a mutex model has an unspecified locking strategy the
|
|
||||||
programmer must assume that the mutex model instead uses an unchecked strategy.</p>
|
|
||||||
|
|
||||||
<p>In general a mutex model with an unspecified locking strategy is unsafe, and it
|
|
||||||
requires programmer discipline to use the mutex model properly. However, this strategy
|
|
||||||
allows an implementation to be as fast as possible with no restrictions on its
|
|
||||||
implementation. This is especially true for portable implementations that wrap the
|
|
||||||
native threading support of a platform. For this reason, the classes
|
|
||||||
<A href="mutex.html">mutex</A>, <A href="mutex.html">try_mutex</A> and
|
|
||||||
<A href="mutex.html">timed_mutex</A> use this locking strategy despite the lack of
|
|
||||||
safety.</p>
|
|
||||||
|
|
||||||
<h2><a name="SchedulingPolicies">Scheduling Policies</a></h2>
|
|
||||||
|
|
||||||
<p>Every mutex model follows one of several scheduling policies. These policies
|
|
||||||
define the semantics when the mutex model is unlocked and there is more than one
|
|
||||||
thread waiting to acquire a lock. In other words, the policy defines which waiting
|
|
||||||
thread shall acquire the lock.</p>
|
|
||||||
|
|
||||||
<h3><a name="FIFO">FIFO</a></h3>
|
|
||||||
|
|
||||||
<p>With a FIFO scheduling policy, threads waiting for the lock will acquire it in
|
|
||||||
a first come first serve order (or First In First Out). This can help prevent a
|
|
||||||
high priority thread from starving lower priority threads that are also waiting
|
|
||||||
on the mutex lock.</p>
|
|
||||||
|
|
||||||
<h3><a name="Priority Driven">Priority Driven</a></h3>
|
|
||||||
|
|
||||||
<p>With a Priority Driven scheduling policy, the thread with the highest priority
|
|
||||||
acquires the lock. Note that this means that low-priority threads may never acquire
|
|
||||||
the lock if the mutex model has high contention and there is always at least one
|
|
||||||
high-priority thread waiting. This is known as thread starvation. When multiple threads
|
|
||||||
of the same priority are waiting on the mutex lock one of the other scheduling
|
|
||||||
priorities will determine which thread shall acquire the lock.</p>
|
|
||||||
|
|
||||||
<h3><a name="UndefinedScheduling">Undefined</a></h3>
|
|
||||||
|
|
||||||
<p>Threads acquire the lock in no particular order. Users should assume that
|
|
||||||
low-priority threads may wait indefinitely, and that threads of the same
|
|
||||||
priority acquire the lock in essentially random order.</p>
|
|
||||||
|
|
||||||
<h3><a name="UnspecifiedScheduling">Unspecified</a></h3>
|
|
||||||
|
|
||||||
<p>The mutex model does not specify which scheduling policy is used. The programmer
|
|
||||||
must assume that an undefined scheduling policy is used. In order to ensure portability,
|
|
||||||
all <b>Boost.Threads</b> mutex models use an unspecified scheduling policy.</p>
|
|
||||||
|
|
||||||
<h2>Concept <a name="Requirements">Requirements</a></h2>
|
|
||||||
|
|
||||||
<h3><a name="Mutex">Mutex</a> Concept</h3>
|
|
||||||
|
|
||||||
<p>A Mutex object has two states: locked and unlocked. Mutex object state can only be
|
|
||||||
determined by an object meeting the <a href="lock_concept.html#ScopedLock">ScopedLock</a>
|
|
||||||
requirements and constructed for the Mutex object.</p>
|
|
||||||
|
|
||||||
<p>A Mutex is <a href="../../utility/utility.htm#Class noncopyable">noncopyable</a>.</p>
|
|
||||||
|
|
||||||
<p>For a Mutex type M and an object m of that type, the following expressions must be
|
|
||||||
well-formed and have the indicated effects.</p>
|
|
||||||
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><b>Expression</b></td>
|
|
||||||
<td><b>Effects</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td><code>M m;</code></td>
|
|
||||||
<td>Constructs a mutex object m. Post-condition: m is unlocked.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td><code>(&m)->~M();</code></td>
|
|
||||||
<td>Precondition: m is unlocked. Destroys a mutex object m.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td><code>M::scoped_lock</code></td>
|
|
||||||
<td>A type meeting the <a href="lock_concept.html#ScopedLock">ScopedLock</a>
|
|
||||||
requirements.</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<h3><a name="TryMutex">TryMutex</a> Concept</h3>
|
|
||||||
<p>A TryMutex must meet the <a href="#Mutex"> Mutex</a> requirements. In addition, for a
|
|
||||||
TryMutex type M and an object m of that type, the following expressions must be
|
|
||||||
well-formed and have the indicated effects.</p>
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><b>Expression</b></td>
|
|
||||||
<td><b>Effects</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td><code>M::scoped_try_lock</code></td>
|
|
||||||
<td>A type meeting the <a href="lock_concept.html#ScopedTryLock">ScopedTryLock</a>
|
|
||||||
requirements.</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
<h3><a name="TimedMutex">TimedMutex</a> Concept</h3>
|
|
||||||
<p>A TimedMutex must meet the <a href="#TryMutex"> TryMutex</a> requirements. In addition, for a
|
|
||||||
TimedMutex type M and an object m of that type, the following
|
|
||||||
expressions must be well-formed and have the indicated effects.</p>
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><b>Expression</b></td>
|
|
||||||
<td><b>Effects</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td><code>M::scoped_timed_lock</code></td>
|
|
||||||
<td>A type meeting the <a href="lock_concept.html#ScopedTimedLock">ScopedTimedLock</a>
|
|
||||||
requirements.</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<h2><a name="Models">Models</a></h2>
|
|
||||||
|
|
||||||
<p> <b>Boost.Threads</b> currently supplies six classes which model mutex
|
|
||||||
concepts.</p>
|
|
||||||
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><b>Concept</b></td>
|
|
||||||
<td><b>Refines</b></td>
|
|
||||||
<td><b>Classes Modeling the Concept</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><a href="#Mutex">Mutex</a></td>
|
|
||||||
<td valign="top"> </td>
|
|
||||||
<td><A href="mutex.html">mutex</A><br>
|
|
||||||
<A href="recursive_mutex.html">recursive_mutex</A></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><a href="#TryMutex">TryMutex</a></td>
|
|
||||||
<td valign="top"><a href="#Mutex">Mutex</a></td>
|
|
||||||
<td><A href="mutex.html">try_mutex<br>
|
|
||||||
</A><A href="recursive_mutex.html">recursive_try_mutex</A> </td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><a href="#TimedMutex">TimedMutex</a></td>
|
|
||||||
<td valign="top"><a href="#TryMutex">TryMutex</a></td>
|
|
||||||
<td><A href="mutex.html">timed_mutex<br>
|
|
||||||
</A><A href="recursive_mutex.html">recursive_timed_mutex</A></td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->03 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39333" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <A href="mailto:williamkempf@hotmail.com">William E. Kempf</A>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
1279
doc/mutex_concepts.qbk
Normal file
1279
doc/mutex_concepts.qbk
Normal file
File diff suppressed because it is too large
Load Diff
233
doc/mutexes.qbk
Normal file
233
doc/mutexes.qbk
Normal file
@@ -0,0 +1,233 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2007-11 Anthony Williams
|
||||||
|
(C) Copyright 2011-12 Vicente J. Botet Escriba
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[section:mutex_types Mutex Types]
|
||||||
|
|
||||||
|
[section:mutex Class `mutex`]
|
||||||
|
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
|
||||||
|
class mutex:
|
||||||
|
boost::noncopyable
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
mutex();
|
||||||
|
~mutex();
|
||||||
|
|
||||||
|
void lock();
|
||||||
|
bool try_lock();
|
||||||
|
void unlock();
|
||||||
|
|
||||||
|
typedef platform-specific-type native_handle_type;
|
||||||
|
native_handle_type native_handle();
|
||||||
|
|
||||||
|
typedef unique_lock<mutex> scoped_lock;
|
||||||
|
typedef unspecified-type scoped_try_lock;
|
||||||
|
};
|
||||||
|
|
||||||
|
__mutex__ implements the __lockable_concept__ to provide an exclusive-ownership mutex. At most one thread can own the lock on a given
|
||||||
|
instance of __mutex__ at any time. Multiple concurrent calls to __lock_ref__, __try_lock_ref__ and __unlock_ref__ shall be permitted.
|
||||||
|
|
||||||
|
[section:nativehandle Member function `native_handle()`]
|
||||||
|
|
||||||
|
typedef platform-specific-type native_handle_type;
|
||||||
|
native_handle_type native_handle();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Returns an instance of `native_handle_type` that can be used with platform-specific APIs to manipulate the underlying
|
||||||
|
implementation. If no such instance exists, `native_handle()` and `native_handle_type` are not present.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:try_mutex Typedef `try_mutex`]
|
||||||
|
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
|
||||||
|
typedef mutex try_mutex;
|
||||||
|
|
||||||
|
__try_mutex__ is a `typedef` to __mutex__, provided for backwards compatibility with previous releases of boost.
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:timed_mutex Class `timed_mutex`]
|
||||||
|
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
|
||||||
|
class timed_mutex:
|
||||||
|
boost::noncopyable
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
timed_mutex();
|
||||||
|
~timed_mutex();
|
||||||
|
|
||||||
|
void lock();
|
||||||
|
void unlock();
|
||||||
|
bool try_lock();
|
||||||
|
bool timed_lock(system_time const & abs_time); // DEPRECATED V2
|
||||||
|
template<typename TimeDuration>
|
||||||
|
bool timed_lock(TimeDuration const & relative_time); // DEPRECATED V2
|
||||||
|
|
||||||
|
template <class Rep, class Period>
|
||||||
|
bool try_lock_for(const chrono::duration<Rep, Period>& rel_time);
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
bool try_lock_until(const chrono::time_point<Clock, Duration>& t);
|
||||||
|
|
||||||
|
typedef platform-specific-type native_handle_type;
|
||||||
|
native_handle_type native_handle();
|
||||||
|
|
||||||
|
typedef unique_lock<timed_mutex> scoped_timed_lock;
|
||||||
|
typedef unspecified-type scoped_try_lock;
|
||||||
|
typedef scoped_timed_lock scoped_lock;
|
||||||
|
};
|
||||||
|
|
||||||
|
__timed_mutex__ implements the __timed_lockable_concept__ to provide an exclusive-ownership mutex. At most one thread can own the
|
||||||
|
lock on a given instance of __timed_mutex__ at any time. Multiple concurrent calls to __lock_ref__, __try_lock_ref__,
|
||||||
|
__timed_lock_ref__, __timed_lock_duration_ref__ and __unlock_ref__ shall be permitted.
|
||||||
|
|
||||||
|
[section:nativehandle Member function `native_handle()`]
|
||||||
|
|
||||||
|
typedef platform-specific-type native_handle_type;
|
||||||
|
native_handle_type native_handle();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Returns an instance of `native_handle_type` that can be used with platform-specific APIs to manipulate the underlying
|
||||||
|
implementation. If no such instance exists, `native_handle()` and `native_handle_type` are not present.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:recursive_mutex Class `recursive_mutex`]
|
||||||
|
|
||||||
|
#include <boost/thread/recursive_mutex.hpp>
|
||||||
|
|
||||||
|
class recursive_mutex:
|
||||||
|
boost::noncopyable
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
recursive_mutex();
|
||||||
|
~recursive_mutex();
|
||||||
|
|
||||||
|
void lock();
|
||||||
|
bool try_lock();
|
||||||
|
void unlock();
|
||||||
|
|
||||||
|
typedef platform-specific-type native_handle_type;
|
||||||
|
native_handle_type native_handle();
|
||||||
|
|
||||||
|
typedef unique_lock<recursive_mutex> scoped_lock;
|
||||||
|
typedef unspecified-type scoped_try_lock;
|
||||||
|
};
|
||||||
|
|
||||||
|
__recursive_mutex__ implements the __lockable_concept__ to provide an exclusive-ownership recursive mutex. At most one thread can
|
||||||
|
own the lock on a given instance of __recursive_mutex__ at any time. Multiple concurrent calls to __lock_ref__, __try_lock_ref__ and
|
||||||
|
__unlock_ref__ shall be permitted. A thread that already has exclusive ownership of a given __recursive_mutex__ instance can call
|
||||||
|
__lock_ref__ or __try_lock_ref__ to acquire an additional level of ownership of the mutex. __unlock_ref__ must be called once for
|
||||||
|
each level of ownership acquired by a single thread before ownership can be acquired by another thread.
|
||||||
|
|
||||||
|
[section:nativehandle Member function `native_handle()`]
|
||||||
|
|
||||||
|
typedef platform-specific-type native_handle_type;
|
||||||
|
native_handle_type native_handle();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Returns an instance of `native_handle_type` that can be used with platform-specific APIs to manipulate the underlying
|
||||||
|
implementation. If no such instance exists, `native_handle()` and `native_handle_type` are not present.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:recursive_try_mutex Typedef `recursive_try_mutex`]
|
||||||
|
|
||||||
|
#include <boost/thread/recursive_mutex.hpp>
|
||||||
|
|
||||||
|
typedef recursive_mutex recursive_try_mutex;
|
||||||
|
|
||||||
|
__recursive_try_mutex__ is a `typedef` to __recursive_mutex__, provided for backwards compatibility with previous releases of boost.
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:recursive_timed_mutex Class `recursive_timed_mutex`]
|
||||||
|
|
||||||
|
#include <boost/thread/recursive_mutex.hpp>
|
||||||
|
|
||||||
|
class recursive_timed_mutex:
|
||||||
|
boost::noncopyable
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
recursive_timed_mutex();
|
||||||
|
~recursive_timed_mutex();
|
||||||
|
|
||||||
|
void lock();
|
||||||
|
bool try_lock();
|
||||||
|
void unlock();
|
||||||
|
|
||||||
|
bool timed_lock(system_time const & abs_time); // DEPRECATED V2
|
||||||
|
template<typename TimeDuration>
|
||||||
|
bool timed_lock(TimeDuration const & relative_time); // DEPRECATED V2
|
||||||
|
|
||||||
|
template <class Rep, class Period>
|
||||||
|
bool try_lock_for(const chrono::duration<Rep, Period>& rel_time);
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
bool try_lock_until(const chrono::time_point<Clock, Duration>& t);
|
||||||
|
|
||||||
|
typedef platform-specific-type native_handle_type;
|
||||||
|
native_handle_type native_handle();
|
||||||
|
|
||||||
|
typedef unique_lock<recursive_timed_mutex> scoped_lock;
|
||||||
|
typedef unspecified-type scoped_try_lock;
|
||||||
|
typedef scoped_lock scoped_timed_lock;
|
||||||
|
};
|
||||||
|
|
||||||
|
__recursive_timed_mutex__ implements the __timed_lockable_concept__ to provide an exclusive-ownership recursive mutex. At most one
|
||||||
|
thread can own the lock on a given instance of __recursive_timed_mutex__ at any time. Multiple concurrent calls to __lock_ref__,
|
||||||
|
__try_lock_ref__, __timed_lock_ref__, __timed_lock_duration_ref__ and __unlock_ref__ shall be permitted. A thread that already has
|
||||||
|
exclusive ownership of a given __recursive_timed_mutex__ instance can call __lock_ref__, __timed_lock_ref__,
|
||||||
|
__timed_lock_duration_ref__ or __try_lock_ref__ to acquire an additional level of ownership of the mutex. __unlock_ref__ must be
|
||||||
|
called once for each level of ownership acquired by a single thread before ownership can be acquired by another thread.
|
||||||
|
|
||||||
|
[section:nativehandle Member function `native_handle()`]
|
||||||
|
|
||||||
|
typedef platform-specific-type native_handle_type;
|
||||||
|
native_handle_type native_handle();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Returns an instance of `native_handle_type` that can be used with platform-specific APIs to manipulate the underlying
|
||||||
|
implementation. If no such instance exists, `native_handle()` and `native_handle_type` are not present.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[include shared_mutex_ref.qbk]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
65
doc/once.qbk
Normal file
65
doc/once.qbk
Normal file
@@ -0,0 +1,65 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2007-8 Anthony Williams.
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[section:once One-time Initialization]
|
||||||
|
|
||||||
|
`boost::call_once` provides a mechanism for ensuring that an initialization routine is run exactly once without data races or deadlocks.
|
||||||
|
|
||||||
|
[section:once_flag Typedef `once_flag`]
|
||||||
|
|
||||||
|
#include <boost/thread/once.hpp>
|
||||||
|
|
||||||
|
typedef platform-specific-type once_flag;
|
||||||
|
#define BOOST_ONCE_INIT platform-specific-initializer
|
||||||
|
|
||||||
|
Objects of type `boost::once_flag` shall be initialized with `BOOST_ONCE_INIT`:
|
||||||
|
|
||||||
|
boost::once_flag f=BOOST_ONCE_INIT;
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:call_once Non-member function `call_once`]
|
||||||
|
|
||||||
|
#include <boost/thread/once.hpp>
|
||||||
|
|
||||||
|
template<typename Callable>
|
||||||
|
void call_once(once_flag& flag,Callable func);
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Requires:] [`Callable` is `CopyConstructible`. Copying `func` shall have no side effects, and the effect of calling the copy shall
|
||||||
|
be equivalent to calling the original. ]]
|
||||||
|
|
||||||
|
[[Effects:] [Calls to `call_once` on the same `once_flag` object are serialized. If there has been no prior effective `call_once` on
|
||||||
|
the same `once_flag` object, the argument `func` (or a copy thereof) is called as-if by invoking `func()`, and the invocation of
|
||||||
|
`call_once` is effective if and only if `func()` returns without exception. If an exception is thrown, the exception is
|
||||||
|
propagated to the caller. If there has been a prior effective `call_once` on the same `once_flag` object, the `call_once` returns
|
||||||
|
without invoking `func`. ]]
|
||||||
|
|
||||||
|
[[Synchronization:] [The completion of an effective `call_once` invocation on a `once_flag` object, synchronizes with
|
||||||
|
all subsequent `call_once` invocations on the same `once_flag` object. ]]
|
||||||
|
|
||||||
|
[[Throws:] [`thread_resource_error` when the effects cannot be achieved. or any exception propagated from `func`.]]
|
||||||
|
|
||||||
|
[[Note:] [The function passed to `call_once` must not also call
|
||||||
|
`call_once` passing the same `once_flag` object. This may cause
|
||||||
|
deadlock, or invoking the passed function a second time. The
|
||||||
|
alternative is to allow the second call to return immediately, but
|
||||||
|
that assumes the code knows it has been called recursively, and can
|
||||||
|
proceed even though the call to `call_once` didn't actually call the
|
||||||
|
function, in which case it could also avoid calling `call_once`
|
||||||
|
recursively.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
void call_once(void (*func)(),once_flag& flag);
|
||||||
|
|
||||||
|
This second overload is provided for backwards compatibility. The effects of `call_once(func,flag)` shall be the same as those of
|
||||||
|
`call_once(flag,func)`.
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
[endsect]
|
||||||
@@ -1,156 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=windows-1252">
|
|
||||||
<meta name="GENERATOR" content="Microsoft FrontPage 4.0">
|
|
||||||
<meta name="ProgId" content="FrontPage.Editor.Document">
|
|
||||||
<title>Boost.Threads Overview</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body>
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><IMG height=86 alt="C++ Boost" src="../../../c++boost.gif" width=277></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">Overview</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<p><a href="#Introduction">Introduction</a><br>
|
|
||||||
<a href="#Dangers">Dangers</a><br>
|
|
||||||
<a href="#Library">C++ Standard Library usage</a><br>
|
|
||||||
<a href="#Common">Common requirements</a></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
<p>Boost.Threads allows C++ programs to execute as multiple, asynchronous,
|
|
||||||
independent, threads-of-execution. Each thread has its own machine state
|
|
||||||
including program instruction counter and registers. Programs which execute as
|
|
||||||
multiple threads are call multi-threaded programs to distinguish them from
|
|
||||||
traditional single-threaded programs. <a href="definitions.html">Definitions</a>
|
|
||||||
gives a more complete description of the multi-threading execution environment.</p>
|
|
||||||
<p>Multi-threading provides several advantages:</p>
|
|
||||||
<ul>
|
|
||||||
<li>Programs which would otherwise block waiting for some external event can
|
|
||||||
continue to respond if the blocking operation is placed in a separate
|
|
||||||
thread. Multi-threading is usually an absolute requirement for these
|
|
||||||
programs.</li>
|
|
||||||
</ul>
|
|
||||||
<ul>
|
|
||||||
<li>Well-designed multi-threaded programs may execute faster than single-threaded
|
|
||||||
programs, particularly on multi-processor hardware.
|
|
||||||
Note, however, that poorly-designed multi-threaded programs are often slower
|
|
||||||
that single-threaded programs.</li>
|
|
||||||
</ul>
|
|
||||||
<ul>
|
|
||||||
<li>Some program designs may be easier to formulate using a multi-threaded
|
|
||||||
approach.
|
|
||||||
After all, the real world is asynchronous! </li>
|
|
||||||
</ul>
|
|
||||||
<h2><a name="Dangers">Dangers</a></h2>
|
|
||||||
<p>Beyond the errors which can occur in single-threaded programs, multi-threaded
|
|
||||||
programs are subject to additional errors:</p>
|
|
||||||
<ul>
|
|
||||||
<li><a href="definitions.html#Race condition">Race conditions</a>.
|
|
||||||
<li><a href="definitions.html#Deadlock">Deadlock</a> (sometimes called
|
|
||||||
"deadly embrace")
|
|
||||||
<li><a href="definitions.html#Priority failure">Priority failures</a>
|
|
||||||
(priority inversion, infinite overtaking, starvation, etc.)</li>
|
|
||||||
</ul>
|
|
||||||
<p>Every multi-threaded program must be designed carefully to avoid race
|
|
||||||
conditions and deadlock. These aren't rare or exotic failures - they are
|
|
||||||
virtually guaranteed to occur unless multi-threaded code is designed to avoid
|
|
||||||
them. Priority failures are somewhat less common, but are none-the-less
|
|
||||||
serious.</p>
|
|
||||||
<p>The <a href="introduction.html">Boost.Threads design</a> attempts to minimize
|
|
||||||
these errors, but they will still occur unless the programmer proactively
|
|
||||||
designs to avoid them.</p>
|
|
||||||
<h3>Testing and debugging considerations</h3>
|
|
||||||
<p>Multi-threaded programs are non-deterministic. In other words, the same
|
|
||||||
program with the same input data may follow different execution paths each time
|
|
||||||
it is invoked. That can make testing and debugging a nightmare:</p>
|
|
||||||
<ul>
|
|
||||||
<li>Failures are often not repeatable.
|
|
||||||
<li>Probe effect causes debuggers to produce very different results from
|
|
||||||
non-debug uses.
|
|
||||||
<li>Debuggers require special support to show thread state.
|
|
||||||
<li>Tests on a single processor system may give no indication of serious
|
|
||||||
errors which would appear on multiprocessor systems, and visa versa. Thus test
|
|
||||||
cases should include a varying number of processors. </li>
|
|
||||||
<li>For programs which create a varying number of threads according to
|
|
||||||
workload, tests which don't span the full range of possibilities may miss
|
|
||||||
serious errors.</li>
|
|
||||||
</ul>
|
|
||||||
<h3>Getting a head start</h3>
|
|
||||||
<p>Although it might appear that multi-threaded programs are inherently
|
|
||||||
unreliable, many reliable multi-threaded programs do exist. Multi-threading
|
|
||||||
techniques are known which lead to reliable programs.</p>
|
|
||||||
<p>Design patterns for reliable multi-threaded programs, including the important
|
|
||||||
<i>monitor</i> pattern, are presented in <cite>Pattern-Oriented Software Architecture Volume 2 - Patterns for
|
|
||||||
Concurrent and Networked Objects</cite> [<a href="bibliography.html#Schmidt-00">Schmidt
|
|
||||||
00</a>]. Many important multi-threading programming considerations
|
|
||||||
(independent of threading library) are discussed in <cite>Programming with
|
|
||||||
POSIX Threads</cite> [<a href="bibliography.html#Butenhof-97">Butenhof 97</a>].</p>
|
|
||||||
<p>Reading and study first yields a head start toward designing reliable
|
|
||||||
multi-threaded programs.</p>
|
|
||||||
|
|
||||||
<h2><a name="Library">C++ Standard Library usage in multi-threaded programs</a></h2>
|
|
||||||
<h3>Runtime libraries</h3>
|
|
||||||
<p><b>Warning:</b> Multi-threaded programs such as those using <b>Boost.Threads</b> must link to
|
|
||||||
<a href="definitions.html#Thread-safe">thread-safe</a> versions of all runtime
|
|
||||||
libraries used by the program, including the runtime library for the C++
|
|
||||||
Standard Library. Otherwise <a href="definitions.html#Race condition">race
|
|
||||||
conditions</a> will occur when multiple threads simultaneously execute runtime
|
|
||||||
library functions for <i>new</i>, <i>delete</i>, or other language features
|
|
||||||
which imply shared state. </p>
|
|
||||||
<h3>Potentially non-thread-safe functions</h3>
|
|
||||||
<p>Certain C++ Standard Library functions inherited from C are particular
|
|
||||||
problems because they hold internal state between calls:</p>
|
|
||||||
<ul>
|
|
||||||
<li>rand</li>
|
|
||||||
<li>strtok</li>
|
|
||||||
<li>asctime</li>
|
|
||||||
<li>ctime </li>
|
|
||||||
<li>gmtime</li>
|
|
||||||
<li>localtime</li>
|
|
||||||
</ul>
|
|
||||||
<p>It is possible to write thread-safe implementations of these by using <a href="thread_specific_ptr.html">thread-specific
|
|
||||||
storage</a>, and several C++ compiler vendors do just that. The technique
|
|
||||||
is well-know and is explained in [<a href="bibliography.html#Butenhof-97">Buttenhof-97</a>].</p>
|
|
||||||
<p>But at least one vendor (HP-UX) does not provide thread-safe implementations
|
|
||||||
of the above functions in their otherwise thread-safe runtime library.
|
|
||||||
Instead they provide replacement functions with different names and arguments.</p>
|
|
||||||
<p><b>Recommendation:</b> For the most portable, yet thread-safe code, use Boost
|
|
||||||
replacements for the problem functions. See the <a href="../../random/index.html">Boost
|
|
||||||
Random Number Library</a> and <a href="../../tokenizer/index.htm">Boost
|
|
||||||
Tokenizer Library</a>.</p>
|
|
||||||
<h2><a name="Common">Common</a> requirements for all Boost.Threads components</h2>
|
|
||||||
<h3>Exceptions</h3>
|
|
||||||
<p> <b>Boost.Threads</b> destructors never throw exceptions. Unless otherwise
|
|
||||||
specified, other <b>Boost.Threads</b>
|
|
||||||
functions that do not have an exception-specification may throw implementation-defined exceptions.</p>
|
|
||||||
<p>In particular, <b>Boost.Threads</b> reports failure to allocate storage by throwing an exception of type
|
|
||||||
std::bad_alloc, or a class derived from std::bad_alloc, failure to obtain
|
|
||||||
thread resources other than memory by throwing an exception of type <a href="thread_resource_error.html">boost::thread_resource_error</a>,
|
|
||||||
and certain lock related failures by throwing an exception of type <a href="lock_error.html">boost::lock_error</a></p>
|
|
||||||
<p><b>Rationale: </b>Follows the C++ Standard Library practice of allowing all
|
|
||||||
functions except destructors or other specified functions to throw exceptions on
|
|
||||||
errors.</p>
|
|
||||||
<h3><a name="NonCopyable">NonCopyable</a> requirement</h3>
|
|
||||||
<p><b>Boost.Threads</b> classes documented as meeting the NonCopyable requirement disallow copy
|
|
||||||
construction and copy assignment. For the sake of exposition, the synopsis of
|
|
||||||
such classes show private derivation from <a href="../../utility/utility.htm">boost::noncopyable</a>.
|
|
||||||
Users should not depend on this derivation, however, as implementations are free
|
|
||||||
to meet the NonCopyable requirement in other ways.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->12 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39332" -->
|
|
||||||
</p>
|
|
||||||
<p>© Copyright 2001 Beman Dawes</p>
|
|
||||||
</body>
|
|
||||||
|
|
||||||
</html>
|
|
||||||
44
doc/overview.qbk
Normal file
44
doc/overview.qbk
Normal file
@@ -0,0 +1,44 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2007-12 Anthony Williams.
|
||||||
|
(C) Copyright 20012 Vicente J. Botet Escriba.
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[section:overview Overview]
|
||||||
|
|
||||||
|
__boost_thread__ enables the use of multiple threads of execution with shared data in portable C++ code. It provides classes and
|
||||||
|
functions for managing the threads themselves, along with others for synchronizing data between the threads or providing separate
|
||||||
|
copies of data specific to individual threads.
|
||||||
|
|
||||||
|
The __boost_thread__ library was originally written and designed by William E. Kempf (version 0). Anthony Williams version (version 1) was a major rewrite designed to
|
||||||
|
closely follow the proposals presented to the C++ Standards Committee, in particular
|
||||||
|
[@http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2008/n2497.html N2497],
|
||||||
|
[@http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2007/n2320.html N2320],
|
||||||
|
[@http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2007/n2184.html N2184],
|
||||||
|
[@http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2006/n2139.html N2139], and
|
||||||
|
[@http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2006/n2094.html N2094]
|
||||||
|
Vicente J. Botet Escriba started in version 2 the adaptation to comply with the accepted Thread C++11 library.
|
||||||
|
|
||||||
|
In order to use the classes and functions described here, you can
|
||||||
|
either include the specific headers specified by the descriptions of
|
||||||
|
each class or function, or include the master thread library header:
|
||||||
|
|
||||||
|
#include <boost/thread.hpp>
|
||||||
|
|
||||||
|
which includes all the other headers in turn.
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
|
||||||
|
[section:build Using and building the library]
|
||||||
|
|
||||||
|
Boost.Thread is configured following the conventions used to build [@http://www.boost.org/doc/libs/1_48_0/libs/config/doc/html/boost_config/boost_macro_reference.html#boost_config.boost_macro_reference.macros_for_libraries_with_separate_source_code libraries with separate source code]. Boost.Thread will import/export the code only if the user has specifically asked for it, by defining either BOOST_ALL_DYN_LINK if they want all boost libraries to be dynamically linked, or BOOST_THREAD_DYN_LINK if they want just this one to be dynamically liked.
|
||||||
|
|
||||||
|
The definition of these macros determines whether BOOST_THREAD_USE_DLL is defined. If BOOST_THREAD_USE_DLL is not defined, the library will define BOOST_THREAD_USE_DLL or BOOST_THREAD_USE_LIB depending on whether the platform. On non windows platforms BOOST_THREAD_USE_LIB is defined if is not defined. In windows platforms, BOOST_THREAD_USE_LIB is defined if BOOST_THREAD_USE_DLL and the compiler supports auto-tss cleanup with Boost.Threads (for the time been Msvc and Intel)
|
||||||
|
|
||||||
|
The source code compiled when building the library defines a macros BOOST_THREAD_SOURCE that is used to import or export it. The user must not define this macro in any case.
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
@@ -1,431 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<title>Boost.Threads, rationale</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#ffffff" link="#0000ff" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><IMG height=86 alt="C++ Boost" src="../../../c++boost.gif" width=277></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">Rationale</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>This page explains the rationale behind various design decisions in the <b> Boost.Threads</b>
|
|
||||||
library. Having the rationale documented here should explain how we arrived at the current
|
|
||||||
design as well as prevent future rehashing of discussions and thought processes that have
|
|
||||||
already occurred. It can also give users a lot of insight into the design process required
|
|
||||||
for this library.</p>
|
|
||||||
|
|
||||||
<h2><a name="library">Rationale for the Creation of Boost.Threads</a></h2>
|
|
||||||
|
|
||||||
<p>Processes often have a degree of "potential parallelism" and it can often be more intuitive
|
|
||||||
to design systems with this in mind. Further, these parallel processes can result in more responsive
|
|
||||||
programs. The benefits for multi-threaded programming are quite well known to most modern programmers,
|
|
||||||
yet the C++ language doesn't directly support this concept.</p>
|
|
||||||
|
|
||||||
<p>Many platforms support multi-threaded programming despite the fact that the language doesn't support
|
|
||||||
it. They do this through external libraries, which are, unfortunately, platform specific. POSIX has
|
|
||||||
tried to address this problem through the standardization of a "pthread" library. However, this
|
|
||||||
is a standard only on POSIX platforms, so its portability is limited.</p>
|
|
||||||
|
|
||||||
<p>Another problem with POSIX and other platform specific thread libraries is that they are
|
|
||||||
almost universally C based libraries. This leaves several C++ specific issues unresolved, such
|
|
||||||
as what happens when an exception is thrown in a thread. Further, there are some C++ concepts,
|
|
||||||
such as destructors, that can make usage much easier than what's available in a C library.</p>
|
|
||||||
|
|
||||||
<p>What's truly needed is C++ language support for threads. However, the C++ standards committee needs
|
|
||||||
existing practice or a good proposal as a starting point for adding this to the standard.</p>
|
|
||||||
|
|
||||||
<p>The Boost.Threads library was developed to provide a C++ developer with a portable interface
|
|
||||||
for writing multi-threaded programs on numerous platforms. There's a hope that the library can
|
|
||||||
be the basis for a more detailed proposal for the C++ standards committee to consider for inclusion
|
|
||||||
in the next C++ standard.</p>
|
|
||||||
|
|
||||||
<h2><a name="primitives">Rationale for the Low Level Primitives Supported in Boost.Threads</a></h2>
|
|
||||||
|
|
||||||
<p>The Boost.Threads library supplies a set of low level primitives for writing multi-threaded
|
|
||||||
programs, such as semaphores, mutexes and condition variables. In fact, the first release of
|
|
||||||
Boost.Threads supports only these low level primitives. However, computer
|
|
||||||
science research has shown
|
|
||||||
that use of these primitives is difficult since there's no way to mathematically prove that a
|
|
||||||
usage pattern is correct, meaning it doesn't result in race conditions or deadlocks. There
|
|
||||||
are several algebras (such as CSP, CCS and Join calculus) that have been developed to help write
|
|
||||||
provably correct parallel processes. In order to prove the correctness these processes must
|
|
||||||
be coded using higher level abstractions. So why does Boost.Threads support the lower level
|
|
||||||
concepts?</p>
|
|
||||||
|
|
||||||
<p>The reason is simple: the higher level concepts need to be implemented using at least some
|
|
||||||
of the lower level concepts. So having portable lower level concepts makes it easier to develop
|
|
||||||
the higher level concepts and will allow researchers to experiment with various techniques.</p>
|
|
||||||
|
|
||||||
<p>Beyond this theoretical application of higher level concepts, however, the fact remains that
|
|
||||||
many multi-threaded programs are written using only the lower level concepts, so they are
|
|
||||||
useful in and of themselves, even if it's hard to prove that their usage is correct. Since
|
|
||||||
many users will be familiar with these lower level concepts but be unfamiliar with any of the
|
|
||||||
higher level concepts there's also an argument for accessibility.</p>
|
|
||||||
|
|
||||||
<h2><a name="lock_objects">Rationale for the Lock Design</a></h2>
|
|
||||||
|
|
||||||
<p>Programmers who are used to multi-threaded programming issues will quickly note that the
|
|
||||||
Boost.Thread's design for mutex lock concepts is not <a href="file:///c:/boost/site/libs/thread/doc/definitions.html#Thread-safe">thread-safe</a>
|
|
||||||
(this is clearly documented
|
|
||||||
as well). At first this may seem like a serious design flaw. Why have a multi-threading primitive
|
|
||||||
that's not thread-safe itself?</p>
|
|
||||||
|
|
||||||
<p>A lock object is not a synchronization primitive. A lock object's sole responsibility is
|
|
||||||
to ensure that a mutex is both locked and unlocked in a manner that won't result in the common
|
|
||||||
error of locking a mutex and then forgetting to unlock it. This means that instances of a
|
|
||||||
lock object are only going to be created, at least in theory, within block scope and won't
|
|
||||||
be shared between threads. Only the mutex objects will be created outside of block scope and/or
|
|
||||||
shared between threads. Though it's possible to create a lock object outside of block scope and
|
|
||||||
to share it between threads to do so would not be a typical usage. Nor are there any cases when
|
|
||||||
such usage would be required.</p>
|
|
||||||
|
|
||||||
<p>Lock objects must maintain some state information. In order to allow a program to determine
|
|
||||||
if a try_lock or timed_lock was successful the lock object must retain state indicating
|
|
||||||
the success or failure of the call made in its constructor. If a lock object were to have
|
|
||||||
such state and remain thread-safe it would need to synchronize access to the state information
|
|
||||||
which would result in roughly doubling the time of most operations. Worse, since checking
|
|
||||||
the state can occur only by a call after construction we'd have a race condition if the lock
|
|
||||||
object were shared between threads.</p>
|
|
||||||
|
|
||||||
<p>So, to avoid the overhead of synchronizing access to the state information and to avoid
|
|
||||||
the race condition the Boost.Threads library simply does nothing to make lock objects thread-safe. Instead, sharing a lock object between threads results in undefined behavior. Since the
|
|
||||||
only proper usage of lock objects is within block scope this isn't a problem, and so long
|
|
||||||
as the lock object is properly used there's no danger of any multi-threading issues.</p>
|
|
||||||
|
|
||||||
<h2><a name="thread">Rationale for Non-copyable Thread Type</a></h2>
|
|
||||||
|
|
||||||
<p>Programmers who are used to C libraries for multi-threaded programming are likely to
|
|
||||||
wonder why Boost.Threads uses a non-copyable design for <a href="thread.html">boost::thread</a>. After all, the C
|
|
||||||
thread types are copyable, and you often have a need for copying them within user code.
|
|
||||||
However, careful comparison of C designs to C++ designs shows a flaw in this logic.</p>
|
|
||||||
|
|
||||||
<p>All C types are copyable. It is, in fact, not possible to make a non-copyable type in
|
|
||||||
C. For this reason types that represent system resources in C are often designed to behave
|
|
||||||
very similarly to a pointer to dynamic memory. There's an API for acquiring the resource
|
|
||||||
and an API for releasing the resources. For memory we have pointers as the type and
|
|
||||||
alloc/free for the acquisition and release APIs. For files we have FILE* as the type
|
|
||||||
and fopen/fclose for the acquisition and release APIs. You can freely copy instances of the
|
|
||||||
types but must manually manage the lifetime of the actual resource through the acquisition
|
|
||||||
and release APIs.</p>
|
|
||||||
|
|
||||||
<p>C++ designs recognize that the acquisition and release APIs are error prone and try
|
|
||||||
to eliminate possible errors by acquiring the resource in the constructor and releasing it
|
|
||||||
in the destructor. The best example of such a design is the std::iostream set of classes
|
|
||||||
which can represent the same resource as the FILE* type in C. A file is opened in the
|
|
||||||
std::fstream's constructor and closed in its destructor. However, if an iostream were
|
|
||||||
copyable it could lead to a file being closed twice, an obvious error, so the std::iostream
|
|
||||||
types are noncopyable by design. This is the same design used by boost::thread, which
|
|
||||||
is a simple and easy to understand design that's consistent with other C++ standard types.</p>
|
|
||||||
|
|
||||||
<p>During the design of boost::thread it was pointed out that it would be possible to allow
|
|
||||||
it to be a copyable type if some form of "reference management" were used, such as ref-counting
|
|
||||||
or ref-lists, and many argued for a boost::thread_ref design instead. The reasoning was
|
|
||||||
that copying "thread" objects was a typical need in the C libraries, and so presumably would
|
|
||||||
be in the C++ libraries as well. It was also thought that implementations could provide
|
|
||||||
more efficient reference management then wrappers (such as boost::shared_ptr) around a noncopyable
|
|
||||||
thread concept. Analysis of whether or not these arguments would hold true don't appear to
|
|
||||||
bear them out. To illustrate the analysis we'll first provide pseudo-code illustrating the six
|
|
||||||
typical usage patterns of a thread object.</p>
|
|
||||||
|
|
||||||
<h3>1. Simple creation of a thread.</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
create_thread(&bar);
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h3>2. Creation of a thread that's later joined.</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
thread = create_thread(&bar);
|
|
||||||
join(thread);
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h3>3. Simple creation of several threads in a loop.</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
for (int i=0; i<NUM_THREADS; ++i)
|
|
||||||
create_thread(&bar);
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h3>4. Creation of several threads in a loop which are later joined.</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
for (int i=0; i<NUM_THREADS; ++i)
|
|
||||||
threads[i] = create_thread(&bar);
|
|
||||||
for (int i=0; i<NUM_THREADS; ++i)
|
|
||||||
threads[i].join();
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h3>5. Creation of a thread whose ownership is passed to another object/method.</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
thread = create_thread(&bar);
|
|
||||||
manager.owns(thread);
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h3>6. Creation of a thread whose ownership is shared between multiple objects.</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
thread = create_thread(&bar);
|
|
||||||
manager1.add(thread);
|
|
||||||
manager2.add(thread);
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>Of these usage patterns there's only one that requires reference management (number 6).
|
|
||||||
Hopefully it's fairly obvious that this usage pattern simply won't occur as often as the
|
|
||||||
other usage patterns. So there really isn't a "typical need" for a thread concept, though
|
|
||||||
there is some need.</p>
|
|
||||||
|
|
||||||
<p>Since the need isn't typical we must use different criteria for deciding on either a
|
|
||||||
thread_ref or thread design. Possible criteria include ease of use and performance. So let's
|
|
||||||
analyze both of these carefully.</p>
|
|
||||||
|
|
||||||
<p>With ease of use we can look at existing experience. The standard C++ objects that
|
|
||||||
represent a system resource, such as std::iostream, are noncopyable, so we know that C++
|
|
||||||
programmers must at least be experienced with this design. Most C++ developers are also
|
|
||||||
used to smart pointers such as boost::shared_ptr, so we know they can at least adapt to
|
|
||||||
a thread_ref concept with little effort. So existing experience isn't going to lead us
|
|
||||||
to a choice.</p>
|
|
||||||
|
|
||||||
<p>The other thing we can look at is how difficult it is to use both types for the six usage
|
|
||||||
patterns above. If we find it overly difficult to use a concept for any of the usage patterns
|
|
||||||
there would be a good argument for choosing the other design. So we'll code all six usage
|
|
||||||
patterns using both designs.</p>
|
|
||||||
|
|
||||||
<h3>1.</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
thread thrd(&bar);
|
|
||||||
}
|
|
||||||
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
thread_ref thrd = create_thread(&bar);
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h3>2.</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
thread thrd(&bar);
|
|
||||||
thrd.join();
|
|
||||||
}
|
|
||||||
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
thread_ref thrd =
|
|
||||||
create_thread(&bar);thrd->join();
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h3>3.</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
for (int i=0; i<NUM_THREADS; ++i)
|
|
||||||
thread thrd(&bar);
|
|
||||||
}
|
|
||||||
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
for (int i=0; i<NUM_THREADS; ++i)
|
|
||||||
thread_ref thrd = create_thread(&bar);
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h3>4.</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
std::auto_ptr<thread> threads[NUM_THREADS];
|
|
||||||
for (int i=0; i<NUM_THREADS; ++i)
|
|
||||||
threads[i] = std::auto_ptr<thread>(new thread(&bar));
|
|
||||||
for (int i= 0; i<NUM_THREADS;
|
|
||||||
++i)threads[i]->join();
|
|
||||||
}
|
|
||||||
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
thread_ref threads[NUM_THREADS];
|
|
||||||
for (int i=0; i<NUM_THREADS; ++i)
|
|
||||||
threads[i] = create_thread(&bar);
|
|
||||||
for (int i= 0; i<NUM_THREADS;
|
|
||||||
++i)threads[i]->join();
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h3>5.</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
thread thrd* = new thread(&bar);
|
|
||||||
manager.owns(thread);
|
|
||||||
}
|
|
||||||
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
thread_ref thrd = create_thread(&bar);
|
|
||||||
manager.owns(thrd);
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h3>6.</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
boost::shared_ptr<thread> thrd(new thread(&bar));
|
|
||||||
manager1.add(thrd);
|
|
||||||
manager2.add(thrd);
|
|
||||||
}
|
|
||||||
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
thread_ref thrd = create_thread(&bar);
|
|
||||||
manager1.add(thrd);
|
|
||||||
manager2.add(thrd);
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>This shows the usage patterns being nearly identical in complexity for both designs.
|
|
||||||
The only actual added complexity occurs because of the use of operator new in (4), (5)
|
|
||||||
and (6) and the use of std::auto_ptr and boost::shared_ptr in (4) and (6) respectively.
|
|
||||||
However, that's not really much added complexity, and C++ programmers are used to using
|
|
||||||
these idioms any way. Some may dislike the presence of operator new in user code,
|
|
||||||
but this can be eliminated by proper design of higher level concepts, such as the
|
|
||||||
boost::thread_group class that simplifies example (4) down to:</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void foo()
|
|
||||||
{
|
|
||||||
thread_group threads;
|
|
||||||
for (int i=0; i<NUM_THREADS; ++i)
|
|
||||||
threads.create_thread(&bar);
|
|
||||||
threads.join_all();
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>So ease of use is really a wash and not much help in picking a design.</p>
|
|
||||||
|
|
||||||
<p>So what about performance? If you look at the above code examples we can analyze
|
|
||||||
the theoretical impact to performance that both designs have. For (1) we can see that
|
|
||||||
platforms that don't have a ref-counted native thread type (POSIX, for instance) will
|
|
||||||
be impacted by a thread_ref design. Even if the native thread type is ref-counted there
|
|
||||||
may be an impact if more state information has to be maintained for concepts foreign
|
|
||||||
to the native API, such as clean up stacks for Win32 implementations. For (2) the
|
|
||||||
performance impact will be identical to (1). The same for (3). For (4) things get a
|
|
||||||
little more interesting and we find that theoretically at least the thread_ref may
|
|
||||||
perform faster since the thread design requires dynamic memory allocation/deallocation.
|
|
||||||
However, in practice there may be dynamic allocation for the thread_ref design as well,
|
|
||||||
it will just be hidden from the user. As long as the implementation has to do dynamic
|
|
||||||
allocations the thread_ref loses again because of the reference management. For (5)
|
|
||||||
we see the same impact as we do for (4). For (6) we still have a possible impact
|
|
||||||
to the thread design because of dynamic allocation but thread_ref no longer suffers
|
|
||||||
because of it's reference management, and in fact, theoretically at least, the thread_ref
|
|
||||||
may do a better job of managing the references. All of this indicates that thread wins
|
|
||||||
for (1), (2) and (3), with (4) and (5) the winner depends on the implementation and the platform
|
|
||||||
but the thread design probably has a better chance, and with (6) it will again
|
|
||||||
depend on the implementation and platform but this time we favor thread_ref slightly.
|
|
||||||
Given all of this it's a narrow margin, but the thread design prevails.</p>
|
|
||||||
|
|
||||||
<p>Given this analysis, and the fact that noncopyable objects for system resources are
|
|
||||||
the normal designs that C++ programmers are used to dealing with, the Boost.Threads
|
|
||||||
library has gone with a noncopyable design.</p>
|
|
||||||
|
|
||||||
<h2>Rationale for not providing <i><a name="Events">Event</a> Variables</i></h2>
|
|
||||||
|
|
||||||
<p><i>Event variables </i>are simply far too error-prone. <a href="condition.html">Condition
|
|
||||||
variables</a> are a much safer alternative.</p>
|
|
||||||
|
|
||||||
<p>[Note that Graphical User Interface <i>events</i> are a different concept,
|
|
||||||
and are not what is being discussed here.]</p>
|
|
||||||
|
|
||||||
<p>Event variables were one of the first synchronization primitives. They are
|
|
||||||
still used today, for example, in the native Windows multithreading API.</p>
|
|
||||||
|
|
||||||
<p>Yet both respected computer science researchers and experienced
|
|
||||||
multithreading practitioners believe event variables are so inherently
|
|
||||||
error-prone that they should never be used, and thus should not be part of a
|
|
||||||
multithreading library.</p>
|
|
||||||
|
|
||||||
<p>Per Brinch Hansen <a href="bibliography.html#Brinch-Hansen-73">[Brinch Hansen
|
|
||||||
73]</a> analyzed event variables in some detail, pointing out [emphasis his]
|
|
||||||
that "<i>event operations force the programmer to be aware of the relative
|
|
||||||
speeds of the sending and receiving processes</i>". His summary:</p>
|
|
||||||
|
|
||||||
<blockquote>
|
|
||||||
<p>We must therefore conclude that event variables of the previous type are
|
|
||||||
impractical for system design. <i>The effect of an interaction between two
|
|
||||||
processes must be independent of the speed at which it is carried out.</i></p>
|
|
||||||
|
|
||||||
</blockquote>
|
|
||||||
<p>Experienced programmers using the Windows platform today
|
|
||||||
report that event variables are a continuing source of errors, even after previous
|
|
||||||
bad experiences caused them to be very careful in their use of event
|
|
||||||
variables. Overt problems can be avoided, for example, by teaming the
|
|
||||||
event variable with a mutex, but that may just convert a <a href="definitions.html#Race condition">race
|
|
||||||
condition</a> into another problem, such as excessive resource use. One of the most
|
|
||||||
distressing aspects of the experience reports is the claim that many defects are
|
|
||||||
latent. That is, the programs appear to work correctly, but contain
|
|
||||||
hidden timing dependencies which will cause them to fail when environmental
|
|
||||||
factors or usage patterns change, altering relative thread timings.</p>
|
|
||||||
|
|
||||||
<p>The decision to exclude event variables from Boost.Threads has been
|
|
||||||
surprising to some Windows programmers. They have written programs which
|
|
||||||
work using event variables, and wonder what the problem is. It seems
|
|
||||||
similar to the "goto considered harmful" controversy of 30 years ago.
|
|
||||||
It isn't that events, like gotos, can't be made to work, but rather that
|
|
||||||
virtually all programs using alternatives will be easier to write, debug,
|
|
||||||
read, maintain, and be less likely to contain latent defects.</p>
|
|
||||||
|
|
||||||
<p>[Rationale provided by Beman Dawes]</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->17 August, 2001<!--webbot bot="Timestamp" endspan i-checksum="34355" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <A href="mailto:williamkempf@hotmail.com">William E. Kempf</A>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
@@ -1,327 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, recursive_mutex</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">recursive_mutex<br>
|
|
||||||
recursive_try_mutex<br>
|
|
||||||
recursive_timed_mutex</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><a href="#Introduction">Introduction</a><br>
|
|
||||||
<a href="#Header">Header</a><br>
|
|
||||||
<a href="#recursive_mutex Synopsis">Class recursive_mutex Synopsis</a><br>
|
|
||||||
<a href="#recursive_mutex Members">Class recursive_mutex Members</a><br>
|
|
||||||
<a href="#recursive_try_mutex Synopsis">Class recursive_try_mutex Synopsis</a><br>
|
|
||||||
<a href="#recursive_try_mutex Members">Class recursive_try_mutex Members</a><br>
|
|
||||||
<a href="#recursive_timed_mutex Synopsis">Class recursive_timed_mutex Synopsis</a><br>
|
|
||||||
<a href="#recursive_timed_mutex Members">Class recursive_timed_mutex Members</a><br>
|
|
||||||
<a href="#Example">Example</a></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>The <code>recursive_mutex</code>, <code>recursive_try_mutex</code> and
|
|
||||||
<code>recursive_timed_mutex</code> classes define full featured models of the
|
|
||||||
<a href="mutex_concept.html#Mutex">Mutex</a>,
|
|
||||||
<a href="mutex_concept.html#TryMutex">TryMutex</a> and
|
|
||||||
<a href="mutex_concept.html#TimedMutex">TimedMutex</a> concepts with recursive locking
|
|
||||||
semantics. These types should be used to synchronize access to shared resources
|
|
||||||
when recursive locking by a single thread is likely to occur. A good example for this
|
|
||||||
is when a class supplies "internal synchronization" to ensure
|
|
||||||
<a href="definitions.html#Thread-safe">thread-safety</a> and a function of the class
|
|
||||||
may have to call other functions of the class which also attempt to lock the mutex.
|
|
||||||
For recursive locking mechanics, see <a href="mutex.html">mutexes</a>.
|
|
||||||
|
|
||||||
<p>Each class supplies one or more typedefs for lock types which model matching
|
|
||||||
lock concepts. For the best possible performance you should use the mutex class that
|
|
||||||
supports the minimum set of lock types that you need.</p>
|
|
||||||
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><b>Mutex Class</b></td>
|
|
||||||
<td><b>Lock name</b></td>
|
|
||||||
<td><b>Implementation defined Lock Type</b></td>
|
|
||||||
<td><b>Lock Concept</b></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><a href="#recursive_mutex Synopsis"><code>recursive_mutex</code></a></td>
|
|
||||||
<td valign="middle"><code>scoped_lock</code></td>
|
|
||||||
<td valign="middle"><a href="scoped_lock.html"><code>detail::thread::scoped_lock<recursive_mutex></code></a></td>
|
|
||||||
<td valign="middle"><a href="lock_concept.html#ScopedLock">ScopedLock</a></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code><a href="#recursive_try_mutex Synopsis">recursive_try_mutex</a></code></td>
|
|
||||||
<td valign="middle"><code>scoped_lock<br>
|
|
||||||
scoped_try_lock</code></td>
|
|
||||||
<td valign="middle"><a href="scoped_lock.html"><code>detail::thread::scoped_lock<recursive_try_mutex><br>
|
|
||||||
</code></a><code><a href="scoped_try_lock.html">detail::thread::scoped_try_lock<recursive_try_mutex></a></code></td>
|
|
||||||
<td valign="middle"><a href="lock_concept.html#ScopedLock">ScopedLock</a><br>
|
|
||||||
<a href="lock_concept.html#ScopedTryLock">ScopedTryLock</a></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td valign="top"><code><a href="#recursive_timed_mutex Synopsis">recursive_timed_mutex</a></code> </td>
|
|
||||||
<td valign="middle"><code>scoped_lock<br>
|
|
||||||
scoped_try_lock<br>
|
|
||||||
scoped_timed_lock</code></td>
|
|
||||||
<td valign="middle"><a href="scoped_lock.html"><code>detail::thread::scoped_lock<recursive_timed_mutex></code></a><br>
|
|
||||||
<a href="scoped_try_lock.html"><code>detail::thread::scoped_try_lock<recursive_timed_mutex></code></a><br>
|
|
||||||
<a href="scoped_timed_lock.html"><code>detail::thread::scoped_timed_lock<recursive_timed_mutex></code></a></td>
|
|
||||||
<td valign="middle"><a href="lock_concept.html#ScopedLock">ScopedLock</a><br>
|
|
||||||
<a href="lock_concept.html#ScopedTryLock">ScopedTryLock</a><br>
|
|
||||||
<a href="lock_concept.html#ScopedTimedLock">ScopedTimedLock</a></td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<p>The <code>recursive_mutex</code>, <code>recursive_try_mutex</code> and
|
|
||||||
<code>recursive_timed_mutex</code> employ a <code>Recursive</code>
|
|
||||||
<a href="mutex_concept.html#LockingStrategies">locking strategy</a>, so attempts to
|
|
||||||
recursively lock them succeed and an internal "lock count" is maintained. Attempts
|
|
||||||
to unlock them by a thread that does not own a lock on them will result in a
|
|
||||||
<a href="lock_error.html">lock_error</a> exception being thrown.</p>
|
|
||||||
|
|
||||||
<p>The <code>recursive_mutex</code>, <code>recursive_try_mutex</code> and
|
|
||||||
<code>recursive_timed_mutex</code> leave the
|
|
||||||
<a href="mutex_concept.html#SchedulingPolicies">scheduling policy</a> as
|
|
||||||
<code>Unspecified</code>. Programmers should assume that threads waiting for a lock on
|
|
||||||
objects of these types acquire the lock in a random order, even though the specific
|
|
||||||
behavior for a given platform may be different.</p>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/recursive_mutex.hpp"><boost/thread/recursive_mutex.hpp></a>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2>Class <a name="recursive_mutex Synopsis"> recursive_mutex Synopsis</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost
|
|
||||||
{
|
|
||||||
class recursive_mutex : private <a href="../../utility/utility.htm">boost::noncopyable</a> // Exposition only.
|
|
||||||
// Class recursive_mutex meets the <a href="overview.html#NonCopyable">NonCopyable</a> requirement.
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef <i>[implementation defined; see <a href="#Introduction">Introduction</a>]</i> scoped_lock;
|
|
||||||
|
|
||||||
recursive_mutex();
|
|
||||||
~recursive_mutex();
|
|
||||||
};
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2>Class <a name="recursive_mutex Members">recursive_mutex Members</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
recursive_mutex();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Postconditions: </b><code>*this</code> is in the unlocked state.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~recursive_mutex();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> <code>*this</code> is in the unlocked state.</p>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Destroys <code>*this</code>.</p>
|
|
||||||
|
|
||||||
<p><b>Dangers:</b> Destruction of a locked mutex is a serious programming error
|
|
||||||
resulting in undefined behavior such as a program crash..</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2>
|
|
||||||
Class <a name="recursive_try_mutex Synopsis">recursive_try_mutex Synopsis</a>
|
|
||||||
</h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost
|
|
||||||
{
|
|
||||||
class recursive_try_mutex : private boost::noncopyable // Exposition only.
|
|
||||||
// Class recursive_try_mutex meets the <a href="overview.html#NonCopyable">NonCopyable</a> requirement.
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef <i>[implementation defined; see <a href="#Introduction">Introduction</a>]</i> scoped_lock;
|
|
||||||
typedef <i>[implementation defined; see <a href="#Introduction">Introduction</a>]</i> scoped_try_lock;
|
|
||||||
|
|
||||||
recursive_try_mutex();
|
|
||||||
~recursive_try_mutex();
|
|
||||||
};
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2>Class <a name="recursive_try_mutex Members">recursive_try_mutex Members</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
recursive_try_mutex();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Postconditions: </b><code>*this</code> is in the unlocked state.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~recursive_try_mutex();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> <code>*this</code> is in the unlocked state.</p>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Destroys <code>*this</code>.</p>
|
|
||||||
|
|
||||||
<p><b>Dangers:</b> Destruction of a locked mutex is a serious programming error
|
|
||||||
resulting in undefined behavior such as a program crash..</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2>
|
|
||||||
Class <a name="recursive_timed_mutex Synopsis">recursive_timed_mutex Synopsis</a>
|
|
||||||
</h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost
|
|
||||||
{
|
|
||||||
class recursive_timed_mutex : private boost::noncopyable // Exposition only.
|
|
||||||
// Class recursive_timed_mutex meets the <a href="overview.html#NonCopyable">NonCopyable</a> requirement.
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef <i>[implementation defined; see <a href="#Introduction">Introduction</a>]</i> scoped_lock;
|
|
||||||
typedef <i>[implementation defined; see <a href="#Introduction">Introduction</a>]</i> scoped_try_lock;
|
|
||||||
typedef <i>[implementation defined; see <a href="#Introduction">Introduction</a>]</i> scoped_timed_lock;
|
|
||||||
|
|
||||||
recursive_timed_mutex();
|
|
||||||
~recursive_timed_mutex();
|
|
||||||
};
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2>
|
|
||||||
Class <a name="recursive_timed_mutex Members">recursive_timed_mutex Members</a>
|
|
||||||
</h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
recursive_timed_mutex();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Postconditions: </b><code>*this</code> is in the unlocked state.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~recursive_timed_mutex();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> <code>*this</code> is in the unlocked state.</p>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Destroys <code>*this</code>.</p>
|
|
||||||
|
|
||||||
<p><b>Dangers:</b> Destruction of a locked mutex is a serious programming error
|
|
||||||
resulting in undefined behavior such as a program crash..</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2><a name="Example">Example</a> Usage</h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/recursive_mutex.hpp"><boost/thread/recursive_mutex.hpp></a>
|
|
||||||
#include <a href="../../../boost/thread/thread.hpp"><boost/thread/thread.hpp></a>
|
|
||||||
#include <iostream>
|
|
||||||
|
|
||||||
class counter
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
counter() : count(0) { }
|
|
||||||
|
|
||||||
int add(int val) {
|
|
||||||
boost::recursive_mutex::scoped_lock scoped_lock(mutex);
|
|
||||||
count += val;
|
|
||||||
return count;
|
|
||||||
}
|
|
||||||
int increment() {
|
|
||||||
boost::recursive_mutex::scoped_lock scoped_lock(mutex);
|
|
||||||
return add(1);
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
boost::recursive_mutex mutex;
|
|
||||||
int count;
|
|
||||||
};
|
|
||||||
|
|
||||||
counter c;
|
|
||||||
|
|
||||||
void change_count(void*)
|
|
||||||
{
|
|
||||||
std::cout << "count == " << c.increment() << std::endl;
|
|
||||||
}
|
|
||||||
|
|
||||||
int main(int, char*[])
|
|
||||||
{
|
|
||||||
const int num_threads=4;
|
|
||||||
|
|
||||||
boost::thread_group threads;
|
|
||||||
for (int i=0; i < num_threads; ++i)
|
|
||||||
threads.create_thread(&change_count, 0);
|
|
||||||
|
|
||||||
threads.join_all();
|
|
||||||
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>The output is:</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
count == 1
|
|
||||||
count == 2
|
|
||||||
count == 3
|
|
||||||
count == 4
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->13 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39334" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
@@ -1,134 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<title>Boost.Threads, atomic_t</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">atomic_t</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2>Header</h2>
|
|
||||||
|
|
||||||
<p>The <tt>atomic_t</tt> class defines an "atomic integer" type. This class should be used
|
|
||||||
to perform thread safe operations on an integral type with out the overhead of locks. Only
|
|
||||||
a limited set of integer operations are available with an <tt>atomic_t</tt> instance.</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <boost/thread/atomic.hpp>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2>Public Interface</h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
class atomic_t
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef <b>implementation defined</b> value_type;
|
|
||||||
|
|
||||||
explicit atomic_t(value_type val=0);
|
|
||||||
};
|
|
||||||
|
|
||||||
atomic_t::value_type read(const atomic_t& x);
|
|
||||||
atomic_t::value_type increment(atomic_t& x);
|
|
||||||
atomic_t::value_type decrement(atomic_t& x);
|
|
||||||
atomic_t::value_type swap(atomic_t& x, atomic_t::value_type y);
|
|
||||||
atomic_t::value_type compare_swap(atomic_t& x, atomic_t::value_type y, atomic_t::value_type z);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
atomic_t(atomic_t::value_type val=0);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>Constructs an <tt>atomic_t</tt> and sets its value to <tt>val</tt>.</p>
|
|
||||||
|
|
||||||
<h3>read</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
atomic_t::value_type read(const atomic_t& x);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>Gets the current value of <tt>x</tt>.</p>
|
|
||||||
|
|
||||||
<h3>increment</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
atomic_t::value_type increment(atomic_t& x);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>Increments <tt>x</tt> and returns a value <tt>< 0</tt> if the result is less than 0,
|
|
||||||
<tt>> 0</tt> if the result is greater than 0 and <tt>== 0</tt> if the result is equal to
|
|
||||||
0.</p>
|
|
||||||
|
|
||||||
<h3>decrement</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
atomic_t::value_type decrement(atomic_t& x);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>Decrements <tt>x</tt> and returns a value <tt>< 0</tt> if the result is less than 0,
|
|
||||||
<tt>> 0</tt> if the result is greater than 0 and <tt>== 0</tt> if the result is equal to
|
|
||||||
0.</p>
|
|
||||||
|
|
||||||
<h3>swap</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
atomic_t::value_type swap(atomic_t& x, atomic_t::value_type y);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>Assigns the value of <tt>y</tt> to <tt>x</tt> and returns the value of <tt>x</tt> prior
|
|
||||||
to the swap.</p>
|
|
||||||
|
|
||||||
<h3>compare_swap</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
atomic_t::value_type compare_swap(atomic_t& x, atomic_t::value_type y, atomic_t::value_type z);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>Compares the value of <tt>z</tt> to the value of <tt>x</tt> and if equal sets the value of
|
|
||||||
<tt>x</tt> to the value of <tt>y</tt> and returns the value of <tt>x</tt> prior to the swap.</p>
|
|
||||||
|
|
||||||
<h2>Example Usage</h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <boost/thread/atomic.hpp>
|
|
||||||
#include <boost/test/test_tools.hpp>
|
|
||||||
|
|
||||||
int test_main(int, char*[])
|
|
||||||
{
|
|
||||||
boost::atomic_t a;
|
|
||||||
BOOST_TEST_VERIFY(boost::read(a) == 0);
|
|
||||||
BOOST_TEST_VERIFY(boost::increment(a) > 0);
|
|
||||||
BOOST_TEST_VERIFY(boost::decrement(a) == 0);
|
|
||||||
BOOST_TEST_VERIFY(boost::swap(a, 1) == 0);
|
|
||||||
BOOST_TEST_VERIFY(boost::swap(a, 2, 0) == 1);
|
|
||||||
BOOST_TEST_VERIFY(boost::read(a) == 1);
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->06 August, 2001<!--webbot bot="Timestamp" endspan i-checksum="34352" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
@@ -1,213 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, scoped_lock</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">scoped_lock</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><a href="#Introduction">Introduction</a><br>
|
|
||||||
<a href="#Header">Header</a><br>
|
|
||||||
<a href="#Synopsis">Synopsis</a><br>
|
|
||||||
<a href="#Members">Members</a><br>
|
|
||||||
<a href="#Example">Example</a></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>This class template defines a generic lock type which meets the
|
|
||||||
<a href="lock_concept.html#ScopedLock">ScopedLock</a> requirements. The
|
|
||||||
<a href="mutex.html">mutex</a>, <a href="mutex.html">try_mutex</a>,
|
|
||||||
<a href="mutex.html">timed_mutex</a>, <a href="recursive_mutex.html">recursive_mutex</a>,
|
|
||||||
<a href="recursive_mutex.html">recursive_try_mutex</a> and
|
|
||||||
<a href="recursive_mutex.html">recursive_timed_mutex</a> classes all use this template
|
|
||||||
to define their <code>scoped_lock</code> types.</p>
|
|
||||||
|
|
||||||
<p>Like all the <b>Boost.Threads</b> <a href="lock_concept.html">lock models</a>,
|
|
||||||
<code>scoped_lock</code> objects are meant to be short-lived. Objects of the class
|
|
||||||
are not <a href="definitions.html#thread-safe">thread-safe</a>, and so should not be
|
|
||||||
shared between threads.</p>
|
|
||||||
|
|
||||||
<p>Class <code> scoped_lock</code> follows the "resource acquisition is
|
|
||||||
initialization" idiom <a href="bibliography.html#Stroustrup-00">[Stroustrup
|
|
||||||
00 14.4.1]</a> and is a realization of the "Scoped Locking Pattern"
|
|
||||||
<a href="bibliography.html#Schmidt-00">[Schmidt-00]</a>. Thus the usage is to let the
|
|
||||||
constructor do the locking, and then let the destructor do the unlocking automatically at
|
|
||||||
the end of the enclosing scope. The lock() and unlock() members are usually not
|
|
||||||
explicitly called, but are provided to allow for complex overlapping locks of multiple
|
|
||||||
mutexes.</p>
|
|
||||||
|
|
||||||
<p>The type used to instantiate the class must meet the
|
|
||||||
<a href="mutex_concept.html#Mutex">Mutex</a> requirements.</p>
|
|
||||||
|
|
||||||
<p>Although this class is an implementation detail, it is publicly documented here because
|
|
||||||
of its importance.</p>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/detail/lock.hpp"><boost/thread/detail/lock.hpp></a>
|
|
||||||
<i>This header is usually not included directly by programmers
|
|
||||||
because it is supplied by <a href="../../../boost/thread/mutex.hpp"><boost/thread/mutex.hpp></a> or
|
|
||||||
<a href="../../../boost/thread/recursive_mutex.hpp"><boost/thread/recursive_mutex.hpp></a></i>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Synopsis">Synopsis</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost { namespace detail { namespace thread {
|
|
||||||
template <typename Mutex>
|
|
||||||
class scoped_lock : private <a href="../../utility/utility.htm#Class noncopyable">boost::noncopyable</a> // Exposition only.
|
|
||||||
// Class scoped_lock meets the <a href="overview.html#NonCopyable">NonCopyable</a> requirement.
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef Mutex mutex_type;
|
|
||||||
|
|
||||||
explicit scoped_lock(Mutex& mx, bool initially_locked=true);
|
|
||||||
~scoped_lock();
|
|
||||||
|
|
||||||
void lock();
|
|
||||||
void unlock();
|
|
||||||
|
|
||||||
operator const void*() const;
|
|
||||||
bool locked() const;
|
|
||||||
};
|
|
||||||
} // namespace thread
|
|
||||||
} // namespace detail
|
|
||||||
} // namespace boost
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Members">Members</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
explicit scoped_lock(Mutex& mx, bool initially_locked=true);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Associates mutex <code>mx</code> with <code>*this</code>.
|
|
||||||
If <code>initially_locked</code> is <code>true,</code> calls <code>lock()</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~scoped_lock();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> If <code> locked()</code>, calls <code>unlock()</code>. Destroys
|
|
||||||
<code>*this</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>lock</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void lock();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> If the associated mutex is already locked by another lock in the
|
|
||||||
current thread, the effects depend on the locking strategy of the associated mutex, as
|
|
||||||
shown in the following table:</p>
|
|
||||||
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><i><a href="mutex_concept.html#LockingStrategies">Locking Strategy</a><br>
|
|
||||||
of associated mutex</i></td>
|
|
||||||
<td><i>Effect if associated mutex is already locked by the current thread</i></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Recursive</td>
|
|
||||||
<td>As if an additional lock were added to the mutex.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Checked</td>
|
|
||||||
<td>Throws <a href="lock_error.html">lock_error</a>.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Unchecked</td>
|
|
||||||
<td>Undefined behavior [<a href="bibliography.html#ISO">ISO</a> 1.3.12] (but
|
|
||||||
typically, <a href="definitions.html#Deadlock">deadlock</a>.)</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<p>If the associated mutex is already locked by some other thread, places the
|
|
||||||
current thread in the <a href="definitions.html#State">Blocked</a> state until
|
|
||||||
the associated mutex is unlocked, after which the current thread is placed in
|
|
||||||
the <a href="definitions.html#State">Ready</a> state, eventually to be returned
|
|
||||||
to the <a href="definitions.html#State">Running</a> state.
|
|
||||||
|
|
||||||
<p><b>Postcondition:</b> locked()
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <a href="lock_error.html">lock_error</a> if <code>locked()</code> or
|
|
||||||
as indicated in <b>Effects</b>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>unlock</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void unlock();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects: </b>Unlocks the associated mutex.</p>
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <a href="lock_error.html">lock_error</a> if <code>!locked()</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>const void* Conversion</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
operator const void*() const;
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> If the associated mutex is currently locked, a value convertible to
|
|
||||||
<code>true</code>, else a value convertible to <code>false</code>.</p>
|
|
||||||
|
|
||||||
<p><b>Rationale:</b> A <code>const void*</code> conversion is considered safer than a
|
|
||||||
conversion to <code>bool</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>locked</h3>
|
|
||||||
<pre>
|
|
||||||
bool locked() const;
|
|
||||||
</pre>
|
|
||||||
<p><b>Returns:</b> <code>this->operator const void*() != 0</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2><a name="Example">Example</a> Usage</h2>
|
|
||||||
|
|
||||||
<p>See the example given in the documentation for the <a href="mutex.html">mutex</a>
|
|
||||||
class.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->13 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39334" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
@@ -1,261 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, scoped_timed_lock</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">scoped_timed_lock</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><a href="#Introduction">Introduction</a><br>
|
|
||||||
<a href="#Header">Header</a><br>
|
|
||||||
<a href="#Synopsis">Synopsis</a><br>
|
|
||||||
<a href="#Members">Members</a><br>
|
|
||||||
<a href="#Example">Example</a></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>This class template defines a generic lock type which meets the
|
|
||||||
<a href="lock_concept.html#ScopedTimedLock">ScopedTimedLock</a> requirements. The
|
|
||||||
<a href="mutex.html">timed_mutex</a> and
|
|
||||||
<a href="recursive_mutex.html">recursive_timed_mutex</a> classes use this template to
|
|
||||||
define their <code>scoped_timed_lock</code> types.</p>
|
|
||||||
|
|
||||||
<p>Like all the <b>Boost.Threads</b> <a href="lock_concept.html">lock models</a>,
|
|
||||||
<code>scoped_timed_lock</code> objects are meant to be short-lived. Objects of the
|
|
||||||
class are not <a href="definitions.html#thread-safe">thread-safe</a>, and so should
|
|
||||||
not be shared between threads.</p>
|
|
||||||
|
|
||||||
<p>Class <code>scoped_timed_lock</code> follows the "resource acquisition is
|
|
||||||
initialization" idiom <a href="bibliography.html#Stroustrup-00">[Stroustrup
|
|
||||||
00 14.4.1]</a> and is a realization of the "Scoped Locking Pattern"
|
|
||||||
<a href="bibliography.html#Schmidt-00">[Schmidt-00]</a>. Thus the usage is to let the
|
|
||||||
constructor do the locking, and then let the destructor do the unlocking automatically
|
|
||||||
at the end of the enclosing scope. The lock() and unlock() members are usually not
|
|
||||||
explicitly called, but are provided to allow for complex overlapping locks of multiple
|
|
||||||
mutexes.</p>
|
|
||||||
|
|
||||||
<p>The type used to instantiate the class must meet the
|
|
||||||
<a href="mutex_concept.html#TimedMutex">TimedMutex</a> requirements.</p>
|
|
||||||
|
|
||||||
<p>Although this class is an implementation detail, it is publicly documented here because
|
|
||||||
of its importance.</p>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/detail/lock.hpp"><boost/thread/detail/lock.hpp></a>
|
|
||||||
<i>This header is usually not included directly by programmers
|
|
||||||
because it is supplied by <a href="../../../boost/thread/mutex.hpp"><boost/thread/mutex.hpp></a> or
|
|
||||||
<a href="../../../boost/thread/recursive_mutex.hpp"><boost/thread/recursive_mutex.hpp></a></i>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Synopsis">Synopsis</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost { namespace detail { namespace thread {
|
|
||||||
template <typename TimedMutex>
|
|
||||||
class scoped_timed_lock : private <a href="../../utility/utility.htm#Class noncopyable">boost::noncopyable</a> // Exposition only.
|
|
||||||
// Class scoped_timed_lock meets the <a href="overview.html#NonCopyable">NonCopyable</a> requirement.
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef TimedMutex mutex_type;
|
|
||||||
|
|
||||||
scoped_timed_lock(TimedMutex& mx, const boost::xtime& xt);
|
|
||||||
scoped_timed_lock(TimedMutex& mx, bool initially_locked);
|
|
||||||
~scoped_timed_lock();
|
|
||||||
|
|
||||||
void lock();
|
|
||||||
bool timed_lock(const xtime& xt);
|
|
||||||
void unlock();
|
|
||||||
|
|
||||||
operator const void*() const;
|
|
||||||
};
|
|
||||||
} // namespace thread
|
|
||||||
} // namesapce detail
|
|
||||||
} // namespace boost
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Members">Members</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
scoped_timed_lock(TimedMutex& mx, const <a href="xtime.html">xtime</a>& xt);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Associates mutex <code>mx</code> with <code>*this</code>.
|
|
||||||
Calls <code>timed_lock</code>( <code>xt</code>)</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
scoped_timed_lock(TimedMutex& mx, bool initially_locked);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Associates mutex <code>mx</code> with <code>*this</code>.
|
|
||||||
If <code>initially_locked</code> is <code>true</code>, calls <code>lock()</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~scoped_timed_lock();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> If <code> locked()</code>, calls <code>unlock()</code>. Destroys
|
|
||||||
<code>*this</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>lock</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void lock();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> If the associated mutex is already locked by another lock in the
|
|
||||||
current thread, the effects depend on the locking strategy of the associated mutex, as
|
|
||||||
shown in the following table:</p>
|
|
||||||
|
|
||||||
<table border="1" cellpadding="5">
|
|
||||||
<tr>
|
|
||||||
<td><i><a href="mutex_concept.html#LockingStrategies">Locking Strategy</a><br>
|
|
||||||
of associated mutex</i></td>
|
|
||||||
<td><i>Effect if associated mutex is already locked by the current thread</i></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Recursive</td>
|
|
||||||
<td>As if an additional lock were added to the mutex.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Checked</td>
|
|
||||||
<td>Throws <a href="lock_error.html">lock_error</a>.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td>Unchecked</td>
|
|
||||||
<td>Undefined behavior [<a href="bibliography.html#ISO">ISO</a> 1.3.12] (but
|
|
||||||
typically, <a href="definitions.html#Deadlock">deadlock</a>.)</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<p>If the associated mutex is already locked by some other thread, places the
|
|
||||||
current thread in the <a href="definitions.html#State">Blocked</a> state until
|
|
||||||
the associated mutex is unlocked, after which the current thread is placed in
|
|
||||||
the <a href="definitions.html#State">Ready</a> state, eventually to be returned
|
|
||||||
to the <a href="definitions.html#State">Running</a> state. Places the associated
|
|
||||||
mutex in the locked state.
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <a href="lock_error.html">lock_error</a> if <code>locked()</code> or
|
|
||||||
as indicated in <b>Effects</b>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>timed_lock</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
bool timed_lock(const <a href="xtime.html">xtime</a>& xt);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Same as <code>lock()</code>, except that if xt is reached,
|
|
||||||
places the current thread in the <a href="definitions.html#State">Ready</a>
|
|
||||||
state without further ado.</p>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> <code>locked()</code>.</p>
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <a href="lock_error.html">lock_error</a> if <code>locked()</code> or
|
|
||||||
as indicated in <b>Effects</b>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>unlock</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void unlock();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects: </b>Unlocks the associated mutex.</p>
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <a href="lock_error.html">lock_error</a> if <code>!locked()</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>const void* Conversion</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
operator const void*() const;
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> If the associated mutex is currently locked, a value convertible to
|
|
||||||
<code>true</code>, else a value convertible to <code>false</code>.</p>
|
|
||||||
|
|
||||||
<p><b>Rationale:</b> A <code>const void*</code> conversion is considered safer than a
|
|
||||||
conversion to <code>bool</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>locked</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
bool locked() const;
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> <code>this->operator const void*() != 0</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2><a name="Example">Example</a> Usage</h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <boost/thread/mutex.hpp>
|
|
||||||
#include <iostream>
|
|
||||||
|
|
||||||
int main(int, char*[])
|
|
||||||
{
|
|
||||||
boost::timed_mutex mutex;
|
|
||||||
boost::xtime xt;
|
|
||||||
boost::get_xtime(&xt, boost::TIME_UTC);
|
|
||||||
xt.sec += 1;
|
|
||||||
boost::mutex::scoped_timed_lock scope_timed_lock(mutex, xt);
|
|
||||||
if (scope_timed_lock.locked())
|
|
||||||
std::cout << "locked" << std::endl;
|
|
||||||
else
|
|
||||||
std::cout << "unlocked" << std::endl;
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>The output is:</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
locked
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%B %d, %Y" startspan -->September 13, 2001<!--webbot bot="Timestamp" endspan i-checksum="37965" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
@@ -1,282 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, scoped_try_lock</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">scoped_try_lock</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><a href="#Introduction">Introduction</a><br>
|
|
||||||
<a href="#Header">Header</a><br>
|
|
||||||
<a href="#Synopsis">Synopsis</a><br>
|
|
||||||
<a href="#Members">Members</a><br>
|
|
||||||
<a href="#Example">Example</a></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>This class template defines a generic lock type which meets the
|
|
||||||
<a href="lock_concept.html#ScopedTryLock">ScopedTryLock</a> requirements. The
|
|
||||||
<a href="mutex.html">try_mutex</a>, <a href="mutex.html">timed_mutex</a>,
|
|
||||||
<a href="recursive_mutex.html">recursive_try_mutex</a> and
|
|
||||||
<a href="recursive_mutex.html">recursive_timed_mutex</a> classes use this template
|
|
||||||
to define their <code>scoped_try_lock</code> types.</p>
|
|
||||||
|
|
||||||
<p>Like all the <b>Boost.Threads</b> <a href="lock_concept.html">lock models</a>,
|
|
||||||
<code>scoped_try_lock</code> objects are meant to be short-lived. Objects of the
|
|
||||||
class are not <a href="definitions.html#thread-safe">thread-safe</a>, and
|
|
||||||
so should not be shared between threads.</p>
|
|
||||||
|
|
||||||
<p>Class <code> scoped_try_lock</code> follows the "resource acquisition is
|
|
||||||
initialization" idiom <a href="bibliography.html#Stroustrup-00">[Stroustrup
|
|
||||||
00 14.4.1]</a> and is a realization of the "Scoped Locking Pattern"
|
|
||||||
<a href="bibliography.html#Schmidt-00">[Schmidt-00]</a>. Thus the usage is to let the
|
|
||||||
constructor do the locking, and then let the destructor do the unlocking automatically at
|
|
||||||
the end of the enclosing scope. The lock() and unlock() members are usually not
|
|
||||||
explicitly called, but are provided to allow for complex overlapping locks of multiple
|
|
||||||
mutexes.</p>
|
|
||||||
|
|
||||||
<p>Although this class is an implementation detail, it is publicly documented here because
|
|
||||||
of its importance.</p>
|
|
||||||
|
|
||||||
<p>The type used to instantiate the class must meet the <a href="mutex_concept.html#TryMutex">TryMutex</a> requirements.</p>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/detail/lock.hpp"><boost/thread/detail/lock.hpp></a>
|
|
||||||
<i>This header is usually not included directly by programmers
|
|
||||||
because it is supplied by <a href="../../../boost/thread/mutex.hpp"><boost/thread/mutex.hpp></a> or
|
|
||||||
<a href="../../../boost/thread/recursive_mutex.hpp"><boost/thread/recursive_mutex.hpp></a></i>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Synopsis">Synopsis</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost { namespace detail { namespace thread {
|
|
||||||
template <typename TryMutex>
|
|
||||||
class scoped_try_lock : private <a href="../../utility/utility.htm#Class noncopyable">boost::noncopyable</a> // Exposition only.
|
|
||||||
// Class scoped_try_lock meets the <a href="overview.html#NonCopyable">NonCopyable</a> requirement.
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef TryMutex mutex_type;
|
|
||||||
|
|
||||||
explicit scoped_try_lock(TryMutex& mx);
|
|
||||||
scoped_try_lock(TryMutex& mx, bool initially_locked);
|
|
||||||
~scoped_try_lock();
|
|
||||||
|
|
||||||
void lock();
|
|
||||||
bool try_lock();
|
|
||||||
void unlock();
|
|
||||||
|
|
||||||
operator const void*() const;
|
|
||||||
};
|
|
||||||
} // namespace thread
|
|
||||||
} // namespace detail
|
|
||||||
} // namespace boost
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Members">Members</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructors</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
explicit scoped_try_lock(TryMutex& mx);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Associates mutex <code>mx</code> with <code>*this</code>.
|
|
||||||
Calls <code>try_lock()</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<pre>
|
|
||||||
scoped_try_lock(TryMutex& mx, bool initially_locked);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Associates mutex <code>mx</code> with <code>*this</code>.
|
|
||||||
If <code>initially_locked</code> is <code>true,</code> calls <code>lock()</code>.</p>
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~scoped_try_lock();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> If <code>locked()</code>, calls <code>unlock()</code>. Destroys
|
|
||||||
<code>*this</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>lock</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void lock();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> If the associated mutex is already locked by another lock in the
|
|
||||||
current thread, the effects depend on the locking strategy of the associated mutex, as
|
|
||||||
shown in the following table:</p>
|
|
||||||
|
|
||||||
<table border="1" cellpadding="5" height="147">
|
|
||||||
<tr>
|
|
||||||
<td height="34"><i><a href="mutex_concept.html#LockingStrategies">Locking Strategy</a><br>
|
|
||||||
of associated mutex</i></td>
|
|
||||||
<td height="34"><i>Effect if associated mutex is already locked by the
|
|
||||||
current thread</i></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td height="19">Recursive</td>
|
|
||||||
<td height="19">As if an additional lock were added to the mutex.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td height="19">Checked</td>
|
|
||||||
<td height="19">Throws <a href="lock_error.html">lock_error</a>.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td height="19">Unchecked</td>
|
|
||||||
<td height="19">Undefined behavior [<a href="bibliography.html#ISO">ISO</a> 1.3.12] (but
|
|
||||||
typically, <a href="definitions.html#Deadlock">deadlock</a>.)</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<p>If the associated mutex is already locked by some other thread, places the
|
|
||||||
current thread in the <a href="definitions.html#State">Blocked</a> state until
|
|
||||||
the associated mutex is unlocked, after which the current thread is placed in
|
|
||||||
the <a href="definitions.html#State">Ready</a> state, eventually to be returned
|
|
||||||
to the <a href="definitions.html#State">Running</a> state. Places the associated
|
|
||||||
mutex in the locked state.</p>
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <a href="lock_error.html">lock_error</a> if <code>locked()</code> or
|
|
||||||
as indicated in <b>Effects</b>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>try_lock</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
bool try_lock();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> If the associated mutex is already locked by another lock in the
|
|
||||||
current thread, the effects depend on the locking strategy of the associated mutex, as
|
|
||||||
shown in the following table:</p>
|
|
||||||
|
|
||||||
<table border="1" cellpadding="5" height="147">
|
|
||||||
<tr>
|
|
||||||
<td height="34"><i><a href="mutex_concept.html#LockingStrategies">Locking Strategy</a><br>
|
|
||||||
of associated mutex</i></td>
|
|
||||||
<td height="34"><i>Effect if associated mutex is already locked by the
|
|
||||||
current thread</i></td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td height="19">Recursive</td>
|
|
||||||
<td height="19">As if an additional lock were added to the mutex.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td height="19">Checked</td>
|
|
||||||
<td height="19">Throws <a href="lock_error.html">lock_error</a>.</td>
|
|
||||||
</tr>
|
|
||||||
<tr>
|
|
||||||
<td height="19">Unspecified</td>
|
|
||||||
<td height="19">Undefined behavior [<a href="bibliography.html#ISO">ISO</a> 1.3.12] (but
|
|
||||||
typically, <a href="definitions.html#Deadlock">deadlock</a>.)</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<p>If the associated mutex is not already locked by some other thread, locks the
|
|
||||||
associated mutex and returns true, else returns false.</p>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> See effects.</p>
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <a href="lock_error.html">lock_error</a> if <code>locked()</code> or
|
|
||||||
as indicated in <b>Effects</b>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>unlock</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void unlock();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects: </b>Unlocks the associated mutex.</p>
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <a href="lock_error.html">lock_error</a> if <code>!locked()</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>const void* Conversion</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
operator const void*() const;
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> If the associated mutex is currently locked, a value convertible to
|
|
||||||
<code>true</code>, else a value convertible to <code>false</code>.</p>
|
|
||||||
|
|
||||||
<p><b>Rationale:</b> A <code>const void*</code> conversion is considered safer
|
|
||||||
than a conversion to <code>bool</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>locked</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
bool locked() const;
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> <code>this->operator const void*() != 0</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2><a name="Example">Example</a> Usage</h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/mutex.hpp"><boost/thread/mutex.hpp></a>
|
|
||||||
#include <iostream>
|
|
||||||
|
|
||||||
int main(int, char*[])
|
|
||||||
{
|
|
||||||
boost::mutex mutex;
|
|
||||||
boost::mutex::try_lock lock(mutex);
|
|
||||||
if (lock)
|
|
||||||
std::cout << "locked" << std::endl;
|
|
||||||
else
|
|
||||||
std::cout << "unlocked" << std::endl;
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>The output is:</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
locked
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->13 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39334" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
@@ -1,226 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, semaphore</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#ffffff" link="#0000ff" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><IMG height=86 alt="C++ Boost" src="../../../c++boost.gif" width=277></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">semaphore</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><a href="#Introduction">Introduction</a><br>
|
|
||||||
<a href="#Header">Header</a><br>
|
|
||||||
<a href="#Synopsis">Synopsis</a><br>
|
|
||||||
<a href="#Members">Members</a><br>
|
|
||||||
<a href="#Example">Example</a></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>The <tt>semaphore</tt> class defines a classic synchronization primitive invented by the
|
|
||||||
Dutch computer scientist Edsger W. Dijkstra. A semaphore manages an internal counter. This
|
|
||||||
counter never goes below zero, or above a specified maximum value. When calling
|
|
||||||
<tt>semaphore::down</tt> the calling thread will block until the value is non-zero and then
|
|
||||||
decrement the value in a single atomic operation. When calling <tt>semaphore::up</tt> the
|
|
||||||
calling thread will increment the value in a single atomic operation, failing if the value has
|
|
||||||
already reached the specified maximum.</p>
|
|
||||||
|
|
||||||
<p><b>Rationale:</b> The semaphore is the simplest synchronization primitive available and is generally the
|
|
||||||
primitive used to build other synchronization concepts at some level of implementation. For this
|
|
||||||
reason <b>Boost.Threads</b> defines the <tt>semaphore</tt> type in the classic form. This simplifies
|
|
||||||
usage and implementation, but it means that the interface is not as safe as other <b>Boost.Threads</b>
|
|
||||||
interfaces.</p>
|
|
||||||
|
|
||||||
<p><b><a name="Danger">Danger</a>:</b> Unlike the <A href="mutex_concept.html">mutex models</a> supplied by <b>Boost.Threads,</b>
|
|
||||||
there is no <A href="lock_concept.html">lock_concept</a> for the semaphore to help ensure proper
|
|
||||||
usage. Great care must be taken when using a <tt>semaphore</tt> object to ensure
|
|
||||||
<a href="definitions.html#Deadlock"> deadlock</a> or <a href="definitions.html#Race condition">race conditions</a> do not occur. </p>
|
|
||||||
|
|
||||||
<p>The dangers are spelled out by <a href="bibliography.html#Andrews-83">[Andrews-83]</a>
|
|
||||||
(function names updated, see historical note below): </p>
|
|
||||||
|
|
||||||
<blockquote>
|
|
||||||
|
|
||||||
<p>Although semaphores can be used to program almost any kind of synchronization,
|
|
||||||
<b>down()</b> and <b>up()</b> are rather unstructured primitives, and so it is easy to err when using them. Execution of each critical section must begin with a
|
|
||||||
<b>down()</b> and end with a <b>up()</b> (on the same semaphore). Omitting a <b>down()</b>
|
|
||||||
or <b>up()</b>, or accidentally coding a <b>down()</b> on one semaphore and a <b>up()</b>
|
|
||||||
on another can have disastrous effects, since mutually exclusive execution would no longer be ensured. Also, when using semaphores, a programmer can forget to include in critical sections all statements that reference shared objects. This, too, could destroy the mutual exclusion required within critical sections. A second difficulty with using semaphores is that both condition synchronization and mutual exclusion are programmed using the same pair of primitives. This makes it difficult to identify the purpose of a given
|
|
||||||
<b>down()</b> or <b>up()</b> operation without looking at the other operations on the corresponding semaphore. Since mutual exclusion and condition synchronization are distinct concepts, they should have distinct notations.</p>
|
|
||||||
|
|
||||||
</blockquote>
|
|
||||||
|
|
||||||
<p><b>Historical note: </b>Dijkstra's original name for <b>down()</b> was <b>P</b>
|
|
||||||
(short for the Dutch "passeren", "to pass"), and for <b>up()</b>
|
|
||||||
was <b>V</b> (short for the Dutch "vrygeven", "to release").</p>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/semaphore.hpp"><boost/thread/semaphore.hpp></a>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Synopsis">Synopsis</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost
|
|
||||||
{
|
|
||||||
class semaphore : private <a href="../../utility/utility.htm#Class noncopyable">boost::noncopyable</a> // Exposition only.
|
|
||||||
// Class semaphore meets the <a href="overview.html#NonCopyable">NonCopyable</a> requirement.
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
explicit semaphore(unsigned count=0, unsigned max=0);
|
|
||||||
~semaphore();
|
|
||||||
|
|
||||||
bool up(unsigned count=1, unsigned* prev=0);
|
|
||||||
void down();
|
|
||||||
bool down(const xtime& xt);
|
|
||||||
private:
|
|
||||||
unsigned m_count; <i>exposition only [ISO 17.3.2.3/2]
|
|
||||||
</i> unsigned m_max; <i>exposition only [ISO 17.3.2.3/2]</i>
|
|
||||||
};
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Members">Members</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
explicit semaphore(unsigned count=0, unsigned max=0);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> As if:</p>
|
|
||||||
|
|
||||||
<p><code> m_count = count;<br>
|
|
||||||
m_max = (max == 0 ? std::numeric_limits<unsigned>::max()
|
|
||||||
? max );</code></p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~semaphore();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Destroys <code>*this</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>up</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
bool up(unsigned count=1, unsigned* prev=0);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> As if:</p>
|
|
||||||
|
|
||||||
<p><code> unsigned ct;<br>
|
|
||||||
bool ret;<br>
|
|
||||||
{ // as a single atomic operation:<br>
|
|
||||||
ct = m_count;<br>
|
|
||||||
if (m_count == m_max) ret =
|
|
||||||
false;<br>
|
|
||||||
else<br>
|
|
||||||
{<br>
|
|
||||||
ret =
|
|
||||||
true;<br>
|
|
||||||
++m_count;<br>
|
|
||||||
}<br>
|
|
||||||
}<br>
|
|
||||||
if (prev) *prev = m_count;<br>
|
|
||||||
return ret;</code></p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>down</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void down();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> If <code>m_count == 0</code>, places the current thread in
|
|
||||||
the <a href="definitions.html#State">blocked</a> state until <code>m_count != 0</code>.
|
|
||||||
Finally, <code>--m_count</code>.<code> </code></p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
bool down(const <a href="xtime.html">xtime</a>& xt);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> If <code>m_count == 0</code>, places the current thread in
|
|
||||||
the <a href="definitions.html#State">blocked</a> state until <code>m_count != 0</code>
|
|
||||||
or <code>xt</code> is reached. Finally, <code>--m_count</code>.<code> </code></p>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> If xt was reached, true, else false.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2><a name="Example">Example</a> Usage</h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/semaphore.hpp"><boost/thread/semaphore.hpp></a>
|
|
||||||
#include <a href="../../../boost/thread/thread.hpp"><boost/thread/thread.hpp></a>
|
|
||||||
#include <iostream>
|
|
||||||
|
|
||||||
int global_data = 0;
|
|
||||||
boost::semaphore global_semaphore(1);
|
|
||||||
|
|
||||||
void change_global_data(void*)
|
|
||||||
{
|
|
||||||
global_semaphore.down();
|
|
||||||
++global_data;
|
|
||||||
std::cout << "global_data == " << global_data << std::endl;
|
|
||||||
global_semaphore.up();
|
|
||||||
}
|
|
||||||
|
|
||||||
int main(int, char*[])
|
|
||||||
{
|
|
||||||
const int num_threads = 4;
|
|
||||||
boost::thread_group thrds;
|
|
||||||
for (int i=0; i < num_threads; ++i)
|
|
||||||
thrds.create_thread(&change_global_data, 0);
|
|
||||||
|
|
||||||
thrds.join_all();
|
|
||||||
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>The output is:</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
global_data == 1
|
|
||||||
global_data == 2
|
|
||||||
global_data == 3
|
|
||||||
global_data == 4
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->13 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39334" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <A href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
44
doc/shared_mutex_ref.qbk
Normal file
44
doc/shared_mutex_ref.qbk
Normal file
@@ -0,0 +1,44 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2007-8 Anthony Williams.
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[section:shared_mutex Class `shared_mutex`]
|
||||||
|
|
||||||
|
#include <boost/thread/shared_mutex.hpp>
|
||||||
|
|
||||||
|
class shared_mutex
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
shared_mutex();
|
||||||
|
~shared_mutex();
|
||||||
|
|
||||||
|
void lock_shared();
|
||||||
|
bool try_lock_shared();
|
||||||
|
bool timed_lock_shared(system_time const& timeout);
|
||||||
|
void unlock_shared();
|
||||||
|
|
||||||
|
void lock();
|
||||||
|
bool try_lock();
|
||||||
|
bool timed_lock(system_time const& timeout);
|
||||||
|
void unlock();
|
||||||
|
|
||||||
|
void lock_upgrade();
|
||||||
|
void unlock_upgrade();
|
||||||
|
|
||||||
|
void unlock_upgrade_and_lock();
|
||||||
|
void unlock_and_lock_upgrade();
|
||||||
|
void unlock_and_lock_shared();
|
||||||
|
void unlock_upgrade_and_lock_shared();
|
||||||
|
};
|
||||||
|
|
||||||
|
The class `boost::shared_mutex` provides an implementation of a multiple-reader / single-writer mutex. It implements the
|
||||||
|
__upgrade_lockable_concept__.
|
||||||
|
|
||||||
|
Multiple concurrent calls to __lock_ref__, __try_lock_ref__, __timed_lock_ref__, __lock_shared_ref__, __try_lock_shared_ref__ and
|
||||||
|
__timed_lock_shared_ref__ shall be permitted.
|
||||||
|
|
||||||
|
|
||||||
|
[endsect]
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
PRE
|
|
||||||
{
|
|
||||||
BACKGROUND-COLOR: lightcyan
|
|
||||||
}
|
|
||||||
254
doc/thread.html
254
doc/thread.html
@@ -1,254 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, Boost.Threads, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, thread</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#ffffff" link="#0000ff" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><IMG height=86 alt="C++ Boost" src="../../../c++boost.gif" width=277></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">Class thread</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><A href="#Introduction">Introduction</A><br>
|
|
||||||
<A href="#Header">Header</A><br>
|
|
||||||
<A href="#Synopsis">Synopsis</A><br>
|
|
||||||
<A href="#Members">Members</A><br>
|
|
||||||
<A href="#Example">Example</A></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>The <code>thread</code> class represents threads of execution, and provides
|
|
||||||
the functionality to create and manage threads within the <b>Boost.Threads</b>
|
|
||||||
library. See <A href="definitions.html">Definitions</A> for a precise description of
|
|
||||||
"thread of execution", and for definitions of threading related terms and of thread
|
|
||||||
states such as "blocked".</p>
|
|
||||||
|
|
||||||
<p>A thread of execution has an initial function. For the program's
|
|
||||||
initial thread, the initial function is <code>main()</code>. For other
|
|
||||||
threads, the initial function is <code>operator()</code> of the function object
|
|
||||||
passed to the class <code>thread</code> constructor.</p>
|
|
||||||
|
|
||||||
<p>A thread of execution is said to be "finished" or "finished execution" when its
|
|
||||||
initial function returns or is terminated. This includes completion of all thread
|
|
||||||
cleanup handlers, and completion of the normal C++ function return behaviors, such
|
|
||||||
as destruction of automatic storage (stack) objects and releasing any associated
|
|
||||||
implementation resources.</p>
|
|
||||||
|
|
||||||
<p>A thread object has an associated state which is either "joinable" or
|
|
||||||
"non-joinable".</p>
|
|
||||||
|
|
||||||
<p>Except as described below, the policy used by an implementation of
|
|
||||||
<b>Boost.Threads</b> to schedule transitions between thread states is unspecified.</p>
|
|
||||||
|
|
||||||
<p><b>Note: </b>Just as the lifetime of a file may be different from the
|
|
||||||
lifetime of an iostream object which represents the file, the lifetime of a
|
|
||||||
thread of execution may be different from the <code>thread</code> object which
|
|
||||||
represents the thread of execution. In particular, after a call to <code>join()</code>,
|
|
||||||
the thread of execution will no longer exist even though the <code>thread</code>
|
|
||||||
object continues to exist until the end of its normal lifetime. The
|
|
||||||
converse is also possible; if a <code>thread</code> object is destroyed without
|
|
||||||
<code>join()</code> having first been called, the thread of execution continues until
|
|
||||||
its initial function completes.</p>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <A href="../../../boost/thread/thread.hpp"><boost/thread/thread.hpp></A>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Synopsis">Synopsis</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost {
|
|
||||||
|
|
||||||
class thread : <a href="../../utility/utility.htm#noncopyable">boost::noncopyable</a> // Exposition only.
|
|
||||||
// Class thread meets the <a href="overview.html#NonCopyable">NonCopyable</a> requirement.
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
thread();
|
|
||||||
explicit thread(const boost::function0<void>& threadfunc);
|
|
||||||
~thread();
|
|
||||||
|
|
||||||
bool operator==(const thread& rhs) const;
|
|
||||||
bool operator!=(const thread& rhs) const;
|
|
||||||
|
|
||||||
void join();
|
|
||||||
|
|
||||||
static void sleep(const xtime& xt);
|
|
||||||
static void yield();
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace boost
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Members">Members</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>Constructors</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
thread();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Constructs a <code>thread</code> object representing the current thread
|
|
||||||
of execution.</p>
|
|
||||||
|
|
||||||
<p><b>Postcondition:</b> <code>*this</code> is non-joinable.</p>
|
|
||||||
|
|
||||||
<p><b>Danger:</b> <code>*this</code> is valid only within the current thread.</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
thread(const <A href="../../function/index.html">boost::function0</A><void>& threadfunc);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Starts a new thread of execution and constructs a <code>thread</code> object
|
|
||||||
representing it. Copies <code>threadfunc</code>
|
|
||||||
(which in turn copies the function object wrapped by <code>threadfunc</code>) to an
|
|
||||||
internal location which persists for the lifetime of the new thread of execution. Calls
|
|
||||||
<code>operator()</code> on the copy of the <code>threadfunc</code> function object in
|
|
||||||
the new thread of execution.</p>
|
|
||||||
|
|
||||||
<p><b>Postcondition:</b> <code>*this</code> is joinable.</p>
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <code>boost::thread_resource_error</code> if a new thread of execution
|
|
||||||
cannot be started.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~thread();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Destroys <code>*this</code>. The actual thread of execution may
|
|
||||||
continue to execute after the <code>thread</code> object has been destroyed.</p>
|
|
||||||
|
|
||||||
<p><b>Notes:</b> If <code>*this</code> is joinable the actual thread of execution
|
|
||||||
becomes "detached". Any resources used by the thread will be reclaimed when the
|
|
||||||
thread of execution completes. To ensure such a thread of execution runs to completion
|
|
||||||
before the <code>thread</code> object is destroyed, call <code>join()</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>Comparison Operators</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
bool operator==(const thread& rhs);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> The thread is non-terminated or <code>*this</code> is joinable.</p>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> <code>true</code> if <code>*this</code> and <code>rhs</code>
|
|
||||||
represent the same thread of execution.</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
bool operator!=(const thread& rhs);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> <code>!(*this==rhs)</code>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>join</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void join();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> <code>*this</code> is joinable.</p>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> The current thread of execution blocks until the initial function of
|
|
||||||
the thread of execution represented by <code>*this</code> finishes and all resources
|
|
||||||
are reclaimed.</p>
|
|
||||||
|
|
||||||
<p><b>Postcondition:</b> <code>*this</code> is non-joinable.</p>
|
|
||||||
|
|
||||||
<p><b>Note:</b></p> If <code>*this == thread()</code> the result is implementation defined.
|
|
||||||
If the implementation doesn't detect this the result will be
|
|
||||||
<a href="definitions.html#Deadlock">deadlock</a>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>sleep</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
static void sleep(const <a href="xtime.html">xtime</a>& xt);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> The current thread of execution blocks until <code>xt</code> is
|
|
||||||
reached.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>yield</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
static void yield();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> The current thread of execution is placed in the "ready" state.</p>
|
|
||||||
|
|
||||||
<p><b>Notes:</b> Allow the current thread to give up the rest of its time slice
|
|
||||||
(or other scheduling quota) to another thread. Particularly useful in non-preemptive
|
|
||||||
implementations.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h2><a name="Example">Example Usage</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <boost/thread/thread.hpp>
|
|
||||||
#include <iostream>
|
|
||||||
|
|
||||||
struct thread_alarm
|
|
||||||
{
|
|
||||||
thread_alarm(int secs) : m_secs(secs) { }
|
|
||||||
void operator()()
|
|
||||||
{
|
|
||||||
boost::xtime xt;
|
|
||||||
boost::xtime_get(&xt, boost::TIME_UTC);
|
|
||||||
xt.sec += m_secs;
|
|
||||||
|
|
||||||
boost::thread::sleep(xt);
|
|
||||||
|
|
||||||
std::cout << "alarm sounded..." << std::endl;
|
|
||||||
}
|
|
||||||
|
|
||||||
int m_secs;
|
|
||||||
};
|
|
||||||
|
|
||||||
int main(int argc, char* argv[])
|
|
||||||
{
|
|
||||||
int secs = 5;
|
|
||||||
std::cout << "setting alarm for 5 seconds..." << std::endl;
|
|
||||||
boost::thread thrd(thread_alarm(secs));
|
|
||||||
thrd.join();
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>The output is:</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
setting alarm for 5 seconds...
|
|
||||||
alarm sounded...
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->13 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39334" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <A href="mailto:williamkempf@hotmail.com">William E. Kempf</A>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
193
doc/thread.qbk
Normal file
193
doc/thread.qbk
Normal file
@@ -0,0 +1,193 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2008-11 Anthony Williams
|
||||||
|
(C) Copyright 2011-12 Vicente J. Botet Escriba
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[article Thread
|
||||||
|
[quickbook 1.5]
|
||||||
|
[authors [Williams, Anthony] [Botet Escriba, Vicente J.]]
|
||||||
|
[copyright 2007-11 Anthony Williams]
|
||||||
|
[copyright 2011-12 Vicente J. Botet Escriba]
|
||||||
|
[purpose C++ Library for launching threads and synchronizing data between them]
|
||||||
|
[category text]
|
||||||
|
[license
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
[@http://www.boost.org/LICENSE_1_0.txt])
|
||||||
|
]
|
||||||
|
]
|
||||||
|
|
||||||
|
[template lockable_concept_link[link_text] [link thread.synchronization.mutex_concepts.lockable [link_text]]]
|
||||||
|
[def __lockable_concept__ [lockable_concept_link `Lockable` concept]]
|
||||||
|
[def __lockable_concept_type__ [lockable_concept_link `Lockable`]]
|
||||||
|
|
||||||
|
[template timed_lockable_concept_link[link_text] [link thread.synchronization.mutex_concepts.timed_lockable [link_text]]]
|
||||||
|
[def __timed_lockable_concept__ [timed_lockable_concept_link `TimedLockable` concept]]
|
||||||
|
[def __timed_lockable_concept_type__ [timed_lockable_concept_link `TimedLockable`]]
|
||||||
|
|
||||||
|
[template shared_lockable_concept_link[link_text] [link thread.synchronization.mutex_concepts.shared_lockable [link_text]]]
|
||||||
|
[def __shared_lockable_concept__ [shared_lockable_concept_link `SharedLockable` concept]]
|
||||||
|
[def __shared_lockable_concept_type__ [shared_lockable_concept_link `SharedLockable`]]
|
||||||
|
|
||||||
|
[template upgrade_lockable_concept_link[link_text] [link thread.synchronization.mutex_concepts.upgrade_lockable [link_text]]]
|
||||||
|
[def __upgrade_lockable_concept__ [upgrade_lockable_concept_link `UpgradeLockable` concept]]
|
||||||
|
[def __upgrade_lockable_concept_type__ [upgrade_lockable_concept_link `UpgradeLockable`]]
|
||||||
|
|
||||||
|
|
||||||
|
[template lock_ref_link[link_text] [link thread.synchronization.mutex_concepts.lockable.lock [link_text]]]
|
||||||
|
[def __lock_ref__ [lock_ref_link `lock()`]]
|
||||||
|
|
||||||
|
[template lock_multiple_ref_link[link_text] [link thread.synchronization.lock_functions.lock_multiple [link_text]]]
|
||||||
|
[def __lock_multiple_ref__ [lock_multiple_ref_link `lock()`]]
|
||||||
|
|
||||||
|
[template try_lock_multiple_ref_link[link_text] [link thread.synchronization.lock_functions.try_lock_multiple [link_text]]]
|
||||||
|
[def __try_lock_multiple_ref__ [try_lock_multiple_ref_link `try_lock()`]]
|
||||||
|
|
||||||
|
[template unlock_ref_link[link_text] [link thread.synchronization.mutex_concepts.lockable.unlock [link_text]]]
|
||||||
|
[def __unlock_ref__ [unlock_ref_link `unlock()`]]
|
||||||
|
|
||||||
|
[template try_lock_ref_link[link_text] [link thread.synchronization.mutex_concepts.lockable.try_lock [link_text]]]
|
||||||
|
[def __try_lock_ref__ [try_lock_ref_link `try_lock()`]]
|
||||||
|
|
||||||
|
[template timed_lock_ref_link[link_text] [link thread.synchronization.mutex_concepts.timed_lockable.timed_lock [link_text]]]
|
||||||
|
[def __timed_lock_ref__ [timed_lock_ref_link `timed_lock()`]]
|
||||||
|
|
||||||
|
[def __try_lock_for [link thread.synchronization.mutex_concepts.timed_lockable.try_lock_for `try_lock_for`]]
|
||||||
|
[def __try_lock_until [link thread.synchronization.mutex_concepts.timed_lockable.try_lock_until `try_lock_until`]]
|
||||||
|
|
||||||
|
[template timed_lock_duration_ref_link[link_text] [link thread.synchronization.mutex_concepts.timed_lockable.timed_lock_duration [link_text]]]
|
||||||
|
[def __timed_lock_duration_ref__ [timed_lock_duration_ref_link `timed_lock()`]]
|
||||||
|
|
||||||
|
[template lock_shared_ref_link[link_text] [link thread.synchronization.mutex_concepts.shared_lockable.lock_shared [link_text]]]
|
||||||
|
[def __lock_shared_ref__ [lock_shared_ref_link `lock_shared()`]]
|
||||||
|
|
||||||
|
[template unlock_shared_ref_link[link_text] [link thread.synchronization.mutex_concepts.shared_lockable.unlock_shared [link_text]]]
|
||||||
|
[def __unlock_shared_ref__ [unlock_shared_ref_link `unlock_shared()`]]
|
||||||
|
|
||||||
|
[template try_lock_shared_ref_link[link_text] [link thread.synchronization.mutex_concepts.shared_lockable.try_lock_shared [link_text]]]
|
||||||
|
[def __try_lock_shared_ref__ [try_lock_shared_ref_link `try_lock_shared()`]]
|
||||||
|
|
||||||
|
[template timed_lock_shared_ref_link[link_text] [link thread.synchronization.mutex_concepts.shared_lockable.timed_lock_shared [link_text]]]
|
||||||
|
[def __timed_lock_shared_ref__ [timed_lock_shared_ref_link `timed_lock_shared()`]]
|
||||||
|
|
||||||
|
[template timed_lock_shared_duration_ref_link[link_text] [link thread.synchronization.mutex_concepts.shared_lockable.timed_lock_shared_duration [link_text]]]
|
||||||
|
[def __timed_lock_shared_duration_ref__ [timed_lock_shared_duration_ref_link `timed_lock_shared()`]]
|
||||||
|
|
||||||
|
[template lock_upgrade_ref_link[link_text] [link thread.synchronization.mutex_concepts.upgrade_lockable.lock_upgrade [link_text]]]
|
||||||
|
[def __lock_upgrade_ref__ [lock_upgrade_ref_link `lock_upgrade()`]]
|
||||||
|
|
||||||
|
[template unlock_upgrade_ref_link[link_text] [link thread.synchronization.mutex_concepts.upgrade_lockable.unlock_upgrade [link_text]]]
|
||||||
|
[def __unlock_upgrade_ref__ [unlock_upgrade_ref_link `unlock_upgrade()`]]
|
||||||
|
|
||||||
|
[template unlock_upgrade_and_lock_ref_link[link_text] [link thread.synchronization.mutex_concepts.upgrade_lockable.unlock_upgrade_and_lock [link_text]]]
|
||||||
|
[def __unlock_upgrade_and_lock_ref__ [unlock_upgrade_and_lock_ref_link `unlock_upgrade_and_lock()`]]
|
||||||
|
|
||||||
|
[template unlock_and_lock_upgrade_ref_link[link_text] [link thread.synchronization.mutex_concepts.upgrade_lockable.unlock_and_lock_upgrade [link_text]]]
|
||||||
|
[def __unlock_and_lock_upgrade_ref__ [unlock_and_lock_upgrade_ref_link `unlock_and_lock_upgrade()`]]
|
||||||
|
|
||||||
|
[template unlock_upgrade_and_lock_shared_ref_link[link_text] [link thread.synchronization.mutex_concepts.upgrade_lockable.unlock_upgrade_and_lock_shared [link_text]]]
|
||||||
|
[def __unlock_upgrade_and_lock_shared_ref__ [unlock_upgrade_and_lock_shared_ref_link `unlock_upgrade_and_lock_shared()`]]
|
||||||
|
|
||||||
|
[template owns_lock_ref_link[link_text] [link thread.synchronization.locks.unique_lock.owns_lock [link_text]]]
|
||||||
|
[def __owns_lock_ref__ [owns_lock_ref_link `owns_lock()`]]
|
||||||
|
|
||||||
|
[template owns_lock_shared_ref_link[link_text] [link thread.synchronization.locks.shared_lock.owns_lock [link_text]]]
|
||||||
|
[def __owns_lock_shared_ref__ [owns_lock_shared_ref_link `owns_lock()`]]
|
||||||
|
|
||||||
|
[template mutex_func_ref_link[link_text] [link thread.synchronization.locks.unique_lock.mutex [link_text]]]
|
||||||
|
[def __mutex_func_ref__ [mutex_func_ref_link `mutex()`]]
|
||||||
|
|
||||||
|
[def __boost_thread__ [*Boost.Thread]]
|
||||||
|
[def __not_a_thread__ ['Not-a-Thread]]
|
||||||
|
[def __interruption_points__ [link interruption_points ['interruption points]]]
|
||||||
|
|
||||||
|
[def __mutex__ [link thread.synchronization.mutex_types.mutex `boost::mutex`]]
|
||||||
|
[def __try_mutex__ [link thread.synchronization.mutex_types.try_mutex `boost::try_mutex`]]
|
||||||
|
[def __timed_mutex__ [link thread.synchronization.mutex_types.timed_mutex `boost::timed_mutex`]]
|
||||||
|
[def __recursive_mutex__ [link thread.synchronization.mutex_types.recursive_mutex `boost::recursive_mutex`]]
|
||||||
|
[def __recursive_try_mutex__ [link thread.synchronization.mutex_types.recursive_try_mutex `boost::recursive_try_mutex`]]
|
||||||
|
[def __recursive_timed_mutex__ [link thread.synchronization.mutex_types.recursive_timed_mutex `boost::recursive_timed_mutex`]]
|
||||||
|
[def __shared_mutex__ [link thread.synchronization.mutex_types.shared_mutex `boost::shared_mutex`]]
|
||||||
|
|
||||||
|
[template unique_lock_link[link_text] [link thread.synchronization.locks.unique_lock [link_text]]]
|
||||||
|
|
||||||
|
[def __lock_guard__ [link thread.synchronization.locks.lock_guard `boost::lock_guard`]]
|
||||||
|
[def __unique_lock__ [unique_lock_link `boost::unique_lock`]]
|
||||||
|
[def __shared_lock__ [link thread.synchronization.locks.shared_lock `boost::shared_lock`]]
|
||||||
|
[def __upgrade_lock__ [link thread.synchronization.locks.upgrade_lock `boost::upgrade_lock`]]
|
||||||
|
[def __upgrade_to_unique_lock__ [link thread.synchronization.locks.upgrade_to_unique_lock `boost::upgrade_to_unique_lock`]]
|
||||||
|
|
||||||
|
|
||||||
|
[def __thread__ [link thread.thread_management.thread `boost::thread`]]
|
||||||
|
[def __thread [link thread.thread_management.thread `boost::thread`]]
|
||||||
|
[def __thread_id__ [link thread.thread_management.thread.id `boost::thread::id`]]
|
||||||
|
[template join_link[link_text] [link thread.thread_management.thread.join [link_text]]]
|
||||||
|
[def __join__ [join_link `join()`]]
|
||||||
|
|
||||||
|
[def __try_join_for [link thread.thread_management.thread.try_join_for `try_join_for`]]
|
||||||
|
[def __try_join_until [link thread.thread_management.thread.try_join_until `try_join_until`]]
|
||||||
|
|
||||||
|
|
||||||
|
[template timed_join_link[link_text] [link thread.thread_management.thread.timed_join [link_text]]]
|
||||||
|
[def __timed_join__ [timed_join_link `timed_join()`]]
|
||||||
|
[def __detach__ [link thread.thread_management.thread.detach `detach()`]]
|
||||||
|
[def __interrupt__ [link thread.thread_management.thread.interrupt `interrupt()`]]
|
||||||
|
[def __sleep__ [link thread.thread_management.this_thread.sleep `boost::this_thread::sleep()`]]
|
||||||
|
[def __sleep_for [link thread.thread_management.this_thread.sleep_for `sleep_for`]]
|
||||||
|
[def __sleep_until [link thread.thread_management.this_thread.sleep_until `sleep_until`]]
|
||||||
|
|
||||||
|
[def __interruption_enabled__ [link thread.thread_management.this_thread.interruption_enabled `boost::this_thread::interruption_enabled()`]]
|
||||||
|
[def __interruption_requested__ [link thread.thread_management.this_thread.interruption_requested `boost::this_thread::interruption_requested()`]]
|
||||||
|
[def __interruption_point__ [link thread.thread_management.this_thread.interruption_point `boost::this_thread::interruption_point()`]]
|
||||||
|
[def __disable_interruption__ [link thread.thread_management.this_thread.disable_interruption `boost::this_thread::disable_interruption`]]
|
||||||
|
[def __restore_interruption__ [link thread.thread_management.this_thread.restore_interruption `boost::this_thread::restore_interruption`]]
|
||||||
|
|
||||||
|
[def __thread_resource_error__ `boost::thread_resource_error`]
|
||||||
|
[def __thread_interrupted__ `boost::thread_interrupted`]
|
||||||
|
[def __barrier__ [link thread.synchronization.barriers.barrier `boost::barrier`]]
|
||||||
|
|
||||||
|
[template cond_wait_link[link_text] [link thread.synchronization.condvar_ref.condition_variable.wait [link_text]]]
|
||||||
|
[def __cond_wait__ [cond_wait_link `wait()`]]
|
||||||
|
[template cond_timed_wait_link[link_text] [link thread.synchronization.condvar_ref.condition_variable.timed_wait [link_text]]]
|
||||||
|
[def __cond_timed_wait__ [cond_timed_wait_link `timed_wait()`]]
|
||||||
|
|
||||||
|
[def __condition_variable [link thread.synchronization.condvar_ref.condition_variable `condition_variable`]]
|
||||||
|
[def __wait_for [link thread.synchronization.condvar_ref.condition_variable.wait_for `wait_for`]]
|
||||||
|
[def __wait_until [link thread.synchronization.condvar_ref.condition_variable.wait_until `wait_until`]]
|
||||||
|
|
||||||
|
|
||||||
|
[template cond_any_wait_link[link_text] [link thread.synchronization.condvar_ref.condition_variable_any.wait [link_text]]]
|
||||||
|
[def __cond_any_wait__ [cond_any_wait_link `wait()`]]
|
||||||
|
[template cond_any_timed_wait_link[link_text] [link thread.synchronization.condvar_ref.condition_variable_any.timed_wait [link_text]]]
|
||||||
|
[def __cond_any_timed_wait__ [cond_any_timed_wait_link `timed_wait()`]]
|
||||||
|
|
||||||
|
[def __condition_variable_any [link thread.synchronization.condvar_ref.condition_variable_any `condition_variable_any`]]
|
||||||
|
[def __cvany_wait_for [link thread.synchronization.condvar_ref.condition_variable_any.wait_for `wait_for`]]
|
||||||
|
[def __cvany_wait_until [link thread.synchronization.condvar_ref.condition_variable_any.wait_until `wait_until`]]
|
||||||
|
|
||||||
|
[def __blocked__ ['blocked]]
|
||||||
|
|
||||||
|
[include overview.qbk]
|
||||||
|
[include changes.qbk]
|
||||||
|
|
||||||
|
[include thread_ref.qbk]
|
||||||
|
|
||||||
|
[section:synchronization Synchronization]
|
||||||
|
[include mutex_concepts.qbk]
|
||||||
|
[include mutexes.qbk]
|
||||||
|
[include condition_variables.qbk]
|
||||||
|
[include once.qbk]
|
||||||
|
[include barrier.qbk]
|
||||||
|
[include futures.qbk]
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[include tss.qbk]
|
||||||
|
|
||||||
|
[include time.qbk]
|
||||||
|
|
||||||
|
[include acknowledgements.qbk]
|
||||||
|
|
||||||
|
[include compliance.qbk]
|
||||||
@@ -1,187 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, thread_group</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">thread_group</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><a href="#Introduction">Introduction</a><br>
|
|
||||||
<a href="#Header">Header</a><br>
|
|
||||||
<a href="#Synopsis">Synopsis</a><br>
|
|
||||||
<a href="#Members">Members</a><br>
|
|
||||||
<a href="#Example">Example</a></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>The <tt>thread_group</tt> class provides a container for easy grouping of threads to simplify several
|
|
||||||
common thread creation and management idioms.</p>
|
|
||||||
|
|
||||||
<p>All <tt>thread_group</tt> member functions are <a href="definitions.html#thread-safe">thread-safe</a>,
|
|
||||||
except destruction.</p>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/thread.hpp"><boost/thread/thread.hpp></a>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Synopsis">Synopsis</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost
|
|
||||||
{
|
|
||||||
class thread_group : <a href="../../utility/utility.htm#noncopyable">boost::noncopyable</a>
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
thread_group();
|
|
||||||
~thread_group();
|
|
||||||
|
|
||||||
thread* create_thread(const boost::function0<void>& threadfunc);
|
|
||||||
void add_thread(thread* thrd);
|
|
||||||
void remove_thread(thread* thrd);
|
|
||||||
void join_all();
|
|
||||||
};
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Members">Members</a></h2>
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
thread_group();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Constructs an empty <tt>thread_group</tt> container.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~thread_group();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Destroys each contained thread object. Destroys <code>*this</code>.</p>
|
|
||||||
|
|
||||||
<p><b>Notes:</b> Behavior is undefined if another thread references *this during
|
|
||||||
the execution of the destructor.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>create_thread</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
thread* create_thread(const boost::function0<void>& threadfunc);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Creates a new <tt>thread</tt> object that executes <tt>threadfunc</tt> and adds it to the
|
|
||||||
<tt>thread_group</tt> container object's list of managed <tt>thread</tt> objects.</p>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> Pointer to the newly created thread.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>add_thread</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void add_thread(thread* thrd);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Adds <tt>thrd</tt> to the <tt>thread_group</tt> object's list of managed <tt>thread</tt>
|
|
||||||
objects. The <tt>thrd</tt> object must have been allocated via operator new and will
|
|
||||||
be deleted when the group is destroyed.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>remove_thread</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void remove_thread(thread* thrd);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Removes <code>*this</code>'s list of managed <tt>thread</tt>
|
|
||||||
objects.</p>
|
|
||||||
|
|
||||||
<p><b>Throws: </b>? if <tt>thrd</tt> is not it <code>*this</code>'s list of managed <tt>thread</tt>
|
|
||||||
objects.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>join_all</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void join_all();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> Calls <code> join()</code> on each of the managed <tt>thread</tt> objects.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h2><a name="Example">Example</a> Usage</h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <boost/thread/thread.hpp>
|
|
||||||
#include <iostream>
|
|
||||||
|
|
||||||
int count = 0;
|
|
||||||
boost::mutex mutex;
|
|
||||||
|
|
||||||
void increment_count()
|
|
||||||
{
|
|
||||||
boost::mutex::lock lock(mutex);
|
|
||||||
std::cout << "count = " << ++count << std::endl;
|
|
||||||
}
|
|
||||||
|
|
||||||
int main(int argc, char* argv[])
|
|
||||||
{
|
|
||||||
boost::thread_group threads;
|
|
||||||
for (int i = 0; i < 10; ++i)
|
|
||||||
threads.create_thread(&increment_count);
|
|
||||||
threads.join_all();
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>The output is:</p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
count = 1
|
|
||||||
count = 2
|
|
||||||
count = 3
|
|
||||||
count = 4
|
|
||||||
count = 5
|
|
||||||
count = 6
|
|
||||||
count = 7
|
|
||||||
count = 8
|
|
||||||
count = 9
|
|
||||||
count = 10
|
|
||||||
</pre>
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->06 August, 2001<!--webbot bot="Timestamp" endspan i-checksum="34352" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
1502
doc/thread_ref.qbk
Normal file
1502
doc/thread_ref.qbk
Normal file
File diff suppressed because it is too large
Load Diff
@@ -1,80 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, BTL, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, thread_resource_error</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">thread_resource_error</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><a href="#Introduction">Introduction</a><br>
|
|
||||||
<a href="#Header">Header</a><br>
|
|
||||||
<a href="#Synopsis">Synopsis</a><br>
|
|
||||||
<a href="#Members">Members</a><br>
|
|
||||||
<a href="#Example">Example</a></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>The <code>thread_resource_error</code> class defines an exception type that is thrown
|
|
||||||
by constructors in the <b>Boost.Threads</b> library when thread related resources
|
|
||||||
can not be
|
|
||||||
acquired. This does not include memory allocation failures which instead throw
|
|
||||||
std::bad_alloc.</p>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/thread.hpp"><boost/thread/exceptions.hpp></a>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Synopsis">Synopsis</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost
|
|
||||||
{
|
|
||||||
class thread_resource_error : public std::runtime_error
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
thread_resource_error();
|
|
||||||
};
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Members">Members</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
thread_resource_error();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p>Constructs a <code>thread_resource_error</code> object.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->04 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39335" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
@@ -1,214 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, Boost.Threads, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, thread_specific_ptr</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">thread_specific_ptr</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><A href="#Introduction">Introduction</A><br>
|
|
||||||
<A href="#Header">Header</A><br>
|
|
||||||
<A href="#Synopsis">Synopsis</A><br>
|
|
||||||
<A href="#Members">Members</A><br>
|
|
||||||
<A href="#Example">Example</A></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>The <code>thread_specific_ptr</code> class defines an interface for using thread
|
|
||||||
specific storage. Thread specific storage is data associated with individual threads
|
|
||||||
and is often used to make operations
|
|
||||||
<a href="definitions.html#Thread-safe">thread-safe</a> that rely on global data.</p>
|
|
||||||
|
|
||||||
<p>Template <code>thread_specific_ptr</code> stores a pointer to an object obtained via
|
|
||||||
<code>new</code> on a thread-by-thread basis and calls delete on the contained pointer
|
|
||||||
when the thread terminates. Each thread initially stores the null pointer in each
|
|
||||||
<code>thread_specific_ptr</code> instance.</p>
|
|
||||||
|
|
||||||
<p>The template <code>thread_specific_ptr</code> is useful in the following cases:</p>
|
|
||||||
|
|
||||||
<ul>
|
|
||||||
<li>An interface was original written assuming a single thread of control and is
|
|
||||||
being ported to a multi-threaded environment.</li>
|
|
||||||
<li>Each thread of control invokes sequences of methods that share data that must be
|
|
||||||
logically accessed through a globally visible access point, but are physically
|
|
||||||
unique for each thread, instead of being explicitly passed.</li>
|
|
||||||
</ul>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/tss.hpp"><boost/thread/tss.hpp></a>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Synopsis">Synopsis</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost {
|
|
||||||
|
|
||||||
template <typename T>
|
|
||||||
class thread_specific_ptr : private boost::noncopyable // Exposition only.
|
|
||||||
// Class thread_specific_ptr meets the <a href="overview.html#NonCopyable">NonCopyable</a> requirement.
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
thread_specific_ptr();
|
|
||||||
~thread_specific_ptr();
|
|
||||||
|
|
||||||
T* get() const;
|
|
||||||
T* operator->() const;
|
|
||||||
T& operator*() const;
|
|
||||||
T* release();
|
|
||||||
void reset(T* p=0);
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace boost
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Members">Members</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>Constructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
thread_specific_ptr();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Postconditions:</b> A thread specific storage has been reserved for use by *this
|
|
||||||
in all threads, with each thread initially storing a null pointer.</p>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> The expression <code>delete get()</code> is well formed.</p>
|
|
||||||
|
|
||||||
<p><b>Throws:</b> <code>boost::thread_resource_error</code> if the necessary resources
|
|
||||||
can not be obtained.</p>
|
|
||||||
|
|
||||||
<p><b>Notes:</b> There is an implementation specific limit to the number of thread
|
|
||||||
specific storage objects that can be created, and this limit may be small.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>Destructor</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
~thread_specific_ptr();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Notes:</b> Does not destroy any data that may be stored in any thread's thread
|
|
||||||
specific storage. For this reason you should not destroy a
|
|
||||||
<code>thread_specific_ptr</code> object until you are certain there are no threads
|
|
||||||
running that have made use of its thread specific storage.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>get</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
T* get() const;
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> The object stored in thread specific storage for the current thread
|
|
||||||
for *this.</p>
|
|
||||||
|
|
||||||
<p><b>Notes:</b> Each thread initially returns 0.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>Smart Pointer Operations</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
T* operator->() const;
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> <code>get()</code></p>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
T& operator*() const;
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> <code>get()</code></p>
|
|
||||||
|
|
||||||
<p><b>Requires:</b> <code>get() != 0</code></p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>Release</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
T* release();
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> <code>get()</code></p>
|
|
||||||
|
|
||||||
<p><b>Postcondition:</b> *this holds the null pointer for the current thread.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>Reset</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
void reset(T* p=0);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Effects:</b> If <code>get()!= p</code> then <code>delete get()</code>.</p>
|
|
||||||
|
|
||||||
<p><b>Postconditions:</b> <code>*this</code> holds the pointer <code>p</code> for
|
|
||||||
the current thread.</p>
|
|
||||||
|
|
||||||
<p><b>Notes:</b> The pointer will be deleted when the thread terminates.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h2><a name="Example">Example Usage</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/thread.hpp"><boost/thread/thread.hpp></a>
|
|
||||||
#include <a href="../../../boost/thread/tss.hpp"><boost/thread/tss.hpp></a>
|
|
||||||
#include <cassert>
|
|
||||||
|
|
||||||
boost::thread_specific_ptr<int> value;
|
|
||||||
|
|
||||||
void increment()
|
|
||||||
{
|
|
||||||
int* p = value.get();
|
|
||||||
++*p;
|
|
||||||
}
|
|
||||||
|
|
||||||
void thread_proc()
|
|
||||||
{
|
|
||||||
value.reset(new int(0)); // initialize the thread's storage
|
|
||||||
for (int i=0; i<10; ++i)
|
|
||||||
{
|
|
||||||
increment();
|
|
||||||
int* p = value.get();
|
|
||||||
assert(*p == i+1);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
int main(int argc, char* argv[])
|
|
||||||
{
|
|
||||||
boost::thread_group threads;
|
|
||||||
for (int i=0; i<5; ++i)
|
|
||||||
threads.create_thread(&thread_proc);
|
|
||||||
threads.join_all();
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->13 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39334" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
75
doc/time.qbk
Normal file
75
doc/time.qbk
Normal file
@@ -0,0 +1,75 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2007-8 Anthony Williams.
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[section:time Date and Time Requirements]
|
||||||
|
|
||||||
|
As of Boost 1.35.0, the __boost_thread__ library uses the [link date_time Boost.Date_Time] library for all operations that require a
|
||||||
|
time out. These include (but are not limited to):
|
||||||
|
|
||||||
|
* __sleep__
|
||||||
|
* __timed_join__
|
||||||
|
* __cond_timed_wait__
|
||||||
|
* __timed_lock_ref__
|
||||||
|
|
||||||
|
For the overloads that accept an absolute time parameter, an object of type [link thread.time.system_time `boost::system_time`] is
|
||||||
|
required. Typically, this will be obtained by adding a duration to the current time, obtained with a call to [link
|
||||||
|
thread.time.get_system_time `boost::get_system_time()`]. e.g.
|
||||||
|
|
||||||
|
boost::system_time const timeout=boost::get_system_time() + boost::posix_time::milliseconds(500);
|
||||||
|
|
||||||
|
extern bool done;
|
||||||
|
extern boost::mutex m;
|
||||||
|
extern boost::condition_variable cond;
|
||||||
|
|
||||||
|
boost::unique_lock<boost::mutex> lk(m);
|
||||||
|
while(!done)
|
||||||
|
{
|
||||||
|
if(!cond.timed_wait(lk,timeout))
|
||||||
|
{
|
||||||
|
throw "timed out";
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
For the overloads that accept a ['TimeDuration] parameter, an object of any type that meets the [link
|
||||||
|
date_time.posix_time.time_duration Boost.Date_Time Time Duration requirements] can be used, e.g.
|
||||||
|
|
||||||
|
boost::this_thread::sleep(boost::posix_time::milliseconds(25));
|
||||||
|
|
||||||
|
boost::mutex m;
|
||||||
|
if(m.timed_lock(boost::posix_time::nanoseconds(100)))
|
||||||
|
{
|
||||||
|
// ...
|
||||||
|
}
|
||||||
|
|
||||||
|
[section:system_time Typedef `system_time`]
|
||||||
|
|
||||||
|
#include <boost/thread/thread_time.hpp>
|
||||||
|
|
||||||
|
typedef boost::posix_time::ptime system_time;
|
||||||
|
|
||||||
|
See the documentation for [link date_time.posix_time.ptime_class `boost::posix_time::ptime`] in the Boost.Date_Time library.
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:get_system_time Non-member function `get_system_time()`]
|
||||||
|
|
||||||
|
#include <boost/thread/thread_time.hpp>
|
||||||
|
|
||||||
|
system_time get_system_time();
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Returns:] [The current time.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
|
||||||
|
[endsect]
|
||||||
189
doc/tss.qbk
Normal file
189
doc/tss.qbk
Normal file
@@ -0,0 +1,189 @@
|
|||||||
|
[/
|
||||||
|
(C) Copyright 2007-8 Anthony Williams.
|
||||||
|
Distributed under the Boost Software License, Version 1.0.
|
||||||
|
(See accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
http://www.boost.org/LICENSE_1_0.txt).
|
||||||
|
]
|
||||||
|
|
||||||
|
[section Thread Local Storage]
|
||||||
|
|
||||||
|
[heading Synopsis]
|
||||||
|
|
||||||
|
Thread local storage allows multi-threaded applications to have a separate instance of a given data item for each thread. Where a
|
||||||
|
single-threaded application would use static or global data, this could lead to contention, deadlock or data corruption in a
|
||||||
|
multi-threaded application. One example is the C `errno` variable, used for storing the error code related to functions from the
|
||||||
|
Standard C library. It is common practice (and required by POSIX) for compilers that support multi-threaded applications to provide
|
||||||
|
a separate instance of `errno` for each thread, in order to avoid different threads competing to read or update the value.
|
||||||
|
|
||||||
|
Though compilers often provide this facility in the form of extensions to the declaration syntax (such as `__declspec(thread)` or
|
||||||
|
`__thread` annotations on `static` or namespace-scope variable declarations), such support is non-portable, and is often limited in
|
||||||
|
some way, such as only supporting POD types.
|
||||||
|
|
||||||
|
[heading Portable thread-local storage with `boost::thread_specific_ptr`]
|
||||||
|
|
||||||
|
`boost::thread_specific_ptr` provides a portable mechanism for thread-local storage that works on all compilers supported by
|
||||||
|
__boost_thread__. Each instance of `boost::thread_specific_ptr` represents a pointer to an object (such as `errno`) where each
|
||||||
|
thread must have a distinct value. The value for the current thread can be obtained using the `get()` member function, or by using
|
||||||
|
the `*` and `->` pointer deference operators. Initially the pointer has a value of `NULL` in each thread, but the value for the
|
||||||
|
current thread can be set using the `reset()` member function.
|
||||||
|
|
||||||
|
If the value of the pointer for the current thread is changed using `reset()`, then the previous value is destroyed by calling the
|
||||||
|
cleanup routine. Alternatively, the stored value can be reset to `NULL` and the prior value returned by calling the `release()`
|
||||||
|
member function, allowing the application to take back responsibility for destroying the object.
|
||||||
|
|
||||||
|
[heading Cleanup at thread exit]
|
||||||
|
|
||||||
|
When a thread exits, the objects associated with each `boost::thread_specific_ptr` instance are destroyed. By default, the object
|
||||||
|
pointed to by a pointer `p` is destroyed by invoking `delete p`, but this can be overridden for a specific instance of
|
||||||
|
`boost::thread_specific_ptr` by providing a cleanup routine to the constructor. In this case, the object is destroyed by invoking
|
||||||
|
`func(p)` where `func` is the cleanup routine supplied to the constructor. The cleanup functions are called in an unspecified
|
||||||
|
order. If a cleanup routine sets the value of associated with an instance of `boost::thread_specific_ptr` that has already been
|
||||||
|
cleaned up, that value is added to the cleanup list. Cleanup finishes when there are no outstanding instances of
|
||||||
|
`boost::thread_specific_ptr` with values.
|
||||||
|
|
||||||
|
Note: on some platforms, cleanup of thread-specific data is not
|
||||||
|
performed for threads created with the platform's native API. On those
|
||||||
|
platforms such cleanup is only done for threads that are started with
|
||||||
|
`boost::thread` unless `boost::on_thread_exit()` is called manually
|
||||||
|
from that thread.
|
||||||
|
|
||||||
|
[section:thread_specific_ptr Class `thread_specific_ptr`]
|
||||||
|
|
||||||
|
#include <boost/thread/tss.hpp>
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
class thread_specific_ptr
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
thread_specific_ptr();
|
||||||
|
explicit thread_specific_ptr(void (*cleanup_function)(T*));
|
||||||
|
~thread_specific_ptr();
|
||||||
|
|
||||||
|
T* get() const;
|
||||||
|
T* operator->() const;
|
||||||
|
T& operator*() const;
|
||||||
|
|
||||||
|
T* release();
|
||||||
|
void reset(T* new_value=0);
|
||||||
|
};
|
||||||
|
|
||||||
|
[section:default_constructor `thread_specific_ptr();`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Requires:] [`delete this->get()` is well-formed.]]
|
||||||
|
|
||||||
|
[[Effects:] [Construct a `thread_specific_ptr` object for storing a pointer to an object of type `T` specific to each thread. The
|
||||||
|
default `delete`-based cleanup function will be used to destroy any thread-local objects when `reset()` is called, or the thread
|
||||||
|
exits.]]
|
||||||
|
|
||||||
|
[[Throws:] [`boost::thread_resource_error` if an error occurs.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:constructor_with_custom_cleanup `explicit thread_specific_ptr(void (*cleanup_function)(T*));`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Requires:] [`cleanup_function(this->get())` does not throw any exceptions.]]
|
||||||
|
|
||||||
|
[[Effects:] [Construct a `thread_specific_ptr` object for storing a pointer to an object of type `T` specific to each thread. The
|
||||||
|
supplied `cleanup_function` will be used to destroy any thread-local objects when `reset()` is called, or the thread exits.]]
|
||||||
|
|
||||||
|
[[Throws:] [`boost::thread_resource_error` if an error occurs.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:destructor `~thread_specific_ptr();`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Calls `this->reset()` to clean up the associated value for the current thread, and destroys `*this`.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[note Care needs to be taken to ensure that any threads still running after an instance of `boost::thread_specific_ptr` has been
|
||||||
|
destroyed do not call any member functions on that instance.]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:get `T* get() const;`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Returns:] [The pointer associated with the current thread.]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[note The initial value associated with an instance of `boost::thread_specific_ptr` is `NULL` for each thread.]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:operator_arrow `T* operator->() const;`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Returns:] [`this->get()`]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:operator_star `T& operator*() const;`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Requires:] [`this->get` is not `NULL`.]]
|
||||||
|
|
||||||
|
[[Returns:] [`*(this->get())`]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:reset `void reset(T* new_value=0);`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [If `this->get()!=new_value` and `this->get()` is non-`NULL`, invoke `delete this->get()` or
|
||||||
|
`cleanup_function(this->get())` as appropriate. Store `new_value` as the pointer associated with the current thread.]]
|
||||||
|
|
||||||
|
[[Postcondition:] [`this->get()==new_value`]]
|
||||||
|
|
||||||
|
[[Throws:] [`boost::thread_resource_error` if an error occurs.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[section:release `T* release();`]
|
||||||
|
|
||||||
|
[variablelist
|
||||||
|
|
||||||
|
[[Effects:] [Return `this->get()` and store `NULL` as the pointer associated with the current thread without invoking the cleanup
|
||||||
|
function.]]
|
||||||
|
|
||||||
|
[[Postcondition:] [`this->get()==0`]]
|
||||||
|
|
||||||
|
[[Throws:] [Nothing.]]
|
||||||
|
|
||||||
|
]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
|
||||||
|
[endsect]
|
||||||
|
|
||||||
|
[endsect]
|
||||||
141
doc/xtime.html
141
doc/xtime.html
@@ -1,141 +0,0 @@
|
|||||||
<html>
|
|
||||||
|
|
||||||
<head>
|
|
||||||
<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
|
|
||||||
<meta name="keywords" content="threads, Boost.Threads, thread library, C++">
|
|
||||||
<link rel="stylesheet" type="text/css" href="styles.css">
|
|
||||||
<title>Boost.Threads, xtime</title>
|
|
||||||
</head>
|
|
||||||
|
|
||||||
<body bgcolor="#FFFFFF" link="#0000FF" vlink="#800080">
|
|
||||||
|
|
||||||
<table border="0" cellpadding="7" cellspacing="0" width="100%">
|
|
||||||
<tr>
|
|
||||||
<td valign="top" width="300">
|
|
||||||
<h3><img src="../../../c++boost.gif" alt="C++ Boost" width="277" height="86"></h3>
|
|
||||||
</td>
|
|
||||||
<td valign="top">
|
|
||||||
<h1 align="center">Boost.Threads</h1>
|
|
||||||
<h2 align="center">xtime</h2>
|
|
||||||
</td>
|
|
||||||
</tr>
|
|
||||||
</table>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p><A href="#Introduction">Introduction</A><br>
|
|
||||||
<A href="#Header">Header</A><br>
|
|
||||||
<A href="#Synopsis">Synopsis</A><br>
|
|
||||||
<A href="#Reference">Reference</A><br>
|
|
||||||
<A href="#Example">Example</A></p>
|
|
||||||
|
|
||||||
<h2><a name="Introduction">Introduction</a></h2>
|
|
||||||
|
|
||||||
<p>The <code>xtime</code> type is used to represent a point on some time scale or
|
|
||||||
a duration in time. This type may be proposed for the C standard by Markus Kuhn.
|
|
||||||
<b>Boost.Threads</b> provides only a very minimal implementation of this proposal
|
|
||||||
and it's expected that a full implementation will be provided in Boost as a separate
|
|
||||||
library, at which time <b>Boost.Threads</b> will deprecate its implementation.</p>
|
|
||||||
|
|
||||||
<h2><a name="Header">Header</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/xtime.hpp"><boost/thread/xtime.hpp></a>
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Synopsis">Synopsis</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
namespace boost {
|
|
||||||
|
|
||||||
enum
|
|
||||||
{
|
|
||||||
TIME_UTC=1,
|
|
||||||
};
|
|
||||||
|
|
||||||
struct xtime
|
|
||||||
{
|
|
||||||
#if defined(BOOST_NO_INT64_T)
|
|
||||||
int_fast32_t sec;
|
|
||||||
#else
|
|
||||||
int_fast64_t sec;
|
|
||||||
#endif
|
|
||||||
int_fast32_t nsec;
|
|
||||||
};
|
|
||||||
|
|
||||||
int xtime_get(struct xtime* xtp, int clock_type);
|
|
||||||
|
|
||||||
} // namespace boost
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<h2><a name="Reference">Reference</a></h2>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>TIME_UTC</h3>
|
|
||||||
|
|
||||||
<p>The clock type for Coordinated Universal Time (UTC). The epoch for this clock type
|
|
||||||
is 1970-01-01 00:00:00. This is the only clock type supported by <b>Boost.Threads</b>.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>xtime</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
struct xtime
|
|
||||||
{
|
|
||||||
#if defined(BOOST_NO_INT64_T)
|
|
||||||
int_fast32_t sec;
|
|
||||||
#else
|
|
||||||
int_fast64_t sec;
|
|
||||||
#endif
|
|
||||||
int_fast32_t nsec;
|
|
||||||
};
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>sec</b> represents the whole seconds that have passed since the epoch.</p>
|
|
||||||
|
|
||||||
<p><b>nsec</b> represents the nanoseconds since <code>sec.</code>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h3>xtime_get</h3>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
int xtime_get(struct xtime* xtp, int clock_type);
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<p><b>Postcondition:</b> <code>xtp</code> represents the current point in time
|
|
||||||
as a duration since the epoch specified by the <code>clock_type</code>.</p>
|
|
||||||
|
|
||||||
<p><b>Returns:</b> <code>clock_type</code> if successful, otherwise 0.
|
|
||||||
|
|
||||||
<p><b>Notes:</b> The resolution is implementation specific. For many
|
|
||||||
implementations the best resolution of time is far more than one nanosecond, and
|
|
||||||
even when the resolution is reasonably good, the latency of a call to <code>xtime_get()</code>
|
|
||||||
may be significant. For maximum portability, avoid durations of less than
|
|
||||||
one second.</p>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
<h2><a name="Example">Example Usage</a></h2>
|
|
||||||
|
|
||||||
<pre>
|
|
||||||
#include <a href="../../../boost/thread/thread.hpp"><boost/thread/thread.hpp></a>
|
|
||||||
#include <a href="../../../boost/thread/tss.hpp"><boost/thread/xtime.hpp></a>
|
|
||||||
|
|
||||||
int main(int argc, char* argv[])
|
|
||||||
{
|
|
||||||
boost::xtime xt;
|
|
||||||
boost::xtime_get(&xt, boost::TIME_UTC);
|
|
||||||
xt.sec += 1;
|
|
||||||
boost::thread::sleep(xt); // Sleep for 1 second
|
|
||||||
}
|
|
||||||
</pre>
|
|
||||||
|
|
||||||
<hr>
|
|
||||||
|
|
||||||
<p>Revised <!--webbot bot="Timestamp" S-Type="EDITED" S-Format="%d %B, %Y" startspan -->10 September, 2001<!--webbot bot="Timestamp" endspan i-checksum="39328" -->
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<p><i>© Copyright <a href="mailto:williamkempf@hotmail.com">William E. Kempf</a>
|
|
||||||
2001 all rights reserved.</i></p>
|
|
||||||
|
|
||||||
</body>
|
|
||||||
</html>
|
|
||||||
@@ -1,66 +0,0 @@
|
|||||||
# (C) Copyright William E. Kempf 2001. Permission to copy, use, modify, sell and
|
|
||||||
# distribute this software is granted provided this copyright notice appears
|
|
||||||
# in all copies. This software is provided "as is" without express or implied
|
|
||||||
# warranty, and with no claim as to its suitability for any purpose.
|
|
||||||
#
|
|
||||||
# Boost.Threads build and test Jamfile
|
|
||||||
#
|
|
||||||
# Declares the following targets:
|
|
||||||
# 1. monitor, an example program.
|
|
||||||
# 2. starvephil, an example program.
|
|
||||||
# 3. tennis, an example program.
|
|
||||||
|
|
||||||
# declare the location of this subproject relative to the root
|
|
||||||
subproject libs/thread/example ;
|
|
||||||
|
|
||||||
# Do some OS-specific setup
|
|
||||||
if $(NT)
|
|
||||||
{
|
|
||||||
BOOST_THREADMON_LIB = <lib>../build/libboost_threadmon ;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
BOOST_THREADMON_LIB = ;
|
|
||||||
}
|
|
||||||
|
|
||||||
#######################
|
|
||||||
|
|
||||||
#
|
|
||||||
# Declare the Boost.Threads monitor example program.
|
|
||||||
#
|
|
||||||
|
|
||||||
exe monitor : monitor/monitor.cpp
|
|
||||||
<lib>../build/libboost_thread
|
|
||||||
$(BOOST_THREADMON_LIB)
|
|
||||||
# requirements
|
|
||||||
: <include>$(BOOST_ROOT)
|
|
||||||
<threading>multi
|
|
||||||
: debug release ;
|
|
||||||
|
|
||||||
#######################
|
|
||||||
|
|
||||||
#
|
|
||||||
# Declare the Boost.Threads starvephil example program.
|
|
||||||
#
|
|
||||||
|
|
||||||
exe starvephil : starvephil/starvephil.cpp
|
|
||||||
<lib>../build/libboost_thread
|
|
||||||
$(BOOST_THREADMON_LIB)
|
|
||||||
# requirements
|
|
||||||
: <include>$(BOOST_ROOT)
|
|
||||||
<threading>multi
|
|
||||||
: debug release ;
|
|
||||||
|
|
||||||
#######################
|
|
||||||
|
|
||||||
#
|
|
||||||
# Declare the Boost.Threads tennis example program.
|
|
||||||
#
|
|
||||||
|
|
||||||
exe tennis : tennis/tennis.cpp
|
|
||||||
<lib>../build/libboost_thread
|
|
||||||
$(BOOST_THREADMON_LIB)
|
|
||||||
# requirements
|
|
||||||
: <include>$(BOOST_ROOT)
|
|
||||||
<threading>multi
|
|
||||||
: debug release ;
|
|
||||||
23
example/Jamfile.v2
Normal file
23
example/Jamfile.v2
Normal file
@@ -0,0 +1,23 @@
|
|||||||
|
# Copyright (C) 2001-2003
|
||||||
|
# William E. Kempf
|
||||||
|
#
|
||||||
|
# Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
# file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
project boost/thread/example
|
||||||
|
: requirements <library>../build//boost_thread <threading>multi
|
||||||
|
;
|
||||||
|
|
||||||
|
|
||||||
|
exe monitor : monitor.cpp ;
|
||||||
|
exe starvephil : starvephil.cpp ;
|
||||||
|
exe tennis : tennis.cpp ;
|
||||||
|
exe condition : condition.cpp ;
|
||||||
|
exe mutex : mutex.cpp ;
|
||||||
|
exe once : once.cpp ;
|
||||||
|
exe recursive_mutex : recursive_mutex.cpp ;
|
||||||
|
exe thread : thread.cpp ;
|
||||||
|
exe thread_group : thread_group.cpp ;
|
||||||
|
exe tss : tss.cpp ;
|
||||||
|
exe xtime : xtime.cpp ;
|
||||||
|
|
||||||
89
example/condition.cpp
Normal file
89
example/condition.cpp
Normal file
@@ -0,0 +1,89 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// William E. Kempf
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <iostream>
|
||||||
|
#include <vector>
|
||||||
|
#include <boost/utility.hpp>
|
||||||
|
#include <boost/thread/condition.hpp>
|
||||||
|
#include <boost/thread/thread.hpp>
|
||||||
|
|
||||||
|
class bounded_buffer : private boost::noncopyable
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
typedef boost::mutex::scoped_lock lock;
|
||||||
|
|
||||||
|
bounded_buffer(int n) : begin(0), end(0), buffered(0), circular_buf(n) { }
|
||||||
|
|
||||||
|
void send (int m) {
|
||||||
|
lock lk(monitor);
|
||||||
|
while (buffered == circular_buf.size())
|
||||||
|
buffer_not_full.wait(lk);
|
||||||
|
circular_buf[end] = m;
|
||||||
|
end = (end+1) % circular_buf.size();
|
||||||
|
++buffered;
|
||||||
|
buffer_not_empty.notify_one();
|
||||||
|
}
|
||||||
|
int receive() {
|
||||||
|
lock lk(monitor);
|
||||||
|
while (buffered == 0)
|
||||||
|
buffer_not_empty.wait(lk);
|
||||||
|
int i = circular_buf[begin];
|
||||||
|
begin = (begin+1) % circular_buf.size();
|
||||||
|
--buffered;
|
||||||
|
buffer_not_full.notify_one();
|
||||||
|
return i;
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
int begin, end, buffered;
|
||||||
|
std::vector<int> circular_buf;
|
||||||
|
boost::condition buffer_not_full, buffer_not_empty;
|
||||||
|
boost::mutex monitor;
|
||||||
|
};
|
||||||
|
|
||||||
|
bounded_buffer buf(2);
|
||||||
|
|
||||||
|
boost::mutex io_mutex;
|
||||||
|
|
||||||
|
void sender() {
|
||||||
|
int n = 0;
|
||||||
|
while (n < 1000000) {
|
||||||
|
buf.send(n);
|
||||||
|
if(!(n%10000))
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock io_lock(io_mutex);
|
||||||
|
std::cout << "sent: " << n << std::endl;
|
||||||
|
}
|
||||||
|
++n;
|
||||||
|
}
|
||||||
|
buf.send(-1);
|
||||||
|
}
|
||||||
|
|
||||||
|
void receiver() {
|
||||||
|
int n;
|
||||||
|
do {
|
||||||
|
n = buf.receive();
|
||||||
|
if(!(n%10000))
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock io_lock(io_mutex);
|
||||||
|
std::cout << "received: " << n << std::endl;
|
||||||
|
}
|
||||||
|
} while (n != -1); // -1 indicates end of buffer
|
||||||
|
buf.send(-1);
|
||||||
|
}
|
||||||
|
|
||||||
|
int main(int, char*[])
|
||||||
|
{
|
||||||
|
boost::thread thrd1(&sender);
|
||||||
|
boost::thread thrd2(&receiver);
|
||||||
|
boost::thread thrd3(&receiver);
|
||||||
|
boost::thread thrd4(&receiver);
|
||||||
|
thrd1.join();
|
||||||
|
thrd2.join();
|
||||||
|
thrd3.join();
|
||||||
|
thrd4.join();
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
@@ -1,3 +1,9 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// William E. Kempf
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
#include <vector>
|
#include <vector>
|
||||||
#include <iostream>
|
#include <iostream>
|
||||||
#include <boost/thread/condition.hpp>
|
#include <boost/thread/condition.hpp>
|
||||||
@@ -6,21 +12,21 @@
|
|||||||
#include <boost/thread/thread.hpp>
|
#include <boost/thread/thread.hpp>
|
||||||
|
|
||||||
namespace {
|
namespace {
|
||||||
const int ITERS = 100;
|
const int ITERS = 100;
|
||||||
boost::mutex io_mutex;
|
boost::mutex io_mutex;
|
||||||
};
|
} // namespace
|
||||||
|
|
||||||
template <typename M>
|
template <typename M>
|
||||||
class buffer_t
|
class buffer_t
|
||||||
{
|
{
|
||||||
public:
|
public:
|
||||||
typedef typename M::scoped_lock scoped_lock;
|
typedef typename M::scoped_lock scoped_lock;
|
||||||
|
|
||||||
buffer_t(int n)
|
buffer_t(int n)
|
||||||
: p(0), c(0), full(0), buf(n)
|
: p(0), c(0), full(0), buf(n)
|
||||||
{
|
{
|
||||||
}
|
}
|
||||||
|
|
||||||
void send(int m)
|
void send(int m)
|
||||||
{
|
{
|
||||||
scoped_lock lk(mutex);
|
scoped_lock lk(mutex);
|
||||||
@@ -29,7 +35,7 @@ public:
|
|||||||
buf[p] = m;
|
buf[p] = m;
|
||||||
p = (p+1) % buf.size();
|
p = (p+1) % buf.size();
|
||||||
++full;
|
++full;
|
||||||
cond.notify_all();
|
cond.notify_one();
|
||||||
}
|
}
|
||||||
int receive()
|
int receive()
|
||||||
{
|
{
|
||||||
@@ -39,41 +45,40 @@ public:
|
|||||||
int i = buf[c];
|
int i = buf[c];
|
||||||
c = (c+1) % buf.size();
|
c = (c+1) % buf.size();
|
||||||
--full;
|
--full;
|
||||||
cond.notify_all();
|
cond.notify_one();
|
||||||
return i;
|
return i;
|
||||||
}
|
}
|
||||||
|
|
||||||
static buffer_t& get_buffer()
|
static buffer_t& get_buffer()
|
||||||
{
|
{
|
||||||
static buffer_t buf(2);
|
static buffer_t buf(2);
|
||||||
return buf;
|
return buf;
|
||||||
}
|
}
|
||||||
|
|
||||||
static void do_sender_thread()
|
static void do_sender_thread()
|
||||||
{
|
{
|
||||||
for (int n = 0; n < ITERS; ++n)
|
for (int n = 0; n < ITERS; ++n)
|
||||||
{
|
{
|
||||||
get_buffer().send(n);
|
|
||||||
{
|
{
|
||||||
boost::mutex::scoped_lock lock(io_mutex);
|
boost::mutex::scoped_lock lock(io_mutex);
|
||||||
std::cout << "sent: " << n << std::endl;
|
std::cout << "sending: " << n << std::endl;
|
||||||
}
|
}
|
||||||
|
get_buffer().send(n);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
static void do_receiver_thread()
|
static void do_receiver_thread()
|
||||||
{
|
{
|
||||||
int n;
|
for (int x=0; x < (ITERS/2); ++x)
|
||||||
do
|
|
||||||
{
|
{
|
||||||
n = get_buffer().receive();
|
int n = get_buffer().receive();
|
||||||
{
|
{
|
||||||
boost::mutex::scoped_lock lock(io_mutex);
|
boost::mutex::scoped_lock lock(io_mutex);
|
||||||
std::cout << "received: " << n << std::endl;
|
std::cout << "received: " << n << std::endl;
|
||||||
}
|
}
|
||||||
} while (n < ITERS - 1);
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
private:
|
private:
|
||||||
M mutex;
|
M mutex;
|
||||||
boost::condition cond;
|
boost::condition cond;
|
||||||
@@ -86,10 +91,12 @@ void do_test(M* dummy=0)
|
|||||||
{
|
{
|
||||||
typedef buffer_t<M> buffer_type;
|
typedef buffer_t<M> buffer_type;
|
||||||
buffer_type::get_buffer();
|
buffer_type::get_buffer();
|
||||||
boost::thread thrd1(&buffer_type::do_sender_thread);
|
boost::thread thrd1(&buffer_type::do_receiver_thread);
|
||||||
boost::thread thrd2(&buffer_type::do_receiver_thread);
|
boost::thread thrd2(&buffer_type::do_receiver_thread);
|
||||||
|
boost::thread thrd3(&buffer_type::do_sender_thread);
|
||||||
thrd1.join();
|
thrd1.join();
|
||||||
thrd2.join();
|
thrd2.join();
|
||||||
|
thrd3.join();
|
||||||
}
|
}
|
||||||
|
|
||||||
void test_buffer()
|
void test_buffer()
|
||||||
47
example/mutex.cpp
Normal file
47
example/mutex.cpp
Normal file
@@ -0,0 +1,47 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// William E. Kempf
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
#include <boost/thread/thread.hpp>
|
||||||
|
#include <iostream>
|
||||||
|
|
||||||
|
boost::mutex io_mutex; // The iostreams are not guaranteed to be thread-safe!
|
||||||
|
|
||||||
|
class counter
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
counter() : count(0) { }
|
||||||
|
|
||||||
|
int increment() {
|
||||||
|
boost::mutex::scoped_lock scoped_lock(mutex);
|
||||||
|
return ++count;
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
boost::mutex mutex;
|
||||||
|
int count;
|
||||||
|
};
|
||||||
|
|
||||||
|
counter c;
|
||||||
|
|
||||||
|
void change_count()
|
||||||
|
{
|
||||||
|
int i = c.increment();
|
||||||
|
boost::mutex::scoped_lock scoped_lock(io_mutex);
|
||||||
|
std::cout << "count == " << i << std::endl;
|
||||||
|
}
|
||||||
|
|
||||||
|
int main(int, char*[])
|
||||||
|
{
|
||||||
|
const int num_threads = 4;
|
||||||
|
boost::thread_group thrds;
|
||||||
|
for (int i=0; i < num_threads; ++i)
|
||||||
|
thrds.create_thread(&change_count);
|
||||||
|
|
||||||
|
thrds.join_all();
|
||||||
|
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
31
example/once.cpp
Normal file
31
example/once.cpp
Normal file
@@ -0,0 +1,31 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// William E. Kempf
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/thread/thread.hpp>
|
||||||
|
#include <boost/thread/once.hpp>
|
||||||
|
#include <cassert>
|
||||||
|
|
||||||
|
int value=0;
|
||||||
|
boost::once_flag once = BOOST_ONCE_INIT;
|
||||||
|
|
||||||
|
void init()
|
||||||
|
{
|
||||||
|
++value;
|
||||||
|
}
|
||||||
|
|
||||||
|
void thread_proc()
|
||||||
|
{
|
||||||
|
boost::call_once(&init, once);
|
||||||
|
}
|
||||||
|
|
||||||
|
int main(int argc, char* argv[])
|
||||||
|
{
|
||||||
|
boost::thread_group threads;
|
||||||
|
for (int i=0; i<5; ++i)
|
||||||
|
threads.create_thread(&thread_proc);
|
||||||
|
threads.join_all();
|
||||||
|
assert(value == 1);
|
||||||
|
}
|
||||||
49
example/recursive_mutex.cpp
Normal file
49
example/recursive_mutex.cpp
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// William E. Kempf
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/thread/recursive_mutex.hpp>
|
||||||
|
#include <boost/thread/thread.hpp>
|
||||||
|
#include <iostream>
|
||||||
|
|
||||||
|
class counter
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
counter() : count(0) { }
|
||||||
|
|
||||||
|
int add(int val) {
|
||||||
|
boost::recursive_mutex::scoped_lock scoped_lock(mutex);
|
||||||
|
count += val;
|
||||||
|
return count;
|
||||||
|
}
|
||||||
|
int increment() {
|
||||||
|
boost::recursive_mutex::scoped_lock scoped_lock(mutex);
|
||||||
|
return add(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
boost::recursive_mutex mutex;
|
||||||
|
int count;
|
||||||
|
};
|
||||||
|
|
||||||
|
counter c;
|
||||||
|
|
||||||
|
void change_count()
|
||||||
|
{
|
||||||
|
std::cout << "count == " << c.increment() << std::endl;
|
||||||
|
}
|
||||||
|
|
||||||
|
int main(int, char*[])
|
||||||
|
{
|
||||||
|
const int num_threads=4;
|
||||||
|
|
||||||
|
boost::thread_group threads;
|
||||||
|
for (int i=0; i < num_threads; ++i)
|
||||||
|
threads.create_thread(&change_count);
|
||||||
|
|
||||||
|
threads.join_all();
|
||||||
|
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
136
example/shared_monitor.cpp
Normal file
136
example/shared_monitor.cpp
Normal file
@@ -0,0 +1,136 @@
|
|||||||
|
// Copyright (C) 2012 Vicente J. Botet Escriba
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <iostream>
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
#include <boost/thread/shared_mutex.hpp>
|
||||||
|
#include <boost/thread/thread.hpp>
|
||||||
|
#include <boost/chrono/chrono_io.hpp>
|
||||||
|
|
||||||
|
#include <cassert>
|
||||||
|
#include <vector>
|
||||||
|
|
||||||
|
#define EXCLUSIVE 1
|
||||||
|
#define SHARED 2
|
||||||
|
|
||||||
|
#define MODE SHARED
|
||||||
|
|
||||||
|
class A
|
||||||
|
{
|
||||||
|
#if MODE == EXCLUSIVE
|
||||||
|
typedef boost::mutex mutex_type;
|
||||||
|
#elif MODE == SHARED
|
||||||
|
typedef boost::shared_mutex mutex_type;
|
||||||
|
#else
|
||||||
|
#error MODE not set
|
||||||
|
#endif
|
||||||
|
typedef std::vector<double> C;
|
||||||
|
mutable mutex_type mut_;
|
||||||
|
C data_;
|
||||||
|
public:
|
||||||
|
A() : data_(10000000) {}
|
||||||
|
A(const A& a);
|
||||||
|
A& operator=(const A& a);
|
||||||
|
|
||||||
|
void compute(const A& x, const A& y);
|
||||||
|
};
|
||||||
|
|
||||||
|
A::A(const A& a)
|
||||||
|
{
|
||||||
|
#if MODE == EXCLUSIVE
|
||||||
|
boost::unique_lock<mutex_type> lk(a.mut_);
|
||||||
|
#elif MODE == SHARED
|
||||||
|
boost::shared_lock<mutex_type> lk(a.mut_);
|
||||||
|
#else
|
||||||
|
#error MODE not set
|
||||||
|
#endif
|
||||||
|
data_ = a.data_;
|
||||||
|
}
|
||||||
|
|
||||||
|
A&
|
||||||
|
A::operator=(const A& a)
|
||||||
|
{
|
||||||
|
if (this != &a)
|
||||||
|
{
|
||||||
|
boost::unique_lock<mutex_type> lk1(mut_, boost::defer_lock);
|
||||||
|
#if MODE == EXCLUSIVE
|
||||||
|
boost::unique_lock<mutex_type> lk2(a.mut_, boost::defer_lock);
|
||||||
|
#elif MODE == SHARED
|
||||||
|
boost::shared_lock<mutex_type> lk2(a.mut_, boost::defer_lock);
|
||||||
|
#else
|
||||||
|
#error MODE not set
|
||||||
|
#endif
|
||||||
|
boost::lock(lk1, lk2);
|
||||||
|
data_ = a.data_;
|
||||||
|
}
|
||||||
|
return *this;
|
||||||
|
}
|
||||||
|
|
||||||
|
void
|
||||||
|
A::compute(const A& x, const A& y)
|
||||||
|
{
|
||||||
|
boost::unique_lock<mutex_type> lk1(mut_, boost::defer_lock);
|
||||||
|
#if MODE == EXCLUSIVE
|
||||||
|
boost::unique_lock<mutex_type> lk2(x.mut_, boost::defer_lock);
|
||||||
|
boost::unique_lock<mutex_type> lk3(y.mut_, boost::defer_lock);
|
||||||
|
#elif MODE == SHARED
|
||||||
|
boost::shared_lock<mutex_type> lk2(x.mut_, boost::defer_lock);
|
||||||
|
boost::shared_lock<mutex_type> lk3(y.mut_, boost::defer_lock);
|
||||||
|
#else
|
||||||
|
#error MODE not set
|
||||||
|
#endif
|
||||||
|
boost::lock(lk1, lk2, lk3);
|
||||||
|
assert(data_.size() == x.data_.size());
|
||||||
|
assert(data_.size() == y.data_.size());
|
||||||
|
for (unsigned i = 0; i < data_.size(); ++i)
|
||||||
|
data_[i] = (x.data_[i] + y.data_[i]) / 2;
|
||||||
|
}
|
||||||
|
|
||||||
|
A a1;
|
||||||
|
A a2;
|
||||||
|
|
||||||
|
void test_s()
|
||||||
|
{
|
||||||
|
A la3 = a1;
|
||||||
|
for (int i = 0; i < 150; ++i)
|
||||||
|
{
|
||||||
|
la3.compute(a1, a2);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
void test_w()
|
||||||
|
{
|
||||||
|
A la3 = a1;
|
||||||
|
for (int i = 0; i < 10; ++i)
|
||||||
|
{
|
||||||
|
la3.compute(a1, a2);
|
||||||
|
a1 = la3;
|
||||||
|
a2 = la3;
|
||||||
|
// boost::this_thread::sleep_for(boost::chrono::seconds(1));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
int main()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::high_resolution_clock Clock;
|
||||||
|
typedef boost::chrono::duration<double> sec;
|
||||||
|
Clock::time_point t0 = Clock::now();
|
||||||
|
std::vector<boost::thread*> v;
|
||||||
|
boost::thread thw(test_w);
|
||||||
|
v.push_back(&thw);
|
||||||
|
boost::thread thr0(test_w);
|
||||||
|
v.push_back(&thr0);
|
||||||
|
boost::thread thr1(test_w);
|
||||||
|
v.push_back(&thr1);
|
||||||
|
boost::thread thr2(test_w);
|
||||||
|
v.push_back(&thr2);
|
||||||
|
boost::thread thr3(test_w);
|
||||||
|
v.push_back(&thr3);
|
||||||
|
for (int i = 0; i < v.size(); ++i)
|
||||||
|
v[i]->join();
|
||||||
|
Clock::time_point t1 = Clock::now();
|
||||||
|
std::cout << sec(t1-t0) << '\n';
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
722
example/shared_mutex.cpp
Normal file
722
example/shared_mutex.cpp
Normal file
@@ -0,0 +1,722 @@
|
|||||||
|
// Copyright (C) 2012 Vicente J. Botet Escriba
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#define BOOST_THREAD_SHARED_MUTEX_PROVIDES_UPWARDS_CONVERSION
|
||||||
|
#define BOOST_THREAD_PROVIDES_EXPLICIT_LOCK_CONVERSION
|
||||||
|
|
||||||
|
#include <iostream>
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
#include <boost/thread/shared_mutex.hpp>
|
||||||
|
#include <boost/thread/thread.hpp>
|
||||||
|
#include <boost/chrono/chrono_io.hpp>
|
||||||
|
|
||||||
|
#include <cassert>
|
||||||
|
#include <vector>
|
||||||
|
|
||||||
|
enum {reading, writing};
|
||||||
|
int state = reading;
|
||||||
|
|
||||||
|
#if 1
|
||||||
|
|
||||||
|
boost::mutex&
|
||||||
|
cout_mut()
|
||||||
|
{
|
||||||
|
static boost::mutex m;
|
||||||
|
return m;
|
||||||
|
}
|
||||||
|
|
||||||
|
void
|
||||||
|
print(const char* tag, unsigned count, char ch)
|
||||||
|
{
|
||||||
|
boost::lock_guard<boost::mutex> _(cout_mut());
|
||||||
|
std::cout << tag << count << ch;
|
||||||
|
}
|
||||||
|
|
||||||
|
#elif 0
|
||||||
|
|
||||||
|
boost::recursive_mutex&
|
||||||
|
cout_mut()
|
||||||
|
{
|
||||||
|
static boost::recursive_mutex m;
|
||||||
|
return m;
|
||||||
|
}
|
||||||
|
|
||||||
|
void print() {}
|
||||||
|
|
||||||
|
template <class A0, class ...Args>
|
||||||
|
void
|
||||||
|
print(const A0& a0, const Args& ...args)
|
||||||
|
{
|
||||||
|
boost::lock_guard<boost::recursive_mutex> _(cout_mut());
|
||||||
|
std::cout << a0;
|
||||||
|
print(args...);
|
||||||
|
}
|
||||||
|
|
||||||
|
#else
|
||||||
|
|
||||||
|
template <class A0, class A1, class A2>
|
||||||
|
void
|
||||||
|
print(const A0&, const A1& a1, const A2&)
|
||||||
|
{
|
||||||
|
assert(a1 > 10000);
|
||||||
|
}
|
||||||
|
|
||||||
|
#endif
|
||||||
|
|
||||||
|
namespace S
|
||||||
|
{
|
||||||
|
|
||||||
|
boost::shared_mutex mut;
|
||||||
|
|
||||||
|
void reader()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
mut.lock_shared();
|
||||||
|
assert(state == reading);
|
||||||
|
++count;
|
||||||
|
mut.unlock_shared();
|
||||||
|
}
|
||||||
|
print("reader = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void writer()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
mut.lock();
|
||||||
|
state = writing;
|
||||||
|
assert(state == writing);
|
||||||
|
state = reading;
|
||||||
|
++count;
|
||||||
|
mut.unlock();
|
||||||
|
}
|
||||||
|
print("writer = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_reader()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock_shared())
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
++count;
|
||||||
|
mut.unlock_shared();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_reader = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_writer()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock())
|
||||||
|
{
|
||||||
|
state = writing;
|
||||||
|
assert(state == writing);
|
||||||
|
state = reading;
|
||||||
|
++count;
|
||||||
|
mut.unlock();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_writer = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_for_reader()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock_shared_for(boost::chrono::microseconds(5)))
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
++count;
|
||||||
|
mut.unlock_shared();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_for_reader = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_for_writer()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock_for(boost::chrono::microseconds(5)))
|
||||||
|
{
|
||||||
|
state = writing;
|
||||||
|
assert(state == writing);
|
||||||
|
state = reading;
|
||||||
|
++count;
|
||||||
|
mut.unlock();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_for_writer = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void
|
||||||
|
test_shared_mutex()
|
||||||
|
{
|
||||||
|
{
|
||||||
|
boost::thread t1(reader);
|
||||||
|
boost::thread t2(writer);
|
||||||
|
boost::thread t3(reader);
|
||||||
|
t1.join();
|
||||||
|
t2.join();
|
||||||
|
t3.join();
|
||||||
|
}
|
||||||
|
{
|
||||||
|
boost::thread t1(try_reader);
|
||||||
|
boost::thread t2(try_writer);
|
||||||
|
boost::thread t3(try_reader);
|
||||||
|
t1.join();
|
||||||
|
t2.join();
|
||||||
|
t3.join();
|
||||||
|
}
|
||||||
|
{
|
||||||
|
boost::thread t1(try_for_reader);
|
||||||
|
boost::thread t2(try_for_writer);
|
||||||
|
boost::thread t3(try_for_reader);
|
||||||
|
t1.join();
|
||||||
|
t2.join();
|
||||||
|
t3.join();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
namespace U
|
||||||
|
{
|
||||||
|
|
||||||
|
boost::upgrade_mutex mut;
|
||||||
|
|
||||||
|
void reader()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
mut.lock_shared();
|
||||||
|
assert(state == reading);
|
||||||
|
++count;
|
||||||
|
mut.unlock_shared();
|
||||||
|
}
|
||||||
|
print("reader = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void writer()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
mut.lock();
|
||||||
|
state = writing;
|
||||||
|
assert(state == writing);
|
||||||
|
state = reading;
|
||||||
|
++count;
|
||||||
|
mut.unlock();
|
||||||
|
}
|
||||||
|
print("writer = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_reader()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock_shared())
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
++count;
|
||||||
|
mut.unlock_shared();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_reader = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_writer()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock())
|
||||||
|
{
|
||||||
|
state = writing;
|
||||||
|
assert(state == writing);
|
||||||
|
state = reading;
|
||||||
|
++count;
|
||||||
|
mut.unlock();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_writer = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_for_reader()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock_shared_for(boost::chrono::microseconds(5)))
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
++count;
|
||||||
|
mut.unlock_shared();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_for_reader = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_for_writer()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock_for(boost::chrono::microseconds(5)))
|
||||||
|
{
|
||||||
|
state = writing;
|
||||||
|
assert(state == writing);
|
||||||
|
state = reading;
|
||||||
|
++count;
|
||||||
|
mut.unlock();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_for_writer = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void upgradable()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
mut.lock_upgrade();
|
||||||
|
assert(state == reading);
|
||||||
|
++count;
|
||||||
|
mut.unlock_upgrade();
|
||||||
|
}
|
||||||
|
print("upgradable = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_upgradable()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock_upgrade())
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
++count;
|
||||||
|
mut.unlock_upgrade();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_upgradable = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_for_upgradable()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock_upgrade_for(boost::chrono::microseconds(5)))
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
++count;
|
||||||
|
mut.unlock_upgrade();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_for_upgradable = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void clockwise()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
mut.lock_shared();
|
||||||
|
assert(state == reading);
|
||||||
|
if (mut.try_unlock_shared_and_lock())
|
||||||
|
{
|
||||||
|
state = writing;
|
||||||
|
}
|
||||||
|
else if (mut.try_unlock_shared_and_lock_upgrade())
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
mut.unlock_upgrade_and_lock();
|
||||||
|
state = writing;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
mut.unlock_shared();
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
assert(state == writing);
|
||||||
|
state = reading;
|
||||||
|
mut.unlock_and_lock_upgrade();
|
||||||
|
assert(state == reading);
|
||||||
|
mut.unlock_upgrade_and_lock_shared();
|
||||||
|
assert(state == reading);
|
||||||
|
mut.unlock_shared();
|
||||||
|
++count;
|
||||||
|
}
|
||||||
|
print("clockwise = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void counter_clockwise()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
mut.lock_upgrade();
|
||||||
|
assert(state == reading);
|
||||||
|
mut.unlock_upgrade_and_lock();
|
||||||
|
assert(state == reading);
|
||||||
|
state = writing;
|
||||||
|
assert(state == writing);
|
||||||
|
state = reading;
|
||||||
|
mut.unlock_and_lock_shared();
|
||||||
|
assert(state == reading);
|
||||||
|
mut.unlock_shared();
|
||||||
|
++count;
|
||||||
|
}
|
||||||
|
print("counter_clockwise = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_clockwise()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock_shared())
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
if (mut.try_unlock_shared_and_lock())
|
||||||
|
{
|
||||||
|
state = writing;
|
||||||
|
}
|
||||||
|
else if (mut.try_unlock_shared_and_lock_upgrade())
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
mut.unlock_upgrade_and_lock();
|
||||||
|
state = writing;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
mut.unlock_shared();
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
assert(state == writing);
|
||||||
|
state = reading;
|
||||||
|
mut.unlock_and_lock_upgrade();
|
||||||
|
assert(state == reading);
|
||||||
|
mut.unlock_upgrade_and_lock_shared();
|
||||||
|
assert(state == reading);
|
||||||
|
mut.unlock_shared();
|
||||||
|
++count;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_clockwise = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_for_clockwise()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock_shared_for(boost::chrono::microseconds(5)))
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
if (mut.try_unlock_shared_and_lock_for(boost::chrono::microseconds(5)))
|
||||||
|
{
|
||||||
|
state = writing;
|
||||||
|
}
|
||||||
|
else if (mut.try_unlock_shared_and_lock_upgrade_for(boost::chrono::microseconds(5)))
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
mut.unlock_upgrade_and_lock();
|
||||||
|
state = writing;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
mut.unlock_shared();
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
assert(state == writing);
|
||||||
|
state = reading;
|
||||||
|
mut.unlock_and_lock_upgrade();
|
||||||
|
assert(state == reading);
|
||||||
|
mut.unlock_upgrade_and_lock_shared();
|
||||||
|
assert(state == reading);
|
||||||
|
mut.unlock_shared();
|
||||||
|
++count;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_for_clockwise = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_counter_clockwise()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock_upgrade())
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
if (mut.try_unlock_upgrade_and_lock())
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
state = writing;
|
||||||
|
assert(state == writing);
|
||||||
|
state = reading;
|
||||||
|
mut.unlock_and_lock_shared();
|
||||||
|
assert(state == reading);
|
||||||
|
mut.unlock_shared();
|
||||||
|
++count;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
mut.unlock_upgrade();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_counter_clockwise = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void try_for_counter_clockwise()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::steady_clock Clock;
|
||||||
|
unsigned count = 0;
|
||||||
|
Clock::time_point until = Clock::now() + boost::chrono::seconds(3);
|
||||||
|
while (Clock::now() < until)
|
||||||
|
{
|
||||||
|
if (mut.try_lock_upgrade_for(boost::chrono::microseconds(5)))
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
if (mut.try_unlock_upgrade_and_lock_for(boost::chrono::microseconds(5)))
|
||||||
|
{
|
||||||
|
assert(state == reading);
|
||||||
|
state = writing;
|
||||||
|
assert(state == writing);
|
||||||
|
state = reading;
|
||||||
|
mut.unlock_and_lock_shared();
|
||||||
|
assert(state == reading);
|
||||||
|
mut.unlock_shared();
|
||||||
|
++count;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
mut.unlock_upgrade();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
print("try_for_counter_clockwise = ", count, '\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
void
|
||||||
|
test_upgrade_mutex()
|
||||||
|
{
|
||||||
|
{
|
||||||
|
boost::thread t1(reader);
|
||||||
|
boost::thread t2(writer);
|
||||||
|
boost::thread t3(reader);
|
||||||
|
t1.join();
|
||||||
|
t2.join();
|
||||||
|
t3.join();
|
||||||
|
}
|
||||||
|
{
|
||||||
|
boost::thread t1(try_reader);
|
||||||
|
boost::thread t2(try_writer);
|
||||||
|
boost::thread t3(try_reader);
|
||||||
|
t1.join();
|
||||||
|
t2.join();
|
||||||
|
t3.join();
|
||||||
|
}
|
||||||
|
{
|
||||||
|
boost::thread t1(try_for_reader);
|
||||||
|
boost::thread t2(try_for_writer);
|
||||||
|
boost::thread t3(try_for_reader);
|
||||||
|
t1.join();
|
||||||
|
t2.join();
|
||||||
|
t3.join();
|
||||||
|
}
|
||||||
|
{
|
||||||
|
boost::thread t1(reader);
|
||||||
|
boost::thread t2(writer);
|
||||||
|
boost::thread t3(upgradable);
|
||||||
|
t1.join();
|
||||||
|
t2.join();
|
||||||
|
t3.join();
|
||||||
|
}
|
||||||
|
{
|
||||||
|
boost::thread t1(reader);
|
||||||
|
boost::thread t2(writer);
|
||||||
|
boost::thread t3(try_upgradable);
|
||||||
|
t1.join();
|
||||||
|
t2.join();
|
||||||
|
t3.join();
|
||||||
|
}
|
||||||
|
{
|
||||||
|
boost::thread t1(reader);
|
||||||
|
boost::thread t2(writer);
|
||||||
|
boost::thread t3(try_for_upgradable);
|
||||||
|
t1.join();
|
||||||
|
t2.join();
|
||||||
|
t3.join();
|
||||||
|
}
|
||||||
|
{
|
||||||
|
state = reading;
|
||||||
|
boost::thread t1(clockwise);
|
||||||
|
boost::thread t2(counter_clockwise);
|
||||||
|
boost::thread t3(clockwise);
|
||||||
|
boost::thread t4(counter_clockwise);
|
||||||
|
t1.join();
|
||||||
|
t2.join();
|
||||||
|
t3.join();
|
||||||
|
t4.join();
|
||||||
|
}
|
||||||
|
{
|
||||||
|
state = reading;
|
||||||
|
boost::thread t1(try_clockwise);
|
||||||
|
boost::thread t2(try_counter_clockwise);
|
||||||
|
t1.join();
|
||||||
|
t2.join();
|
||||||
|
}
|
||||||
|
{
|
||||||
|
state = reading;
|
||||||
|
boost::thread t1(try_for_clockwise);
|
||||||
|
boost::thread t2(try_for_counter_clockwise);
|
||||||
|
t1.join();
|
||||||
|
t2.join();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
namespace Assignment
|
||||||
|
{
|
||||||
|
|
||||||
|
class A
|
||||||
|
{
|
||||||
|
typedef boost::upgrade_mutex mutex_type;
|
||||||
|
typedef boost::shared_lock<mutex_type> SharedLock;
|
||||||
|
typedef boost::upgrade_lock<mutex_type> UpgradeLock;
|
||||||
|
typedef boost::unique_lock<mutex_type> Lock;
|
||||||
|
|
||||||
|
mutable mutex_type mut_;
|
||||||
|
std::vector<double> data_;
|
||||||
|
|
||||||
|
public:
|
||||||
|
|
||||||
|
A(const A& a)
|
||||||
|
{
|
||||||
|
SharedLock _(a.mut_);
|
||||||
|
data_ = a.data_;
|
||||||
|
}
|
||||||
|
|
||||||
|
A& operator=(const A& a)
|
||||||
|
{
|
||||||
|
if (this != &a)
|
||||||
|
{
|
||||||
|
Lock this_lock(mut_, boost::defer_lock);
|
||||||
|
SharedLock that_lock(a.mut_, boost::defer_lock);
|
||||||
|
boost::lock(this_lock, that_lock);
|
||||||
|
data_ = a.data_;
|
||||||
|
}
|
||||||
|
return *this;
|
||||||
|
}
|
||||||
|
|
||||||
|
void swap(A& a)
|
||||||
|
{
|
||||||
|
Lock this_lock(mut_, boost::defer_lock);
|
||||||
|
Lock that_lock(a.mut_, boost::defer_lock);
|
||||||
|
boost::lock(this_lock, that_lock);
|
||||||
|
data_.swap(a.data_);
|
||||||
|
}
|
||||||
|
|
||||||
|
void average(A& a)
|
||||||
|
{
|
||||||
|
assert(data_.size() == a.data_.size());
|
||||||
|
assert(this != &a);
|
||||||
|
|
||||||
|
Lock this_lock(mut_, boost::defer_lock);
|
||||||
|
UpgradeLock share_that_lock(a.mut_, boost::defer_lock);
|
||||||
|
boost::lock(this_lock, share_that_lock);
|
||||||
|
|
||||||
|
for (unsigned i = 0; i < data_.size(); ++i)
|
||||||
|
data_[i] = (data_[i] + a.data_[i]) / 2;
|
||||||
|
|
||||||
|
SharedLock share_this_lock(boost::move(this_lock));
|
||||||
|
Lock that_lock(boost::move(share_that_lock));
|
||||||
|
a.data_ = data_;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
} // Assignment
|
||||||
|
|
||||||
|
void temp()
|
||||||
|
{
|
||||||
|
using namespace boost;
|
||||||
|
static upgrade_mutex mut;
|
||||||
|
unique_lock<upgrade_mutex> ul(mut);
|
||||||
|
shared_lock<upgrade_mutex> sl;
|
||||||
|
sl = shared_lock<upgrade_mutex>(boost::move(ul));
|
||||||
|
}
|
||||||
|
|
||||||
|
int main()
|
||||||
|
{
|
||||||
|
typedef boost::chrono::high_resolution_clock Clock;
|
||||||
|
typedef boost::chrono::duration<double> sec;
|
||||||
|
Clock::time_point t0 = Clock::now();
|
||||||
|
|
||||||
|
S::test_shared_mutex();
|
||||||
|
U::test_upgrade_mutex();
|
||||||
|
Clock::time_point t1 = Clock::now();
|
||||||
|
std::cout << sec(t1 - t0) << '\n';
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
185
example/starvephil.cpp
Normal file
185
example/starvephil.cpp
Normal file
@@ -0,0 +1,185 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// William E. Kempf
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
#include <boost/thread/condition.hpp>
|
||||||
|
#include <boost/thread/thread.hpp>
|
||||||
|
#include <boost/thread/xtime.hpp>
|
||||||
|
#include <iostream>
|
||||||
|
#include <time.h>
|
||||||
|
|
||||||
|
namespace
|
||||||
|
{
|
||||||
|
boost::mutex iomx;
|
||||||
|
} // namespace
|
||||||
|
|
||||||
|
class canteen
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
canteen() : m_chickens(0) { }
|
||||||
|
|
||||||
|
void get(int id)
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(m_mutex);
|
||||||
|
while (m_chickens == 0)
|
||||||
|
{
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(iomx);
|
||||||
|
std::cout << "(" << clock() << ") Phil" << id <<
|
||||||
|
": wot, no chickens? I'll WAIT ..." << std::endl;
|
||||||
|
}
|
||||||
|
m_condition.wait(lock);
|
||||||
|
}
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(iomx);
|
||||||
|
std::cout << "(" << clock() << ") Phil" << id <<
|
||||||
|
": those chickens look good ... one please ..." << std::endl;
|
||||||
|
}
|
||||||
|
m_chickens--;
|
||||||
|
}
|
||||||
|
void put(int value)
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(m_mutex);
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(iomx);
|
||||||
|
std::cout << "(" << clock()
|
||||||
|
<< ") Chef: ouch ... make room ... this dish is "
|
||||||
|
<< "very hot ..." << std::endl;
|
||||||
|
}
|
||||||
|
boost::xtime xt;
|
||||||
|
boost::xtime_get(&xt, boost::TIME_UTC);
|
||||||
|
xt.sec += 3;
|
||||||
|
boost::thread::sleep(xt);
|
||||||
|
m_chickens += value;
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(iomx);
|
||||||
|
std::cout << "(" << clock() <<
|
||||||
|
") Chef: more chickens ... " << m_chickens <<
|
||||||
|
" now available ... NOTIFYING ..." << std::endl;
|
||||||
|
}
|
||||||
|
m_condition.notify_all();
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
boost::mutex m_mutex;
|
||||||
|
boost::condition m_condition;
|
||||||
|
int m_chickens;
|
||||||
|
};
|
||||||
|
|
||||||
|
canteen g_canteen;
|
||||||
|
|
||||||
|
void chef()
|
||||||
|
{
|
||||||
|
const int chickens = 4;
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(iomx);
|
||||||
|
std::cout << "(" << clock() << ") Chef: starting ..." << std::endl;
|
||||||
|
}
|
||||||
|
for (;;)
|
||||||
|
{
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(iomx);
|
||||||
|
std::cout << "(" << clock() << ") Chef: cooking ..." << std::endl;
|
||||||
|
}
|
||||||
|
boost::xtime xt;
|
||||||
|
boost::xtime_get(&xt, boost::TIME_UTC);
|
||||||
|
xt.sec += 2;
|
||||||
|
boost::thread::sleep(xt);
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(iomx);
|
||||||
|
std::cout << "(" << clock() << ") Chef: " << chickens
|
||||||
|
<< " chickens, ready-to-go ..." << std::endl;
|
||||||
|
}
|
||||||
|
g_canteen.put(chickens);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
struct phil
|
||||||
|
{
|
||||||
|
phil(int id) : m_id(id) { }
|
||||||
|
void run() {
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(iomx);
|
||||||
|
std::cout << "(" << clock() << ") Phil" << m_id
|
||||||
|
<< ": starting ..." << std::endl;
|
||||||
|
}
|
||||||
|
for (;;)
|
||||||
|
{
|
||||||
|
if (m_id > 0)
|
||||||
|
{
|
||||||
|
boost::xtime xt;
|
||||||
|
boost::xtime_get(&xt, boost::TIME_UTC);
|
||||||
|
xt.sec += 3;
|
||||||
|
boost::thread::sleep(xt);
|
||||||
|
}
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(iomx);
|
||||||
|
std::cout << "(" << clock() << ") Phil" << m_id
|
||||||
|
<< ": gotta eat ..." << std::endl;
|
||||||
|
}
|
||||||
|
g_canteen.get(m_id);
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(iomx);
|
||||||
|
std::cout << "(" << clock() << ") Phil" << m_id
|
||||||
|
<< ": mmm ... that's good ..." << std::endl;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
static void do_thread(void* param) {
|
||||||
|
static_cast<phil*>(param)->run();
|
||||||
|
}
|
||||||
|
|
||||||
|
int m_id;
|
||||||
|
};
|
||||||
|
|
||||||
|
struct thread_adapt
|
||||||
|
{
|
||||||
|
thread_adapt(void (*func)(void*), void* param)
|
||||||
|
: _func(func), _param(param)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
int operator()() const
|
||||||
|
{
|
||||||
|
_func(_param);
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
void (*_func)(void*);
|
||||||
|
void* _param;
|
||||||
|
};
|
||||||
|
|
||||||
|
class thread_adapter
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
thread_adapter(void (*func)(void*), void* param)
|
||||||
|
: _func(func), _param(param)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
void operator()() const { _func(_param); }
|
||||||
|
private:
|
||||||
|
void (*_func)(void*);
|
||||||
|
void* _param;
|
||||||
|
};
|
||||||
|
|
||||||
|
int main(int argc, char* argv[])
|
||||||
|
{
|
||||||
|
boost::thread thrd_chef(&chef);
|
||||||
|
phil p[] = { phil(0), phil(1), phil(2), phil(3), phil(4) };
|
||||||
|
boost::thread thrd_phil0(thread_adapter(&phil::do_thread, &p[0]));
|
||||||
|
boost::thread thrd_phil1(thread_adapter(&phil::do_thread, &p[1]));
|
||||||
|
boost::thread thrd_phil2(thread_adapter(&phil::do_thread, &p[2]));
|
||||||
|
boost::thread thrd_phil3(thread_adapter(&phil::do_thread, &p[3]));
|
||||||
|
boost::thread thrd_phil4(thread_adapter(&phil::do_thread, &p[4]));
|
||||||
|
|
||||||
|
thrd_chef.join();
|
||||||
|
thrd_phil0.join();
|
||||||
|
thrd_phil1.join();
|
||||||
|
thrd_phil2.join();
|
||||||
|
thrd_phil3.join();
|
||||||
|
thrd_phil4.join();
|
||||||
|
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
@@ -1,171 +0,0 @@
|
|||||||
#include <boost/thread/mutex.hpp>
|
|
||||||
#include <boost/thread/condition.hpp>
|
|
||||||
#include <boost/thread/thread.hpp>
|
|
||||||
#include <boost/thread/xtime.hpp>
|
|
||||||
#include <iostream>
|
|
||||||
#include <time.h>
|
|
||||||
|
|
||||||
namespace
|
|
||||||
{
|
|
||||||
boost::mutex iomx;
|
|
||||||
};
|
|
||||||
|
|
||||||
class canteen
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
canteen() : m_chickens(0) { }
|
|
||||||
|
|
||||||
void get(int id)
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock lock(m_mutex);
|
|
||||||
while (m_chickens == 0)
|
|
||||||
{
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock lock(iomx);
|
|
||||||
std::cout << "(" << clock() << ") Phil" << id <<
|
|
||||||
": wot, no chickens? I'll WAIT ..." << std::endl;
|
|
||||||
}
|
|
||||||
m_condition.wait(lock);
|
|
||||||
}
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock lock(iomx);
|
|
||||||
std::cout << "(" << clock() << ") Phil" << id <<
|
|
||||||
": those chickens look good ... one please ..." << std::endl;
|
|
||||||
}
|
|
||||||
m_chickens--;
|
|
||||||
}
|
|
||||||
void put(int value)
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock lock(m_mutex);
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock lock(iomx);
|
|
||||||
std::cout << "(" << clock() <<
|
|
||||||
") Chef: ouch ... make room ... this dish is very hot ..." << std::endl;
|
|
||||||
}
|
|
||||||
boost::xtime xt;
|
|
||||||
boost::xtime_get(&xt, boost::TIME_UTC);
|
|
||||||
xt.sec += 3;
|
|
||||||
boost::thread::sleep(xt);
|
|
||||||
m_chickens += value;
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock lock(iomx);
|
|
||||||
std::cout << "(" << clock() <<
|
|
||||||
") Chef: more chickens ... " << m_chickens <<
|
|
||||||
" now available ... NOTIFYING ..." << std::endl;
|
|
||||||
}
|
|
||||||
m_condition.notify_all();
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
boost::mutex m_mutex;
|
|
||||||
boost::condition m_condition;
|
|
||||||
int m_chickens;
|
|
||||||
};
|
|
||||||
|
|
||||||
canteen g_canteen;
|
|
||||||
|
|
||||||
void chef()
|
|
||||||
{
|
|
||||||
const int chickens = 4;
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock lock(iomx);
|
|
||||||
std::cout << "(" << clock() << ") Chef: starting ..." << std::endl;
|
|
||||||
}
|
|
||||||
for (;;)
|
|
||||||
{
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock lock(iomx);
|
|
||||||
std::cout << "(" << clock() << ") Chef: cooking ..." << std::endl;
|
|
||||||
}
|
|
||||||
boost::xtime xt;
|
|
||||||
boost::xtime_get(&xt, boost::TIME_UTC);
|
|
||||||
xt.sec += 2;
|
|
||||||
boost::thread::sleep(xt);
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock lock(iomx);
|
|
||||||
std::cout << "(" << clock() << ") Chef: " << chickens
|
|
||||||
<< " chickens, ready-to-go ..." << std::endl;
|
|
||||||
}
|
|
||||||
g_canteen.put(chickens);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
struct phil
|
|
||||||
{
|
|
||||||
phil(int id) : m_id(id) { }
|
|
||||||
void run() {
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock lock(iomx);
|
|
||||||
std::cout << "(" << clock() << ") Phil" << m_id << ": starting ..." << std::endl;
|
|
||||||
}
|
|
||||||
for (;;)
|
|
||||||
{
|
|
||||||
if (m_id > 0)
|
|
||||||
{
|
|
||||||
boost::xtime xt;
|
|
||||||
boost::xtime_get(&xt, boost::TIME_UTC);
|
|
||||||
xt.sec += 3;
|
|
||||||
boost::thread::sleep(xt);
|
|
||||||
}
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock lock(iomx);
|
|
||||||
std::cout << "(" << clock() << ") Phil" << m_id
|
|
||||||
<< ": gotta eat ..." << std::endl;
|
|
||||||
}
|
|
||||||
g_canteen.get(m_id);
|
|
||||||
{
|
|
||||||
boost::mutex::scoped_lock lock(iomx);
|
|
||||||
std::cout << "(" << clock() << ") Phil" << m_id
|
|
||||||
<< ": mmm ... that's good ..." << std::endl;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
static void do_thread(void* param) {
|
|
||||||
static_cast<phil*>(param)->run();
|
|
||||||
}
|
|
||||||
|
|
||||||
int m_id;
|
|
||||||
};
|
|
||||||
|
|
||||||
struct thread_adapt
|
|
||||||
{
|
|
||||||
thread_adapt(void (*func)(void*), void* param) : _func(func), _param(param) { }
|
|
||||||
int operator()() const
|
|
||||||
{
|
|
||||||
_func(_param);
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
void (*_func)(void*);
|
|
||||||
void* _param;
|
|
||||||
};
|
|
||||||
|
|
||||||
class thread_adapter
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
thread_adapter(void (*func)(void*), void* param) : _func(func), _param(param) { }
|
|
||||||
void operator()() const { _func(_param); }
|
|
||||||
private:
|
|
||||||
void (*_func)(void*);
|
|
||||||
void* _param;
|
|
||||||
};
|
|
||||||
|
|
||||||
int main(int argc, char* argv[])
|
|
||||||
{
|
|
||||||
boost::thread thrd_chef(&chef);
|
|
||||||
phil p[] = { phil(0), phil(1), phil(2), phil(3), phil(4) };
|
|
||||||
boost::thread thrd_phil0(thread_adapter(&phil::do_thread, &p[0]));
|
|
||||||
boost::thread thrd_phil1(thread_adapter(&phil::do_thread, &p[1]));
|
|
||||||
boost::thread thrd_phil2(thread_adapter(&phil::do_thread, &p[2]));
|
|
||||||
boost::thread thrd_phil3(thread_adapter(&phil::do_thread, &p[3]));
|
|
||||||
boost::thread thrd_phil4(thread_adapter(&phil::do_thread, &p[4]));
|
|
||||||
|
|
||||||
thrd_chef.join();
|
|
||||||
thrd_phil0.join();
|
|
||||||
thrd_phil1.join();
|
|
||||||
thrd_phil2.join();
|
|
||||||
thrd_phil3.join();
|
|
||||||
thrd_phil4.join();
|
|
||||||
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
@@ -1,13 +1,18 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// William E. Kempf
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
#include <boost/thread/mutex.hpp>
|
#include <boost/thread/mutex.hpp>
|
||||||
#include <boost/thread/condition.hpp>
|
#include <boost/thread/condition.hpp>
|
||||||
#include <boost/thread/semaphore.hpp>
|
|
||||||
#include <boost/thread/thread.hpp>
|
#include <boost/thread/thread.hpp>
|
||||||
#include <boost/thread/xtime.hpp>
|
#include <boost/thread/xtime.hpp>
|
||||||
#include <iostream>
|
#include <iostream>
|
||||||
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
#if defined(BOOST_HAS_WINTHREADS)
|
||||||
# include <windows.h>
|
# include <windows.h>
|
||||||
# include <process.h>
|
# include <process.h>
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
enum game_state
|
enum game_state
|
||||||
@@ -50,7 +55,10 @@ void player(void* param)
|
|||||||
{
|
{
|
||||||
cond.wait(lock);
|
cond.wait(lock);
|
||||||
if (state == other)
|
if (state == other)
|
||||||
std::cout << "---" << player_name(active) << ": Spurious wakeup!" << std::endl;
|
{
|
||||||
|
std::cout << "---" << player_name(active)
|
||||||
|
<< ": Spurious wakeup!" << std::endl;
|
||||||
|
}
|
||||||
} while (state == other);
|
} while (state == other);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -61,7 +69,10 @@ void player(void* param)
|
|||||||
|
|
||||||
struct thread_adapt
|
struct thread_adapt
|
||||||
{
|
{
|
||||||
thread_adapt(void (*func)(void*), void* param) : _func(func), _param(param) { }
|
thread_adapt(void (*func)(void*), void* param)
|
||||||
|
: _func(func), _param(param)
|
||||||
|
{
|
||||||
|
}
|
||||||
int operator()() const
|
int operator()() const
|
||||||
{
|
{
|
||||||
_func(_param);
|
_func(_param);
|
||||||
@@ -75,7 +86,10 @@ struct thread_adapt
|
|||||||
class thread_adapter
|
class thread_adapter
|
||||||
{
|
{
|
||||||
public:
|
public:
|
||||||
thread_adapter(void (*func)(void*), void* param) : _func(func), _param(param) { }
|
thread_adapter(void (*func)(void*), void* param)
|
||||||
|
: _func(func), _param(param)
|
||||||
|
{
|
||||||
|
}
|
||||||
void operator()() const { _func(_param); }
|
void operator()() const { _func(_param); }
|
||||||
private:
|
private:
|
||||||
void (*_func)(void*);
|
void (*_func)(void*);
|
||||||
@@ -98,7 +112,7 @@ int main(int argc, char* argv[])
|
|||||||
std::cout << "---Noise ON..." << std::endl;
|
std::cout << "---Noise ON..." << std::endl;
|
||||||
}
|
}
|
||||||
|
|
||||||
for (int i = 0; i < 1000000; ++i)
|
for (int i = 0; i < 1000000000; ++i)
|
||||||
cond.notify_all();
|
cond.notify_all();
|
||||||
|
|
||||||
{
|
{
|
||||||
35
example/thread.cpp
Normal file
35
example/thread.cpp
Normal file
@@ -0,0 +1,35 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// William E. Kempf
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/thread/thread.hpp>
|
||||||
|
#include <boost/thread/xtime.hpp>
|
||||||
|
#include <iostream>
|
||||||
|
|
||||||
|
struct thread_alarm
|
||||||
|
{
|
||||||
|
thread_alarm(int secs) : m_secs(secs) { }
|
||||||
|
void operator()()
|
||||||
|
{
|
||||||
|
boost::xtime xt;
|
||||||
|
boost::xtime_get(&xt, boost::TIME_UTC);
|
||||||
|
xt.sec += m_secs;
|
||||||
|
|
||||||
|
boost::thread::sleep(xt);
|
||||||
|
|
||||||
|
std::cout << "alarm sounded..." << std::endl;
|
||||||
|
}
|
||||||
|
|
||||||
|
int m_secs;
|
||||||
|
};
|
||||||
|
|
||||||
|
int main(int argc, char* argv[])
|
||||||
|
{
|
||||||
|
int secs = 5;
|
||||||
|
std::cout << "setting alarm for 5 seconds..." << std::endl;
|
||||||
|
thread_alarm alarm(secs);
|
||||||
|
boost::thread thrd(alarm);
|
||||||
|
thrd.join();
|
||||||
|
}
|
||||||
25
example/thread_group.cpp
Normal file
25
example/thread_group.cpp
Normal file
@@ -0,0 +1,25 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// William E. Kempf
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/thread/thread.hpp>
|
||||||
|
#include <iostream>
|
||||||
|
|
||||||
|
int count = 0;
|
||||||
|
boost::mutex mutex;
|
||||||
|
|
||||||
|
void increment_count()
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(mutex);
|
||||||
|
std::cout << "count = " << ++count << std::endl;
|
||||||
|
}
|
||||||
|
|
||||||
|
int main(int argc, char* argv[])
|
||||||
|
{
|
||||||
|
boost::thread_group threads;
|
||||||
|
for (int i = 0; i < 10; ++i)
|
||||||
|
threads.create_thread(&increment_count);
|
||||||
|
threads.join_all();
|
||||||
|
}
|
||||||
36
example/tss.cpp
Normal file
36
example/tss.cpp
Normal file
@@ -0,0 +1,36 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// William E. Kempf
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/thread/thread.hpp>
|
||||||
|
#include <boost/thread/tss.hpp>
|
||||||
|
#include <cassert>
|
||||||
|
|
||||||
|
boost::thread_specific_ptr<int> value;
|
||||||
|
|
||||||
|
void increment()
|
||||||
|
{
|
||||||
|
int* p = value.get();
|
||||||
|
++*p;
|
||||||
|
}
|
||||||
|
|
||||||
|
void thread_proc()
|
||||||
|
{
|
||||||
|
value.reset(new int(0)); // initialize the thread's storage
|
||||||
|
for (int i=0; i<10; ++i)
|
||||||
|
{
|
||||||
|
increment();
|
||||||
|
int* p = value.get();
|
||||||
|
assert(*p == i+1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
int main(int argc, char* argv[])
|
||||||
|
{
|
||||||
|
boost::thread_group threads;
|
||||||
|
for (int i=0; i<5; ++i)
|
||||||
|
threads.create_thread(&thread_proc);
|
||||||
|
threads.join_all();
|
||||||
|
}
|
||||||
16
example/xtime.cpp
Normal file
16
example/xtime.cpp
Normal file
@@ -0,0 +1,16 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// William E. Kempf
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/thread/thread.hpp>
|
||||||
|
#include <boost/thread/xtime.hpp>
|
||||||
|
|
||||||
|
int main(int argc, char* argv[])
|
||||||
|
{
|
||||||
|
boost::xtime xt;
|
||||||
|
boost::xtime_get(&xt, boost::TIME_UTC);
|
||||||
|
xt.sec += 1;
|
||||||
|
boost::thread::sleep(xt); // Sleep for 1 second
|
||||||
|
}
|
||||||
26
include/boost/thread.hpp
Normal file
26
include/boost/thread.hpp
Normal file
@@ -0,0 +1,26 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// William E. Kempf
|
||||||
|
// (C) Copyright 2008-9 Anthony Williams
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
// See www.boost.org/libs/thread for documentation.
|
||||||
|
|
||||||
|
#if !defined(BOOST_THREAD_WEK01082003_HPP)
|
||||||
|
#define BOOST_THREAD_WEK01082003_HPP
|
||||||
|
|
||||||
|
#include <boost/thread/thread.hpp>
|
||||||
|
#include <boost/thread/condition_variable.hpp>
|
||||||
|
#include <boost/thread/exceptions.hpp>
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
#include <boost/thread/once.hpp>
|
||||||
|
#include <boost/thread/recursive_mutex.hpp>
|
||||||
|
#include <boost/thread/tss.hpp>
|
||||||
|
#include <boost/thread/thread_time.hpp>
|
||||||
|
#include <boost/thread/locks.hpp>
|
||||||
|
#include <boost/thread/shared_mutex.hpp>
|
||||||
|
#include <boost/thread/barrier.hpp>
|
||||||
|
#include <boost/thread/future.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
@@ -1,61 +0,0 @@
|
|||||||
/*
|
|
||||||
*
|
|
||||||
* Copyright (C) 2001
|
|
||||||
* William E. Kempf
|
|
||||||
*
|
|
||||||
* Permission to use, copy, modify, distribute and sell this software
|
|
||||||
* and its documentation for any purpose is hereby granted without fee,
|
|
||||||
* provided that the above copyright notice appear in all copies and
|
|
||||||
* that both that copyright notice and this permission notice appear
|
|
||||||
* in supporting documentation. William E. Kempf makes no representations
|
|
||||||
* about the suitability of this software for any purpose.
|
|
||||||
* It is provided "as is" without express or implied warranty.
|
|
||||||
*
|
|
||||||
* Revision History (excluding minor changes for specific compilers)
|
|
||||||
* 8 Feb 01 Initial version.
|
|
||||||
*/
|
|
||||||
|
|
||||||
#ifndef BOOST_ATOMIC_HPP
|
|
||||||
#define BOOST_ATOMIC_HPP
|
|
||||||
|
|
||||||
#include <boost/config.hpp>
|
|
||||||
#ifndef BOOST_HAS_THREADS
|
|
||||||
# error Thread support is unavailable!
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#if !defined(BOOST_HAS_WINTHREADS)
|
|
||||||
# include <boost/thread/mutex.hpp>
|
|
||||||
#endif
|
|
||||||
|
|
||||||
namespace boost {
|
|
||||||
class atomic_t
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef long value_type;
|
|
||||||
|
|
||||||
friend value_type read(const atomic_t&);
|
|
||||||
friend value_type increment(atomic_t&);
|
|
||||||
friend value_type decrement(atomic_t&);
|
|
||||||
friend value_type swap(atomic_t&, value_type);
|
|
||||||
friend value_type compare_swap(atomic_t&, value_type, value_type);
|
|
||||||
|
|
||||||
explicit atomic_t(value_type val=0)
|
|
||||||
: _value(val)
|
|
||||||
{
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
volatile value_type _value;
|
|
||||||
#if !defined(BOOST_HAS_WINTHREADS)
|
|
||||||
mutex _mutex;
|
|
||||||
#endif
|
|
||||||
};
|
|
||||||
|
|
||||||
extern atomic_t::value_type read(const atomic_t&);
|
|
||||||
extern atomic_t::value_type increment(atomic_t&);
|
|
||||||
extern atomic_t::value_type decrement(atomic_t&);
|
|
||||||
extern atomic_t::value_type swap(atomic_t&, atomic_t::value_type);
|
|
||||||
extern atomic_t::value_type compare_swap(atomic_t&, atomic_t::value_type, atomic_t::value_type);
|
|
||||||
} // namespace boost
|
|
||||||
|
|
||||||
#endif // BOOST_ATOMIC_HPP
|
|
||||||
64
include/boost/thread/barrier.hpp
Normal file
64
include/boost/thread/barrier.hpp
Normal file
@@ -0,0 +1,64 @@
|
|||||||
|
// Copyright (C) 2002-2003
|
||||||
|
// David Moore, William E. Kempf
|
||||||
|
// Copyright (C) 2007-8 Anthony Williams
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#ifndef BOOST_BARRIER_JDM030602_HPP
|
||||||
|
#define BOOST_BARRIER_JDM030602_HPP
|
||||||
|
|
||||||
|
#include <boost/thread/detail/config.hpp>
|
||||||
|
#include <boost/throw_exception.hpp>
|
||||||
|
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
#include <boost/thread/condition_variable.hpp>
|
||||||
|
#include <string>
|
||||||
|
#include <stdexcept>
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
|
||||||
|
class barrier
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
barrier(unsigned int count)
|
||||||
|
: m_threshold(count), m_count(count), m_generation(0)
|
||||||
|
{
|
||||||
|
if (count == 0)
|
||||||
|
boost::throw_exception(thread_exception(system::errc::invalid_argument, "barrier constructor: count cannot be zero."));
|
||||||
|
}
|
||||||
|
|
||||||
|
bool wait()
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lock(m_mutex);
|
||||||
|
unsigned int gen = m_generation;
|
||||||
|
|
||||||
|
if (--m_count == 0)
|
||||||
|
{
|
||||||
|
m_generation++;
|
||||||
|
m_count = m_threshold;
|
||||||
|
m_cond.notify_all();
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
while (gen == m_generation)
|
||||||
|
m_cond.wait(lock);
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
mutex m_mutex;
|
||||||
|
condition_variable m_cond;
|
||||||
|
unsigned int m_threshold;
|
||||||
|
unsigned int m_count;
|
||||||
|
unsigned int m_generation;
|
||||||
|
};
|
||||||
|
|
||||||
|
} // namespace boost
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
@@ -1,156 +1,16 @@
|
|||||||
// Copyright (C) 2001
|
#ifndef BOOST_THREAD_CONDITION_HPP
|
||||||
// William E. Kempf
|
#define BOOST_THREAD_CONDITION_HPP
|
||||||
|
// (C) Copyright 2007 Anthony Williams
|
||||||
//
|
//
|
||||||
// Permission to use, copy, modify, distribute and sell this software
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
// and its documentation for any purpose is hereby granted without fee,
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
// provided that the above copyright notice appear in all copies and
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
// that both that copyright notice and this permission notice appear
|
|
||||||
// in supporting documentation. William E. Kempf makes no representations
|
|
||||||
// about the suitability of this software for any purpose.
|
|
||||||
// It is provided "as is" without express or implied warranty.
|
|
||||||
|
|
||||||
#ifndef BOOST_CONDITION_WEK070601_HPP
|
#include <boost/thread/condition_variable.hpp>
|
||||||
#define BOOST_CONDITION_WEK070601_HPP
|
|
||||||
|
|
||||||
#include <boost/config.hpp>
|
namespace boost
|
||||||
#ifndef BOOST_HAS_THREADS
|
|
||||||
# error Thread support is unavailable!
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#include <boost/thread/exceptions.hpp>
|
|
||||||
#include <boost/utility.hpp>
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_PTHREADS)
|
|
||||||
# include <pthread.h>
|
|
||||||
#endif
|
|
||||||
|
|
||||||
namespace boost {
|
|
||||||
|
|
||||||
struct xtime;
|
|
||||||
|
|
||||||
class condition : private noncopyable
|
|
||||||
{
|
{
|
||||||
public:
|
typedef condition_variable_any condition;
|
||||||
condition();
|
}
|
||||||
~condition();
|
|
||||||
|
|
||||||
void notify_one();
|
|
||||||
void notify_all();
|
|
||||||
|
|
||||||
template <typename L>
|
|
||||||
void wait(L& lock)
|
|
||||||
{
|
|
||||||
if (!lock)
|
|
||||||
throw lock_error();
|
|
||||||
|
|
||||||
do_wait(lock.m_mutex);
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename L, typename Pr>
|
|
||||||
void wait(L& lock, Pr pred)
|
|
||||||
{
|
|
||||||
if (!lock)
|
|
||||||
throw lock_error();
|
|
||||||
|
|
||||||
while (!pred())
|
|
||||||
do_wait(lock.m_mutex);
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename L>
|
|
||||||
bool timed_wait(L& lock, const xtime& xt)
|
|
||||||
{
|
|
||||||
if (!lock)
|
|
||||||
throw lock_error();
|
|
||||||
|
|
||||||
return do_timed_wait(lock.m_mutex, xt);
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename L, typename Pr>
|
|
||||||
bool timed_wait(L& lock, const xtime& xt, Pr pred)
|
|
||||||
{
|
|
||||||
if (!lock)
|
|
||||||
throw lock_error();
|
|
||||||
|
|
||||||
while (!pred())
|
|
||||||
{
|
|
||||||
if (!do_timed_wait(lock.m_mutex, xt))
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
private:
|
|
||||||
template <typename M>
|
|
||||||
void do_wait(M& mutex)
|
|
||||||
{
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
enter_wait();
|
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
typename M::cv_state state;
|
|
||||||
mutex.do_unlock(state);
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_PTHREADS)
|
|
||||||
do_wait(state.pmutex);
|
|
||||||
#elif defined(BOOST_HAS_WINTHREADS)
|
|
||||||
do_wait();
|
|
||||||
#endif
|
|
||||||
|
|
||||||
mutex.do_lock(state);
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename M>
|
|
||||||
bool do_timed_wait(M& mutex, const xtime& xt)
|
|
||||||
{
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
enter_wait();
|
|
||||||
#endif
|
|
||||||
|
|
||||||
typename M::cv_state state;
|
|
||||||
mutex.do_unlock(state);
|
|
||||||
|
|
||||||
bool ret = false;
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_PTHREADS)
|
|
||||||
ret = do_timed_wait(xt, state.pmutex);
|
|
||||||
#elif defined(BOOST_HAS_WINTHREADS)
|
|
||||||
ret = do_timed_wait(xt);
|
|
||||||
#endif
|
|
||||||
|
|
||||||
mutex.do_lock(state);
|
|
||||||
|
|
||||||
return ret;
|
|
||||||
}
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
void enter_wait();
|
|
||||||
void do_wait();
|
|
||||||
bool do_timed_wait(const xtime& xt);
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
void do_wait(pthread_mutex_t* pmutex);
|
|
||||||
bool do_timed_wait(const xtime& xt, pthread_mutex_t* pmutex);
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
unsigned long m_gate;
|
|
||||||
unsigned long m_queue;
|
|
||||||
unsigned long m_mutex;
|
|
||||||
unsigned m_gone; // # threads that timed out and never made it to the m_queue
|
|
||||||
unsigned long m_blocked; // # threads m_blocked m_waiting for the condition
|
|
||||||
unsigned m_waiting; // # threads m_waiting no longer m_waiting for the condition but still
|
|
||||||
// m_waiting to be removed from the m_queue
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
pthread_cond_t m_condition;
|
|
||||||
#endif
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace boost
|
|
||||||
|
|
||||||
// Change Log:
|
|
||||||
// 8 Feb 01 WEKEMPF Initial version.
|
|
||||||
// 22 May 01 WEKEMPF Modified to use xtime for time outs.
|
|
||||||
// 23 May 01 WEKEMPF Removed "duration" timed_waits, as they are too difficult
|
|
||||||
// to use with spurious wakeups.
|
|
||||||
|
|
||||||
#endif // BOOST_CONDITION_WEK070601_HPP
|
|
||||||
|
|||||||
21
include/boost/thread/condition_variable.hpp
Normal file
21
include/boost/thread/condition_variable.hpp
Normal file
@@ -0,0 +1,21 @@
|
|||||||
|
#ifndef BOOST_THREAD_CONDITION_VARIABLE_HPP
|
||||||
|
#define BOOST_THREAD_CONDITION_VARIABLE_HPP
|
||||||
|
|
||||||
|
// condition_variable.hpp
|
||||||
|
//
|
||||||
|
// (C) Copyright 2007 Anthony Williams
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/thread/detail/platform.hpp>
|
||||||
|
#if defined(BOOST_THREAD_PLATFORM_WIN32)
|
||||||
|
#include <boost/thread/win32/condition_variable.hpp>
|
||||||
|
#elif defined(BOOST_THREAD_PLATFORM_PTHREAD)
|
||||||
|
#include <boost/thread/pthread/condition_variable.hpp>
|
||||||
|
#else
|
||||||
|
#error "Boost threads unavailable on this platform"
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#endif
|
||||||
@@ -1,100 +0,0 @@
|
|||||||
// Copyright (C) 2001
|
|
||||||
// William E. Kempf
|
|
||||||
//
|
|
||||||
// Permission to use, copy, modify, distribute and sell this software
|
|
||||||
// and its documentation for any purpose is hereby granted without fee,
|
|
||||||
// provided that the above copyright notice appear in all copies and
|
|
||||||
// that both that copyright notice and this permission notice appear
|
|
||||||
// in supporting documentation. William E. Kempf makes no representations
|
|
||||||
// about the suitability of this software for any purpose.
|
|
||||||
// It is provided "as is" without express or implied warranty.
|
|
||||||
|
|
||||||
// This file is used to configure Boost.Threads during development
|
|
||||||
// in order to decouple dependency on any Boost release. Once
|
|
||||||
// accepted into Boost these contents will be moved to <boost/config>
|
|
||||||
// or some other appropriate build configuration and all
|
|
||||||
// #include <boost/thread/config.hpp> statements will be changed
|
|
||||||
// accordingly.
|
|
||||||
|
|
||||||
#ifndef BOOST_THREAD_CONFIG_WEK070601_HPP
|
|
||||||
#define BOOST_THREAD_CONFIG_WEK070601_HPP
|
|
||||||
|
|
||||||
#include <boost/config.hpp>
|
|
||||||
|
|
||||||
#error "Included <boost/thread/config.hpp>"
|
|
||||||
|
|
||||||
/*// Define if threading support is enabled for the toolset.
|
|
||||||
#undef BOOST_HAS_THREADS
|
|
||||||
|
|
||||||
// Define if threading should be implemented in terms of Win32 threads.
|
|
||||||
#undef BOOST_HAS_WINTHREADS
|
|
||||||
|
|
||||||
// Define if threading should be implemented in terms of POSIX threads.
|
|
||||||
#undef BOOST_HAS_PTHREADS
|
|
||||||
|
|
||||||
// Define if BOOST_HAS_PTHREADS and pthread_delay_np() exists.
|
|
||||||
#undef BOOST_HAS_PTHREAD_DELAY_NP
|
|
||||||
|
|
||||||
// Define if BOOST_HAS_PTHREADS and not BOOST_HAS_PTHREAD_DELAY_NP
|
|
||||||
// but nanosleep can be used instead.
|
|
||||||
#undef BOOST_HAS_NANOSLEEP
|
|
||||||
|
|
||||||
// Define if BOOST_HAS_PTHREADS and pthread_yield() exists.
|
|
||||||
#undef BOOST_HAS_PTHREAD_YIELD
|
|
||||||
|
|
||||||
// Define if BOOST_HAS_PTHREADS and not BOOST_HAS_PTHREAD_YIELD and
|
|
||||||
// sched_yield() exists.
|
|
||||||
#undef BOOST_HAS_SCHED_YIELD
|
|
||||||
|
|
||||||
// Define if gettimeofday() exists.
|
|
||||||
#undef BOOST_HAS_GETTIMEOFDAY
|
|
||||||
|
|
||||||
// Define if not BOOST_HAS_GETTIMEOFDAY and clock_gettime() exists.
|
|
||||||
#undef BOOST_HAS_CLOCK_GETTIME
|
|
||||||
|
|
||||||
// Define if not BOOST_HAS_GETTIMEOFDAY and not BOOST_HAS_CLOCK_GETTIME and
|
|
||||||
// GetSystemTimeAsFileTime() can be called with an FTIME structure.
|
|
||||||
#undef BOOST_HAS_FTIME
|
|
||||||
|
|
||||||
// Define if pthread_mutexattr_settype and pthread_mutexattr_gettype exist.
|
|
||||||
#undef BOOST_HAS_PTHREAD_MUTEXATTR_SETTYPE
|
|
||||||
|
|
||||||
// Here we'll set up known compiler options.
|
|
||||||
|
|
||||||
#if defined(BOOST_MSVC)
|
|
||||||
# if defined(_MT)
|
|
||||||
# define BOOST_HAS_THREADS
|
|
||||||
# endif
|
|
||||||
# define BOOST_HAS_WINTHREADS // comment out this to test pthreads-win32.
|
|
||||||
# if !defined(BOOST_HAS_WINTHREADS)
|
|
||||||
# define BOOST_HAS_PTHREADS
|
|
||||||
# define BOOST_HAS_PTHREAD_MUTEXATTR_SETTYPE
|
|
||||||
# define PtW32NoCatchWarn
|
|
||||||
# pragma comment(lib, "pthreadVCE.lib")
|
|
||||||
# endif
|
|
||||||
# define BOOST_HAS_FTIME
|
|
||||||
// pdm: this is for linux - is there a better #define to #if on?
|
|
||||||
// wek: not sure how else to do this, but GNU CC on Win32 should probably
|
|
||||||
// use BOOST_HAS_WINTHREADS, and I expect there will be other
|
|
||||||
// platform specific variations for this compiler toolset. Need
|
|
||||||
// to decide how to handle this.
|
|
||||||
#elif defined( __GNUC__ )
|
|
||||||
# define BOOST_HAS_THREADS
|
|
||||||
# define BOOST_HAS_PTHREADS
|
|
||||||
# define BOOST_HAS_NANOSLEEP
|
|
||||||
# define BOOST_HAS_GETTIMEOFDAY
|
|
||||||
// pdm: From the pthread.h header, one of these macros
|
|
||||||
// must be defined for this stuff to exist.
|
|
||||||
// wek: This seems like a harmless enough method to determine these
|
|
||||||
// switches, but one should note that some implementations may not
|
|
||||||
// use these. Notably, pthreads-win32 doesn't define either
|
|
||||||
// __USE_UNIX98 or __USE_GNU.
|
|
||||||
# if defined( __USE_UNIX98 )
|
|
||||||
# define BOOST_HAS_PTHREAD_MUTEXATTR_SETTYPE
|
|
||||||
# elif defined( __USE_GNU )
|
|
||||||
# define BOOST_HAS_PTHREAD_MUTEXATTR_SETTYPE
|
|
||||||
# define BOOST_HAS_PTHREAD_YIELD
|
|
||||||
# endif
|
|
||||||
#endif*/
|
|
||||||
|
|
||||||
#endif // BOOST_THREAD_CONFIG_WEK070601_HPP
|
|
||||||
26
include/boost/thread/cv_status.hpp
Normal file
26
include/boost/thread/cv_status.hpp
Normal file
@@ -0,0 +1,26 @@
|
|||||||
|
// cv_status.hpp
|
||||||
|
//
|
||||||
|
// Copyright (C) 2011 Vicente J. Botet Escriba
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#ifndef BOOST_THREAD_CV_STATUS_HPP
|
||||||
|
#define BOOST_THREAD_CV_STATUS_HPP
|
||||||
|
|
||||||
|
#include <boost/thread/detail/scoped_enum.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
|
||||||
|
// enum class cv_status;
|
||||||
|
BOOST_SCOPED_ENUM_DECLARE_BEGIN(cv_status)
|
||||||
|
{
|
||||||
|
no_timeout,
|
||||||
|
timeout
|
||||||
|
}
|
||||||
|
BOOST_SCOPED_ENUM_DECLARE_END(cv_status)
|
||||||
|
}
|
||||||
|
|
||||||
|
#endif // header
|
||||||
126
include/boost/thread/detail/config.hpp
Normal file
126
include/boost/thread/detail/config.hpp
Normal file
@@ -0,0 +1,126 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// William E. Kempf
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#ifndef BOOST_THREAD_CONFIG_WEK01032003_HPP
|
||||||
|
#define BOOST_THREAD_CONFIG_WEK01032003_HPP
|
||||||
|
|
||||||
|
#include <boost/config.hpp>
|
||||||
|
#include <boost/detail/workaround.hpp>
|
||||||
|
|
||||||
|
#if !defined BOOST_THREAD_VERSION
|
||||||
|
#define BOOST_THREAD_VERSION 1
|
||||||
|
#else
|
||||||
|
#if BOOST_THREAD_VERSION!=1 && BOOST_THREAD_VERSION!=2
|
||||||
|
#error "BOOST_THREAD_VERSION must be 1 or 2"
|
||||||
|
#endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if ! defined BOOST_THREAD_DONT_USE_SYSTEM
|
||||||
|
#define BOOST_THREAD_USES_SYSTEM
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if ! defined BOOST_THREAD_DONT_USE_CHRONO && ! defined BOOST_THREAD_DONT_USE_SYSTEM
|
||||||
|
#define BOOST_THREAD_USES_CHRONO
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if ! defined BOOST_THREAD_DONT_USE_MOVE
|
||||||
|
#define BOOST_THREAD_USES_MOVE
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if BOOST_WORKAROUND(__BORLANDC__, < 0x600)
|
||||||
|
# pragma warn -8008 // Condition always true/false
|
||||||
|
# pragma warn -8080 // Identifier declared but never used
|
||||||
|
# pragma warn -8057 // Parameter never used
|
||||||
|
# pragma warn -8066 // Unreachable code
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include "platform.hpp"
|
||||||
|
|
||||||
|
// provided for backwards compatibility, since this
|
||||||
|
// macro was used for several releases by mistake.
|
||||||
|
#if defined(BOOST_THREAD_DYN_DLL)
|
||||||
|
# define BOOST_THREAD_DYN_LINK
|
||||||
|
#endif
|
||||||
|
|
||||||
|
// compatibility with the rest of Boost's auto-linking code:
|
||||||
|
#if defined(BOOST_THREAD_DYN_LINK) || defined(BOOST_ALL_DYN_LINK)
|
||||||
|
# undef BOOST_THREAD_USE_LIB
|
||||||
|
# define BOOST_THREAD_USE_DLL
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if defined(BOOST_THREAD_BUILD_DLL) //Build dll
|
||||||
|
#elif defined(BOOST_THREAD_BUILD_LIB) //Build lib
|
||||||
|
#elif defined(BOOST_THREAD_USE_DLL) //Use dll
|
||||||
|
#elif defined(BOOST_THREAD_USE_LIB) //Use lib
|
||||||
|
#else //Use default
|
||||||
|
# if defined(BOOST_THREAD_PLATFORM_WIN32)
|
||||||
|
# if defined(BOOST_MSVC) || defined(BOOST_INTEL_WIN)
|
||||||
|
//For compilers supporting auto-tss cleanup
|
||||||
|
//with Boost.Threads lib, use Boost.Threads lib
|
||||||
|
# define BOOST_THREAD_USE_LIB
|
||||||
|
# else
|
||||||
|
//For compilers not yet supporting auto-tss cleanup
|
||||||
|
//with Boost.Threads lib, use Boost.Threads dll
|
||||||
|
# define BOOST_THREAD_USE_DLL
|
||||||
|
# endif
|
||||||
|
# else
|
||||||
|
# define BOOST_THREAD_USE_LIB
|
||||||
|
# endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if defined(BOOST_HAS_DECLSPEC)
|
||||||
|
# if defined(BOOST_THREAD_BUILD_DLL) //Build dll
|
||||||
|
# define BOOST_THREAD_DECL BOOST_SYMBOL_EXPORT
|
||||||
|
//# define BOOST_THREAD_DECL __declspec(dllexport)
|
||||||
|
|
||||||
|
# elif defined(BOOST_THREAD_USE_DLL) //Use dll
|
||||||
|
# define BOOST_THREAD_DECL BOOST_SYMBOL_IMPORT
|
||||||
|
//# define BOOST_THREAD_DECL __declspec(dllimport)
|
||||||
|
# else
|
||||||
|
# define BOOST_THREAD_DECL
|
||||||
|
# endif
|
||||||
|
#elif (__GNUC__ == 4 && __GNUC_MINOR__ >= 1) || (__GNUC__ > 4)
|
||||||
|
# define BOOST_THREAD_DECL BOOST_SYMBOL_VISIBLE
|
||||||
|
|
||||||
|
#else
|
||||||
|
# define BOOST_THREAD_DECL
|
||||||
|
#endif // BOOST_HAS_DECLSPEC
|
||||||
|
|
||||||
|
//
|
||||||
|
// Automatically link to the correct build variant where possible.
|
||||||
|
//
|
||||||
|
#if !defined(BOOST_ALL_NO_LIB) && !defined(BOOST_THREAD_NO_LIB) && !defined(BOOST_THREAD_BUILD_DLL) && !defined(BOOST_THREAD_BUILD_LIB)
|
||||||
|
//
|
||||||
|
// Tell the autolink to link dynamically, this will get undef'ed by auto_link.hpp
|
||||||
|
// once it's done with it:
|
||||||
|
//
|
||||||
|
#if defined(BOOST_THREAD_USE_DLL)
|
||||||
|
# define BOOST_DYN_LINK
|
||||||
|
#endif
|
||||||
|
//
|
||||||
|
// Set the name of our library, this will get undef'ed by auto_link.hpp
|
||||||
|
// once it's done with it:
|
||||||
|
//
|
||||||
|
#if defined(BOOST_THREAD_LIB_NAME)
|
||||||
|
# define BOOST_LIB_NAME BOOST_THREAD_LIB_NAME
|
||||||
|
#else
|
||||||
|
# define BOOST_LIB_NAME boost_thread
|
||||||
|
#endif
|
||||||
|
//
|
||||||
|
// If we're importing code from a dll, then tell auto_link.hpp about it:
|
||||||
|
//
|
||||||
|
// And include the header that does the work:
|
||||||
|
//
|
||||||
|
#include <boost/config/auto_link.hpp>
|
||||||
|
#endif // auto-linking disabled
|
||||||
|
|
||||||
|
#endif // BOOST_THREAD_CONFIG_WEK1032003_HPP
|
||||||
|
|
||||||
|
// Change Log:
|
||||||
|
// 22 Jan 05 Roland Schwarz (speedsnail)
|
||||||
|
// Usage of BOOST_HAS_DECLSPEC macro.
|
||||||
|
// Default again is static lib usage.
|
||||||
|
// BOOST_DYN_LINK only defined when autolink included.
|
||||||
39
include/boost/thread/detail/force_cast.hpp
Normal file
39
include/boost/thread/detail/force_cast.hpp
Normal file
@@ -0,0 +1,39 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// Mac Murrett
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
//
|
||||||
|
// See http://www.boost.org for most recent version including documentation.
|
||||||
|
|
||||||
|
#ifndef BOOST_FORCE_CAST_MJM012402_HPP
|
||||||
|
#define BOOST_FORCE_CAST_MJM012402_HPP
|
||||||
|
|
||||||
|
#include <boost/thread/detail/config.hpp>
|
||||||
|
|
||||||
|
namespace boost {
|
||||||
|
namespace detail {
|
||||||
|
namespace thread {
|
||||||
|
|
||||||
|
// force_cast will convert anything to anything.
|
||||||
|
|
||||||
|
// general case
|
||||||
|
template<class Return_Type, class Argument_Type>
|
||||||
|
inline Return_Type &force_cast(Argument_Type &rSrc)
|
||||||
|
{
|
||||||
|
return(*reinterpret_cast<Return_Type *>(&rSrc));
|
||||||
|
}
|
||||||
|
|
||||||
|
// specialization for const
|
||||||
|
template<class Return_Type, class Argument_Type>
|
||||||
|
inline const Return_Type &force_cast(const Argument_Type &rSrc)
|
||||||
|
{
|
||||||
|
return(*reinterpret_cast<const Return_Type *>(&rSrc));
|
||||||
|
}
|
||||||
|
|
||||||
|
} // namespace thread
|
||||||
|
} // namespace detail
|
||||||
|
} // namespace boost
|
||||||
|
|
||||||
|
#endif // BOOST_FORCE_CAST_MJM012402_HPP
|
||||||
@@ -1,172 +0,0 @@
|
|||||||
// Copyright (C) 2001
|
|
||||||
// William E. Kempf
|
|
||||||
//
|
|
||||||
// Permission to use, copy, modify, distribute and sell this software
|
|
||||||
// and its documentation for any purpose is hereby granted without fee,
|
|
||||||
// provided that the above copyright notice appear in all copies and
|
|
||||||
// that both that copyright notice and this permission notice appear
|
|
||||||
// in supporting documentation. William E. Kempf makes no representations
|
|
||||||
// about the suitability of this software for any purpose.
|
|
||||||
// It is provided "as is" without express or implied warranty.
|
|
||||||
|
|
||||||
#ifndef BOOST_XLOCK_WEK070601_HPP
|
|
||||||
#define BOOST_XLOCK_WEK070601_HPP
|
|
||||||
|
|
||||||
#include <boost/utility.hpp>
|
|
||||||
#include <boost/thread/exceptions.hpp>
|
|
||||||
|
|
||||||
namespace boost {
|
|
||||||
|
|
||||||
class condition;
|
|
||||||
struct xtime;
|
|
||||||
|
|
||||||
namespace detail { namespace thread {
|
|
||||||
|
|
||||||
template <typename Mutex>
|
|
||||||
class scoped_lock : private noncopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef Mutex mutex_type;
|
|
||||||
|
|
||||||
explicit scoped_lock(Mutex& mx, bool initially_locked=true)
|
|
||||||
: m_mutex(mx), m_locked(false)
|
|
||||||
{
|
|
||||||
if (initially_locked) lock();
|
|
||||||
}
|
|
||||||
~scoped_lock()
|
|
||||||
{
|
|
||||||
if (m_locked) unlock();
|
|
||||||
}
|
|
||||||
|
|
||||||
void lock()
|
|
||||||
{
|
|
||||||
if (m_locked) throw lock_error();
|
|
||||||
m_mutex.do_lock();
|
|
||||||
m_locked = true;
|
|
||||||
}
|
|
||||||
void unlock()
|
|
||||||
{
|
|
||||||
if (!m_locked) throw lock_error();
|
|
||||||
m_mutex.do_unlock();
|
|
||||||
m_locked = false;
|
|
||||||
}
|
|
||||||
|
|
||||||
bool locked() const { return m_locked; }
|
|
||||||
operator const void*() const { return m_locked ? this : 0; }
|
|
||||||
|
|
||||||
private:
|
|
||||||
friend class boost::condition;
|
|
||||||
|
|
||||||
Mutex& m_mutex;
|
|
||||||
bool m_locked;
|
|
||||||
};
|
|
||||||
|
|
||||||
template <typename TryMutex>
|
|
||||||
class scoped_try_lock : private noncopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef TryMutex mutex_type;
|
|
||||||
|
|
||||||
explicit scoped_try_lock(TryMutex& mx)
|
|
||||||
: m_mutex(mx), m_locked(false)
|
|
||||||
{
|
|
||||||
try_lock();
|
|
||||||
}
|
|
||||||
scoped_try_lock(TryMutex& mx, bool initially_locked)
|
|
||||||
: m_mutex(mx), m_locked(false)
|
|
||||||
{
|
|
||||||
if (initially_locked) lock();
|
|
||||||
}
|
|
||||||
~scoped_try_lock()
|
|
||||||
{
|
|
||||||
if (m_locked) unlock();
|
|
||||||
}
|
|
||||||
|
|
||||||
void lock()
|
|
||||||
{
|
|
||||||
if (m_locked) throw lock_error();
|
|
||||||
m_mutex.do_lock();
|
|
||||||
m_locked = true;
|
|
||||||
}
|
|
||||||
bool try_lock()
|
|
||||||
{
|
|
||||||
if (m_locked) throw lock_error();
|
|
||||||
return (m_locked = m_mutex.do_trylock());
|
|
||||||
}
|
|
||||||
void unlock()
|
|
||||||
{
|
|
||||||
if (!m_locked) throw lock_error();
|
|
||||||
m_mutex.do_unlock();
|
|
||||||
m_locked = false;
|
|
||||||
}
|
|
||||||
|
|
||||||
bool locked() const { return m_locked; }
|
|
||||||
operator const void*() const { return m_locked ? this : 0; }
|
|
||||||
|
|
||||||
private:
|
|
||||||
friend class boost::condition;
|
|
||||||
|
|
||||||
TryMutex& m_mutex;
|
|
||||||
bool m_locked;
|
|
||||||
};
|
|
||||||
|
|
||||||
template <typename TimedMutex>
|
|
||||||
class scoped_timed_lock : private noncopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef TimedMutex mutex_type;
|
|
||||||
|
|
||||||
scoped_timed_lock(TimedMutex& mx, const xtime& xt)
|
|
||||||
: m_mutex(mx), m_locked(false)
|
|
||||||
{
|
|
||||||
timed_lock(xt);
|
|
||||||
}
|
|
||||||
scoped_timed_lock(TimedMutex& mx, bool initially_locked)
|
|
||||||
: m_mutex(mx), m_locked(false)
|
|
||||||
{
|
|
||||||
if (initially_locked) lock();
|
|
||||||
}
|
|
||||||
~scoped_timed_lock()
|
|
||||||
{
|
|
||||||
if (m_locked) unlock();
|
|
||||||
}
|
|
||||||
|
|
||||||
void lock()
|
|
||||||
{
|
|
||||||
if (m_locked) throw lock_error();
|
|
||||||
m_mutex.do_lock();
|
|
||||||
m_locked = true;
|
|
||||||
}
|
|
||||||
bool timed_lock(const xtime& xt)
|
|
||||||
{
|
|
||||||
if (m_locked) throw lock_error();
|
|
||||||
return (m_locked = m_mutex.do_timedlock(xt));
|
|
||||||
}
|
|
||||||
void unlock()
|
|
||||||
{
|
|
||||||
if (!m_locked) throw lock_error();
|
|
||||||
m_mutex.do_unlock();
|
|
||||||
m_locked = false;
|
|
||||||
}
|
|
||||||
|
|
||||||
bool locked() const { return m_locked; }
|
|
||||||
operator const void*() const { return m_locked ? this : 0; }
|
|
||||||
|
|
||||||
private:
|
|
||||||
friend class boost::condition;
|
|
||||||
|
|
||||||
TimedMutex& m_mutex;
|
|
||||||
bool m_locked;
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace thread
|
|
||||||
} // namespace detail
|
|
||||||
} // namespace boost
|
|
||||||
|
|
||||||
// Change Log:
|
|
||||||
// 8 Feb 01 WEKEMPF Initial version.
|
|
||||||
// 22 May 01 WEKEMPF Modified to use xtime for time outs.
|
|
||||||
// 30 Jul 01 WEKEMPF Moved lock types into boost::detail::thread. Renamed some types.
|
|
||||||
// Added locked() methods.
|
|
||||||
|
|
||||||
#endif // BOOST_XLOCK_WEK070601_HPP
|
|
||||||
66
include/boost/thread/detail/move.hpp
Normal file
66
include/boost/thread/detail/move.hpp
Normal file
@@ -0,0 +1,66 @@
|
|||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
// (C) Copyright 2007-8 Anthony Williams
|
||||||
|
|
||||||
|
#ifndef BOOST_THREAD_MOVE_HPP
|
||||||
|
#define BOOST_THREAD_MOVE_HPP
|
||||||
|
|
||||||
|
#include <boost/thread/detail/config.hpp>
|
||||||
|
#ifndef BOOST_NO_SFINAE
|
||||||
|
#include <boost/utility/enable_if.hpp>
|
||||||
|
#include <boost/type_traits/is_convertible.hpp>
|
||||||
|
#include <boost/type_traits/remove_reference.hpp>
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <boost/move/move.hpp>
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
|
||||||
|
namespace detail
|
||||||
|
{
|
||||||
|
template<typename T>
|
||||||
|
struct thread_move_t
|
||||||
|
{
|
||||||
|
T& t;
|
||||||
|
explicit thread_move_t(T& t_):
|
||||||
|
t(t_)
|
||||||
|
{}
|
||||||
|
|
||||||
|
T& operator*() const
|
||||||
|
{
|
||||||
|
return t;
|
||||||
|
}
|
||||||
|
|
||||||
|
T* operator->() const
|
||||||
|
{
|
||||||
|
return &t;
|
||||||
|
}
|
||||||
|
private:
|
||||||
|
void operator=(thread_move_t&);
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifndef BOOST_NO_SFINAE
|
||||||
|
template<typename T>
|
||||||
|
typename enable_if<boost::is_convertible<T&,boost::detail::thread_move_t<T> >, boost::detail::thread_move_t<T> >::type move(T& t)
|
||||||
|
{
|
||||||
|
return boost::detail::thread_move_t<T>(t);
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
template<typename T>
|
||||||
|
boost::detail::thread_move_t<T> move(boost::detail::thread_move_t<T> t)
|
||||||
|
{
|
||||||
|
return t;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
71
include/boost/thread/detail/platform.hpp
Normal file
71
include/boost/thread/detail/platform.hpp
Normal file
@@ -0,0 +1,71 @@
|
|||||||
|
// Copyright 2006 Roland Schwarz.
|
||||||
|
// (C) Copyright 2007 Anthony Williams
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
//
|
||||||
|
// This work is a reimplementation along the design and ideas
|
||||||
|
// of William E. Kempf.
|
||||||
|
|
||||||
|
#ifndef BOOST_THREAD_RS06040501_HPP
|
||||||
|
#define BOOST_THREAD_RS06040501_HPP
|
||||||
|
|
||||||
|
// fetch compiler and platform configuration
|
||||||
|
#include <boost/config.hpp>
|
||||||
|
|
||||||
|
// insist on threading support being available:
|
||||||
|
#include <boost/config/requires_threads.hpp>
|
||||||
|
|
||||||
|
// choose platform
|
||||||
|
#if defined(linux) || defined(__linux) || defined(__linux__)
|
||||||
|
# define BOOST_THREAD_LINUX
|
||||||
|
#elif defined(__FreeBSD__) || defined(__NetBSD__) || defined(__OpenBSD__) || defined(__DragonFly__)
|
||||||
|
# define BOOST_THREAD_BSD
|
||||||
|
#elif defined(sun) || defined(__sun)
|
||||||
|
# define BOOST_THREAD_SOLARIS
|
||||||
|
#elif defined(__sgi)
|
||||||
|
# define BOOST_THREAD_IRIX
|
||||||
|
#elif defined(__hpux)
|
||||||
|
# define BOOST_THREAD_HPUX
|
||||||
|
#elif defined(__CYGWIN__)
|
||||||
|
# define BOOST_THREAD_CYGWIN
|
||||||
|
#elif (defined(_WIN32) || defined(__WIN32__) || defined(WIN32)) && !defined(BOOST_DISABLE_WIN32)
|
||||||
|
# define BOOST_THREAD_WIN32
|
||||||
|
#elif defined(__BEOS__)
|
||||||
|
# define BOOST_THREAD_BEOS
|
||||||
|
#elif defined(macintosh) || defined(__APPLE__) || defined(__APPLE_CC__)
|
||||||
|
# define BOOST_THREAD_MACOS
|
||||||
|
#elif defined(__IBMCPP__) || defined(_AIX)
|
||||||
|
# define BOOST_THREAD_AIX
|
||||||
|
#elif defined(__amigaos__)
|
||||||
|
# define BOOST_THREAD_AMIGAOS
|
||||||
|
#elif defined(__QNXNTO__)
|
||||||
|
# define BOOST_THREAD_QNXNTO
|
||||||
|
#elif defined(unix) || defined(__unix) || defined(_XOPEN_SOURCE) || defined(_POSIX_SOURCE)
|
||||||
|
# if defined(BOOST_HAS_PTHREADS) && !defined(BOOST_THREAD_POSIX)
|
||||||
|
# define BOOST_THREAD_POSIX
|
||||||
|
# endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
// For every supported platform add a new entry into the dispatch table below.
|
||||||
|
// BOOST_THREAD_POSIX is tested first, so on platforms where posix and native
|
||||||
|
// threading is available, the user may choose, by defining BOOST_THREAD_POSIX
|
||||||
|
// in her source. If a platform is known to support pthreads and no native
|
||||||
|
// port of boost_thread is available just specify "pthread" in the
|
||||||
|
// dispatcher table. If there is no entry for a platform but pthreads is
|
||||||
|
// available on the platform, pthread is choosen as default. If nothing is
|
||||||
|
// available the preprocessor will fail with a diagnostic message.
|
||||||
|
|
||||||
|
#if defined(BOOST_THREAD_POSIX)
|
||||||
|
# define BOOST_THREAD_PLATFORM_PTHREAD
|
||||||
|
#else
|
||||||
|
# if defined(BOOST_THREAD_WIN32)
|
||||||
|
# define BOOST_THREAD_PLATFORM_WIN32
|
||||||
|
# elif defined(BOOST_HAS_PTHREADS)
|
||||||
|
# define BOOST_THREAD_PLATFORM_PTHREAD
|
||||||
|
# else
|
||||||
|
# error "Sorry, no boost threads are available for this platform."
|
||||||
|
# endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#endif // BOOST_THREAD_RS06040501_HPP
|
||||||
113
include/boost/thread/detail/scoped_enum.hpp
Normal file
113
include/boost/thread/detail/scoped_enum.hpp
Normal file
@@ -0,0 +1,113 @@
|
|||||||
|
// Copyright (C) 2012
|
||||||
|
// Vicente J. Botet Escriba
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#ifndef BOOST_THREAD_DETAIL_SCOPED_ENUM_HPP
|
||||||
|
#define BOOST_THREAD_DETAIL_SCOPED_ENUM_HPP
|
||||||
|
|
||||||
|
#include <boost/config.hpp>
|
||||||
|
#include <boost/detail/workaround.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
|
||||||
|
#ifdef BOOST_NO_SCOPED_ENUMS
|
||||||
|
template <typename NT>
|
||||||
|
struct underlying_type
|
||||||
|
{
|
||||||
|
typedef typename NT::underlying_type type;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename UT, typename NT>
|
||||||
|
UT underlying_cast(NT v)
|
||||||
|
{
|
||||||
|
return v.underlying();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename EC>
|
||||||
|
inline
|
||||||
|
typename EC::enum_type native_value(EC e)
|
||||||
|
{
|
||||||
|
return e.native();
|
||||||
|
}
|
||||||
|
|
||||||
|
#else // BOOST_NO_SCOPED_ENUMS
|
||||||
|
|
||||||
|
template <typename NT>
|
||||||
|
struct underlying_type
|
||||||
|
{
|
||||||
|
//typedef typename std::underlying_type<NT>::type type;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename UT, typename NT>
|
||||||
|
UT underlying_cast(NT v)
|
||||||
|
{
|
||||||
|
return static_cast<UT>(v);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename EC>
|
||||||
|
inline
|
||||||
|
EC native_value(EC e)
|
||||||
|
{
|
||||||
|
return e;
|
||||||
|
}
|
||||||
|
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
#ifdef BOOST_NO_SCOPED_ENUMS
|
||||||
|
|
||||||
|
#ifndef BOOST_NO_EXPLICIT_CONVERSION_OPERATORS
|
||||||
|
|
||||||
|
#define BOOST_SCOPED_ENUM_UT_DECLARE_CONVERSION_OPERATOR \
|
||||||
|
explicit operator underlying_type() const { return underlying(); }
|
||||||
|
|
||||||
|
#else
|
||||||
|
|
||||||
|
#define BOOST_SCOPED_ENUM_UT_DECLARE_CONVERSION_OPERATOR
|
||||||
|
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#define BOOST_SCOPED_ENUM_UT_DECLARE_BEGIN(NT, UT) \
|
||||||
|
struct NT { \
|
||||||
|
typedef UT underlying_type; \
|
||||||
|
enum enum_type
|
||||||
|
|
||||||
|
#define BOOST_SCOPED_ENUM_DECLARE_END(NT) \
|
||||||
|
; \
|
||||||
|
NT() {} \
|
||||||
|
NT(enum_type v) : v_(v) {} \
|
||||||
|
explicit NT(underlying_type v) : v_(v) {} \
|
||||||
|
underlying_type underlying() const { return v_; } \
|
||||||
|
enum_type native() const { return enum_type(v_); } \
|
||||||
|
BOOST_SCOPED_ENUM_UT_DECLARE_CONVERSION_OPERATOR \
|
||||||
|
friend bool operator ==(NT lhs, enum_type rhs) { return enum_type(lhs.v_)==rhs; } \
|
||||||
|
friend bool operator ==(enum_type lhs, NT rhs) { return lhs==enum_type(rhs.v_); } \
|
||||||
|
friend bool operator !=(NT lhs, enum_type rhs) { return enum_type(lhs.v_)!=rhs; } \
|
||||||
|
friend bool operator !=(enum_type lhs, NT rhs) { return lhs!=enum_type(rhs.v_); } \
|
||||||
|
private: \
|
||||||
|
underlying_type v_; \
|
||||||
|
};
|
||||||
|
|
||||||
|
#define BOOST_SCOPED_ENUM_DECLARE_BEGIN(NT) \
|
||||||
|
BOOST_SCOPED_ENUM_UT_DECLARE_BEGIN(NT,int)
|
||||||
|
|
||||||
|
#define BOOST_SCOPED_ENUM_NATIVE(NT) NT::enum_type
|
||||||
|
#define BOOST_SCOPED_ENUM_FORWARD_DECLARE(NT) struct NT
|
||||||
|
|
||||||
|
#else // BOOST_NO_SCOPED_ENUMS
|
||||||
|
|
||||||
|
#define BOOST_SCOPED_ENUM_UT_DECLARE_BEGIN(NT,UT) enum class NT:UT
|
||||||
|
#define BOOST_SCOPED_ENUM_DECLARE_BEGIN(NT) enum class NT
|
||||||
|
#define BOOST_SCOPED_ENUM_DECLARE_END(NT) ;
|
||||||
|
|
||||||
|
#define BOOST_SCOPED_ENUM_NATIVE(NT) NT
|
||||||
|
#define BOOST_SCOPED_ENUM_FORWARD_DECLARE(NT) enum class NT
|
||||||
|
|
||||||
|
#endif // BOOST_NO_SCOPED_ENUMS
|
||||||
|
|
||||||
|
|
||||||
|
#endif // BOOST_THREAD_DETAIL_SCOPED_ENUM_HPP
|
||||||
59
include/boost/thread/detail/singleton.hpp
Normal file
59
include/boost/thread/detail/singleton.hpp
Normal file
@@ -0,0 +1,59 @@
|
|||||||
|
// Copyright (C) 2001-2003
|
||||||
|
// Mac Murrett
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
//
|
||||||
|
// See http://www.boost.org for most recent version including documentation.
|
||||||
|
|
||||||
|
#ifndef BOOST_SINGLETON_MJM012402_HPP
|
||||||
|
#define BOOST_SINGLETON_MJM012402_HPP
|
||||||
|
|
||||||
|
#include <boost/thread/detail/config.hpp>
|
||||||
|
|
||||||
|
namespace boost {
|
||||||
|
namespace detail {
|
||||||
|
namespace thread {
|
||||||
|
|
||||||
|
// class singleton has the same goal as all singletons: create one instance of
|
||||||
|
// a class on demand, then dish it out as requested.
|
||||||
|
|
||||||
|
template <class T>
|
||||||
|
class singleton : private T
|
||||||
|
{
|
||||||
|
private:
|
||||||
|
singleton();
|
||||||
|
~singleton();
|
||||||
|
|
||||||
|
public:
|
||||||
|
static T &instance();
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
template <class T>
|
||||||
|
inline singleton<T>::singleton()
|
||||||
|
{
|
||||||
|
/* no-op */
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class T>
|
||||||
|
inline singleton<T>::~singleton()
|
||||||
|
{
|
||||||
|
/* no-op */
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class T>
|
||||||
|
/*static*/ T &singleton<T>::instance()
|
||||||
|
{
|
||||||
|
// function-local static to force this to work correctly at static
|
||||||
|
// initialization time.
|
||||||
|
static singleton<T> s_oT;
|
||||||
|
return(s_oT);
|
||||||
|
}
|
||||||
|
|
||||||
|
} // namespace thread
|
||||||
|
} // namespace detail
|
||||||
|
} // namespace boost
|
||||||
|
|
||||||
|
#endif // BOOST_SINGLETON_MJM012402_HPP
|
||||||
807
include/boost/thread/detail/thread.hpp
Normal file
807
include/boost/thread/detail/thread.hpp
Normal file
@@ -0,0 +1,807 @@
|
|||||||
|
#ifndef BOOST_THREAD_THREAD_COMMON_HPP
|
||||||
|
#define BOOST_THREAD_THREAD_COMMON_HPP
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
// (C) Copyright 2007-10 Anthony Williams
|
||||||
|
// (C) Copyright 20011-12 Vicente J. Botet Escriba
|
||||||
|
|
||||||
|
#include <boost/thread/detail/config.hpp>
|
||||||
|
#include <boost/thread/exceptions.hpp>
|
||||||
|
#ifndef BOOST_NO_IOSTREAM
|
||||||
|
#include <ostream>
|
||||||
|
#endif
|
||||||
|
#if defined BOOST_THREAD_USES_MOVE
|
||||||
|
#include <boost/move/move.hpp>
|
||||||
|
#else
|
||||||
|
#include <boost/thread/detail/move.hpp>
|
||||||
|
#endif
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
#include <boost/thread/xtime.hpp>
|
||||||
|
#include <boost/thread/detail/thread_heap_alloc.hpp>
|
||||||
|
#include <boost/utility.hpp>
|
||||||
|
#include <boost/assert.hpp>
|
||||||
|
#include <list>
|
||||||
|
#include <algorithm>
|
||||||
|
#include <boost/ref.hpp>
|
||||||
|
#include <boost/cstdint.hpp>
|
||||||
|
#include <boost/bind.hpp>
|
||||||
|
#include <stdlib.h>
|
||||||
|
#include <memory>
|
||||||
|
#include <boost/utility/enable_if.hpp>
|
||||||
|
#include <boost/type_traits/remove_reference.hpp>
|
||||||
|
#include <boost/io/ios_state.hpp>
|
||||||
|
#include <boost/type_traits/is_same.hpp>
|
||||||
|
#include <boost/type_traits/decay.hpp>
|
||||||
|
#include <boost/functional/hash.hpp>
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
#include <boost/chrono/system_clocks.hpp>
|
||||||
|
#include <boost/chrono/ceil.hpp>
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
#ifdef BOOST_MSVC
|
||||||
|
#pragma warning(push)
|
||||||
|
#pragma warning(disable:4251)
|
||||||
|
#endif
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
|
||||||
|
#ifndef BOOST_NO_RVALUE_REFERENCES
|
||||||
|
namespace thread_detail
|
||||||
|
{
|
||||||
|
template <class T>
|
||||||
|
typename decay<T>::type
|
||||||
|
decay_copy(T&& t)
|
||||||
|
{
|
||||||
|
return boost::forward<T>(t);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
namespace detail
|
||||||
|
{
|
||||||
|
template<typename F>
|
||||||
|
class thread_data:
|
||||||
|
public detail::thread_data_base
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
#ifndef BOOST_NO_RVALUE_REFERENCES
|
||||||
|
thread_data(F&& f_):
|
||||||
|
f(boost::forward<F>(f_))
|
||||||
|
{}
|
||||||
|
// This overloading must be removed if we want the packaged_task's tests to pass.
|
||||||
|
// thread_data(F& f_):
|
||||||
|
// f(f_)
|
||||||
|
// {}
|
||||||
|
#else
|
||||||
|
thread_data(F f_):
|
||||||
|
f(f_)
|
||||||
|
{}
|
||||||
|
#if defined BOOST_THREAD_USES_MOVE
|
||||||
|
thread_data(boost::rv<F>& f_):
|
||||||
|
f(boost::move(f_))
|
||||||
|
{}
|
||||||
|
#else
|
||||||
|
thread_data(detail::thread_move_t<F> f_):
|
||||||
|
f(f_)
|
||||||
|
{}
|
||||||
|
#endif
|
||||||
|
#endif
|
||||||
|
void run()
|
||||||
|
{
|
||||||
|
f();
|
||||||
|
}
|
||||||
|
private:
|
||||||
|
F f;
|
||||||
|
|
||||||
|
void operator=(thread_data&);
|
||||||
|
thread_data(thread_data&);
|
||||||
|
};
|
||||||
|
|
||||||
|
template<typename F>
|
||||||
|
class thread_data<boost::reference_wrapper<F> >:
|
||||||
|
public detail::thread_data_base
|
||||||
|
{
|
||||||
|
private:
|
||||||
|
F& f;
|
||||||
|
|
||||||
|
void operator=(thread_data&);
|
||||||
|
thread_data(thread_data&);
|
||||||
|
public:
|
||||||
|
thread_data(boost::reference_wrapper<F> f_):
|
||||||
|
f(f_)
|
||||||
|
{}
|
||||||
|
|
||||||
|
void run()
|
||||||
|
{
|
||||||
|
f();
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
template<typename F>
|
||||||
|
class thread_data<const boost::reference_wrapper<F> >:
|
||||||
|
public detail::thread_data_base
|
||||||
|
{
|
||||||
|
private:
|
||||||
|
F& f;
|
||||||
|
void operator=(thread_data&);
|
||||||
|
thread_data(thread_data&);
|
||||||
|
public:
|
||||||
|
thread_data(const boost::reference_wrapper<F> f_):
|
||||||
|
f(f_)
|
||||||
|
{}
|
||||||
|
|
||||||
|
void run()
|
||||||
|
{
|
||||||
|
f();
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
class BOOST_THREAD_DECL thread
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
typedef int boost_move_emulation_t;
|
||||||
|
typedef thread_attributes attributes;
|
||||||
|
|
||||||
|
#ifndef BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
public:
|
||||||
|
thread(thread const&) = delete;
|
||||||
|
thread& operator=(thread const&) = delete;
|
||||||
|
#else // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
// BOOST_MOVABLE_BUT_NOT_COPYABLE(thread)
|
||||||
|
|
||||||
|
#if defined BOOST_THREAD_USES_MOVE
|
||||||
|
private:
|
||||||
|
//thread(thread const&);
|
||||||
|
thread(thread &);
|
||||||
|
//thread& operator=(thread const&);
|
||||||
|
thread& operator=(thread &);
|
||||||
|
#else
|
||||||
|
private:
|
||||||
|
thread(thread&);
|
||||||
|
thread& operator=(thread&);
|
||||||
|
#endif
|
||||||
|
public:
|
||||||
|
#endif // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
|
||||||
|
void release_handle();
|
||||||
|
|
||||||
|
detail::thread_data_ptr thread_info;
|
||||||
|
|
||||||
|
void start_thread();
|
||||||
|
void start_thread(const attributes& attr);
|
||||||
|
|
||||||
|
explicit thread(detail::thread_data_ptr data);
|
||||||
|
|
||||||
|
detail::thread_data_ptr get_thread_info BOOST_PREVENT_MACRO_SUBSTITUTION () const;
|
||||||
|
|
||||||
|
#ifndef BOOST_NO_RVALUE_REFERENCES
|
||||||
|
template<typename F>
|
||||||
|
static inline detail::thread_data_ptr make_thread_info(F&& f)
|
||||||
|
{
|
||||||
|
return detail::thread_data_ptr(detail::heap_new<detail::thread_data<typename boost::remove_reference<F>::type> >(
|
||||||
|
boost::forward<F>(f)));
|
||||||
|
}
|
||||||
|
static inline detail::thread_data_ptr make_thread_info(void (*f)())
|
||||||
|
{
|
||||||
|
return detail::thread_data_ptr(detail::heap_new<detail::thread_data<void(*)()> >(
|
||||||
|
boost::forward<void(*)()>(f)));
|
||||||
|
}
|
||||||
|
#else
|
||||||
|
template<typename F>
|
||||||
|
static inline detail::thread_data_ptr make_thread_info(F f)
|
||||||
|
{
|
||||||
|
return detail::thread_data_ptr(detail::heap_new<detail::thread_data<F> >(f));
|
||||||
|
}
|
||||||
|
#if defined BOOST_THREAD_USES_MOVE
|
||||||
|
template<typename F>
|
||||||
|
static inline detail::thread_data_ptr make_thread_info(boost::rv<F>& f)
|
||||||
|
{
|
||||||
|
return detail::thread_data_ptr(detail::heap_new<detail::thread_data<F> >(boost::move(f)));
|
||||||
|
}
|
||||||
|
|
||||||
|
#else
|
||||||
|
template<typename F>
|
||||||
|
static inline detail::thread_data_ptr make_thread_info(boost::detail::thread_move_t<F> f)
|
||||||
|
{
|
||||||
|
return detail::thread_data_ptr(detail::heap_new<detail::thread_data<F> >(f));
|
||||||
|
}
|
||||||
|
|
||||||
|
#endif
|
||||||
|
#endif
|
||||||
|
struct dummy;
|
||||||
|
public:
|
||||||
|
#if BOOST_WORKAROUND(__SUNPRO_CC, < 0x5100)
|
||||||
|
thread(const volatile thread&);
|
||||||
|
#endif
|
||||||
|
thread() BOOST_NOEXCEPT;
|
||||||
|
~thread();
|
||||||
|
|
||||||
|
#ifndef BOOST_NO_RVALUE_REFERENCES
|
||||||
|
#ifdef BOOST_MSVCXX
|
||||||
|
template <class F>
|
||||||
|
explicit thread(F f,typename disable_if<boost::is_convertible<F&,detail::thread_move_t<F> >, dummy* >::type=0):
|
||||||
|
thread_info(make_thread_info(static_cast<F&&>(f)))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
#else
|
||||||
|
template <
|
||||||
|
class F
|
||||||
|
//, class Dummy = typename disable_if< is_same<typename decay<F>::type, thread> >::type
|
||||||
|
>
|
||||||
|
explicit thread(F&& f
|
||||||
|
, typename disable_if<is_same<typename decay<F>::type, thread>, dummy* >::type=0
|
||||||
|
):
|
||||||
|
thread_info(make_thread_info(thread_detail::decay_copy(boost::forward<F>(f))))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
template <
|
||||||
|
class F
|
||||||
|
//, class Dummy = typename disable_if< is_same<typename decay<F>::type, thread> >::type
|
||||||
|
>
|
||||||
|
thread(attributes& attrs, F&& f
|
||||||
|
, typename disable_if<is_same<typename decay<F>::type, thread>, dummy* >::type=0
|
||||||
|
):
|
||||||
|
thread_info(make_thread_info(thread_detail::decay_copy(boost::forward<F>(f))))
|
||||||
|
{
|
||||||
|
start_thread(attrs);
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
thread(thread&& other) BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
thread_info.swap(other.thread_info);
|
||||||
|
}
|
||||||
|
|
||||||
|
thread& operator=(thread&& other) BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
thread_info=other.thread_info;
|
||||||
|
other.thread_info.reset();
|
||||||
|
return *this;
|
||||||
|
}
|
||||||
|
|
||||||
|
// thread&& move()
|
||||||
|
// {
|
||||||
|
// return static_cast<thread&&>(*this);
|
||||||
|
// }
|
||||||
|
|
||||||
|
#else
|
||||||
|
#ifdef BOOST_NO_SFINAE
|
||||||
|
template <class F>
|
||||||
|
explicit thread(F f):
|
||||||
|
thread_info(make_thread_info(f))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
template <class F>
|
||||||
|
thread(attributes& attrs, F f):
|
||||||
|
thread_info(make_thread_info(f))
|
||||||
|
{
|
||||||
|
start_thread(attrs);
|
||||||
|
}
|
||||||
|
#else
|
||||||
|
#if defined BOOST_THREAD_USES_MOVE
|
||||||
|
template <class F>
|
||||||
|
explicit thread(F f,typename disable_if<boost::is_convertible<F&,boost::rv<F>& >, dummy* >::type=0):
|
||||||
|
thread_info(make_thread_info(f))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
template <class F>
|
||||||
|
thread(attributes& attrs, F f,typename disable_if<boost::is_convertible<F&,boost::rv<F>& >, dummy* >::type=0):
|
||||||
|
thread_info(make_thread_info(f))
|
||||||
|
{
|
||||||
|
start_thread(attrs);
|
||||||
|
}
|
||||||
|
#else
|
||||||
|
template <class F>
|
||||||
|
explicit thread(F f,typename disable_if<boost::is_convertible<F&,detail::thread_move_t<F> >, dummy* >::type=0):
|
||||||
|
thread_info(make_thread_info(f))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
template <class F>
|
||||||
|
thread(attributes& attrs, F f,typename disable_if<boost::is_convertible<F&,detail::thread_move_t<F> >, dummy* >::type=0):
|
||||||
|
thread_info(make_thread_info(f))
|
||||||
|
{
|
||||||
|
start_thread(attrs);
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if defined BOOST_THREAD_USES_MOVE
|
||||||
|
template <class F>
|
||||||
|
explicit thread(boost::rv<F>& f):
|
||||||
|
thread_info(make_thread_info(boost::move(f)))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
// explicit thread(void (*f)()):
|
||||||
|
// thread_info(make_thread_info(f))
|
||||||
|
// {
|
||||||
|
// start_thread();
|
||||||
|
// }
|
||||||
|
//
|
||||||
|
// template <class F>
|
||||||
|
// explicit thread(BOOST_FWD_REF(F) f):
|
||||||
|
// thread_info(make_thread_info(boost::forward<F>(f)))
|
||||||
|
// {
|
||||||
|
// start_thread();
|
||||||
|
// }
|
||||||
|
|
||||||
|
template <class F>
|
||||||
|
thread(attributes& attrs, boost::rv<F>& f):
|
||||||
|
thread_info(make_thread_info(boost::move(f)))
|
||||||
|
{
|
||||||
|
start_thread(attrs);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
thread(boost::rv<thread>& x)
|
||||||
|
//thread(BOOST_RV_REF(thread) x)
|
||||||
|
{
|
||||||
|
thread_info=x.thread_info;
|
||||||
|
x.thread_info.reset();
|
||||||
|
}
|
||||||
|
#else
|
||||||
|
template <class F>
|
||||||
|
explicit thread(detail::thread_move_t<F> f):
|
||||||
|
thread_info(make_thread_info(f))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class F>
|
||||||
|
thread(attributes& attrs, detail::thread_move_t<F> f):
|
||||||
|
thread_info(make_thread_info(f))
|
||||||
|
{
|
||||||
|
start_thread(attrs);
|
||||||
|
}
|
||||||
|
|
||||||
|
thread(detail::thread_move_t<thread> x)
|
||||||
|
{
|
||||||
|
thread_info=x->thread_info;
|
||||||
|
x->thread_info.reset();
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if BOOST_WORKAROUND(__SUNPRO_CC, < 0x5100)
|
||||||
|
thread& operator=(thread x)
|
||||||
|
{
|
||||||
|
swap(x);
|
||||||
|
return *this;
|
||||||
|
}
|
||||||
|
#else
|
||||||
|
#if defined BOOST_THREAD_USES_MOVE
|
||||||
|
thread& operator=(boost::rv<thread>& x)
|
||||||
|
{
|
||||||
|
thread new_thread(boost::move(x));
|
||||||
|
swap(new_thread);
|
||||||
|
return *this;
|
||||||
|
}
|
||||||
|
#else
|
||||||
|
thread& operator=(detail::thread_move_t<thread> x)
|
||||||
|
{
|
||||||
|
thread new_thread(x);
|
||||||
|
swap(new_thread);
|
||||||
|
return *this;
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if defined BOOST_THREAD_USES_MOVE
|
||||||
|
operator ::boost::rv<thread>&()
|
||||||
|
{
|
||||||
|
return *static_cast< ::boost::rv<thread>* >(this);
|
||||||
|
}
|
||||||
|
operator const ::boost::rv<thread>&() const
|
||||||
|
{
|
||||||
|
return *static_cast<const ::boost::rv<thread>* >(this);
|
||||||
|
}
|
||||||
|
#else
|
||||||
|
operator detail::thread_move_t<thread>()
|
||||||
|
{
|
||||||
|
return move();
|
||||||
|
}
|
||||||
|
|
||||||
|
detail::thread_move_t<thread> move()
|
||||||
|
{
|
||||||
|
detail::thread_move_t<thread> x(*this);
|
||||||
|
return x;
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#endif
|
||||||
|
|
||||||
|
template <class F,class A1>
|
||||||
|
thread(F f,A1 a1,typename disable_if<boost::is_convertible<F&,thread_attributes >, dummy* >::type=0):
|
||||||
|
thread_info(make_thread_info(boost::bind(boost::type<void>(),f,a1)))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
template <class F,class A1,class A2>
|
||||||
|
thread(F f,A1 a1,A2 a2):
|
||||||
|
thread_info(make_thread_info(boost::bind(boost::type<void>(),f,a1,a2)))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class F,class A1,class A2,class A3>
|
||||||
|
thread(F f,A1 a1,A2 a2,A3 a3):
|
||||||
|
thread_info(make_thread_info(boost::bind(boost::type<void>(),f,a1,a2,a3)))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class F,class A1,class A2,class A3,class A4>
|
||||||
|
thread(F f,A1 a1,A2 a2,A3 a3,A4 a4):
|
||||||
|
thread_info(make_thread_info(boost::bind(boost::type<void>(),f,a1,a2,a3,a4)))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class F,class A1,class A2,class A3,class A4,class A5>
|
||||||
|
thread(F f,A1 a1,A2 a2,A3 a3,A4 a4,A5 a5):
|
||||||
|
thread_info(make_thread_info(boost::bind(boost::type<void>(),f,a1,a2,a3,a4,a5)))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class F,class A1,class A2,class A3,class A4,class A5,class A6>
|
||||||
|
thread(F f,A1 a1,A2 a2,A3 a3,A4 a4,A5 a5,A6 a6):
|
||||||
|
thread_info(make_thread_info(boost::bind(boost::type<void>(),f,a1,a2,a3,a4,a5,a6)))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class F,class A1,class A2,class A3,class A4,class A5,class A6,class A7>
|
||||||
|
thread(F f,A1 a1,A2 a2,A3 a3,A4 a4,A5 a5,A6 a6,A7 a7):
|
||||||
|
thread_info(make_thread_info(boost::bind(boost::type<void>(),f,a1,a2,a3,a4,a5,a6,a7)))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class F,class A1,class A2,class A3,class A4,class A5,class A6,class A7,class A8>
|
||||||
|
thread(F f,A1 a1,A2 a2,A3 a3,A4 a4,A5 a5,A6 a6,A7 a7,A8 a8):
|
||||||
|
thread_info(make_thread_info(boost::bind(boost::type<void>(),f,a1,a2,a3,a4,a5,a6,a7,a8)))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class F,class A1,class A2,class A3,class A4,class A5,class A6,class A7,class A8,class A9>
|
||||||
|
thread(F f,A1 a1,A2 a2,A3 a3,A4 a4,A5 a5,A6 a6,A7 a7,A8 a8,A9 a9):
|
||||||
|
thread_info(make_thread_info(boost::bind(boost::type<void>(),f,a1,a2,a3,a4,a5,a6,a7,a8,a9)))
|
||||||
|
{
|
||||||
|
start_thread();
|
||||||
|
}
|
||||||
|
|
||||||
|
void swap(thread& x) BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
thread_info.swap(x.thread_info);
|
||||||
|
}
|
||||||
|
|
||||||
|
class BOOST_SYMBOL_VISIBLE id;
|
||||||
|
id get_id() const BOOST_NOEXCEPT;
|
||||||
|
|
||||||
|
|
||||||
|
bool joinable() const BOOST_NOEXCEPT;
|
||||||
|
void join();
|
||||||
|
#if defined(BOOST_THREAD_PLATFORM_WIN32)
|
||||||
|
bool timed_join(const system_time& abs_time);
|
||||||
|
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
template <class Rep, class Period>
|
||||||
|
bool try_join_for(const chrono::duration<Rep, Period>& rel_time)
|
||||||
|
{
|
||||||
|
return try_join_until(chrono::steady_clock::now() + rel_time);
|
||||||
|
}
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
bool try_join_until(const chrono::time_point<Clock, Duration>& t)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
system_clock::time_point s_now = system_clock::now();
|
||||||
|
typename Clock::time_point c_now = Clock::now();
|
||||||
|
return try_join_until(s_now + ceil<nanoseconds>(t - c_now));
|
||||||
|
}
|
||||||
|
template <class Duration>
|
||||||
|
bool try_join_until(const chrono::time_point<chrono::system_clock, Duration>& t)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
typedef time_point<system_clock, nanoseconds> nano_sys_tmpt;
|
||||||
|
return try_join_until(nano_sys_tmpt(ceil<nanoseconds>(t.time_since_epoch())));
|
||||||
|
}
|
||||||
|
bool try_join_until(const chrono::time_point<chrono::system_clock, chrono::nanoseconds>& tp);
|
||||||
|
#endif
|
||||||
|
public:
|
||||||
|
|
||||||
|
#else
|
||||||
|
bool timed_join(const system_time& abs_time) {
|
||||||
|
struct timespec const ts=detail::get_timespec(abs_time);
|
||||||
|
return do_try_join_until(ts);
|
||||||
|
}
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
template <class Rep, class Period>
|
||||||
|
bool try_join_for(const chrono::duration<Rep, Period>& rel_time)
|
||||||
|
{
|
||||||
|
return try_join_until(chrono::steady_clock::now() + rel_time);
|
||||||
|
}
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
bool try_join_until(const chrono::time_point<Clock, Duration>& t)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
system_clock::time_point s_now = system_clock::now();
|
||||||
|
typename Clock::time_point c_now = Clock::now();
|
||||||
|
return try_join_until(s_now + ceil<nanoseconds>(t - c_now));
|
||||||
|
}
|
||||||
|
template <class Duration>
|
||||||
|
bool try_join_until(const chrono::time_point<chrono::system_clock, Duration>& t)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
typedef time_point<system_clock, nanoseconds> nano_sys_tmpt;
|
||||||
|
return try_join_until(nano_sys_tmpt(ceil<nanoseconds>(t.time_since_epoch())));
|
||||||
|
}
|
||||||
|
bool try_join_until(const chrono::time_point<chrono::system_clock, chrono::nanoseconds>& tp)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
nanoseconds d = tp.time_since_epoch();
|
||||||
|
timespec ts;
|
||||||
|
seconds s = duration_cast<seconds>(d);
|
||||||
|
ts.tv_sec = static_cast<long>(s.count());
|
||||||
|
ts.tv_nsec = static_cast<long>((d - s).count());
|
||||||
|
return do_try_join_until(ts);
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
private:
|
||||||
|
bool do_try_join_until(struct timespec const &timeout);
|
||||||
|
public:
|
||||||
|
|
||||||
|
#endif
|
||||||
|
|
||||||
|
template<typename TimeDuration>
|
||||||
|
inline bool timed_join(TimeDuration const& rel_time)
|
||||||
|
{
|
||||||
|
return timed_join(get_system_time()+rel_time);
|
||||||
|
}
|
||||||
|
|
||||||
|
void detach();
|
||||||
|
|
||||||
|
static unsigned hardware_concurrency() BOOST_NOEXCEPT;
|
||||||
|
|
||||||
|
#define BOOST_THREAD_DEFINES_THREAD_NATIVE_HANDLE
|
||||||
|
typedef detail::thread_data_base::native_handle_type native_handle_type;
|
||||||
|
native_handle_type native_handle();
|
||||||
|
|
||||||
|
// backwards compatibility
|
||||||
|
bool operator==(const thread& other) const;
|
||||||
|
bool operator!=(const thread& other) const;
|
||||||
|
|
||||||
|
static inline void yield() BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
this_thread::yield();
|
||||||
|
}
|
||||||
|
|
||||||
|
static inline void sleep(const system_time& xt)
|
||||||
|
{
|
||||||
|
this_thread::sleep(xt);
|
||||||
|
}
|
||||||
|
|
||||||
|
// extensions
|
||||||
|
void interrupt();
|
||||||
|
bool interruption_requested() const;
|
||||||
|
};
|
||||||
|
|
||||||
|
inline void swap(thread& lhs,thread& rhs) BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
return lhs.swap(rhs);
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifndef BOOST_NO_RVALUE_REFERENCES
|
||||||
|
inline thread&& move(thread& t)
|
||||||
|
{
|
||||||
|
return static_cast<thread&&>(t);
|
||||||
|
}
|
||||||
|
inline thread&& move(thread&& t)
|
||||||
|
{
|
||||||
|
return static_cast<thread&&>(t);
|
||||||
|
}
|
||||||
|
#else
|
||||||
|
#if !defined BOOST_THREAD_USES_MOVE
|
||||||
|
inline detail::thread_move_t<thread> move(detail::thread_move_t<thread> t)
|
||||||
|
{
|
||||||
|
return t;
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#ifdef BOOST_NO_RVALUE_REFERENCES
|
||||||
|
#if !defined BOOST_THREAD_USES_MOVE
|
||||||
|
template <>
|
||||||
|
struct has_move_emulation_enabled_aux<thread>
|
||||||
|
: BOOST_MOVE_BOOST_NS::integral_constant<bool, true>
|
||||||
|
{};
|
||||||
|
#endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
namespace this_thread
|
||||||
|
{
|
||||||
|
thread::id BOOST_THREAD_DECL get_id() BOOST_NOEXCEPT;
|
||||||
|
|
||||||
|
void BOOST_THREAD_DECL interruption_point();
|
||||||
|
bool BOOST_THREAD_DECL interruption_enabled();
|
||||||
|
bool BOOST_THREAD_DECL interruption_requested();
|
||||||
|
|
||||||
|
inline BOOST_SYMBOL_VISIBLE void sleep(xtime const& abs_time)
|
||||||
|
{
|
||||||
|
sleep(system_time(abs_time));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
class BOOST_SYMBOL_VISIBLE thread::id
|
||||||
|
{
|
||||||
|
private:
|
||||||
|
friend inline
|
||||||
|
std::size_t
|
||||||
|
hash_value(const thread::id &v)
|
||||||
|
{
|
||||||
|
return hash_value(v.thread_data.get());
|
||||||
|
}
|
||||||
|
|
||||||
|
detail::thread_data_ptr thread_data;
|
||||||
|
|
||||||
|
id(detail::thread_data_ptr thread_data_):
|
||||||
|
thread_data(thread_data_)
|
||||||
|
{}
|
||||||
|
friend class thread;
|
||||||
|
friend id BOOST_THREAD_DECL this_thread::get_id() BOOST_NOEXCEPT;
|
||||||
|
public:
|
||||||
|
id() BOOST_NOEXCEPT:
|
||||||
|
thread_data()
|
||||||
|
{}
|
||||||
|
|
||||||
|
id(const id& other) BOOST_NOEXCEPT :
|
||||||
|
thread_data(other.thread_data)
|
||||||
|
{}
|
||||||
|
|
||||||
|
bool operator==(const id& y) const BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
return thread_data==y.thread_data;
|
||||||
|
}
|
||||||
|
|
||||||
|
bool operator!=(const id& y) const BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
return thread_data!=y.thread_data;
|
||||||
|
}
|
||||||
|
|
||||||
|
bool operator<(const id& y) const BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
return thread_data<y.thread_data;
|
||||||
|
}
|
||||||
|
|
||||||
|
bool operator>(const id& y) const BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
return y.thread_data<thread_data;
|
||||||
|
}
|
||||||
|
|
||||||
|
bool operator<=(const id& y) const BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
return !(y.thread_data<thread_data);
|
||||||
|
}
|
||||||
|
|
||||||
|
bool operator>=(const id& y) const BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
return !(thread_data<y.thread_data);
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifndef BOOST_NO_IOSTREAM
|
||||||
|
#ifndef BOOST_NO_MEMBER_TEMPLATE_FRIENDS
|
||||||
|
template<class charT, class traits>
|
||||||
|
friend BOOST_SYMBOL_VISIBLE
|
||||||
|
std::basic_ostream<charT, traits>&
|
||||||
|
operator<<(std::basic_ostream<charT, traits>& os, const id& x)
|
||||||
|
{
|
||||||
|
if(x.thread_data)
|
||||||
|
{
|
||||||
|
io::ios_flags_saver ifs( os );
|
||||||
|
return os<< std::hex << x.thread_data;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
return os<<"{Not-any-thread}";
|
||||||
|
}
|
||||||
|
}
|
||||||
|
#else
|
||||||
|
template<class charT, class traits>
|
||||||
|
BOOST_SYMBOL_VISIBLE
|
||||||
|
std::basic_ostream<charT, traits>&
|
||||||
|
print(std::basic_ostream<charT, traits>& os) const
|
||||||
|
{
|
||||||
|
if(thread_data)
|
||||||
|
{
|
||||||
|
return os<<thread_data;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
return os<<"{Not-any-thread}";
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#endif
|
||||||
|
#endif
|
||||||
|
};
|
||||||
|
|
||||||
|
#if !defined(BOOST_NO_IOSTREAM) && defined(BOOST_NO_MEMBER_TEMPLATE_FRIENDS)
|
||||||
|
template<class charT, class traits>
|
||||||
|
BOOST_SYMBOL_VISIBLE
|
||||||
|
std::basic_ostream<charT, traits>&
|
||||||
|
operator<<(std::basic_ostream<charT, traits>& os, const thread::id& x)
|
||||||
|
{
|
||||||
|
return x.print(os);
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
inline bool thread::operator==(const thread& other) const
|
||||||
|
{
|
||||||
|
return get_id()==other.get_id();
|
||||||
|
}
|
||||||
|
|
||||||
|
inline bool thread::operator!=(const thread& other) const
|
||||||
|
{
|
||||||
|
return get_id()!=other.get_id();
|
||||||
|
}
|
||||||
|
|
||||||
|
namespace detail
|
||||||
|
{
|
||||||
|
struct thread_exit_function_base
|
||||||
|
{
|
||||||
|
virtual ~thread_exit_function_base()
|
||||||
|
{}
|
||||||
|
virtual void operator()()=0;
|
||||||
|
};
|
||||||
|
|
||||||
|
template<typename F>
|
||||||
|
struct thread_exit_function:
|
||||||
|
thread_exit_function_base
|
||||||
|
{
|
||||||
|
F f;
|
||||||
|
|
||||||
|
thread_exit_function(F f_):
|
||||||
|
f(f_)
|
||||||
|
{}
|
||||||
|
|
||||||
|
void operator()()
|
||||||
|
{
|
||||||
|
f();
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
void BOOST_THREAD_DECL add_thread_exit_function(thread_exit_function_base*);
|
||||||
|
}
|
||||||
|
|
||||||
|
namespace this_thread
|
||||||
|
{
|
||||||
|
template<typename F>
|
||||||
|
void at_thread_exit(F f)
|
||||||
|
{
|
||||||
|
detail::thread_exit_function_base* const thread_exit_func=detail::heap_new<detail::thread_exit_function<F> >(f);
|
||||||
|
detail::add_thread_exit_function(thread_exit_func);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifdef BOOST_MSVC
|
||||||
|
#pragma warning(pop)
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
108
include/boost/thread/detail/thread_group.hpp
Normal file
108
include/boost/thread/detail/thread_group.hpp
Normal file
@@ -0,0 +1,108 @@
|
|||||||
|
#ifndef BOOST_THREAD_DETAIL_THREAD_GROUP_HPP
|
||||||
|
#define BOOST_THREAD_DETAIL_THREAD_GROUP_HPP
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
// (C) Copyright 2007-9 Anthony Williams
|
||||||
|
|
||||||
|
#include <list>
|
||||||
|
#include <boost/thread/shared_mutex.hpp>
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
#ifdef BOOST_MSVC
|
||||||
|
#pragma warning(push)
|
||||||
|
#pragma warning(disable:4251)
|
||||||
|
#endif
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
class thread_group
|
||||||
|
{
|
||||||
|
private:
|
||||||
|
thread_group(thread_group const&);
|
||||||
|
thread_group& operator=(thread_group const&);
|
||||||
|
public:
|
||||||
|
thread_group() {}
|
||||||
|
~thread_group()
|
||||||
|
{
|
||||||
|
for(std::list<thread*>::iterator it=threads.begin(),end=threads.end();
|
||||||
|
it!=end;
|
||||||
|
++it)
|
||||||
|
{
|
||||||
|
delete *it;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename F>
|
||||||
|
thread* create_thread(F threadfunc)
|
||||||
|
{
|
||||||
|
boost::lock_guard<shared_mutex> guard(m);
|
||||||
|
std::auto_ptr<thread> new_thread(new thread(threadfunc));
|
||||||
|
threads.push_back(new_thread.get());
|
||||||
|
return new_thread.release();
|
||||||
|
}
|
||||||
|
|
||||||
|
void add_thread(thread* thrd)
|
||||||
|
{
|
||||||
|
if(thrd)
|
||||||
|
{
|
||||||
|
boost::lock_guard<shared_mutex> guard(m);
|
||||||
|
threads.push_back(thrd);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
void remove_thread(thread* thrd)
|
||||||
|
{
|
||||||
|
boost::lock_guard<shared_mutex> guard(m);
|
||||||
|
std::list<thread*>::iterator const it=std::find(threads.begin(),threads.end(),thrd);
|
||||||
|
if(it!=threads.end())
|
||||||
|
{
|
||||||
|
threads.erase(it);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
void join_all()
|
||||||
|
{
|
||||||
|
boost::shared_lock<shared_mutex> guard(m);
|
||||||
|
|
||||||
|
for(std::list<thread*>::iterator it=threads.begin(),end=threads.end();
|
||||||
|
it!=end;
|
||||||
|
++it)
|
||||||
|
{
|
||||||
|
(*it)->join();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
void interrupt_all()
|
||||||
|
{
|
||||||
|
boost::shared_lock<shared_mutex> guard(m);
|
||||||
|
|
||||||
|
for(std::list<thread*>::iterator it=threads.begin(),end=threads.end();
|
||||||
|
it!=end;
|
||||||
|
++it)
|
||||||
|
{
|
||||||
|
(*it)->interrupt();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
size_t size() const
|
||||||
|
{
|
||||||
|
boost::shared_lock<shared_mutex> guard(m);
|
||||||
|
return threads.size();
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
std::list<thread*> threads;
|
||||||
|
mutable shared_mutex m;
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifdef BOOST_MSVC
|
||||||
|
#pragma warning(pop)
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
23
include/boost/thread/detail/thread_heap_alloc.hpp
Normal file
23
include/boost/thread/detail/thread_heap_alloc.hpp
Normal file
@@ -0,0 +1,23 @@
|
|||||||
|
#ifndef BOOST_THREAD_THREAD_HEAP_ALLOC_HPP
|
||||||
|
#define BOOST_THREAD_THREAD_HEAP_ALLOC_HPP
|
||||||
|
|
||||||
|
// thread_heap_alloc.hpp
|
||||||
|
//
|
||||||
|
// (C) Copyright 2008 Anthony Williams
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/thread/detail/platform.hpp>
|
||||||
|
|
||||||
|
#if defined(BOOST_THREAD_PLATFORM_WIN32)
|
||||||
|
#include <boost/thread/win32/thread_heap_alloc.hpp>
|
||||||
|
#elif defined(BOOST_THREAD_PLATFORM_PTHREAD)
|
||||||
|
#include <boost/thread/pthread/thread_heap_alloc.hpp>
|
||||||
|
#else
|
||||||
|
#error "Boost threads unavailable on this platform"
|
||||||
|
#endif
|
||||||
|
|
||||||
|
|
||||||
|
#endif
|
||||||
35
include/boost/thread/detail/thread_interruption.hpp
Normal file
35
include/boost/thread/detail/thread_interruption.hpp
Normal file
@@ -0,0 +1,35 @@
|
|||||||
|
#ifndef BOOST_THREAD_DETAIL_THREAD_INTERRUPTION_HPP
|
||||||
|
#define BOOST_THREAD_DETAIL_THREAD_INTERRUPTION_HPP
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
// (C) Copyright 2007-9 Anthony Williams
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
namespace this_thread
|
||||||
|
{
|
||||||
|
class BOOST_THREAD_DECL disable_interruption
|
||||||
|
{
|
||||||
|
disable_interruption(const disable_interruption&);
|
||||||
|
disable_interruption& operator=(const disable_interruption&);
|
||||||
|
|
||||||
|
bool interruption_was_enabled;
|
||||||
|
friend class restore_interruption;
|
||||||
|
public:
|
||||||
|
disable_interruption();
|
||||||
|
~disable_interruption();
|
||||||
|
};
|
||||||
|
|
||||||
|
class BOOST_THREAD_DECL restore_interruption
|
||||||
|
{
|
||||||
|
restore_interruption(const restore_interruption&);
|
||||||
|
restore_interruption& operator=(const restore_interruption&);
|
||||||
|
public:
|
||||||
|
explicit restore_interruption(disable_interruption& d);
|
||||||
|
~restore_interruption();
|
||||||
|
};
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#endif
|
||||||
65
include/boost/thread/detail/tss_hooks.hpp
Normal file
65
include/boost/thread/detail/tss_hooks.hpp
Normal file
@@ -0,0 +1,65 @@
|
|||||||
|
// (C) Copyright Michael Glassford 2004.
|
||||||
|
// Use, modification and distribution are subject to the
|
||||||
|
// Boost Software License, Version 1.0. (See accompanying file
|
||||||
|
// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#if !defined(BOOST_TLS_HOOKS_HPP)
|
||||||
|
#define BOOST_TLS_HOOKS_HPP
|
||||||
|
|
||||||
|
#include <boost/thread/detail/config.hpp>
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
#if defined(BOOST_HAS_WINTHREADS)
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
BOOST_THREAD_DECL void __cdecl on_process_enter(void);
|
||||||
|
//Function to be called when the exe or dll
|
||||||
|
//that uses Boost.Threads first starts
|
||||||
|
//or is first loaded.
|
||||||
|
//Should be called only before the first call to
|
||||||
|
//on_thread_enter().
|
||||||
|
//Called automatically by Boost.Threads when
|
||||||
|
//a method for doing so has been discovered.
|
||||||
|
//May be omitted; may be called multiple times.
|
||||||
|
|
||||||
|
BOOST_THREAD_DECL void __cdecl on_process_exit(void);
|
||||||
|
//Function to be called when the exe or dll
|
||||||
|
//that uses Boost.Threads first starts
|
||||||
|
//or is first loaded.
|
||||||
|
//Should be called only after the last call to
|
||||||
|
//on_exit_thread().
|
||||||
|
//Called automatically by Boost.Threads when
|
||||||
|
//a method for doing so has been discovered.
|
||||||
|
//Must not be omitted; may be called multiple times.
|
||||||
|
|
||||||
|
BOOST_THREAD_DECL void __cdecl on_thread_enter(void);
|
||||||
|
//Function to be called just after a thread starts
|
||||||
|
//in an exe or dll that uses Boost.Threads.
|
||||||
|
//Must be called in the context of the thread
|
||||||
|
//that is starting.
|
||||||
|
//Called automatically by Boost.Threads when
|
||||||
|
//a method for doing so has been discovered.
|
||||||
|
//May be omitted; may be called multiple times.
|
||||||
|
|
||||||
|
BOOST_THREAD_DECL void __cdecl on_thread_exit(void);
|
||||||
|
//Function to be called just be fore a thread ends
|
||||||
|
//in an exe or dll that uses Boost.Threads.
|
||||||
|
//Must be called in the context of the thread
|
||||||
|
//that is ending.
|
||||||
|
//Called automatically by Boost.Threads when
|
||||||
|
//a method for doing so has been discovered.
|
||||||
|
//Must not be omitted; may be called multiple times.
|
||||||
|
|
||||||
|
void tss_cleanup_implemented();
|
||||||
|
//Dummy function used both to detect whether tss cleanup
|
||||||
|
//cleanup has been implemented and to force
|
||||||
|
//it to be linked into the Boost.Threads library.
|
||||||
|
}
|
||||||
|
|
||||||
|
#endif //defined(BOOST_HAS_WINTHREADS)
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif //!defined(BOOST_TLS_HOOKS_HPP)
|
||||||
@@ -1,46 +1,222 @@
|
|||||||
// Copyright (C) 2001
|
// Copyright (C) 2001-2003
|
||||||
// William E. Kempf
|
// William E. Kempf
|
||||||
|
// Copyright (C) 2007-9 Anthony Williams
|
||||||
//
|
//
|
||||||
// Permission to use, copy, modify, distribute and sell this software
|
// Distributed under the Boost Software License, Version 1.0. (See accompanying
|
||||||
// and its documentation for any purpose is hereby granted without fee,
|
// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
|
||||||
// provided that the above copyright notice appear in all copies and
|
|
||||||
// that both that copyright notice and this permission notice appear
|
|
||||||
// in supporting documentation. William E. Kempf makes no representations
|
|
||||||
// about the suitability of this software for any purpose.
|
|
||||||
// It is provided "as is" without express or implied warranty.
|
|
||||||
|
|
||||||
// This file is used to configure Boost.Threads during development
|
|
||||||
// in order to decouple dependency on any Boost release. Once
|
|
||||||
// accepted into Boost these contents will be moved to <boost/config>
|
|
||||||
// or some other appropriate build configuration and all
|
|
||||||
// #include <boost/thread/config.hpp> statements will be changed
|
|
||||||
// accordingly.
|
|
||||||
|
|
||||||
#ifndef BOOST_THREAD_EXCEPTIONS_PDM070801_H
|
#ifndef BOOST_THREAD_EXCEPTIONS_PDM070801_H
|
||||||
#define BOOST_THREAD_EXCEPTIONS_PDM070801_H
|
#define BOOST_THREAD_EXCEPTIONS_PDM070801_H
|
||||||
|
|
||||||
|
#include <boost/thread/detail/config.hpp>
|
||||||
|
|
||||||
// pdm: Sorry, but this class is used all over the place & I end up
|
// pdm: Sorry, but this class is used all over the place & I end up
|
||||||
// with recursive headers if I don't separate it
|
// with recursive headers if I don't separate it
|
||||||
// wek: Not sure why recursive headers would cause compilation problems
|
// wek: Not sure why recursive headers would cause compilation problems
|
||||||
// given the include guards, but regardless it makes sense to
|
// given the include guards, but regardless it makes sense to
|
||||||
// seperate this out any way.
|
// seperate this out any way.
|
||||||
|
|
||||||
|
#include <string>
|
||||||
#include <stdexcept>
|
#include <stdexcept>
|
||||||
|
#include <boost/system/system_error.hpp>
|
||||||
|
#include <boost/system/error_code.hpp>
|
||||||
|
|
||||||
namespace boost {
|
|
||||||
|
|
||||||
class lock_error : public std::runtime_error
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
{
|
{
|
||||||
public:
|
|
||||||
lock_error() : std::runtime_error("thread lock error") { }
|
|
||||||
};
|
|
||||||
|
|
||||||
class thread_resource_error : public std::runtime_error
|
class BOOST_SYMBOL_VISIBLE thread_interrupted
|
||||||
{
|
{};
|
||||||
public:
|
|
||||||
thread_resource_error() : std::runtime_error("thread resource error") { }
|
class BOOST_SYMBOL_VISIBLE thread_exception:
|
||||||
};
|
public system::system_error
|
||||||
|
//public std::exception
|
||||||
|
{
|
||||||
|
typedef system::system_error base_type;
|
||||||
|
public:
|
||||||
|
thread_exception()
|
||||||
|
: base_type(0,system::system_category())
|
||||||
|
{}
|
||||||
|
|
||||||
|
thread_exception(int sys_error_code)
|
||||||
|
: base_type(sys_error_code, system::system_category())
|
||||||
|
{}
|
||||||
|
|
||||||
|
thread_exception( int ev, const char * what_arg )
|
||||||
|
: base_type(system::error_code(ev, system::system_category()), what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
thread_exception( int ev, const std::string & what_arg )
|
||||||
|
: base_type(system::error_code(ev, system::system_category()), what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
|
||||||
|
~thread_exception() throw()
|
||||||
|
{}
|
||||||
|
|
||||||
|
|
||||||
|
int native_error() const
|
||||||
|
{
|
||||||
|
return code().value();
|
||||||
|
}
|
||||||
|
|
||||||
|
};
|
||||||
|
|
||||||
|
class BOOST_SYMBOL_VISIBLE condition_error:
|
||||||
|
public system::system_error
|
||||||
|
//public std::exception
|
||||||
|
{
|
||||||
|
typedef system::system_error base_type;
|
||||||
|
public:
|
||||||
|
condition_error()
|
||||||
|
: base_type(system::error_code(0, system::system_category()), "Condition error")
|
||||||
|
{}
|
||||||
|
condition_error( int ev )
|
||||||
|
: base_type(system::error_code(ev, system::system_category()), "Condition error")
|
||||||
|
{
|
||||||
|
}
|
||||||
|
condition_error( int ev, const char * what_arg )
|
||||||
|
: base_type(system::error_code(ev, system::system_category()), what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
condition_error( int ev, const std::string & what_arg )
|
||||||
|
: base_type(system::error_code(ev, system::system_category()), what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
class BOOST_SYMBOL_VISIBLE lock_error:
|
||||||
|
public thread_exception
|
||||||
|
{
|
||||||
|
typedef thread_exception base_type;
|
||||||
|
public:
|
||||||
|
lock_error()
|
||||||
|
: base_type(0, "boost::lock_error")
|
||||||
|
{}
|
||||||
|
|
||||||
|
lock_error( int ev )
|
||||||
|
: base_type(ev, "boost::lock_error")
|
||||||
|
{
|
||||||
|
}
|
||||||
|
lock_error( int ev, const char * what_arg )
|
||||||
|
: base_type(ev, what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
lock_error( int ev, const std::string & what_arg )
|
||||||
|
: base_type(ev, what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
|
||||||
|
~lock_error() throw()
|
||||||
|
{}
|
||||||
|
|
||||||
|
};
|
||||||
|
|
||||||
|
class BOOST_SYMBOL_VISIBLE thread_resource_error:
|
||||||
|
public thread_exception
|
||||||
|
{
|
||||||
|
typedef thread_exception base_type;
|
||||||
|
public:
|
||||||
|
thread_resource_error()
|
||||||
|
: base_type(system::errc::resource_unavailable_try_again, "boost::thread_resource_error")
|
||||||
|
{}
|
||||||
|
|
||||||
|
thread_resource_error( int ev )
|
||||||
|
: base_type(ev, "boost::thread_resource_error")
|
||||||
|
{
|
||||||
|
}
|
||||||
|
thread_resource_error( int ev, const char * what_arg )
|
||||||
|
: base_type(ev, what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
thread_resource_error( int ev, const std::string & what_arg )
|
||||||
|
: base_type(ev, what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
~thread_resource_error() throw()
|
||||||
|
{}
|
||||||
|
|
||||||
|
};
|
||||||
|
|
||||||
|
class BOOST_SYMBOL_VISIBLE unsupported_thread_option:
|
||||||
|
public thread_exception
|
||||||
|
{
|
||||||
|
typedef thread_exception base_type;
|
||||||
|
public:
|
||||||
|
unsupported_thread_option()
|
||||||
|
: base_type(system::errc::invalid_argument, "boost::unsupported_thread_option")
|
||||||
|
{}
|
||||||
|
|
||||||
|
unsupported_thread_option( int ev )
|
||||||
|
: base_type(ev, "boost::unsupported_thread_option")
|
||||||
|
{
|
||||||
|
}
|
||||||
|
unsupported_thread_option( int ev, const char * what_arg )
|
||||||
|
: base_type(ev, what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
unsupported_thread_option( int ev, const std::string & what_arg )
|
||||||
|
: base_type(ev, what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
|
||||||
|
};
|
||||||
|
|
||||||
|
class BOOST_SYMBOL_VISIBLE invalid_thread_argument:
|
||||||
|
public thread_exception
|
||||||
|
{
|
||||||
|
typedef thread_exception base_type;
|
||||||
|
public:
|
||||||
|
invalid_thread_argument()
|
||||||
|
: base_type(system::errc::invalid_argument, "boost::invalid_thread_argument")
|
||||||
|
{}
|
||||||
|
|
||||||
|
invalid_thread_argument( int ev )
|
||||||
|
: base_type(ev, "boost::invalid_thread_argument")
|
||||||
|
{
|
||||||
|
}
|
||||||
|
invalid_thread_argument( int ev, const char * what_arg )
|
||||||
|
: base_type(ev, what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
invalid_thread_argument( int ev, const std::string & what_arg )
|
||||||
|
: base_type(ev, what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
|
||||||
|
};
|
||||||
|
|
||||||
|
class BOOST_SYMBOL_VISIBLE thread_permission_error:
|
||||||
|
public thread_exception
|
||||||
|
{
|
||||||
|
typedef thread_exception base_type;
|
||||||
|
public:
|
||||||
|
thread_permission_error()
|
||||||
|
: base_type(system::errc::permission_denied, "boost::thread_permission_error")
|
||||||
|
{}
|
||||||
|
|
||||||
|
thread_permission_error( int ev )
|
||||||
|
: base_type(ev, "boost::thread_permission_error")
|
||||||
|
{
|
||||||
|
}
|
||||||
|
thread_permission_error( int ev, const char * what_arg )
|
||||||
|
: base_type(ev, what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
thread_permission_error( int ev, const std::string & what_arg )
|
||||||
|
: base_type(ev, what_arg)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
|
||||||
|
};
|
||||||
|
|
||||||
} // namespace boost
|
} // namespace boost
|
||||||
|
|
||||||
#endif // BOOST_THREAD_CONFIG_PDM070801_H
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
|
|||||||
1859
include/boost/thread/future.hpp
Normal file
1859
include/boost/thread/future.hpp
Normal file
File diff suppressed because it is too large
Load Diff
2113
include/boost/thread/locks.hpp
Normal file
2113
include/boost/thread/locks.hpp
Normal file
File diff suppressed because it is too large
Load Diff
@@ -1,146 +1,21 @@
|
|||||||
// Copyright (C) 2001
|
#ifndef BOOST_THREAD_MUTEX_HPP
|
||||||
// William E. Kempf
|
#define BOOST_THREAD_MUTEX_HPP
|
||||||
|
|
||||||
|
// mutex.hpp
|
||||||
//
|
//
|
||||||
// Permission to use, copy, modify, distribute and sell this software
|
// (C) Copyright 2007 Anthony Williams
|
||||||
// and its documentation for any purpose is hereby granted without fee,
|
//
|
||||||
// provided that the above copyright notice appear in all copies and
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
// that both that copyright notice and this permission notice appear
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
// in supporting documentation. William E. Kempf makes no representations
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
// about the suitability of this software for any purpose.
|
|
||||||
// It is provided "as is" without express or implied warranty.
|
|
||||||
|
|
||||||
#ifndef BOOST_MUTEX_WEK070601_HPP
|
#include <boost/thread/detail/platform.hpp>
|
||||||
#define BOOST_MUTEX_WEK070601_HPP
|
#if defined(BOOST_THREAD_PLATFORM_WIN32)
|
||||||
|
#include <boost/thread/win32/mutex.hpp>
|
||||||
#include <boost/config.hpp>
|
#elif defined(BOOST_THREAD_PLATFORM_PTHREAD)
|
||||||
#ifndef BOOST_HAS_THREADS
|
#include <boost/thread/pthread/mutex.hpp>
|
||||||
# error Thread support is unavailable!
|
#else
|
||||||
|
#error "Boost threads unavailable on this platform"
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
#include <boost/utility.hpp>
|
|
||||||
#include <boost/thread/detail/lock.hpp>
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_PTHREADS)
|
|
||||||
# include <pthread.h>
|
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
namespace boost {
|
|
||||||
|
|
||||||
class condition;
|
|
||||||
struct xtime;
|
|
||||||
|
|
||||||
class mutex : private noncopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
friend class detail::thread::scoped_lock<mutex>;
|
|
||||||
friend class condition;
|
|
||||||
|
|
||||||
typedef detail::thread::scoped_lock<mutex> scoped_lock;
|
|
||||||
|
|
||||||
mutex();
|
|
||||||
~mutex();
|
|
||||||
|
|
||||||
private:
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
typedef void* cv_state;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
struct cv_state
|
|
||||||
{
|
|
||||||
pthread_mutex_t* pmutex;
|
|
||||||
};
|
|
||||||
#endif
|
|
||||||
void do_lock();
|
|
||||||
void do_unlock();
|
|
||||||
void do_lock(cv_state& state);
|
|
||||||
void do_unlock(cv_state& state);
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
unsigned long m_mutex;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
pthread_mutex_t m_mutex;
|
|
||||||
#endif
|
|
||||||
};
|
|
||||||
|
|
||||||
class try_mutex : private noncopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
friend class detail::thread::scoped_lock<try_mutex>;
|
|
||||||
friend class detail::thread::scoped_try_lock<try_mutex>;
|
|
||||||
friend class condition;
|
|
||||||
|
|
||||||
typedef detail::thread::scoped_lock<try_mutex> scoped_lock;
|
|
||||||
typedef detail::thread::scoped_try_lock<try_mutex> scoped_try_lock;
|
|
||||||
|
|
||||||
try_mutex();
|
|
||||||
~try_mutex();
|
|
||||||
|
|
||||||
private:
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
typedef void* cv_state;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
struct cv_state
|
|
||||||
{
|
|
||||||
pthread_mutex_t* pmutex;
|
|
||||||
};
|
|
||||||
#endif
|
|
||||||
void do_lock();
|
|
||||||
bool do_trylock();
|
|
||||||
void do_unlock();
|
|
||||||
void do_lock(cv_state& state);
|
|
||||||
void do_unlock(cv_state& state);
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
unsigned long m_mutex;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
pthread_mutex_t m_mutex;
|
|
||||||
#endif
|
|
||||||
};
|
|
||||||
|
|
||||||
class timed_mutex : private noncopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
friend class detail::thread::scoped_lock<timed_mutex>;
|
|
||||||
friend class detail::thread::scoped_try_lock<timed_mutex>;
|
|
||||||
friend class detail::thread::scoped_timed_lock<timed_mutex>;
|
|
||||||
friend class condition;
|
|
||||||
|
|
||||||
typedef detail::thread::scoped_lock<timed_mutex> scoped_lock;
|
|
||||||
typedef detail::thread::scoped_try_lock<timed_mutex> scoped_try_lock;
|
|
||||||
typedef detail::thread::scoped_timed_lock<timed_mutex> scoped_timed_lock;
|
|
||||||
|
|
||||||
timed_mutex();
|
|
||||||
~timed_mutex();
|
|
||||||
|
|
||||||
private:
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
typedef void* cv_state;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
struct cv_state
|
|
||||||
{
|
|
||||||
pthread_mutex_t* pmutex;
|
|
||||||
};
|
|
||||||
#endif
|
|
||||||
void do_lock();
|
|
||||||
bool do_trylock();
|
|
||||||
bool do_timedlock(const xtime& xt);
|
|
||||||
void do_unlock();
|
|
||||||
void do_lock(cv_state& state);
|
|
||||||
void do_unlock(cv_state& state);
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
unsigned long m_mutex;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
pthread_mutex_t m_mutex;
|
|
||||||
pthread_cond_t m_condition;
|
|
||||||
bool m_locked;
|
|
||||||
#endif
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace boost
|
|
||||||
|
|
||||||
// Change Log:
|
|
||||||
// 8 Feb 01 WEKEMPF Initial version.
|
|
||||||
// 22 May 01 WEKEMPF Modified to use xtime for time outs. Factored out
|
|
||||||
// to three classes, mutex, try_mutex and timed_mutex.
|
|
||||||
|
|
||||||
#endif // BOOST_MUTEX_WEK070601_HPP
|
|
||||||
|
|||||||
@@ -1,45 +1,34 @@
|
|||||||
// Copyright (C) 2001
|
#ifndef BOOST_THREAD_ONCE_HPP
|
||||||
// William E. Kempf
|
#define BOOST_THREAD_ONCE_HPP
|
||||||
|
|
||||||
|
// once.hpp
|
||||||
//
|
//
|
||||||
// Permission to use, copy, modify, distribute and sell this software
|
// (C) Copyright 2006-7 Anthony Williams
|
||||||
// and its documentation for any purpose is hereby granted without fee,
|
//
|
||||||
// provided that the above copyright notice appear in all copies and
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
// that both that copyright notice and this permission notice appear
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
// in supporting documentation. William E. Kempf makes no representations
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
// about the suitability of this software for any purpose.
|
|
||||||
// It is provided "as is" without express or implied warranty.
|
|
||||||
|
|
||||||
#ifndef BOOST_ONCE_WEK080101_HPP
|
#include <boost/thread/detail/platform.hpp>
|
||||||
#define BOOST_ONCE_WEK080101_HPP
|
#if defined(BOOST_THREAD_PLATFORM_WIN32)
|
||||||
|
#include <boost/thread/win32/once.hpp>
|
||||||
#include <boost/config.hpp>
|
#elif defined(BOOST_THREAD_PLATFORM_PTHREAD)
|
||||||
#ifndef BOOST_HAS_THREADS
|
#include <boost/thread/pthread/once.hpp>
|
||||||
# error Thread support is unavailable!
|
#else
|
||||||
|
#error "Boost threads unavailable on this platform"
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
#if defined(BOOST_HAS_PTHREADS)
|
#include <boost/config/abi_prefix.hpp>
|
||||||
# include <pthread.h>
|
|
||||||
#endif
|
|
||||||
|
|
||||||
namespace boost {
|
namespace boost
|
||||||
|
{
|
||||||
|
// template<class Callable, class ...Args> void call_once(once_flag& flag, Callable func, Args&&... args);
|
||||||
|
inline void call_once(void (*func)(),once_flag& flag)
|
||||||
|
{
|
||||||
|
call_once(flag,func);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
#if defined(BOOST_HAS_PTHREADS)
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
typedef pthread_once_t once_flag;
|
|
||||||
const once_flag once_init = PTHREAD_ONCE_INIT;
|
|
||||||
|
|
||||||
#elif defined(BOOST_HAS_WINTHREADS)
|
|
||||||
|
|
||||||
typedef bool once_flag;
|
|
||||||
const once_flag once_init = false;
|
|
||||||
|
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
void call_once(void (*func)(), once_flag& flag);
|
|
||||||
|
|
||||||
} // namespace boost
|
|
||||||
|
|
||||||
// Change Log:
|
|
||||||
// 1 Aug 01 WEKEMPF Initial version.
|
|
||||||
|
|
||||||
#endif // BOOST_ONCE_WEK080101_HPP
|
|
||||||
|
|||||||
343
include/boost/thread/pthread/condition_variable.hpp
Normal file
343
include/boost/thread/pthread/condition_variable.hpp
Normal file
@@ -0,0 +1,343 @@
|
|||||||
|
#ifndef BOOST_THREAD_CONDITION_VARIABLE_PTHREAD_HPP
|
||||||
|
#define BOOST_THREAD_CONDITION_VARIABLE_PTHREAD_HPP
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
// (C) Copyright 2007-10 Anthony Williams
|
||||||
|
// (C) Copyright 2011 Vicente J. Botet Escriba
|
||||||
|
|
||||||
|
#include <boost/thread/pthread/timespec.hpp>
|
||||||
|
#include <boost/thread/pthread/pthread_mutex_scoped_lock.hpp>
|
||||||
|
#include <boost/thread/pthread/thread_data.hpp>
|
||||||
|
#include <boost/thread/pthread/condition_variable_fwd.hpp>
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
#include <boost/chrono/system_clocks.hpp>
|
||||||
|
#include <boost/chrono/ceil.hpp>
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
namespace this_thread
|
||||||
|
{
|
||||||
|
void BOOST_THREAD_DECL interruption_point();
|
||||||
|
}
|
||||||
|
|
||||||
|
namespace thread_cv_detail
|
||||||
|
{
|
||||||
|
template<typename MutexType>
|
||||||
|
struct lock_on_exit
|
||||||
|
{
|
||||||
|
MutexType* m;
|
||||||
|
|
||||||
|
lock_on_exit():
|
||||||
|
m(0)
|
||||||
|
{}
|
||||||
|
|
||||||
|
void activate(MutexType& m_)
|
||||||
|
{
|
||||||
|
m_.unlock();
|
||||||
|
m=&m_;
|
||||||
|
}
|
||||||
|
~lock_on_exit()
|
||||||
|
{
|
||||||
|
if(m)
|
||||||
|
{
|
||||||
|
m->lock();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
inline void condition_variable::wait(unique_lock<mutex>& m)
|
||||||
|
{
|
||||||
|
int res=0;
|
||||||
|
{
|
||||||
|
thread_cv_detail::lock_on_exit<unique_lock<mutex> > guard;
|
||||||
|
detail::interruption_checker check_for_interruption(&internal_mutex,&cond);
|
||||||
|
guard.activate(m);
|
||||||
|
do {
|
||||||
|
res = pthread_cond_wait(&cond,&internal_mutex);
|
||||||
|
} while (res == EINTR);
|
||||||
|
}
|
||||||
|
this_thread::interruption_point();
|
||||||
|
if(res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(condition_error(res, "boost:: condition_variable constructor failed in pthread_cond_wait"));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
inline bool condition_variable::do_timed_wait(
|
||||||
|
unique_lock<mutex>& m,
|
||||||
|
struct timespec const &timeout)
|
||||||
|
{
|
||||||
|
if (!m.owns_lock())
|
||||||
|
boost::throw_exception(condition_error(EPERM, "condition_variable do_timed_wait: mutex not locked"));
|
||||||
|
|
||||||
|
thread_cv_detail::lock_on_exit<unique_lock<mutex> > guard;
|
||||||
|
int cond_res;
|
||||||
|
{
|
||||||
|
detail::interruption_checker check_for_interruption(&internal_mutex,&cond);
|
||||||
|
guard.activate(m);
|
||||||
|
cond_res=pthread_cond_timedwait(&cond,&internal_mutex,&timeout);
|
||||||
|
}
|
||||||
|
this_thread::interruption_point();
|
||||||
|
if(cond_res==ETIMEDOUT)
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
if(cond_res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(condition_error(cond_res, "condition_variable failed in pthread_cond_timedwait"));
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
inline void condition_variable::notify_one() BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock internal_lock(&internal_mutex);
|
||||||
|
BOOST_VERIFY(!pthread_cond_signal(&cond));
|
||||||
|
}
|
||||||
|
|
||||||
|
inline void condition_variable::notify_all() BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock internal_lock(&internal_mutex);
|
||||||
|
BOOST_VERIFY(!pthread_cond_broadcast(&cond));
|
||||||
|
}
|
||||||
|
|
||||||
|
class condition_variable_any
|
||||||
|
{
|
||||||
|
pthread_mutex_t internal_mutex;
|
||||||
|
pthread_cond_t cond;
|
||||||
|
|
||||||
|
#ifndef BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
public:
|
||||||
|
condition_variable_any(condition_variable_any const&) = delete;
|
||||||
|
condition_variable_any& operator=(condition_variable_any const&) = delete;
|
||||||
|
#else // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
condition_variable_any(condition_variable_any&);
|
||||||
|
condition_variable_any& operator=(condition_variable_any&);
|
||||||
|
#endif // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
|
||||||
|
public:
|
||||||
|
condition_variable_any()
|
||||||
|
{
|
||||||
|
int const res=pthread_mutex_init(&internal_mutex,NULL);
|
||||||
|
if(res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(thread_resource_error(res, "condition_variable_any failed in pthread_mutex_init"));
|
||||||
|
}
|
||||||
|
int const res2=pthread_cond_init(&cond,NULL);
|
||||||
|
if(res2)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_destroy(&internal_mutex));
|
||||||
|
boost::throw_exception(thread_resource_error(res, "condition_variable_any failed in pthread_cond_init"));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
~condition_variable_any()
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_destroy(&internal_mutex));
|
||||||
|
BOOST_VERIFY(!pthread_cond_destroy(&cond));
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename lock_type>
|
||||||
|
void wait(lock_type& m)
|
||||||
|
{
|
||||||
|
int res=0;
|
||||||
|
{
|
||||||
|
thread_cv_detail::lock_on_exit<lock_type> guard;
|
||||||
|
detail::interruption_checker check_for_interruption(&internal_mutex,&cond);
|
||||||
|
guard.activate(m);
|
||||||
|
res=pthread_cond_wait(&cond,&internal_mutex);
|
||||||
|
}
|
||||||
|
this_thread::interruption_point();
|
||||||
|
if(res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(condition_error(res, "condition_variable_any failed in pthread_cond_wait"));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename lock_type,typename predicate_type>
|
||||||
|
void wait(lock_type& m,predicate_type pred)
|
||||||
|
{
|
||||||
|
while(!pred()) wait(m);
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename lock_type>
|
||||||
|
bool timed_wait(lock_type& m,boost::system_time const& wait_until)
|
||||||
|
{
|
||||||
|
struct timespec const timeout=detail::get_timespec(wait_until);
|
||||||
|
return do_timed_wait(m, timeout);
|
||||||
|
}
|
||||||
|
template<typename lock_type>
|
||||||
|
bool timed_wait(lock_type& m,xtime const& wait_until)
|
||||||
|
{
|
||||||
|
return timed_wait(m,system_time(wait_until));
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename lock_type,typename duration_type>
|
||||||
|
bool timed_wait(lock_type& m,duration_type const& wait_duration)
|
||||||
|
{
|
||||||
|
return timed_wait(m,get_system_time()+wait_duration);
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename lock_type,typename predicate_type>
|
||||||
|
bool timed_wait(lock_type& m,boost::system_time const& wait_until,predicate_type pred)
|
||||||
|
{
|
||||||
|
while (!pred())
|
||||||
|
{
|
||||||
|
if(!timed_wait(m, wait_until))
|
||||||
|
return pred();
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename lock_type,typename predicate_type>
|
||||||
|
bool timed_wait(lock_type& m,xtime const& wait_until,predicate_type pred)
|
||||||
|
{
|
||||||
|
return timed_wait(m,system_time(wait_until),pred);
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename lock_type,typename duration_type,typename predicate_type>
|
||||||
|
bool timed_wait(lock_type& m,duration_type const& wait_duration,predicate_type pred)
|
||||||
|
{
|
||||||
|
return timed_wait(m,get_system_time()+wait_duration,pred);
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
template <class lock_type,class Duration>
|
||||||
|
cv_status
|
||||||
|
wait_until(
|
||||||
|
lock_type& lock,
|
||||||
|
const chrono::time_point<chrono::system_clock, Duration>& t)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
typedef time_point<system_clock, nanoseconds> nano_sys_tmpt;
|
||||||
|
wait_until(lock,
|
||||||
|
nano_sys_tmpt(ceil<nanoseconds>(t.time_since_epoch())));
|
||||||
|
return system_clock::now() < t ? cv_status::no_timeout :
|
||||||
|
cv_status::timeout;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class lock_type, class Clock, class Duration>
|
||||||
|
cv_status
|
||||||
|
wait_until(
|
||||||
|
lock_type& lock,
|
||||||
|
const chrono::time_point<Clock, Duration>& t)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
system_clock::time_point s_now = system_clock::now();
|
||||||
|
typename Clock::time_point c_now = Clock::now();
|
||||||
|
wait_until(lock, s_now + ceil<nanoseconds>(t - c_now));
|
||||||
|
return Clock::now() < t ? cv_status::no_timeout : cv_status::timeout;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class lock_type, class Clock, class Duration, class Predicate>
|
||||||
|
bool
|
||||||
|
wait_until(
|
||||||
|
lock_type& lock,
|
||||||
|
const chrono::time_point<Clock, Duration>& t,
|
||||||
|
Predicate pred)
|
||||||
|
{
|
||||||
|
while (!pred())
|
||||||
|
{
|
||||||
|
if (wait_until(lock, t) == cv_status::timeout)
|
||||||
|
return pred();
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
template <class lock_type, class Rep, class Period>
|
||||||
|
cv_status
|
||||||
|
wait_for(
|
||||||
|
lock_type& lock,
|
||||||
|
const chrono::duration<Rep, Period>& d)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
system_clock::time_point s_now = system_clock::now();
|
||||||
|
steady_clock::time_point c_now = steady_clock::now();
|
||||||
|
wait_until(lock, s_now + ceil<nanoseconds>(d));
|
||||||
|
return steady_clock::now() - c_now < d ? cv_status::no_timeout :
|
||||||
|
cv_status::timeout;
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
template <class lock_type, class Rep, class Period, class Predicate>
|
||||||
|
bool
|
||||||
|
wait_for(
|
||||||
|
lock_type& lock,
|
||||||
|
const chrono::duration<Rep, Period>& d,
|
||||||
|
Predicate pred)
|
||||||
|
{
|
||||||
|
while (!pred())
|
||||||
|
{
|
||||||
|
if (wait_for(lock, d) == cv_status::timeout)
|
||||||
|
return pred();
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class lock_type>
|
||||||
|
inline void wait_until(
|
||||||
|
lock_type& lk,
|
||||||
|
chrono::time_point<chrono::system_clock, chrono::nanoseconds> tp)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
nanoseconds d = tp.time_since_epoch();
|
||||||
|
timespec ts;
|
||||||
|
seconds s = duration_cast<seconds>(d);
|
||||||
|
ts.tv_sec = static_cast<long>(s.count());
|
||||||
|
ts.tv_nsec = static_cast<long>((d - s).count());
|
||||||
|
do_timed_wait(lk, ts);
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
void notify_one() BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock internal_lock(&internal_mutex);
|
||||||
|
BOOST_VERIFY(!pthread_cond_signal(&cond));
|
||||||
|
}
|
||||||
|
|
||||||
|
void notify_all() BOOST_NOEXCEPT
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock internal_lock(&internal_mutex);
|
||||||
|
BOOST_VERIFY(!pthread_cond_broadcast(&cond));
|
||||||
|
}
|
||||||
|
private: // used by boost::thread::try_join_until
|
||||||
|
|
||||||
|
template <class lock_type>
|
||||||
|
inline bool do_timed_wait(
|
||||||
|
lock_type& m,
|
||||||
|
struct timespec const &timeout)
|
||||||
|
{
|
||||||
|
int res=0;
|
||||||
|
{
|
||||||
|
thread_cv_detail::lock_on_exit<lock_type> guard;
|
||||||
|
detail::interruption_checker check_for_interruption(&internal_mutex,&cond);
|
||||||
|
guard.activate(m);
|
||||||
|
res=pthread_cond_timedwait(&cond,&internal_mutex,&timeout);
|
||||||
|
}
|
||||||
|
this_thread::interruption_point();
|
||||||
|
if(res==ETIMEDOUT)
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
if(res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(condition_error(res, "condition_variable_any failed in pthread_cond_timedwait"));
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
};
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
238
include/boost/thread/pthread/condition_variable_fwd.hpp
Normal file
238
include/boost/thread/pthread/condition_variable_fwd.hpp
Normal file
@@ -0,0 +1,238 @@
|
|||||||
|
#ifndef BOOST_THREAD_PTHREAD_CONDITION_VARIABLE_FWD_HPP
|
||||||
|
#define BOOST_THREAD_PTHREAD_CONDITION_VARIABLE_FWD_HPP
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
// (C) Copyright 2007-8 Anthony Williams
|
||||||
|
// (C) Copyright 2011 Vicente J. Botet Escriba
|
||||||
|
|
||||||
|
#include <boost/assert.hpp>
|
||||||
|
#include <boost/throw_exception.hpp>
|
||||||
|
#include <pthread.h>
|
||||||
|
#include <boost/thread/cv_status.hpp>
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
#include <boost/thread/locks.hpp>
|
||||||
|
#include <boost/thread/thread_time.hpp>
|
||||||
|
#include <boost/thread/xtime.hpp>
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
#include <boost/chrono/system_clocks.hpp>
|
||||||
|
#include <boost/chrono/ceil.hpp>
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
|
||||||
|
class condition_variable
|
||||||
|
{
|
||||||
|
private:
|
||||||
|
pthread_mutex_t internal_mutex;
|
||||||
|
pthread_cond_t cond;
|
||||||
|
|
||||||
|
#ifndef BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
public:
|
||||||
|
condition_variable(condition_variable const&) = delete;
|
||||||
|
condition_variable& operator=(condition_variable const&) = delete;
|
||||||
|
#else // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
condition_variable(condition_variable const&);
|
||||||
|
condition_variable& operator=(condition_variable const&);
|
||||||
|
#endif // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
|
||||||
|
public:
|
||||||
|
condition_variable()
|
||||||
|
{
|
||||||
|
int const res=pthread_mutex_init(&internal_mutex,NULL);
|
||||||
|
if(res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(thread_resource_error(res, "boost:: condition_variable constructor failed in pthread_mutex_init"));
|
||||||
|
}
|
||||||
|
int const res2=pthread_cond_init(&cond,NULL);
|
||||||
|
if(res2)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_destroy(&internal_mutex));
|
||||||
|
boost::throw_exception(thread_resource_error(res2, "boost:: condition_variable constructor failed in pthread_cond_init"));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
~condition_variable()
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_destroy(&internal_mutex));
|
||||||
|
int ret;
|
||||||
|
do {
|
||||||
|
ret = pthread_cond_destroy(&cond);
|
||||||
|
} while (ret == EINTR);
|
||||||
|
BOOST_VERIFY(!ret);
|
||||||
|
}
|
||||||
|
|
||||||
|
void wait(unique_lock<mutex>& m);
|
||||||
|
|
||||||
|
template<typename predicate_type>
|
||||||
|
void wait(unique_lock<mutex>& m,predicate_type pred)
|
||||||
|
{
|
||||||
|
while(!pred()) wait(m);
|
||||||
|
}
|
||||||
|
|
||||||
|
inline bool timed_wait(
|
||||||
|
unique_lock<mutex>& m,
|
||||||
|
boost::system_time const& wait_until)
|
||||||
|
{
|
||||||
|
struct timespec const timeout=detail::get_timespec(wait_until);
|
||||||
|
return do_timed_wait(m, timeout);
|
||||||
|
}
|
||||||
|
bool timed_wait(
|
||||||
|
unique_lock<mutex>& m,
|
||||||
|
xtime const& wait_until)
|
||||||
|
{
|
||||||
|
return timed_wait(m,system_time(wait_until));
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename duration_type>
|
||||||
|
bool timed_wait(
|
||||||
|
unique_lock<mutex>& m,
|
||||||
|
duration_type const& wait_duration)
|
||||||
|
{
|
||||||
|
return timed_wait(m,get_system_time()+wait_duration);
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename predicate_type>
|
||||||
|
bool timed_wait(
|
||||||
|
unique_lock<mutex>& m,
|
||||||
|
boost::system_time const& wait_until,predicate_type pred)
|
||||||
|
{
|
||||||
|
while (!pred())
|
||||||
|
{
|
||||||
|
if(!timed_wait(m, wait_until))
|
||||||
|
return pred();
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename predicate_type>
|
||||||
|
bool timed_wait(
|
||||||
|
unique_lock<mutex>& m,
|
||||||
|
xtime const& wait_until,predicate_type pred)
|
||||||
|
{
|
||||||
|
return timed_wait(m,system_time(wait_until),pred);
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename duration_type,typename predicate_type>
|
||||||
|
bool timed_wait(
|
||||||
|
unique_lock<mutex>& m,
|
||||||
|
duration_type const& wait_duration,predicate_type pred)
|
||||||
|
{
|
||||||
|
return timed_wait(m,get_system_time()+wait_duration,pred);
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
|
||||||
|
template <class Duration>
|
||||||
|
cv_status
|
||||||
|
wait_until(
|
||||||
|
unique_lock<mutex>& lock,
|
||||||
|
const chrono::time_point<chrono::system_clock, Duration>& t)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
typedef time_point<system_clock, nanoseconds> nano_sys_tmpt;
|
||||||
|
wait_until(lock,
|
||||||
|
nano_sys_tmpt(ceil<nanoseconds>(t.time_since_epoch())));
|
||||||
|
return system_clock::now() < t ? cv_status::no_timeout :
|
||||||
|
cv_status::timeout;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
cv_status
|
||||||
|
wait_until(
|
||||||
|
unique_lock<mutex>& lock,
|
||||||
|
const chrono::time_point<Clock, Duration>& t)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
system_clock::time_point s_now = system_clock::now();
|
||||||
|
typename Clock::time_point c_now = Clock::now();
|
||||||
|
wait_until(lock, s_now + ceil<nanoseconds>(t - c_now));
|
||||||
|
return Clock::now() < t ? cv_status::no_timeout : cv_status::timeout;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class Clock, class Duration, class Predicate>
|
||||||
|
bool
|
||||||
|
wait_until(
|
||||||
|
unique_lock<mutex>& lock,
|
||||||
|
const chrono::time_point<Clock, Duration>& t,
|
||||||
|
Predicate pred)
|
||||||
|
{
|
||||||
|
while (!pred())
|
||||||
|
{
|
||||||
|
if (wait_until(lock, t) == cv_status::timeout)
|
||||||
|
return pred();
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
template <class Rep, class Period>
|
||||||
|
cv_status
|
||||||
|
wait_for(
|
||||||
|
unique_lock<mutex>& lock,
|
||||||
|
const chrono::duration<Rep, Period>& d)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
system_clock::time_point s_now = system_clock::now();
|
||||||
|
steady_clock::time_point c_now = steady_clock::now();
|
||||||
|
wait_until(lock, s_now + ceil<nanoseconds>(d));
|
||||||
|
return steady_clock::now() - c_now < d ? cv_status::no_timeout :
|
||||||
|
cv_status::timeout;
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
template <class Rep, class Period, class Predicate>
|
||||||
|
bool
|
||||||
|
wait_for(
|
||||||
|
unique_lock<mutex>& lock,
|
||||||
|
const chrono::duration<Rep, Period>& d,
|
||||||
|
Predicate pred)
|
||||||
|
{
|
||||||
|
while (!pred())
|
||||||
|
{
|
||||||
|
if (wait_for(lock, d) == cv_status::timeout)
|
||||||
|
return pred();
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#define BOOST_THREAD_DEFINES_CONDITION_VARIABLE_NATIVE_HANDLE
|
||||||
|
typedef pthread_cond_t* native_handle_type;
|
||||||
|
native_handle_type native_handle()
|
||||||
|
{
|
||||||
|
return &cond;
|
||||||
|
}
|
||||||
|
|
||||||
|
void notify_one() BOOST_NOEXCEPT;
|
||||||
|
void notify_all() BOOST_NOEXCEPT;
|
||||||
|
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
inline void wait_until(
|
||||||
|
unique_lock<mutex>& lk,
|
||||||
|
chrono::time_point<chrono::system_clock, chrono::nanoseconds> tp)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
nanoseconds d = tp.time_since_epoch();
|
||||||
|
timespec ts;
|
||||||
|
seconds s = duration_cast<seconds>(d);
|
||||||
|
ts.tv_sec = static_cast<long>(s.count());
|
||||||
|
ts.tv_nsec = static_cast<long>((d - s).count());
|
||||||
|
do_timed_wait(lk, ts);
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
//private: // used by boost::thread::try_join_until
|
||||||
|
|
||||||
|
inline bool do_timed_wait(
|
||||||
|
unique_lock<mutex>& lock,
|
||||||
|
struct timespec const &timeout);
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
307
include/boost/thread/pthread/mutex.hpp
Normal file
307
include/boost/thread/pthread/mutex.hpp
Normal file
@@ -0,0 +1,307 @@
|
|||||||
|
#ifndef BOOST_THREAD_PTHREAD_MUTEX_HPP
|
||||||
|
#define BOOST_THREAD_PTHREAD_MUTEX_HPP
|
||||||
|
// (C) Copyright 2007-8 Anthony Williams
|
||||||
|
// (C) Copyright 2011-2012 Vicente J. Botet Escriba
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <pthread.h>
|
||||||
|
#include <boost/utility.hpp>
|
||||||
|
#include <boost/throw_exception.hpp>
|
||||||
|
#include <boost/thread/exceptions.hpp>
|
||||||
|
#include <boost/thread/locks.hpp>
|
||||||
|
#include <boost/thread/thread_time.hpp>
|
||||||
|
#include <boost/thread/xtime.hpp>
|
||||||
|
#include <boost/assert.hpp>
|
||||||
|
#include <errno.h>
|
||||||
|
#include <boost/thread/pthread/timespec.hpp>
|
||||||
|
#include <boost/thread/pthread/pthread_mutex_scoped_lock.hpp>
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
#include <boost/chrono/system_clocks.hpp>
|
||||||
|
#include <boost/chrono/ceil.hpp>
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#ifdef _POSIX_TIMEOUTS
|
||||||
|
#if _POSIX_TIMEOUTS >= 0 && _POSIX_C_SOURCE>=200112L
|
||||||
|
#define BOOST_PTHREAD_HAS_TIMEDLOCK
|
||||||
|
#endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
class mutex
|
||||||
|
{
|
||||||
|
#ifndef BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
public:
|
||||||
|
mutex(mutex const&) = delete;
|
||||||
|
mutex& operator=(mutex const&) = delete;
|
||||||
|
#else // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
mutex(mutex const&);
|
||||||
|
mutex& operator=(mutex const&);
|
||||||
|
#endif // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
pthread_mutex_t m;
|
||||||
|
public:
|
||||||
|
mutex()
|
||||||
|
{
|
||||||
|
int const res=pthread_mutex_init(&m,NULL);
|
||||||
|
if(res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(thread_resource_error(res, "boost:: mutex constructor failed in pthread_mutex_init"));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
~mutex()
|
||||||
|
{
|
||||||
|
int ret;
|
||||||
|
do
|
||||||
|
{
|
||||||
|
ret = pthread_mutex_destroy(&m);
|
||||||
|
} while (ret == EINTR);
|
||||||
|
}
|
||||||
|
|
||||||
|
void lock()
|
||||||
|
{
|
||||||
|
int res;
|
||||||
|
do
|
||||||
|
{
|
||||||
|
res = pthread_mutex_lock(&m);
|
||||||
|
} while (res == EINTR);
|
||||||
|
if (res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(lock_error(res,"boost: mutex lock failed in pthread_mutex_lock"));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
void unlock()
|
||||||
|
{
|
||||||
|
int ret;
|
||||||
|
do
|
||||||
|
{
|
||||||
|
ret = pthread_mutex_unlock(&m);
|
||||||
|
} while (ret == EINTR);
|
||||||
|
BOOST_VERIFY(!ret);
|
||||||
|
}
|
||||||
|
|
||||||
|
bool try_lock()
|
||||||
|
{
|
||||||
|
int res;
|
||||||
|
do
|
||||||
|
{
|
||||||
|
res = pthread_mutex_trylock(&m);
|
||||||
|
} while (res == EINTR);
|
||||||
|
if(res && (res!=EBUSY))
|
||||||
|
{
|
||||||
|
// The following throw_exception has been replaced by an assertion and just return false,
|
||||||
|
// as this is an internal error and the user can do nothing with the exception.
|
||||||
|
//boost::throw_exception(lock_error(res,"boost: mutex try_lock failed in pthread_mutex_trylock"));
|
||||||
|
BOOST_ASSERT_MSG(false ,"boost: mutex try_lock failed in pthread_mutex_trylock");
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
return !res;
|
||||||
|
}
|
||||||
|
|
||||||
|
#define BOOST_THREAD_DEFINES_MUTEX_NATIVE_HANDLE
|
||||||
|
typedef pthread_mutex_t* native_handle_type;
|
||||||
|
native_handle_type native_handle()
|
||||||
|
{
|
||||||
|
return &m;
|
||||||
|
}
|
||||||
|
|
||||||
|
typedef unique_lock<mutex> scoped_lock;
|
||||||
|
typedef detail::try_lock_wrapper<mutex> scoped_try_lock;
|
||||||
|
};
|
||||||
|
|
||||||
|
typedef mutex try_mutex;
|
||||||
|
|
||||||
|
class timed_mutex
|
||||||
|
{
|
||||||
|
#ifndef BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
public:
|
||||||
|
timed_mutex(timed_mutex const&) = delete;
|
||||||
|
timed_mutex& operator=(timed_mutex const&) = delete;
|
||||||
|
#else // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
timed_mutex(timed_mutex const&);
|
||||||
|
timed_mutex& operator=(timed_mutex const&);
|
||||||
|
public:
|
||||||
|
#endif // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
pthread_mutex_t m;
|
||||||
|
#ifndef BOOST_PTHREAD_HAS_TIMEDLOCK
|
||||||
|
pthread_cond_t cond;
|
||||||
|
bool is_locked;
|
||||||
|
#endif
|
||||||
|
public:
|
||||||
|
timed_mutex()
|
||||||
|
{
|
||||||
|
int const res=pthread_mutex_init(&m,NULL);
|
||||||
|
if(res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(thread_resource_error(res, "boost:: timed_mutex constructor failed in pthread_mutex_init"));
|
||||||
|
}
|
||||||
|
#ifndef BOOST_PTHREAD_HAS_TIMEDLOCK
|
||||||
|
int const res2=pthread_cond_init(&cond,NULL);
|
||||||
|
if(res2)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_destroy(&m));
|
||||||
|
boost::throw_exception(thread_resource_error(res2, "boost:: timed_mutex constructor failed in pthread_cond_init"));
|
||||||
|
}
|
||||||
|
is_locked=false;
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
~timed_mutex()
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_destroy(&m));
|
||||||
|
#ifndef BOOST_PTHREAD_HAS_TIMEDLOCK
|
||||||
|
BOOST_VERIFY(!pthread_cond_destroy(&cond));
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename TimeDuration>
|
||||||
|
bool timed_lock(TimeDuration const & relative_time)
|
||||||
|
{
|
||||||
|
return timed_lock(get_system_time()+relative_time);
|
||||||
|
}
|
||||||
|
bool timed_lock(boost::xtime const & absolute_time)
|
||||||
|
{
|
||||||
|
return timed_lock(system_time(absolute_time));
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifdef BOOST_PTHREAD_HAS_TIMEDLOCK
|
||||||
|
void lock()
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_lock(&m));
|
||||||
|
}
|
||||||
|
|
||||||
|
void unlock()
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_unlock(&m));
|
||||||
|
}
|
||||||
|
|
||||||
|
bool try_lock()
|
||||||
|
{
|
||||||
|
int const res=pthread_mutex_trylock(&m);
|
||||||
|
BOOST_ASSERT(!res || res==EBUSY);
|
||||||
|
return !res;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
private:
|
||||||
|
bool do_try_lock_until(struct timespec const &timeout)
|
||||||
|
{
|
||||||
|
int const res=pthread_mutex_timedlock(&m,&timeout);
|
||||||
|
BOOST_ASSERT(!res || res==ETIMEDOUT);
|
||||||
|
return !res;
|
||||||
|
}
|
||||||
|
public:
|
||||||
|
|
||||||
|
#else
|
||||||
|
void lock()
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock const local_lock(&m);
|
||||||
|
while(is_locked)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_cond_wait(&cond,&m));
|
||||||
|
}
|
||||||
|
is_locked=true;
|
||||||
|
}
|
||||||
|
|
||||||
|
void unlock()
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock const local_lock(&m);
|
||||||
|
is_locked=false;
|
||||||
|
BOOST_VERIFY(!pthread_cond_signal(&cond));
|
||||||
|
}
|
||||||
|
|
||||||
|
bool try_lock()
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock const local_lock(&m);
|
||||||
|
if(is_locked)
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
is_locked=true;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
bool do_try_lock_until(struct timespec const &timeout)
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock const local_lock(&m);
|
||||||
|
while(is_locked)
|
||||||
|
{
|
||||||
|
int const cond_res=pthread_cond_timedwait(&cond,&m,&timeout);
|
||||||
|
if(cond_res==ETIMEDOUT)
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
BOOST_ASSERT(!cond_res);
|
||||||
|
}
|
||||||
|
is_locked=true;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
public:
|
||||||
|
#endif
|
||||||
|
|
||||||
|
bool timed_lock(system_time const & abs_time)
|
||||||
|
{
|
||||||
|
struct timespec const ts=detail::get_timespec(abs_time);
|
||||||
|
return do_try_lock_until(ts);
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
template <class Rep, class Period>
|
||||||
|
bool try_lock_for(const chrono::duration<Rep, Period>& rel_time)
|
||||||
|
{
|
||||||
|
return try_lock_until(chrono::steady_clock::now() + rel_time);
|
||||||
|
}
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
bool try_lock_until(const chrono::time_point<Clock, Duration>& t)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
system_clock::time_point s_now = system_clock::now();
|
||||||
|
typename Clock::time_point c_now = Clock::now();
|
||||||
|
return try_lock_until(s_now + ceil<nanoseconds>(t - c_now));
|
||||||
|
}
|
||||||
|
template <class Duration>
|
||||||
|
bool try_lock_until(const chrono::time_point<chrono::system_clock, Duration>& t)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
typedef time_point<system_clock, nanoseconds> nano_sys_tmpt;
|
||||||
|
return try_lock_until(nano_sys_tmpt(ceil<nanoseconds>(t.time_since_epoch())));
|
||||||
|
}
|
||||||
|
bool try_lock_until(const chrono::time_point<chrono::system_clock, chrono::nanoseconds>& tp)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
nanoseconds d = tp.time_since_epoch();
|
||||||
|
timespec ts;
|
||||||
|
seconds s = duration_cast<seconds>(d);
|
||||||
|
ts.tv_sec = static_cast<long>(s.count());
|
||||||
|
ts.tv_nsec = static_cast<long>((d - s).count());
|
||||||
|
return do_try_lock_until(ts);
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#define BOOST_THREAD_DEFINES_TIMED_MUTEX_NATIVE_HANDLE
|
||||||
|
typedef pthread_mutex_t* native_handle_type;
|
||||||
|
native_handle_type native_handle()
|
||||||
|
{
|
||||||
|
return &m;
|
||||||
|
}
|
||||||
|
|
||||||
|
typedef unique_lock<timed_mutex> scoped_timed_lock;
|
||||||
|
typedef detail::try_lock_wrapper<timed_mutex> scoped_try_lock;
|
||||||
|
typedef scoped_timed_lock scoped_lock;
|
||||||
|
};
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
|
||||||
|
#endif
|
||||||
117
include/boost/thread/pthread/once.hpp
Normal file
117
include/boost/thread/pthread/once.hpp
Normal file
@@ -0,0 +1,117 @@
|
|||||||
|
#ifndef BOOST_THREAD_PTHREAD_ONCE_HPP
|
||||||
|
#define BOOST_THREAD_PTHREAD_ONCE_HPP
|
||||||
|
|
||||||
|
// once.hpp
|
||||||
|
//
|
||||||
|
// (C) Copyright 2007-8 Anthony Williams
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/thread/detail/config.hpp>
|
||||||
|
|
||||||
|
#include <pthread.h>
|
||||||
|
#include <boost/assert.hpp>
|
||||||
|
#include <boost/thread/pthread/pthread_mutex_scoped_lock.hpp>
|
||||||
|
#include <boost/cstdint.hpp>
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
|
||||||
|
#if BOOST_THREAD_VERSION==3
|
||||||
|
|
||||||
|
struct once_flag
|
||||||
|
{
|
||||||
|
BOOST_CONSTEXPR once_flag() BOOST_NOEXCEPT
|
||||||
|
: epoch(0)
|
||||||
|
{}
|
||||||
|
#ifndef BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
once_flag(const once_flag&) = delete;
|
||||||
|
once_flag& operator=(const once_flag&) = delete;
|
||||||
|
#else // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
once_flag(const once_flag&);
|
||||||
|
once_flag& operator=(const once_flag&);
|
||||||
|
public:
|
||||||
|
#endif // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
boost::uintmax_t epoch;
|
||||||
|
|
||||||
|
};
|
||||||
|
|
||||||
|
#else // BOOST_THREAD_VERSION==3
|
||||||
|
|
||||||
|
struct once_flag
|
||||||
|
{
|
||||||
|
boost::uintmax_t epoch;
|
||||||
|
};
|
||||||
|
|
||||||
|
#define BOOST_ONCE_INITIAL_FLAG_VALUE 0
|
||||||
|
#define BOOST_ONCE_INIT {BOOST_ONCE_INITIAL_FLAG_VALUE}
|
||||||
|
|
||||||
|
#endif // BOOST_THREAD_VERSION==3
|
||||||
|
|
||||||
|
namespace detail
|
||||||
|
{
|
||||||
|
BOOST_THREAD_DECL boost::uintmax_t& get_once_per_thread_epoch();
|
||||||
|
BOOST_THREAD_DECL extern boost::uintmax_t once_global_epoch;
|
||||||
|
BOOST_THREAD_DECL extern pthread_mutex_t once_epoch_mutex;
|
||||||
|
BOOST_THREAD_DECL extern pthread_cond_t once_epoch_cv;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Based on Mike Burrows fast_pthread_once algorithm as described in
|
||||||
|
// http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2007/n2444.html
|
||||||
|
template<typename Function>
|
||||||
|
void call_once(once_flag& flag,Function f)
|
||||||
|
{
|
||||||
|
static boost::uintmax_t const uninitialized_flag=BOOST_ONCE_INITIAL_FLAG_VALUE;
|
||||||
|
static boost::uintmax_t const being_initialized=uninitialized_flag+1;
|
||||||
|
boost::uintmax_t const epoch=flag.epoch;
|
||||||
|
boost::uintmax_t& this_thread_epoch=detail::get_once_per_thread_epoch();
|
||||||
|
|
||||||
|
if(epoch<this_thread_epoch)
|
||||||
|
{
|
||||||
|
pthread::pthread_mutex_scoped_lock lk(&detail::once_epoch_mutex);
|
||||||
|
|
||||||
|
while(flag.epoch<=being_initialized)
|
||||||
|
{
|
||||||
|
if(flag.epoch==uninitialized_flag)
|
||||||
|
{
|
||||||
|
flag.epoch=being_initialized;
|
||||||
|
#ifndef BOOST_NO_EXCEPTIONS
|
||||||
|
try
|
||||||
|
{
|
||||||
|
#endif
|
||||||
|
pthread::pthread_mutex_scoped_unlock relocker(&detail::once_epoch_mutex);
|
||||||
|
f();
|
||||||
|
#ifndef BOOST_NO_EXCEPTIONS
|
||||||
|
}
|
||||||
|
catch(...)
|
||||||
|
{
|
||||||
|
flag.epoch=uninitialized_flag;
|
||||||
|
BOOST_VERIFY(!pthread_cond_broadcast(&detail::once_epoch_cv));
|
||||||
|
throw;
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
flag.epoch=--detail::once_global_epoch;
|
||||||
|
BOOST_VERIFY(!pthread_cond_broadcast(&detail::once_epoch_cv));
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
while(flag.epoch==being_initialized)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_cond_wait(&detail::once_epoch_cv,&detail::once_epoch_mutex));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
this_thread_epoch=detail::once_global_epoch;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
64
include/boost/thread/pthread/pthread_mutex_scoped_lock.hpp
Normal file
64
include/boost/thread/pthread/pthread_mutex_scoped_lock.hpp
Normal file
@@ -0,0 +1,64 @@
|
|||||||
|
#ifndef BOOST_PTHREAD_MUTEX_SCOPED_LOCK_HPP
|
||||||
|
#define BOOST_PTHREAD_MUTEX_SCOPED_LOCK_HPP
|
||||||
|
// (C) Copyright 2007-8 Anthony Williams
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <pthread.h>
|
||||||
|
#include <boost/assert.hpp>
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
namespace pthread
|
||||||
|
{
|
||||||
|
class pthread_mutex_scoped_lock
|
||||||
|
{
|
||||||
|
pthread_mutex_t* m;
|
||||||
|
bool locked;
|
||||||
|
public:
|
||||||
|
explicit pthread_mutex_scoped_lock(pthread_mutex_t* m_):
|
||||||
|
m(m_),locked(true)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_lock(m));
|
||||||
|
}
|
||||||
|
void unlock()
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_unlock(m));
|
||||||
|
locked=false;
|
||||||
|
}
|
||||||
|
|
||||||
|
~pthread_mutex_scoped_lock()
|
||||||
|
{
|
||||||
|
if(locked)
|
||||||
|
{
|
||||||
|
unlock();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
};
|
||||||
|
|
||||||
|
class pthread_mutex_scoped_unlock
|
||||||
|
{
|
||||||
|
pthread_mutex_t* m;
|
||||||
|
public:
|
||||||
|
explicit pthread_mutex_scoped_unlock(pthread_mutex_t* m_):
|
||||||
|
m(m_)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_unlock(m));
|
||||||
|
}
|
||||||
|
~pthread_mutex_scoped_unlock()
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_lock(m));
|
||||||
|
}
|
||||||
|
|
||||||
|
};
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
407
include/boost/thread/pthread/recursive_mutex.hpp
Normal file
407
include/boost/thread/pthread/recursive_mutex.hpp
Normal file
@@ -0,0 +1,407 @@
|
|||||||
|
#ifndef BOOST_THREAD_PTHREAD_RECURSIVE_MUTEX_HPP
|
||||||
|
#define BOOST_THREAD_PTHREAD_RECURSIVE_MUTEX_HPP
|
||||||
|
// (C) Copyright 2007-8 Anthony Williams
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <pthread.h>
|
||||||
|
#include <boost/utility.hpp>
|
||||||
|
#include <boost/throw_exception.hpp>
|
||||||
|
#include <boost/thread/exceptions.hpp>
|
||||||
|
#include <boost/thread/locks.hpp>
|
||||||
|
#include <boost/thread/thread_time.hpp>
|
||||||
|
#include <boost/assert.hpp>
|
||||||
|
#ifndef _WIN32
|
||||||
|
#include <unistd.h>
|
||||||
|
#endif
|
||||||
|
#include <boost/date_time/posix_time/conversion.hpp>
|
||||||
|
#include <errno.h>
|
||||||
|
#include <boost/thread/pthread/timespec.hpp>
|
||||||
|
#include <boost/thread/pthread/pthread_mutex_scoped_lock.hpp>
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
#include <boost/chrono/system_clocks.hpp>
|
||||||
|
#include <boost/chrono/ceil.hpp>
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#ifdef _POSIX_TIMEOUTS
|
||||||
|
#if _POSIX_TIMEOUTS >= 0
|
||||||
|
#define BOOST_PTHREAD_HAS_TIMEDLOCK
|
||||||
|
#endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#if defined(BOOST_HAS_PTHREAD_MUTEXATTR_SETTYPE) && defined(BOOST_PTHREAD_HAS_TIMEDLOCK)
|
||||||
|
#define BOOST_USE_PTHREAD_RECURSIVE_TIMEDLOCK
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
class recursive_mutex
|
||||||
|
{
|
||||||
|
#ifndef BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
public:
|
||||||
|
recursive_mutex(recursive_mutex const&) = delete;
|
||||||
|
recursive_mutex& operator=(recursive_mutex const&) = delete;
|
||||||
|
#else // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
recursive_mutex(recursive_mutex const&);
|
||||||
|
recursive_mutex& operator=(recursive_mutex const&);
|
||||||
|
#endif // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
pthread_mutex_t m;
|
||||||
|
#ifndef BOOST_HAS_PTHREAD_MUTEXATTR_SETTYPE
|
||||||
|
pthread_cond_t cond;
|
||||||
|
bool is_locked;
|
||||||
|
pthread_t owner;
|
||||||
|
unsigned count;
|
||||||
|
#endif
|
||||||
|
public:
|
||||||
|
recursive_mutex()
|
||||||
|
{
|
||||||
|
#ifdef BOOST_HAS_PTHREAD_MUTEXATTR_SETTYPE
|
||||||
|
pthread_mutexattr_t attr;
|
||||||
|
|
||||||
|
int const init_attr_res=pthread_mutexattr_init(&attr);
|
||||||
|
if(init_attr_res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(thread_resource_error(init_attr_res, "boost:: recursive_mutex constructor failed in pthread_mutexattr_init"));
|
||||||
|
}
|
||||||
|
int const set_attr_res=pthread_mutexattr_settype(&attr,PTHREAD_MUTEX_RECURSIVE);
|
||||||
|
if(set_attr_res)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutexattr_destroy(&attr));
|
||||||
|
boost::throw_exception(thread_resource_error(set_attr_res, "boost:: recursive_mutex constructor failed in pthread_mutexattr_settype"));
|
||||||
|
}
|
||||||
|
|
||||||
|
int const res=pthread_mutex_init(&m,&attr);
|
||||||
|
if(res)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutexattr_destroy(&attr));
|
||||||
|
boost::throw_exception(thread_resource_error(res, "boost:: recursive_mutex constructor failed in pthread_mutex_init"));
|
||||||
|
}
|
||||||
|
BOOST_VERIFY(!pthread_mutexattr_destroy(&attr));
|
||||||
|
#else
|
||||||
|
int const res=pthread_mutex_init(&m,NULL);
|
||||||
|
if(res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(thread_resource_error(res, "boost:: recursive_mutex constructor failed in pthread_mutex_init"));
|
||||||
|
}
|
||||||
|
int const res2=pthread_cond_init(&cond,NULL);
|
||||||
|
if(res2)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_destroy(&m));
|
||||||
|
boost::throw_exception(thread_resource_error(res2, "boost:: recursive_mutex constructor failed in pthread_cond_init"));
|
||||||
|
}
|
||||||
|
is_locked=false;
|
||||||
|
count=0;
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
~recursive_mutex()
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_destroy(&m));
|
||||||
|
#ifndef BOOST_HAS_PTHREAD_MUTEXATTR_SETTYPE
|
||||||
|
BOOST_VERIFY(!pthread_cond_destroy(&cond));
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifdef BOOST_HAS_PTHREAD_MUTEXATTR_SETTYPE
|
||||||
|
void lock()
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_lock(&m));
|
||||||
|
}
|
||||||
|
|
||||||
|
void unlock()
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_unlock(&m));
|
||||||
|
}
|
||||||
|
|
||||||
|
bool try_lock()
|
||||||
|
{
|
||||||
|
int const res=pthread_mutex_trylock(&m);
|
||||||
|
BOOST_ASSERT(!res || res==EBUSY);
|
||||||
|
return !res;
|
||||||
|
}
|
||||||
|
#define BOOST_THREAD_DEFINES_RECURSIVE_MUTEX_NATIVE_HANDLE
|
||||||
|
typedef pthread_mutex_t* native_handle_type;
|
||||||
|
native_handle_type native_handle()
|
||||||
|
{
|
||||||
|
return &m;
|
||||||
|
}
|
||||||
|
|
||||||
|
#else
|
||||||
|
void lock()
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock const local_lock(&m);
|
||||||
|
if(is_locked && pthread_equal(owner,pthread_self()))
|
||||||
|
{
|
||||||
|
++count;
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
while(is_locked)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_cond_wait(&cond,&m));
|
||||||
|
}
|
||||||
|
is_locked=true;
|
||||||
|
++count;
|
||||||
|
owner=pthread_self();
|
||||||
|
}
|
||||||
|
|
||||||
|
void unlock()
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock const local_lock(&m);
|
||||||
|
if(!--count)
|
||||||
|
{
|
||||||
|
is_locked=false;
|
||||||
|
}
|
||||||
|
BOOST_VERIFY(!pthread_cond_signal(&cond));
|
||||||
|
}
|
||||||
|
|
||||||
|
bool try_lock()
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock const local_lock(&m);
|
||||||
|
if(is_locked && !pthread_equal(owner,pthread_self()))
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
is_locked=true;
|
||||||
|
++count;
|
||||||
|
owner=pthread_self();
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
#endif
|
||||||
|
|
||||||
|
typedef unique_lock<recursive_mutex> scoped_lock;
|
||||||
|
typedef detail::try_lock_wrapper<recursive_mutex> scoped_try_lock;
|
||||||
|
};
|
||||||
|
|
||||||
|
typedef recursive_mutex recursive_try_mutex;
|
||||||
|
|
||||||
|
class recursive_timed_mutex
|
||||||
|
{
|
||||||
|
#ifndef BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
public:
|
||||||
|
recursive_timed_mutex(recursive_timed_mutex const&) = delete;
|
||||||
|
recursive_timed_mutex& operator=(recursive_timed_mutex const&) = delete;
|
||||||
|
#else // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
recursive_timed_mutex(recursive_timed_mutex const&);
|
||||||
|
recursive_timed_mutex& operator=(recursive_timed_mutex const&);
|
||||||
|
#endif // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
pthread_mutex_t m;
|
||||||
|
#ifndef BOOST_USE_PTHREAD_RECURSIVE_TIMEDLOCK
|
||||||
|
pthread_cond_t cond;
|
||||||
|
bool is_locked;
|
||||||
|
pthread_t owner;
|
||||||
|
unsigned count;
|
||||||
|
#endif
|
||||||
|
public:
|
||||||
|
recursive_timed_mutex()
|
||||||
|
{
|
||||||
|
#ifdef BOOST_USE_PTHREAD_RECURSIVE_TIMEDLOCK
|
||||||
|
pthread_mutexattr_t attr;
|
||||||
|
|
||||||
|
int const init_attr_res=pthread_mutexattr_init(&attr);
|
||||||
|
if(init_attr_res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(thread_resource_error(init_attr_res, "boost:: recursive_timed_mutex constructor failed in pthread_mutexattr_init"));
|
||||||
|
}
|
||||||
|
int const set_attr_res=pthread_mutexattr_settype(&attr,PTHREAD_MUTEX_RECURSIVE);
|
||||||
|
if(set_attr_res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(thread_resource_error(set_attr_res, "boost:: recursive_timed_mutex constructor failed in pthread_mutexattr_settype"));
|
||||||
|
}
|
||||||
|
|
||||||
|
int const res=pthread_mutex_init(&m,&attr);
|
||||||
|
if(res)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutexattr_destroy(&attr));
|
||||||
|
boost::throw_exception(thread_resource_error(res, "boost:: recursive_timed_mutex constructor failed in pthread_mutex_init"));
|
||||||
|
}
|
||||||
|
BOOST_VERIFY(!pthread_mutexattr_destroy(&attr));
|
||||||
|
#else
|
||||||
|
int const res=pthread_mutex_init(&m,NULL);
|
||||||
|
if(res)
|
||||||
|
{
|
||||||
|
boost::throw_exception(thread_resource_error(res, "boost:: recursive_timed_mutex constructor failed in pthread_mutex_init"));
|
||||||
|
}
|
||||||
|
int const res2=pthread_cond_init(&cond,NULL);
|
||||||
|
if(res2)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_destroy(&m));
|
||||||
|
boost::throw_exception(thread_resource_error(res2, "boost:: recursive_timed_mutex constructor failed in pthread_cond_init"));
|
||||||
|
}
|
||||||
|
is_locked=false;
|
||||||
|
count=0;
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
~recursive_timed_mutex()
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_destroy(&m));
|
||||||
|
#ifndef BOOST_USE_PTHREAD_RECURSIVE_TIMEDLOCK
|
||||||
|
BOOST_VERIFY(!pthread_cond_destroy(&cond));
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename TimeDuration>
|
||||||
|
bool timed_lock(TimeDuration const & relative_time)
|
||||||
|
{
|
||||||
|
return timed_lock(get_system_time()+relative_time);
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifdef BOOST_USE_PTHREAD_RECURSIVE_TIMEDLOCK
|
||||||
|
void lock()
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_lock(&m));
|
||||||
|
}
|
||||||
|
|
||||||
|
void unlock()
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_unlock(&m));
|
||||||
|
}
|
||||||
|
|
||||||
|
bool try_lock()
|
||||||
|
{
|
||||||
|
int const res=pthread_mutex_trylock(&m);
|
||||||
|
BOOST_ASSERT(!res || res==EBUSY);
|
||||||
|
return !res;
|
||||||
|
}
|
||||||
|
private:
|
||||||
|
bool do_try_lock_until(struct timespec const &timeout)
|
||||||
|
{
|
||||||
|
int const res=pthread_mutex_timedlock(&m,&timeout);
|
||||||
|
BOOST_ASSERT(!res || res==ETIMEDOUT);
|
||||||
|
return !res;
|
||||||
|
}
|
||||||
|
|
||||||
|
public:
|
||||||
|
|
||||||
|
#else
|
||||||
|
void lock()
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock const local_lock(&m);
|
||||||
|
if(is_locked && pthread_equal(owner,pthread_self()))
|
||||||
|
{
|
||||||
|
++count;
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
while(is_locked)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_cond_wait(&cond,&m));
|
||||||
|
}
|
||||||
|
is_locked=true;
|
||||||
|
++count;
|
||||||
|
owner=pthread_self();
|
||||||
|
}
|
||||||
|
|
||||||
|
void unlock()
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock const local_lock(&m);
|
||||||
|
if(!--count)
|
||||||
|
{
|
||||||
|
is_locked=false;
|
||||||
|
}
|
||||||
|
BOOST_VERIFY(!pthread_cond_signal(&cond));
|
||||||
|
}
|
||||||
|
|
||||||
|
bool try_lock()
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock const local_lock(&m);
|
||||||
|
if(is_locked && !pthread_equal(owner,pthread_self()))
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
is_locked=true;
|
||||||
|
++count;
|
||||||
|
owner=pthread_self();
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
bool do_try_lock_until(struct timespec const &timeout)
|
||||||
|
{
|
||||||
|
boost::pthread::pthread_mutex_scoped_lock const local_lock(&m);
|
||||||
|
if(is_locked && pthread_equal(owner,pthread_self()))
|
||||||
|
{
|
||||||
|
++count;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
while(is_locked)
|
||||||
|
{
|
||||||
|
int const cond_res=pthread_cond_timedwait(&cond,&m,&timeout);
|
||||||
|
if(cond_res==ETIMEDOUT)
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
BOOST_ASSERT(!cond_res);
|
||||||
|
}
|
||||||
|
is_locked=true;
|
||||||
|
++count;
|
||||||
|
owner=pthread_self();
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
public:
|
||||||
|
|
||||||
|
#endif
|
||||||
|
|
||||||
|
bool timed_lock(system_time const & abs_time)
|
||||||
|
{
|
||||||
|
struct timespec const ts=detail::get_timespec(abs_time);
|
||||||
|
return do_try_lock_until(ts);
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
template <class Rep, class Period>
|
||||||
|
bool try_lock_for(const chrono::duration<Rep, Period>& rel_time)
|
||||||
|
{
|
||||||
|
return try_lock_until(chrono::steady_clock::now() + rel_time);
|
||||||
|
}
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
bool try_lock_until(const chrono::time_point<Clock, Duration>& t)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
system_clock::time_point s_now = system_clock::now();
|
||||||
|
typename Clock::time_point c_now = Clock::now();
|
||||||
|
return try_lock_until(s_now + ceil<nanoseconds>(t - c_now));
|
||||||
|
}
|
||||||
|
template <class Duration>
|
||||||
|
bool try_lock_until(const chrono::time_point<chrono::system_clock, Duration>& t)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
typedef time_point<system_clock, nanoseconds> nano_sys_tmpt;
|
||||||
|
return try_lock_until(nano_sys_tmpt(ceil<nanoseconds>(t.time_since_epoch())));
|
||||||
|
}
|
||||||
|
bool try_lock_until(const chrono::time_point<chrono::system_clock, chrono::nanoseconds>& tp)
|
||||||
|
{
|
||||||
|
using namespace chrono;
|
||||||
|
nanoseconds d = tp.time_since_epoch();
|
||||||
|
timespec ts;
|
||||||
|
seconds s = duration_cast<seconds>(d);
|
||||||
|
ts.tv_sec = static_cast<long>(s.count());
|
||||||
|
ts.tv_nsec = static_cast<long>((d - s).count());
|
||||||
|
return do_try_lock_until(ts);
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#define BOOST_THREAD_DEFINES_RECURSIVE_TIMED_MUTEX_NATIVE_HANDLE
|
||||||
|
typedef pthread_mutex_t* native_handle_type;
|
||||||
|
native_handle_type native_handle()
|
||||||
|
{
|
||||||
|
return &m;
|
||||||
|
}
|
||||||
|
|
||||||
|
typedef unique_lock<recursive_timed_mutex> scoped_timed_lock;
|
||||||
|
typedef detail::try_lock_wrapper<recursive_timed_mutex> scoped_try_lock;
|
||||||
|
typedef scoped_timed_lock scoped_lock;
|
||||||
|
};
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
440
include/boost/thread/pthread/shared_mutex.hpp
Normal file
440
include/boost/thread/pthread/shared_mutex.hpp
Normal file
@@ -0,0 +1,440 @@
|
|||||||
|
#ifndef BOOST_THREAD_PTHREAD_SHARED_MUTEX_HPP
|
||||||
|
#define BOOST_THREAD_PTHREAD_SHARED_MUTEX_HPP
|
||||||
|
|
||||||
|
// (C) Copyright 2006-8 Anthony Williams
|
||||||
|
// (C) Copyright 2012 Vicente J. Botet Escriba
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/assert.hpp>
|
||||||
|
#include <boost/static_assert.hpp>
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
#include <boost/thread/condition_variable.hpp>
|
||||||
|
#include <boost/thread/detail/thread_interruption.hpp>
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
#include <boost/chrono/system_clocks.hpp>
|
||||||
|
#include <boost/chrono/ceil.hpp>
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
class shared_mutex
|
||||||
|
{
|
||||||
|
private:
|
||||||
|
struct state_data
|
||||||
|
{
|
||||||
|
unsigned shared_count;
|
||||||
|
bool exclusive;
|
||||||
|
bool upgrade;
|
||||||
|
bool exclusive_waiting_blocked;
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
state_data state;
|
||||||
|
boost::mutex state_change;
|
||||||
|
boost::condition_variable shared_cond;
|
||||||
|
boost::condition_variable exclusive_cond;
|
||||||
|
boost::condition_variable upgrade_cond;
|
||||||
|
|
||||||
|
void release_waiters()
|
||||||
|
{
|
||||||
|
exclusive_cond.notify_one();
|
||||||
|
shared_cond.notify_all();
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
#ifndef BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
public:
|
||||||
|
shared_mutex(shared_mutex const&) = delete;
|
||||||
|
shared_mutex& operator=(shared_mutex const&) = delete;
|
||||||
|
#else // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
private:
|
||||||
|
shared_mutex(shared_mutex const&);
|
||||||
|
shared_mutex& operator=(shared_mutex const&);
|
||||||
|
#endif // BOOST_NO_DELETED_FUNCTIONS
|
||||||
|
public:
|
||||||
|
|
||||||
|
shared_mutex()
|
||||||
|
{
|
||||||
|
state_data state_={0,0,0,0};
|
||||||
|
state=state_;
|
||||||
|
}
|
||||||
|
|
||||||
|
~shared_mutex()
|
||||||
|
{
|
||||||
|
}
|
||||||
|
|
||||||
|
void lock_shared()
|
||||||
|
{
|
||||||
|
boost::this_thread::disable_interruption do_not_disturb;
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
|
||||||
|
while(state.exclusive || state.exclusive_waiting_blocked)
|
||||||
|
{
|
||||||
|
shared_cond.wait(lk);
|
||||||
|
}
|
||||||
|
++state.shared_count;
|
||||||
|
}
|
||||||
|
|
||||||
|
bool try_lock_shared()
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
|
||||||
|
if(state.exclusive || state.exclusive_waiting_blocked)
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
++state.shared_count;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
bool timed_lock_shared(system_time const& timeout)
|
||||||
|
{
|
||||||
|
boost::this_thread::disable_interruption do_not_disturb;
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
|
||||||
|
while(state.exclusive || state.exclusive_waiting_blocked)
|
||||||
|
{
|
||||||
|
if(!shared_cond.timed_wait(lk,timeout))
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
++state.shared_count;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename TimeDuration>
|
||||||
|
bool timed_lock_shared(TimeDuration const & relative_time)
|
||||||
|
{
|
||||||
|
return timed_lock_shared(get_system_time()+relative_time);
|
||||||
|
}
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
template <class Rep, class Period>
|
||||||
|
bool try_lock_shared_for(const chrono::duration<Rep, Period>& rel_time)
|
||||||
|
{
|
||||||
|
return try_lock_shared_until(chrono::steady_clock::now() + rel_time);
|
||||||
|
}
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
bool try_lock_shared_until(const chrono::time_point<Clock, Duration>& abs_time)
|
||||||
|
{
|
||||||
|
boost::this_thread::disable_interruption do_not_disturb;
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
|
||||||
|
while(state.exclusive || state.exclusive_waiting_blocked)
|
||||||
|
{
|
||||||
|
if(cv_status::timeout==shared_cond.wait_until(lk,abs_time))
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
++state.shared_count;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
void unlock_shared()
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
bool const last_reader=!--state.shared_count;
|
||||||
|
|
||||||
|
if(last_reader)
|
||||||
|
{
|
||||||
|
if(state.upgrade)
|
||||||
|
{
|
||||||
|
state.upgrade=false;
|
||||||
|
state.exclusive=true;
|
||||||
|
upgrade_cond.notify_one();
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
state.exclusive_waiting_blocked=false;
|
||||||
|
}
|
||||||
|
release_waiters();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
void lock()
|
||||||
|
{
|
||||||
|
boost::this_thread::disable_interruption do_not_disturb;
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
|
||||||
|
while(state.shared_count || state.exclusive)
|
||||||
|
{
|
||||||
|
state.exclusive_waiting_blocked=true;
|
||||||
|
exclusive_cond.wait(lk);
|
||||||
|
}
|
||||||
|
state.exclusive=true;
|
||||||
|
}
|
||||||
|
|
||||||
|
bool timed_lock(system_time const& timeout)
|
||||||
|
{
|
||||||
|
boost::this_thread::disable_interruption do_not_disturb;
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
|
||||||
|
while(state.shared_count || state.exclusive)
|
||||||
|
{
|
||||||
|
state.exclusive_waiting_blocked=true;
|
||||||
|
if(!exclusive_cond.timed_wait(lk,timeout))
|
||||||
|
{
|
||||||
|
if(state.shared_count || state.exclusive)
|
||||||
|
{
|
||||||
|
state.exclusive_waiting_blocked=false;
|
||||||
|
release_waiters();
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
state.exclusive=true;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename TimeDuration>
|
||||||
|
bool timed_lock(TimeDuration const & relative_time)
|
||||||
|
{
|
||||||
|
return timed_lock(get_system_time()+relative_time);
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
template <class Rep, class Period>
|
||||||
|
bool try_lock_for(const chrono::duration<Rep, Period>& rel_time)
|
||||||
|
{
|
||||||
|
return try_lock_until(chrono::steady_clock::now() + rel_time);
|
||||||
|
}
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
bool try_lock_until(const chrono::time_point<Clock, Duration>& abs_time)
|
||||||
|
{
|
||||||
|
boost::this_thread::disable_interruption do_not_disturb;
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
|
||||||
|
while(state.shared_count || state.exclusive)
|
||||||
|
{
|
||||||
|
state.exclusive_waiting_blocked=true;
|
||||||
|
if(cv_status::timeout == exclusive_cond.wait_until(lk,abs_time))
|
||||||
|
{
|
||||||
|
if(state.shared_count || state.exclusive)
|
||||||
|
{
|
||||||
|
state.exclusive_waiting_blocked=false;
|
||||||
|
release_waiters();
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
state.exclusive=true;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
|
bool try_lock()
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
|
||||||
|
if(state.shared_count || state.exclusive)
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
state.exclusive=true;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
void unlock()
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
state.exclusive=false;
|
||||||
|
state.exclusive_waiting_blocked=false;
|
||||||
|
release_waiters();
|
||||||
|
}
|
||||||
|
|
||||||
|
void lock_upgrade()
|
||||||
|
{
|
||||||
|
boost::this_thread::disable_interruption do_not_disturb;
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
while(state.exclusive || state.exclusive_waiting_blocked || state.upgrade)
|
||||||
|
{
|
||||||
|
shared_cond.wait(lk);
|
||||||
|
}
|
||||||
|
++state.shared_count;
|
||||||
|
state.upgrade=true;
|
||||||
|
}
|
||||||
|
|
||||||
|
bool timed_lock_upgrade(system_time const& timeout)
|
||||||
|
{
|
||||||
|
boost::this_thread::disable_interruption do_not_disturb;
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
while(state.exclusive || state.exclusive_waiting_blocked || state.upgrade)
|
||||||
|
{
|
||||||
|
if(!shared_cond.timed_wait(lk,timeout))
|
||||||
|
{
|
||||||
|
if(state.exclusive || state.exclusive_waiting_blocked || state.upgrade)
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
++state.shared_count;
|
||||||
|
state.upgrade=true;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename TimeDuration>
|
||||||
|
bool timed_lock_upgrade(TimeDuration const & relative_time)
|
||||||
|
{
|
||||||
|
return timed_lock_upgrade(get_system_time()+relative_time);
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
template <class Rep, class Period>
|
||||||
|
bool try_lock_upgrade_for(const chrono::duration<Rep, Period>& rel_time)
|
||||||
|
{
|
||||||
|
return try_lock_upgrade_until(chrono::steady_clock::now() + rel_time);
|
||||||
|
}
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
bool try_lock_upgrade_until(const chrono::time_point<Clock, Duration>& abs_time)
|
||||||
|
{
|
||||||
|
boost::this_thread::disable_interruption do_not_disturb;
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
while(state.exclusive || state.exclusive_waiting_blocked || state.upgrade)
|
||||||
|
{
|
||||||
|
if(cv_status::timeout == shared_cond.wait_until(lk,abs_time))
|
||||||
|
{
|
||||||
|
if(state.exclusive || state.exclusive_waiting_blocked || state.upgrade)
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
++state.shared_count;
|
||||||
|
state.upgrade=true;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
bool try_lock_upgrade()
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
if(state.exclusive || state.exclusive_waiting_blocked || state.upgrade)
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
++state.shared_count;
|
||||||
|
state.upgrade=true;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
void unlock_upgrade()
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
state.upgrade=false;
|
||||||
|
bool const last_reader=!--state.shared_count;
|
||||||
|
|
||||||
|
if(last_reader)
|
||||||
|
{
|
||||||
|
state.exclusive_waiting_blocked=false;
|
||||||
|
release_waiters();
|
||||||
|
} else {
|
||||||
|
shared_cond.notify_all();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Upgrade <-> Exclusive
|
||||||
|
void unlock_upgrade_and_lock()
|
||||||
|
{
|
||||||
|
boost::this_thread::disable_interruption do_not_disturb;
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
--state.shared_count;
|
||||||
|
while(state.shared_count)
|
||||||
|
{
|
||||||
|
upgrade_cond.wait(lk);
|
||||||
|
}
|
||||||
|
state.upgrade=false;
|
||||||
|
state.exclusive=true;
|
||||||
|
}
|
||||||
|
|
||||||
|
void unlock_and_lock_upgrade()
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
state.exclusive=false;
|
||||||
|
state.upgrade=true;
|
||||||
|
++state.shared_count;
|
||||||
|
state.exclusive_waiting_blocked=false;
|
||||||
|
release_waiters();
|
||||||
|
}
|
||||||
|
|
||||||
|
#if 0 // To be added
|
||||||
|
bool try_unlock_upgrade_and_lock();
|
||||||
|
template <class Rep, class Period>
|
||||||
|
bool
|
||||||
|
try_unlock_upgrade_and_lock_for(
|
||||||
|
const chrono::duration<Rep, Period>& rel_time);
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
bool
|
||||||
|
try_unlock_upgrade_and_lock_until(
|
||||||
|
const chrono::time_point<Clock, Duration>& abs_time);
|
||||||
|
#endif
|
||||||
|
|
||||||
|
// Shared <-> Exclusive
|
||||||
|
void unlock_and_lock_shared()
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
state.exclusive=false;
|
||||||
|
++state.shared_count;
|
||||||
|
state.exclusive_waiting_blocked=false;
|
||||||
|
release_waiters();
|
||||||
|
}
|
||||||
|
|
||||||
|
#if 0 // To be added
|
||||||
|
bool try_unlock_shared_and_lock();
|
||||||
|
template <class Rep, class Period>
|
||||||
|
bool
|
||||||
|
try_unlock_shared_and_lock_for(
|
||||||
|
const chrono::duration<Rep, Period>& rel_time);
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
bool
|
||||||
|
try_unlock_shared_and_lock_until(
|
||||||
|
const chrono::time_point<Clock, Duration>& abs_time);
|
||||||
|
#endif
|
||||||
|
|
||||||
|
// Shared <-> Upgrade
|
||||||
|
void unlock_upgrade_and_lock_shared()
|
||||||
|
{
|
||||||
|
boost::mutex::scoped_lock lk(state_change);
|
||||||
|
state.upgrade=false;
|
||||||
|
state.exclusive_waiting_blocked=false;
|
||||||
|
release_waiters();
|
||||||
|
}
|
||||||
|
|
||||||
|
#if 0 // To be added
|
||||||
|
bool try_unlock_shared_and_lock_upgrade();
|
||||||
|
template <class Rep, class Period>
|
||||||
|
bool
|
||||||
|
try_unlock_shared_and_lock_upgrade_for(
|
||||||
|
const chrono::duration<Rep, Period>& rel_time);
|
||||||
|
template <class Clock, class Duration>
|
||||||
|
bool
|
||||||
|
try_unlock_shared_and_lock_upgrade_until(
|
||||||
|
const chrono::time_point<Clock, Duration>& abs_time);
|
||||||
|
#endif
|
||||||
|
};
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
204
include/boost/thread/pthread/thread_data.hpp
Normal file
204
include/boost/thread/pthread/thread_data.hpp
Normal file
@@ -0,0 +1,204 @@
|
|||||||
|
#ifndef BOOST_THREAD_PTHREAD_THREAD_DATA_HPP
|
||||||
|
#define BOOST_THREAD_PTHREAD_THREAD_DATA_HPP
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
// (C) Copyright 2007 Anthony Williams
|
||||||
|
|
||||||
|
#include <boost/thread/detail/config.hpp>
|
||||||
|
#include <boost/thread/exceptions.hpp>
|
||||||
|
#include <boost/shared_ptr.hpp>
|
||||||
|
#include <boost/enable_shared_from_this.hpp>
|
||||||
|
#include <boost/thread/mutex.hpp>
|
||||||
|
#include <boost/optional.hpp>
|
||||||
|
#include <pthread.h>
|
||||||
|
#include <boost/assert.hpp>
|
||||||
|
#include <boost/thread/pthread/condition_variable_fwd.hpp>
|
||||||
|
#include <map>
|
||||||
|
#include <unistd.h>
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
#include <boost/chrono/system_clocks.hpp>
|
||||||
|
#endif
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
class thread_attributes {
|
||||||
|
public:
|
||||||
|
thread_attributes() {
|
||||||
|
int res = pthread_attr_init(&val_);
|
||||||
|
BOOST_VERIFY(!res && "pthread_attr_init failed");
|
||||||
|
}
|
||||||
|
~thread_attributes() {
|
||||||
|
int res = pthread_attr_destroy(&val_);
|
||||||
|
BOOST_VERIFY(!res && "pthread_attr_destroy failed");
|
||||||
|
}
|
||||||
|
// stack
|
||||||
|
void set_stack_size(std::size_t size) {
|
||||||
|
if (size==0) return;
|
||||||
|
std::size_t page_size = getpagesize();
|
||||||
|
#ifdef PTHREAD_STACK_MIN
|
||||||
|
if (size<PTHREAD_STACK_MIN) size=PTHREAD_STACK_MIN;
|
||||||
|
#endif
|
||||||
|
size = ((size+page_size-1)/page_size)*page_size;
|
||||||
|
int res = pthread_attr_setstacksize(&val_, size);
|
||||||
|
BOOST_VERIFY(!res && "pthread_attr_setstacksize failed");
|
||||||
|
}
|
||||||
|
|
||||||
|
std::size_t get_stack_size() const {
|
||||||
|
std::size_t size;
|
||||||
|
int res = pthread_attr_getstacksize(&val_, &size);
|
||||||
|
BOOST_VERIFY(!res && "pthread_attr_getstacksize failed");
|
||||||
|
return size;
|
||||||
|
}
|
||||||
|
|
||||||
|
typedef pthread_attr_t native_handle_type;
|
||||||
|
native_handle_type* native_handle() {
|
||||||
|
return &val_;
|
||||||
|
}
|
||||||
|
const native_handle_type* native_handle() const {
|
||||||
|
return &val_;
|
||||||
|
}
|
||||||
|
|
||||||
|
private:
|
||||||
|
pthread_attr_t val_;
|
||||||
|
};
|
||||||
|
|
||||||
|
class thread;
|
||||||
|
|
||||||
|
namespace detail
|
||||||
|
{
|
||||||
|
struct tss_cleanup_function;
|
||||||
|
struct thread_exit_callback_node;
|
||||||
|
struct tss_data_node
|
||||||
|
{
|
||||||
|
boost::shared_ptr<boost::detail::tss_cleanup_function> func;
|
||||||
|
void* value;
|
||||||
|
|
||||||
|
tss_data_node(boost::shared_ptr<boost::detail::tss_cleanup_function> func_,
|
||||||
|
void* value_):
|
||||||
|
func(func_),value(value_)
|
||||||
|
{}
|
||||||
|
};
|
||||||
|
|
||||||
|
struct thread_data_base;
|
||||||
|
typedef boost::shared_ptr<thread_data_base> thread_data_ptr;
|
||||||
|
|
||||||
|
struct BOOST_THREAD_DECL thread_data_base:
|
||||||
|
enable_shared_from_this<thread_data_base>
|
||||||
|
{
|
||||||
|
thread_data_ptr self;
|
||||||
|
pthread_t thread_handle;
|
||||||
|
boost::mutex data_mutex;
|
||||||
|
boost::condition_variable done_condition;
|
||||||
|
boost::mutex sleep_mutex;
|
||||||
|
boost::condition_variable sleep_condition;
|
||||||
|
bool done;
|
||||||
|
bool join_started;
|
||||||
|
bool joined;
|
||||||
|
boost::detail::thread_exit_callback_node* thread_exit_callbacks;
|
||||||
|
std::map<void const*,boost::detail::tss_data_node> tss_data;
|
||||||
|
bool interrupt_enabled;
|
||||||
|
bool interrupt_requested;
|
||||||
|
pthread_mutex_t* cond_mutex;
|
||||||
|
pthread_cond_t* current_cond;
|
||||||
|
|
||||||
|
thread_data_base():
|
||||||
|
done(false),join_started(false),joined(false),
|
||||||
|
thread_exit_callbacks(0),
|
||||||
|
interrupt_enabled(true),
|
||||||
|
interrupt_requested(false),
|
||||||
|
current_cond(0)
|
||||||
|
{}
|
||||||
|
virtual ~thread_data_base();
|
||||||
|
|
||||||
|
typedef pthread_t native_handle_type;
|
||||||
|
|
||||||
|
virtual void run()=0;
|
||||||
|
};
|
||||||
|
|
||||||
|
BOOST_THREAD_DECL thread_data_base* get_current_thread_data();
|
||||||
|
|
||||||
|
class interruption_checker
|
||||||
|
{
|
||||||
|
thread_data_base* const thread_info;
|
||||||
|
pthread_mutex_t* m;
|
||||||
|
bool set;
|
||||||
|
|
||||||
|
void check_for_interruption()
|
||||||
|
{
|
||||||
|
if(thread_info->interrupt_requested)
|
||||||
|
{
|
||||||
|
thread_info->interrupt_requested=false;
|
||||||
|
throw thread_interrupted();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
void operator=(interruption_checker&);
|
||||||
|
public:
|
||||||
|
explicit interruption_checker(pthread_mutex_t* cond_mutex,pthread_cond_t* cond):
|
||||||
|
thread_info(detail::get_current_thread_data()),m(cond_mutex),
|
||||||
|
set(thread_info && thread_info->interrupt_enabled)
|
||||||
|
{
|
||||||
|
if(set)
|
||||||
|
{
|
||||||
|
lock_guard<mutex> guard(thread_info->data_mutex);
|
||||||
|
check_for_interruption();
|
||||||
|
thread_info->cond_mutex=cond_mutex;
|
||||||
|
thread_info->current_cond=cond;
|
||||||
|
BOOST_VERIFY(!pthread_mutex_lock(m));
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_lock(m));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
~interruption_checker()
|
||||||
|
{
|
||||||
|
if(set)
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_unlock(m));
|
||||||
|
lock_guard<mutex> guard(thread_info->data_mutex);
|
||||||
|
thread_info->cond_mutex=NULL;
|
||||||
|
thread_info->current_cond=NULL;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
BOOST_VERIFY(!pthread_mutex_unlock(m));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
namespace this_thread
|
||||||
|
{
|
||||||
|
#ifdef BOOST_THREAD_USES_CHRONO
|
||||||
|
void BOOST_SYMBOL_VISIBLE sleep_for(const chrono::nanoseconds& ns);
|
||||||
|
#endif
|
||||||
|
void BOOST_THREAD_DECL yield() BOOST_NOEXCEPT;
|
||||||
|
|
||||||
|
#ifdef __DECXXX
|
||||||
|
/// Workaround of DECCXX issue of incorrect template substitution
|
||||||
|
template<typename TimeDuration>
|
||||||
|
inline void sleep(TimeDuration const& rel_time)
|
||||||
|
{
|
||||||
|
this_thread::sleep(get_system_time()+rel_time);
|
||||||
|
}
|
||||||
|
|
||||||
|
template<>
|
||||||
|
void BOOST_THREAD_DECL sleep(system_time const& abs_time);
|
||||||
|
#else
|
||||||
|
void BOOST_THREAD_DECL sleep(system_time const& abs_time);
|
||||||
|
|
||||||
|
template<typename TimeDuration>
|
||||||
|
inline BOOST_SYMBOL_VISIBLE void sleep(TimeDuration const& rel_time)
|
||||||
|
{
|
||||||
|
this_thread::sleep(get_system_time()+rel_time);
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
242
include/boost/thread/pthread/thread_heap_alloc.hpp
Normal file
242
include/boost/thread/pthread/thread_heap_alloc.hpp
Normal file
@@ -0,0 +1,242 @@
|
|||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
// (C) Copyright 2008 Anthony Williams
|
||||||
|
#ifndef THREAD_HEAP_ALLOC_PTHREAD_HPP
|
||||||
|
#define THREAD_HEAP_ALLOC_PTHREAD_HPP
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
namespace detail
|
||||||
|
{
|
||||||
|
template<typename T>
|
||||||
|
inline T* heap_new()
|
||||||
|
{
|
||||||
|
return new T();
|
||||||
|
}
|
||||||
|
|
||||||
|
#ifndef BOOST_NO_RVALUE_REFERENCES
|
||||||
|
template<typename T,typename A1>
|
||||||
|
inline T* heap_new(A1&& a1)
|
||||||
|
{
|
||||||
|
return new T(static_cast<A1&&>(a1));
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2>
|
||||||
|
inline T* heap_new(A1&& a1,A2&& a2)
|
||||||
|
{
|
||||||
|
return new T(static_cast<A1&&>(a1),static_cast<A2&&>(a2));
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3>
|
||||||
|
inline T* heap_new(A1&& a1,A2&& a2,A3&& a3)
|
||||||
|
{
|
||||||
|
return new T(static_cast<A1&&>(a1),static_cast<A2&&>(a2),
|
||||||
|
static_cast<A3&&>(a3));
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1&& a1,A2&& a2,A3&& a3,A4&& a4)
|
||||||
|
{
|
||||||
|
return new T(static_cast<A1&&>(a1),static_cast<A2&&>(a2),
|
||||||
|
static_cast<A3&&>(a3),static_cast<A4&&>(a4));
|
||||||
|
}
|
||||||
|
#else
|
||||||
|
template<typename T,typename A1>
|
||||||
|
inline T* heap_new_impl(A1 a1)
|
||||||
|
{
|
||||||
|
return new T(a1);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2>
|
||||||
|
inline T* heap_new_impl(A1 a1,A2 a2)
|
||||||
|
{
|
||||||
|
return new T(a1,a2);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3>
|
||||||
|
inline T* heap_new_impl(A1 a1,A2 a2,A3 a3)
|
||||||
|
{
|
||||||
|
return new T(a1,a2,a3);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new_impl(A1 a1,A2 a2,A3 a3,A4 a4)
|
||||||
|
{
|
||||||
|
return new T(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename T,typename A1>
|
||||||
|
inline T* heap_new(A1 const& a1)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&>(a1);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1>
|
||||||
|
inline T* heap_new(A1& a1)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&>(a1);
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename T,typename A1,typename A2>
|
||||||
|
inline T* heap_new(A1 const& a1,A2 const& a2)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2 const&>(a1,a2);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2>
|
||||||
|
inline T* heap_new(A1& a1,A2 const& a2)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2 const&>(a1,a2);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2>
|
||||||
|
inline T* heap_new(A1 const& a1,A2& a2)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2&>(a1,a2);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2>
|
||||||
|
inline T* heap_new(A1& a1,A2& a2)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2&>(a1,a2);
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename T,typename A1,typename A2,typename A3>
|
||||||
|
inline T* heap_new(A1 const& a1,A2 const& a2,A3 const& a3)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2 const&,A3 const&>(a1,a2,a3);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3>
|
||||||
|
inline T* heap_new(A1& a1,A2 const& a2,A3 const& a3)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2 const&,A3 const&>(a1,a2,a3);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3>
|
||||||
|
inline T* heap_new(A1 const& a1,A2& a2,A3 const& a3)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2&,A3 const&>(a1,a2,a3);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3>
|
||||||
|
inline T* heap_new(A1& a1,A2& a2,A3 const& a3)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2&,A3 const&>(a1,a2,a3);
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename T,typename A1,typename A2,typename A3>
|
||||||
|
inline T* heap_new(A1 const& a1,A2 const& a2,A3& a3)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2 const&,A3&>(a1,a2,a3);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3>
|
||||||
|
inline T* heap_new(A1& a1,A2 const& a2,A3& a3)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2 const&,A3&>(a1,a2,a3);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3>
|
||||||
|
inline T* heap_new(A1 const& a1,A2& a2,A3& a3)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2&,A3&>(a1,a2,a3);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3>
|
||||||
|
inline T* heap_new(A1& a1,A2& a2,A3& a3)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2&,A3&>(a1,a2,a3);
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1 const& a1,A2 const& a2,A3 const& a3,A4 const& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2 const&,A3 const&,A4 const&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1& a1,A2 const& a2,A3 const& a3,A4 const& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2 const&,A3 const&,A4 const&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1 const& a1,A2& a2,A3 const& a3,A4 const& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2&,A3 const&,A4 const&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1& a1,A2& a2,A3 const& a3,A4 const& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2&,A3 const&,A4 const&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1 const& a1,A2 const& a2,A3& a3,A4 const& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2 const&,A3&,A4 const&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1& a1,A2 const& a2,A3& a3,A4 const& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2 const&,A3&,A4 const&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1 const& a1,A2& a2,A3& a3,A4 const& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2&,A3&,A4 const&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1& a1,A2& a2,A3& a3,A4 const& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2&,A3&,A4 const&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1 const& a1,A2 const& a2,A3 const& a3,A4& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2 const&,A3 const&,A4&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1& a1,A2 const& a2,A3 const& a3,A4& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2 const&,A3 const&,A4&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1 const& a1,A2& a2,A3 const& a3,A4& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2&,A3 const&,A4&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1& a1,A2& a2,A3 const& a3,A4& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2&,A3 const&,A4&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1 const& a1,A2 const& a2,A3& a3,A4& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2 const&,A3&,A4&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1& a1,A2 const& a2,A3& a3,A4& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2 const&,A3&,A4&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1 const& a1,A2& a2,A3& a3,A4& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1 const&,A2&,A3&,A4&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
template<typename T,typename A1,typename A2,typename A3,typename A4>
|
||||||
|
inline T* heap_new(A1& a1,A2& a2,A3& a3,A4& a4)
|
||||||
|
{
|
||||||
|
return heap_new_impl<T,A1&,A2&,A3&,A4&>(a1,a2,a3,a4);
|
||||||
|
}
|
||||||
|
|
||||||
|
#endif
|
||||||
|
template<typename T>
|
||||||
|
inline void heap_delete(T* data)
|
||||||
|
{
|
||||||
|
delete data;
|
||||||
|
}
|
||||||
|
|
||||||
|
template<typename T>
|
||||||
|
struct do_heap_delete
|
||||||
|
{
|
||||||
|
void operator()(T* data) const
|
||||||
|
{
|
||||||
|
detail::heap_delete(data);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
36
include/boost/thread/pthread/timespec.hpp
Normal file
36
include/boost/thread/pthread/timespec.hpp
Normal file
@@ -0,0 +1,36 @@
|
|||||||
|
#ifndef BOOST_THREAD_PTHREAD_TIMESPEC_HPP
|
||||||
|
#define BOOST_THREAD_PTHREAD_TIMESPEC_HPP
|
||||||
|
// (C) Copyright 2007-8 Anthony Williams
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/thread/thread_time.hpp>
|
||||||
|
#include <boost/date_time/posix_time/conversion.hpp>
|
||||||
|
#include <pthread.h>
|
||||||
|
#ifndef _WIN32
|
||||||
|
#include <unistd.h>
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <boost/config/abi_prefix.hpp>
|
||||||
|
|
||||||
|
namespace boost
|
||||||
|
{
|
||||||
|
namespace detail
|
||||||
|
{
|
||||||
|
inline struct timespec get_timespec(boost::system_time const& abs_time)
|
||||||
|
{
|
||||||
|
struct timespec timeout={0,0};
|
||||||
|
boost::posix_time::time_duration const time_since_epoch=abs_time-boost::posix_time::from_time_t(0);
|
||||||
|
|
||||||
|
timeout.tv_sec=time_since_epoch.total_seconds();
|
||||||
|
timeout.tv_nsec=(long)(time_since_epoch.fractional_seconds()*(1000000000l/time_since_epoch.ticks_per_second()));
|
||||||
|
return timeout;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#include <boost/config/abi_suffix.hpp>
|
||||||
|
|
||||||
|
#endif
|
||||||
@@ -1,167 +1,21 @@
|
|||||||
// Copyright (C) 2001
|
#ifndef BOOST_THREAD_RECURSIVE_MUTEX_HPP
|
||||||
// William E. Kempf
|
#define BOOST_THREAD_RECURSIVE_MUTEX_HPP
|
||||||
|
|
||||||
|
// recursive_mutex.hpp
|
||||||
//
|
//
|
||||||
// Permission to use, copy, modify, distribute and sell this software
|
// (C) Copyright 2007 Anthony Williams
|
||||||
// and its documentation for any purpose is hereby granted without fee,
|
//
|
||||||
// provided that the above copyright notice appear in all copies and
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
// that both that copyright notice and this permission notice appear
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
// in supporting documentation. William E. Kempf makes no representations
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
// about the suitability of this software for any purpose.
|
|
||||||
// It is provided "as is" without express or implied warranty.
|
|
||||||
|
|
||||||
#ifndef BOOST_RECURSIVE_MUTEX_WEK070601_HPP
|
#include <boost/thread/detail/platform.hpp>
|
||||||
#define BOOST_RECURSIVE_MUTEX_WEK070601_HPP
|
#if defined(BOOST_THREAD_PLATFORM_WIN32)
|
||||||
|
#include <boost/thread/win32/recursive_mutex.hpp>
|
||||||
#include <boost/config.hpp>
|
#elif defined(BOOST_THREAD_PLATFORM_PTHREAD)
|
||||||
#ifndef BOOST_HAS_THREADS
|
#include <boost/thread/pthread/recursive_mutex.hpp>
|
||||||
# error Thread support is unavailable!
|
#else
|
||||||
|
#error "Boost threads unavailable on this platform"
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
#include <boost/utility.hpp>
|
|
||||||
#include <boost/thread/detail/lock.hpp>
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_PTHREADS)
|
|
||||||
# include <pthread.h>
|
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
namespace boost {
|
|
||||||
|
|
||||||
class condition;
|
|
||||||
struct xtime;
|
|
||||||
|
|
||||||
class recursive_mutex : private noncopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
friend class detail::thread::scoped_lock<recursive_mutex>;
|
|
||||||
friend class condition;
|
|
||||||
|
|
||||||
typedef detail::thread::scoped_lock<recursive_mutex> scoped_lock;
|
|
||||||
|
|
||||||
recursive_mutex();
|
|
||||||
~recursive_mutex();
|
|
||||||
|
|
||||||
private:
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
typedef std::size_t cv_state;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
struct cv_state
|
|
||||||
{
|
|
||||||
long count;
|
|
||||||
pthread_mutex_t* pmutex;
|
|
||||||
};
|
|
||||||
#endif
|
|
||||||
void do_lock();
|
|
||||||
void do_unlock();
|
|
||||||
void do_lock(cv_state& state);
|
|
||||||
void do_unlock(cv_state& state);
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
unsigned long m_mutex;
|
|
||||||
unsigned long m_count;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
pthread_mutex_t m_mutex;
|
|
||||||
unsigned m_count;
|
|
||||||
# if !defined(BOOST_HAS_PTHREAD_MUTEXATTR_SETTYPE)
|
|
||||||
pthread_cond_t m_unlocked;
|
|
||||||
pthread_t m_thread_id;
|
|
||||||
bool m_valid_id;
|
|
||||||
# endif
|
|
||||||
#endif
|
|
||||||
};
|
|
||||||
|
|
||||||
class recursive_try_mutex : private noncopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
friend class detail::thread::scoped_lock<recursive_try_mutex>;
|
|
||||||
friend class detail::thread::scoped_try_lock<recursive_try_mutex>;
|
|
||||||
friend class condition;
|
|
||||||
|
|
||||||
typedef detail::thread::scoped_lock<recursive_try_mutex> scoped_lock;
|
|
||||||
typedef detail::thread::scoped_try_lock<recursive_try_mutex> scoped_try_lock;
|
|
||||||
|
|
||||||
recursive_try_mutex();
|
|
||||||
~recursive_try_mutex();
|
|
||||||
|
|
||||||
private:
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
typedef std::size_t cv_state;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
struct cv_state
|
|
||||||
{
|
|
||||||
long count;
|
|
||||||
pthread_mutex_t* pmutex;
|
|
||||||
};
|
|
||||||
#endif
|
|
||||||
void do_lock();
|
|
||||||
bool do_trylock();
|
|
||||||
void do_unlock();
|
|
||||||
void do_lock(cv_state& state);
|
|
||||||
void do_unlock(cv_state& state);
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
unsigned long m_mutex;
|
|
||||||
unsigned long m_count;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
pthread_mutex_t m_mutex;
|
|
||||||
unsigned m_count;
|
|
||||||
# if !defined(BOOST_HAS_PTHREAD_MUTEXATTR_SETTYPE)
|
|
||||||
pthread_cond_t m_unlocked;
|
|
||||||
pthread_t m_thread_id;
|
|
||||||
bool m_valid_id;
|
|
||||||
# endif
|
|
||||||
#endif
|
|
||||||
};
|
|
||||||
|
|
||||||
class recursive_timed_mutex : private noncopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
friend class detail::thread::scoped_lock<recursive_timed_mutex>;
|
|
||||||
friend class detail::thread::scoped_try_lock<recursive_timed_mutex>;
|
|
||||||
friend class detail::thread::scoped_timed_lock<recursive_timed_mutex>;
|
|
||||||
friend class condition;
|
|
||||||
|
|
||||||
typedef detail::thread::scoped_lock<recursive_timed_mutex> scoped_lock;
|
|
||||||
typedef detail::thread::scoped_try_lock<recursive_timed_mutex> scoped_try_lock;
|
|
||||||
typedef detail::thread::scoped_timed_lock<recursive_timed_mutex> scoped_timed_lock;
|
|
||||||
|
|
||||||
recursive_timed_mutex();
|
|
||||||
~recursive_timed_mutex();
|
|
||||||
|
|
||||||
private:
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
typedef std::size_t cv_state;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
struct cv_state
|
|
||||||
{
|
|
||||||
long count;
|
|
||||||
pthread_mutex_t* pmutex;
|
|
||||||
};
|
|
||||||
#endif
|
|
||||||
void do_lock();
|
|
||||||
bool do_trylock();
|
|
||||||
bool do_timedlock(const xtime& xt);
|
|
||||||
void do_unlock();
|
|
||||||
void do_lock(cv_state& state);
|
|
||||||
void do_unlock(cv_state& state);
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
unsigned long m_mutex;
|
|
||||||
unsigned long m_count;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
pthread_mutex_t m_mutex;
|
|
||||||
pthread_cond_t m_unlocked;
|
|
||||||
pthread_t m_thread_id;
|
|
||||||
bool m_valid_id;
|
|
||||||
unsigned m_count;
|
|
||||||
#endif
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace boost
|
|
||||||
|
|
||||||
// Change Log:
|
|
||||||
// 8 Feb 01 WEKEMPF Initial version.
|
|
||||||
// 1 Jun 01 WEKEMPF Modified to use xtime for time outs. Factored out
|
|
||||||
// to three classes, mutex, try_mutex and timed_mutex.
|
|
||||||
// 11 Jun 01 WEKEMPF Modified to use PTHREAD_MUTEX_RECURSIVE if available.
|
|
||||||
|
|
||||||
#endif // BOOST_RECURSIVE_MUTEX_WEK070601_HPP
|
|
||||||
|
|||||||
@@ -1,57 +0,0 @@
|
|||||||
// Copyright (C) 2001
|
|
||||||
// William E. Kempf
|
|
||||||
//
|
|
||||||
// Permission to use, copy, modify, distribute and sell this software
|
|
||||||
// and its documentation for any purpose is hereby granted without fee,
|
|
||||||
// provided that the above copyright notice appear in all copies and
|
|
||||||
// that both that copyright notice and this permission notice appear
|
|
||||||
// in supporting documentation. William E. Kempf makes no representations
|
|
||||||
// about the suitability of this software for any purpose.
|
|
||||||
// It is provided "as is" without express or implied warranty.
|
|
||||||
|
|
||||||
#ifndef BOOST_SEMAPHORE_WEK070601_HPP
|
|
||||||
#define BOOST_SEMAPHORE_WEK070601_HPP
|
|
||||||
|
|
||||||
#include <boost/config.hpp>
|
|
||||||
#ifndef BOOST_HAS_THREADS
|
|
||||||
# error Thread support is unavailable!
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#include <boost/utility.hpp>
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_PTHREADS)
|
|
||||||
# include <pthread.h>
|
|
||||||
#endif
|
|
||||||
|
|
||||||
namespace boost {
|
|
||||||
|
|
||||||
struct xtime;
|
|
||||||
|
|
||||||
class semaphore : private noncopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
explicit semaphore(unsigned count=0, unsigned max=0);
|
|
||||||
~semaphore();
|
|
||||||
|
|
||||||
bool up(unsigned count=1, unsigned* prev=0);
|
|
||||||
void down();
|
|
||||||
bool down(const xtime& xt);
|
|
||||||
|
|
||||||
private:
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
unsigned long m_sema;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
pthread_mutex_t m_mutex;
|
|
||||||
pthread_cond_t m_condition;
|
|
||||||
unsigned m_available;
|
|
||||||
unsigned m_max;
|
|
||||||
#endif
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace boost
|
|
||||||
|
|
||||||
// Change Log:
|
|
||||||
// 8 Feb 01 WEKEMPF Initial version.
|
|
||||||
// 22 May 01 WEKEMPF Modified to use xtime for time outs.
|
|
||||||
|
|
||||||
#endif // BOOST_SEMAPHORE_WEK070601_HPP
|
|
||||||
21
include/boost/thread/shared_mutex.hpp
Normal file
21
include/boost/thread/shared_mutex.hpp
Normal file
@@ -0,0 +1,21 @@
|
|||||||
|
#ifndef BOOST_THREAD_SHARED_MUTEX_HPP
|
||||||
|
#define BOOST_THREAD_SHARED_MUTEX_HPP
|
||||||
|
|
||||||
|
// shared_mutex.hpp
|
||||||
|
//
|
||||||
|
// (C) Copyright 2007 Anthony Williams
|
||||||
|
//
|
||||||
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
|
|
||||||
|
#include <boost/thread/detail/platform.hpp>
|
||||||
|
#if defined(BOOST_THREAD_PLATFORM_WIN32)
|
||||||
|
#include <boost/thread/win32/shared_mutex.hpp>
|
||||||
|
#elif defined(BOOST_THREAD_PLATFORM_PTHREAD)
|
||||||
|
#include <boost/thread/pthread/shared_mutex.hpp>
|
||||||
|
#else
|
||||||
|
#error "Boost threads unavailable on this platform"
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#endif
|
||||||
@@ -1,84 +1,28 @@
|
|||||||
// Copyright (C) 2001
|
#ifndef BOOST_THREAD_THREAD_HPP
|
||||||
// William E. Kempf
|
#define BOOST_THREAD_THREAD_HPP
|
||||||
|
|
||||||
|
// thread.hpp
|
||||||
//
|
//
|
||||||
// Permission to use, copy, modify, distribute and sell this software
|
// (C) Copyright 2007-8 Anthony Williams
|
||||||
// and its documentation for any purpose is hereby granted without fee,
|
//
|
||||||
// provided that the above copyright notice appear in all copies and
|
// Distributed under the Boost Software License, Version 1.0. (See
|
||||||
// that both that copyright notice and this permission notice appear
|
// accompanying file LICENSE_1_0.txt or copy at
|
||||||
// in supporting documentation. William E. Kempf makes no representations
|
// http://www.boost.org/LICENSE_1_0.txt)
|
||||||
// about the suitability of this software for any purpose.
|
|
||||||
// It is provided "as is" without express or implied warranty.
|
|
||||||
|
|
||||||
#ifndef BOOST_THREAD_WEK070601_HPP
|
#include <boost/thread/detail/platform.hpp>
|
||||||
#define BOOST_THREAD_WEK070601_HPP
|
|
||||||
|
|
||||||
#include <boost/config.hpp>
|
#if defined(BOOST_THREAD_PLATFORM_WIN32)
|
||||||
#ifndef BOOST_HAS_THREADS
|
#include <boost/thread/win32/thread_data.hpp>
|
||||||
# error Thread support is unavailable!
|
#elif defined(BOOST_THREAD_PLATFORM_PTHREAD)
|
||||||
|
#include <boost/thread/pthread/thread_data.hpp>
|
||||||
|
#else
|
||||||
|
#error "Boost threads unavailable on this platform"
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
#include <boost/utility.hpp>
|
#include <boost/thread/detail/thread.hpp>
|
||||||
#include <boost/function.hpp>
|
#include <boost/thread/detail/thread_interruption.hpp>
|
||||||
#include <boost/thread/mutex.hpp>
|
#include <boost/thread/detail/thread_group.hpp>
|
||||||
#include <list>
|
#include <boost/thread/v2/thread.hpp>
|
||||||
#include <memory>
|
|
||||||
|
|
||||||
#if defined(BOOST_HAS_PTHREADS)
|
|
||||||
# include <pthread.h>
|
|
||||||
# include <boost/thread/condition.hpp>
|
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
namespace boost {
|
|
||||||
|
|
||||||
struct xtime;
|
|
||||||
|
|
||||||
class thread : private noncopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
thread();
|
|
||||||
explicit thread(const function0<void>& threadfunc);
|
|
||||||
~thread();
|
|
||||||
|
|
||||||
bool operator==(const thread& other) const;
|
|
||||||
bool operator!=(const thread& other) const;
|
|
||||||
|
|
||||||
void join();
|
|
||||||
|
|
||||||
static void sleep(const xtime& xt);
|
|
||||||
static void yield();
|
|
||||||
|
|
||||||
private:
|
|
||||||
#if defined(BOOST_HAS_WINTHREADS)
|
|
||||||
unsigned long m_thread;
|
|
||||||
unsigned int m_id;
|
|
||||||
#elif defined(BOOST_HAS_PTHREADS)
|
|
||||||
private:
|
|
||||||
pthread_t m_thread;
|
|
||||||
#endif
|
|
||||||
bool m_joinable;
|
|
||||||
};
|
|
||||||
|
|
||||||
class thread_group : private noncopyable
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
thread_group();
|
|
||||||
~thread_group();
|
|
||||||
|
|
||||||
thread* create_thread(const function0<void>& threadfunc);
|
|
||||||
void add_thread(thread* thrd);
|
|
||||||
void remove_thread(thread* thrd);
|
|
||||||
void join_all();
|
|
||||||
|
|
||||||
private:
|
|
||||||
std::list<thread*> m_threads;
|
|
||||||
mutex m_mutex;
|
|
||||||
};
|
|
||||||
|
|
||||||
} // namespace boost
|
|
||||||
|
|
||||||
// Change Log:
|
|
||||||
// 8 Feb 01 WEKEMPF Initial version.
|
|
||||||
// 1 Jun 01 WEKEMPF Added boost::thread initial implementation.
|
|
||||||
// 3 Jul 01 WEKEMPF Redesigned boost::thread to be noncopyable.
|
|
||||||
|
|
||||||
#endif // BOOST_THREAD_WEK070601_HPP
|
|
||||||
|
|||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user